diff --git a/programs/media/zsea/Docs/RAW/RAW.png b/programs/media/zsea/Docs/RAW/RAW.png new file mode 100644 index 0000000000..699a44bea3 Binary files /dev/null and b/programs/media/zsea/Docs/RAW/RAW.png differ diff --git a/programs/media/zsea/Docs/RAW/RAW_format.doc b/programs/media/zsea/Docs/RAW/RAW_format.doc new file mode 100644 index 0000000000..4c54d18cad Binary files /dev/null and b/programs/media/zsea/Docs/RAW/RAW_format.doc differ diff --git a/programs/media/zsea/Docs/RAW/RAW_format.html b/programs/media/zsea/Docs/RAW/RAW_format.html new file mode 100644 index 0000000000..32c821e35b --- /dev/null +++ b/programs/media/zsea/Docs/RAW/RAW_format.html @@ -0,0 +1,163 @@ + + + + + + + + + + + + + + +

RAW ( ).

+



+

+

:

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+

,

+

,

+

+

0

 +

4

 +

'RAW'

+

4

 +

4

 +

X ( ),

+

8

 +

4

 +

Y ( ),

+

12

 +

4

 +
+
= *
+ : 1, 4, 8, 16, 24, 32, 48, 64
+
+

16

 +

2

 +
+
+ Grayscale: 1, 4, 8, 16
+ R, G, B T (Transparency + — ): + 5, 8, 16
+
+

18

 +

2

 +
+
:
+ Grayscale: 1, 2 ( 2 T + 8)
+ R, G, B: 1, ( 16 ), 3
+ R, G, B T (Transparency + — ): 4
+
+

20

 +

4

 +

( ), + 0

+

24

 +

4

 +

, 256*4=1024 + .

+

28

 +

4

 +

R, G, B. 0, + .

+

32

 +

4

 +

.

+

36

 +

4

 +

T (Transparency + — )

+

40

 +

4

 +

T.

+

+

R, G, B.

+

T (Transparency + — )

+


+ + \ No newline at end of file diff --git a/programs/media/zsea/Docs/RAW/RAW_format.odt b/programs/media/zsea/Docs/RAW/RAW_format.odt new file mode 100644 index 0000000000..134a7227b5 Binary files /dev/null and b/programs/media/zsea/Docs/RAW/RAW_format.odt differ diff --git a/programs/media/zsea/Docs/RAW/RAW_format.pdf b/programs/media/zsea/Docs/RAW/RAW_format.pdf new file mode 100644 index 0000000000..0a2cc383b7 Binary files /dev/null and b/programs/media/zsea/Docs/RAW/RAW_format.pdf differ diff --git a/programs/media/zsea/Docs/RAW1/RAW1.png b/programs/media/zsea/Docs/RAW1/RAW1.png new file mode 100644 index 0000000000..04303ec464 Binary files /dev/null and b/programs/media/zsea/Docs/RAW1/RAW1.png differ diff --git a/programs/media/zsea/Docs/RAW1/raw1.doc b/programs/media/zsea/Docs/RAW1/raw1.doc new file mode 100644 index 0000000000..35dbcbf492 Binary files /dev/null and b/programs/media/zsea/Docs/RAW1/raw1.doc differ diff --git a/programs/media/zsea/Docs/RAW1/raw1.html b/programs/media/zsea/Docs/RAW1/raw1.html new file mode 100644 index 0000000000..ca15b2c3dc --- /dev/null +++ b/programs/media/zsea/Docs/RAW1/raw1.html @@ -0,0 +1,209 @@ + + + + + + + + + + + + + + +

+
RAW
+
+
gif- START + :
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+

, +

+

,

+

+

0

 +

4

 +

'RAW1'

+

4

 +

4

 +

n =

+

8

 +

4

 +

( + ),

+

12

 +

4

 +

( + ),

+

Repeat 0 ; repeat n — + , 1 GIF, N + 0

+

16+N*16

 +

4

 +

- 'RAW + '**3

+

20+N*16

 +

4

 +

x- ,

+

24+N*16

 +

4

 +

y- ,

+

28+N*16

 +

2

 +

, 0.01 **2

+

30+N*16

 +

1

 +
+
<Packed Fields>
+
+
0 bit + -
+ 0 - + , 1 -
+
+
1 bit + —
+ :
+
    +

    + 0 - + .

+
+
1 + - .
+
+
2,3,4 bit + —
+ :
+ 0 - + . .
+ 1 - . +
+ 2 - . + , , + .
+ 3 - . + , + , + .
+ 4-7 -.
+
+
5,6,7 + bit + -
+
+
+
+

31+N*16

 +

1

 +

**1 + (, )

+

end repeat 0

+

Repeat 1

+

Repeat 2

+

Repeat 3

+

...

+

Repeat Nmax

+
+

+
:
+
    +
  1. + **1 - + , . + 0, , + .
  2. + **2 -
  3. + **3 RAW — , RAW + , + .
+
+

+

+

+
+ + \ No newline at end of file diff --git a/programs/media/zsea/Docs/RAW1/raw1.odt b/programs/media/zsea/Docs/RAW1/raw1.odt new file mode 100644 index 0000000000..67d2ce3f19 Binary files /dev/null and b/programs/media/zsea/Docs/RAW1/raw1.odt differ diff --git a/programs/media/zsea/Docs/RAW1/raw1.pdf b/programs/media/zsea/Docs/RAW1/raw1.pdf new file mode 100644 index 0000000000..bea4498a00 Binary files /dev/null and b/programs/media/zsea/Docs/RAW1/raw1.pdf differ diff --git a/programs/media/zsea/Docs/call_new.txt b/programs/media/zsea/Docs/call_new.txt new file mode 100644 index 0000000000..76212bb00c --- /dev/null +++ b/programs/media/zsea/Docs/call_new.txt @@ -0,0 +1,68 @@ + +The block is passed to the plugin: +;--------------------------------------------------------------------- +; not change this section!!! +; start section +;--------------------------------------------------------------------- +align 4 +image_file dd 0 ;+0 +raw_pointer dd 0 ;+4 +return_code dd 0 ;+8 +img_size dd 0 ;+12 +deflate_unpack dd 0 ;+16 +raw_pointer_2 dd 0 ;+20 +;--------------------------------------------------------------------- +; end section +;--------------------------------------------------------------------- + + +Calling plugins: + +;--------------------------------------------------------------------- +convert: + xor eax,eax + cmp [error_fs],eax + jnz .error + mov [return_code],eax +; mov eax,image_file + push image_file + call [plugin] + cmp [return_code],dword 0 + je @f + cmp [return_code],dword 2 + je @f +;------------------------------- + xor eax,eax + mov [return_code],eax +; mov eax,image_file + push image_file + call [plugin_1] + cmp [return_code],dword 0 + je @f + cmp [return_code],dword 2 + je @f +;------------------------------- + xor eax,eax + mov [return_code],eax +; mov eax,image_file + push image_file + call [plugin_2] + cmp [return_code],dword 0 + je @f + cmp [return_code],dword 2 + je @f +;------------------------------- + xor eax,eax + mov [return_code],eax +; mov eax,image_file + push image_file + call [plugin_3] +;------------------------------- +@@: + mov ecx,[image_file] + mcall 68,13 + + cmp [return_code],dword 0 + je .all_ok + xor eax,eax +;------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/Docs/call_old.txt b/programs/media/zsea/Docs/call_old.txt new file mode 100644 index 0000000000..082d6813e9 --- /dev/null +++ b/programs/media/zsea/Docs/call_old.txt @@ -0,0 +1,66 @@ + +The block is passed to the plugin: +;--------------------------------------------------------------------- +; not change this section!!! +; start section +;--------------------------------------------------------------------- +align 4 +image_file dd 0 ;+0 +raw_pointer dd 0 ;+4 +return_code dd 0 ;+8 +img_size dd 0 ;+12 +deflate_unpack dd 0 ;+16 +raw_pointer_2 dd 0 ;+20 +;--------------------------------------------------------------------- +; end section +;--------------------------------------------------------------------- + + +Calling plugins: + + + +;--------------------------------------------------------------------- +convert: + xor eax,eax + cmp [error_fs],eax + jnz .error + mov [return_code],eax + mov eax,image_file + call [plugin] + cmp [return_code],dword 0 + je @f + cmp [return_code],dword 2 + je @f +;------------------------------- + xor eax,eax + mov [return_code],eax + mov eax,image_file + call [plugin_1] + cmp [return_code],dword 0 + je @f + cmp [return_code],dword 2 + je @f +;------------------------------- + xor eax,eax + mov [return_code],eax + mov eax,image_file + call [plugin_2] + cmp [return_code],dword 0 + je @f + cmp [return_code],dword 2 + je @f +;------------------------------- + xor eax,eax + mov [return_code],eax + mov eax,image_file + call [plugin_3] +;------------------------------- +@@: + mov ecx,[image_file] + mcall 68, 13, + + cmp [return_code],dword 0 + je .all_ok + xor eax,eax +;------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/Docs/resouce.txt b/programs/media/zsea/Docs/resouce.txt new file mode 100644 index 0000000000..bc7812ac61 --- /dev/null +++ b/programs/media/zsea/Docs/resouce.txt @@ -0,0 +1,10 @@ +Use variable "status": + +1 1h 1 open file +2 2h 10 file info +4 4h 100 window about +8 8h 1000 window background +16 10h 10000 window set sort mode +32 20h 100000 window error +64 40h 1000000 window option +128 80h 10000000 \ No newline at end of file diff --git a/programs/media/zsea/Docs/zSea_keys.txt b/programs/media/zsea/Docs/zSea_keys.txt new file mode 100644 index 0000000000..f039ec10b5 --- /dev/null +++ b/programs/media/zsea/Docs/zSea_keys.txt @@ -0,0 +1,63 @@ +ࠢ騥 ⠭ zSea v1.00 Beta ( ⥪ ). + + : +PageUp - ⠭ 㪠⥫ 䠩 砫 ᯨ᪠. +PageDown - ⠭ 㪠⥫ 䠩 ᯨ᪠. +Home - ६饭 㪠⥫ 䠩 砫 ᯨ᪠. +End - ६饭 㪠⥫ 䠩 ᯨ᪠. +"0" ( . .) "*" ( . .) - ⮬⠡஢ ࠧ ࠭. +"+" - 㢥 ⠡ +"-" - 㬥 ⠡ +"|" ( . .) "/" ( . .) - ⠡ 100% +W - 筮 "⠭ ⨭ ࠡ祣 ⮫" +I - 筮 " ᬠਢ 䠩" +S - 筮 "롮 ० ஢" +O - 筮 "樨 ਫ" +५ ( . .) - ᤢ ⨭, ᫨ ⮡ࠦ. +Enter ( . .) - ⮡ࠦ ࠭ ०. +PrintScreen - SlideShow, ⠭ Esc Space (஡). +Alt+F1 - ⨢ . + + : +५ ६饭 㭪⠬. +Esc - . +Enter - ⢥ত 㭪. +५ ࠢ ६饭 ᥤ . + + + : +Esc - . +Enter - ⢥ত. +५ ६饭 㭪⠬. +"+" "-" ᫮ . +Space (஡) - ⨢஢ ⪫ 㭪, ᫨ checkbox. + + ᯮ - ਢ . + + +OpenDialog - 䠩 (⤥쭠 ணࠬ): +1) ६饭 : + ) ५ ( ⮬ ᫥ ᯮ ⥫쭮 ) - ६饭 . + ) PageUp - ࠭筮 ⠭ . + ) PageDown - ࠭筮 ⠭ . + ) Home - 砫 ⠫ 䠩. + ) End - ⠫ 䠩. +2) Enter - ⢨ 䠩 樨 ண 室 뤥: + ) 室 . + ) ணࠬ. +3) : + Alt+F1 - 맮 롮 ᪠. + Alt+F2 - 맮 ஢. + Alt+F3 - 맮 䨫樨. + : + ५ ६饭 㭪⠬. + Esc - . + Enter - ⢥ত 㭪. + ५ ࠢ ६饭 ᥤ . +4) Ctrl+R - ᮤন ४ਨ. +5) Backspace (५ 冷 Insert) - 室 ४ਨ. +6) Insert - 뤥 梥⮬ 䠩 ஬ 室 ६饭 1 . +7) Ctrl+A Ctrl+(NumPad(+) Up) - 뤥 䠩 ४਩ ⨢ , ᪫祭 ४ਨ '..' +8) Ctrl+(NumPad(-) Up) - 뤥 䠩 ४਩ ⨢ , ᪫祭 ४ਨ '..' +9) Ctrl+(NumPad(*) Up) - ஢ 뤥 䠩 ४਩ ⨢ , ᪫祭 ४ਨ '..' +10) Esc - 襭 ࠡ ணࠬ, 䠩. diff --git a/programs/media/zsea/animat.inc b/programs/media/zsea/animat.inc new file mode 100644 index 0000000000..e3c854f75f --- /dev/null +++ b/programs/media/zsea/animat.inc @@ -0,0 +1,345 @@ +;--------------------------------------------------------------------- +RAW1_processing: +; mov ebx,[raw_pointer] +; mov eax,[ebx+16] +; mov [raw_pointer],eax +; jmp convert.all_ok + xor eax,eax + mov [Repeat_N],eax + inc eax + mov [RAW1_flag],al + + mov ebx,[raw_pointer] + mov [RAW1_pointer],ebx + mov eax,[ebx+4] + mov [Total_Repeat_N],eax + cmp eax,1 + jne @f + xor eax,eax + mov [RAW1_flag],al +@@: +; mov [test1],eax + mov eax,[ebx+8] + mov [img_width],eax + mov [img_width_2],eax +; mov [test1],eax + mov ecx,[ebx+12] + mov [img_high],ecx + mov [img_high_2],ecx +; mov [test2],ecx + imul ecx,eax + +; mov eax,ecx +; shl ecx,1 +; add ecx,eax + shl ecx,2 + + add ecx,256*4 + add ecx,44 + push ecx + + mcall 68,12 + + mov [raw_pointer],eax + mov ebx,[RAW1_pointer] + mov ecx,[ebx+8] + mov [eax+4],ecx ; x + mov ecx,[ebx+12] + mov [eax+8],ecx ; y + mov [eax+12],dword 32 ;8 + mov [eax+20],dword 44 + mov [eax+24],dword 1024 + mov [eax+28],dword 44+1024 +; mov [eax+32], + +; mov [img_palette],eax + add eax,44+1024 + mov [soi],eax + pop ecx + + cmp [Total_Repeat_N],1 + je @f + + sub ecx,44+1024 + mov [RAW1_size],ecx + mov edi,[soi] + mov eax,-1 + shr ecx,2 + cld + rep stosd + + mov ecx,[RAW1_size] + mcall 68,12 + mov [previous_frame_pointer],eax +@@: + mov [img_resolution_2],8 + mov [img_resolution],32 + + call copy_next_frame + +; inc [Repeat_N] +; call copy_next_frame +; inc [Repeat_N] +; call copy_next_frame +; mov [Repeat_N],0 + + jmp convert.img_resolution_ok +;--------------------------------------------------------------------- +copy_next_frame: + mov eax,[RAW1_pointer] + mov ebx,[eax+8] + mov [RAW1_size_x],ebx + + mov eax,[Repeat_N] + shl eax,4 + ; eax = (start of current Repeat_N) - 16 + add eax,[RAW1_pointer] + mov esi,[eax+16] + + ; esi = pointer to current RAW +; mov ebx,[RAW1_pointer] + mov edi,[RAW1_size_x] ;[ebx+8] + mov ebx,[eax+24] + shl ebx,2 + imul edi,ebx + mov ebx,[eax+20] + shl ebx,2 + add edi,ebx +; add edi,[raw_pointer] +; add edi,44 + add edi,[soi] + ; edi = pointer to start for current frame + mov ebx,[eax+28] + + test bx,bx + jnz @f +; inc ebx + mov bx,10 +@@: + mov [Frame_delay],bx + shr ebx,16 + mov [Transp_index],bh + + mov al,bl + shr al,2 + and al,111b + mov [Disposal_Method],al +; cmp al,2 +; jne @f +; call save_previous_frame +;@@: + cmp al,3 + jne @f + call save_previous_frame +@@: + and bl,1b + mov [Transp_flag],bl + + mov ebx,[esi+4] ; X size og current frame + mov ecx,[esi+8] ; Y size og current frame + + mov eax,[esi+20] + add eax,esi + mov [img_palette],eax + + pusha + mov ebx,[raw_pointer] + mov edi,[ebx+20] + add edi,ebx + mov esi,eax + mov ecx,256 + xor eax,eax + cld + rep movsd + popa + + mov eax,[esi+28] + add esi,eax +.y: + push edi + push ebx +.x: + cld + lodsb + cmp [Transp_flag],0 + je @f + cmp [Transp_index],al + jne @f +; cmp [Disposal_Method],2 +; jne .not_disposal_backgr +; mov [edi],dword -1 ; 0xff +; inc edi +;.not_disposal_backgr: + add edi,4 + jmp .no_store +@@: + push ebx edi + mov ebx,[raw_pointer] + mov edi,[ebx+20] + add edi,ebx + and eax,0xff + shl eax,2 + add edi,eax + mov eax,[edi] + pop edi ebx + stosd +.no_store: + dec ebx + jnz .x + + pop ebx + pop edi + mov eax,[RAW1_size_x] + shl eax,2 + add edi,eax + dec ecx + jnz .y + inc [Repeat_N] + mov eax,[Repeat_N] +; mov [test2],eax + cmp [Total_Repeat_N],eax + ja @f + xor eax,eax + mov [Repeat_N],eax +@@: + mcall 26,9 + movzx ebx,word [Frame_delay] + add eax,ebx + mov [Animation_timer],eax + ret +;--------------------------------------------------------------------- +animation_handler: + mcall 23,1 +; pusha +; mcall 26,9 +; cmp [Animation_timer],eax +; ja @f +; call .draw_image +;@@: +; popa + cmp [open_file_flag],1 + je kopen_1 + cmp [sort_directory_flag],byte 1 + je red_sort_directory + cmp [redraw_flag],byte 1 + je redraw_window + cmp eax,1 ; ? + je red ; - red + cmp eax,2 ; ? + je key ; - key + cmp eax,3 ; ? + je button ; - button + cmp eax,6 + je mouse + mcall 26,9 + cmp [Animation_timer],eax + ja animation_handler ;@f +.1: + call .draw_image +; mov eax,[scaling_mode] +; jmp zoom_plus.2 + jmp still +;@@: +; mcall 23,1 +; jmp still.1 +;--------------------------------------------------------------------- +.draw_image: +; mov eax,[Repeat_N] +; test eax,eax +; jz .first_frame + mov al,[Disposal_Method] + cmp al,2 + jne @f + call restore_background + jmp .first_frame +@@: + cmp al,3 + jne @f + call restore_previous_frame +@@: +.first_frame: + call copy_next_frame + mov [no_fill],1 + call drawimage + mov [no_fill],0 + ret +;--------------------------------------------------------------------- +restore_background: +; cmp [Transp_flag],0 +; je @f +; pusha +; mov edi,[soi] +; mov eax,[fill_color] ; -1 +; mov ecx,[RAW1_size] +; shr ecx,2 +; cld +; rep stosd +; popa +; ret +;@@: + pusha + mov eax,[Repeat_N] + test eax,eax + jz @f + dec eax +@@: + shl eax,4 + ; eax = (start of current Repeat_N) - 16 + add eax,[RAW1_pointer] + mov esi,[eax+16] + ; esi = pointer to current RAW + mov edi,[RAW1_size_x] ;[ebx+8] + mov ebx,[eax+24] + shl ebx,2 + imul edi,ebx + mov ebx,[eax+20] + shl ebx,2 + add edi,ebx + add edi,[soi] + ; edi = pointer to start for current frame + mov ebx,[esi+4] ; X size og current frame + mov ecx,[esi+8] ; Y size og current frame +.y: + push edi + push ebx + mov eax,[fill_color] +.x: + cld + stosd + + dec ebx + jnz .x + + pop ebx + pop edi + mov eax,[RAW1_size_x] + shl eax,2 + add edi,eax + dec ecx + jnz .y + + popa + ret +;--------------------------------------------------------------------- +restore_previous_frame: + pusha + mov esi,[previous_frame_pointer] + mov edi,[soi] + mov ecx,[RAW1_size] + shr ecx,2 + cld + rep movsd + popa + ret +;--------------------------------------------------------------------- +save_previous_frame: + pusha + mov esi,[soi] + mov edi,[previous_frame_pointer] + mov ecx,[RAW1_size] + shr ecx,2 + cld + rep movsd + popa + ret +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/build.bat b/programs/media/zsea/build.bat new file mode 100644 index 0000000000..9bd8a31461 --- /dev/null +++ b/programs/media/zsea/build.bat @@ -0,0 +1,5 @@ +@echo lang fix en >lang.inc +@fasm -m 16384 zSea.asm zSea +@erase lang.inc +@kpack zSea +@pause \ No newline at end of file diff --git a/programs/media/zsea/build.sh b/programs/media/zsea/build.sh new file mode 100644 index 0000000000..e1c1c272f3 --- /dev/null +++ b/programs/media/zsea/build.sh @@ -0,0 +1,9 @@ +#!/bin/bash +# This script does for linux the same as build.bat for DOS + echo "lang fix en" + echo "lang fix en" > lang.inc + fasm -m 65536 zSea.asm zSea + @kpack zSea + rm -f lang.inc + read + exit 0 diff --git a/programs/media/zsea/clr_bcgr.inc b/programs/media/zsea/clr_bcgr.inc new file mode 100644 index 0000000000..e6fcf7a2db --- /dev/null +++ b/programs/media/zsea/clr_bcgr.inc @@ -0,0 +1,17 @@ +;--------------------------------------------------------------------- +clear_thread: + call get_memory_for_tread_stack + mov [clear_thread_stack],eax + mcall 51, 1, clear_thread_start ;, clear_thread_stack + ret +;--------------------------------------------------------------------- +clear_thread_start: + mcall 5,100 +@@: + mcall 23,10 + cmp eax,5 + je @f + mcall 15,3 + mcall 68,13,[clear_thread_stack] + mcall -1 +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/config.inc b/programs/media/zsea/config.inc new file mode 100644 index 0000000000..dc70bf9760 --- /dev/null +++ b/programs/media/zsea/config.inc @@ -0,0 +1 @@ +__CPU_type fix p5 diff --git a/programs/media/zsea/convert.inc b/programs/media/zsea/convert.inc new file mode 100644 index 0000000000..f092129778 --- /dev/null +++ b/programs/media/zsea/convert.inc @@ -0,0 +1,258 @@ +;--------------------------------------------------------------------- +convert_plugin_invoke: + mov eax,[plugin_0_name] + call prepare_convert + push eax + call [Convert_plugin_0.Start] + call check_convert +;------------------------------- + mov eax,[plugin_1_name] + call prepare_convert + push eax + call [Convert_plugin_1.Start] + call check_convert +;------------------------------- + mov eax,[plugin_2_name] + call prepare_convert + push eax + call [Convert_plugin_2.Start] + call check_convert +;------------------------------- + mov eax,[plugin_3_name] + call prepare_convert + push eax + call [Convert_plugin_3.Start] + call check_convert +;------------------------------- + mov eax,[plugin_4_name] + call prepare_convert + push eax + call [Convert_plugin_4.Start] + call check_convert +;------------------------------- + mov eax,[plugin_5_name] + call prepare_convert + push eax + call [Convert_plugin_5.Start] + call check_convert +;------------------------------- + mov eax,[plugin_6_name] + call prepare_convert + push eax + call [Convert_plugin_6.Start] + call check_convert +;------------------------------- + mov eax,[plugin_7_name] + call prepare_convert + push eax + call [Convert_plugin_7.Start] + call check_convert +;------------------------------- + mov eax,[plugin_8_name] + call prepare_convert + push eax + call [Convert_plugin_8.Start] + mov eax,[return_code] + call check_convert +;------------------------------- + mov eax,[plugin_9_name] + call prepare_convert + push eax + call [Convert_plugin_9.Start] +;------------------------------- +.end: + mov ecx,[image_file] + mcall 68, 13, + ret +;--------------------------------------------------------------------- +prepare_convert: + cmp eax,dword 'NoKe' + je .1 ;@f + xor eax,eax + mov [return_code],eax + mov eax,image_file + ret +.1: + add esp,4 + jmp convert_plugin_invoke.end +;--------------------------------------------------------------------- +check_convert: + mov eax,[return_code] + test eax,eax + jz prepare_convert.1 + cmp eax,dword 2 + je prepare_convert.1 + ret +;--------------------------------------------------------------------- +convert: + xor eax,eax + cmp [error_fs],eax + jnz .error + + call convert_plugin_invoke + + cmp [return_code],dword 0 + je .all_ok + xor eax,eax +;------------------------------- +.error_1: + mov [img_size],eax + mov [img_width],eax + mov [img_width_2],eax + mov [img_high],eax + mov [img_high_2],eax + mov [img_resolution],eax + mov [img_resolution_2],eax + mov [img_palette],eax + mov [soi],eax + mov [file_name],eax + mov [Total_Repeat_N],eax + mov [RAW1_pointer],eax + mov [RAW1_flag],al + + mov [scaling_mode],dword 100 + call error_window + ret +;------------------------------- +.error: + xor eax,eax + mov [return_code],eax + jmp .error_1 +;------------------------------- +.all_ok: + mov ebx,[raw_pointer] + cmp [ebx],dword 'RAW1' + je RAW1_processing + xor eax,eax + mov [RAW1_flag],al + mov [RAW1_pointer],eax + inc eax + mov [Total_Repeat_N],eax + mov eax,[ebx+4] + mov [img_width],eax + mov [img_width_2],eax + mov eax,[ebx+8] + mov [img_high],eax + mov [img_high_2],eax + mov eax,[ebx+12] + mov [img_resolution_2],eax +; mov eax,[ebx+20] +; add eax,ebx +; mov [img_palette],eax +; mov eax,[ebx+28] +; add eax,ebx +; mov [soi],eax +;------------------------------- +; xor eax,eax +; mov [raw_pointer_2],eax + mov eax,image_file +; call [plugin_convert] + call [convert_Start] + + mov ebx,[raw_pointer] + mov eax,[ebx+12] +; cmp [ebx+18],word 2 +; jne @f +; shr eax,1 +;@@: + cmp eax,15 + jne @f + inc eax +@@: + mov [img_resolution],eax + + mov eax,[ebx+20] + add eax,ebx + mov [img_palette],eax + + mov eax,[ebx+28] + add eax,ebx + mov [soi],eax + +; mov eax,[raw_pointer_2] +; test eax,eax +; jz @f +; mov [soi],eax +;@@: + +;------------------------------- +; mov eax,[img_resolution] +; cmp eax,32 +; ja @f +; cmp [ebx+18],word 2 +; je @f +; cmp [ebx+18],word 1 +; jne .img_resolution_ok +;.grayscale_16: +; cmp eax,16 +; jne .img_resolution_ok +; shr eax,1 +; mov [img_resolution],eax +; jmp .img_resolution_ok +;@@: +; shr eax,1 +; cmp eax,16 +; jne @f +; shr eax,1 +;@@: +; mov [img_resolution],eax + +.img_resolution_ok: + xor eax,eax + mov [scroll_bar_data_vertical.position],eax + mov [scroll_bar_data_horizontal.position],eax + call get_window_param + test [window_status],1b + jnz .end + cmp [scaling_mode],dword 100 + jne .end + mov ebx,[img_high] + mov eax,[img_width] + test ebx, ebx + jns @f + neg ebx +@@: + add eax,9 + cmp eax,770 + jae @f + mov eax,770 +@@: + add ebx,54 + cmp ebx,150 + jae @f + mov ebx,150 +@@: + mov [wnd_width],eax + mov [wnd_height],ebx + + mcall 14 + + mov ebx,eax + and eax,0xffff + shr ebx,16 + inc eax + inc ebx + cmp eax,[wnd_height] + jae @f + xor eax,eax + mov ax,[scroll_bar_data_vertical.size_x] + add [wnd_width],eax +@@: + cmp ebx,[wnd_width] + jae @f + xor eax,eax + mov ax,[scroll_bar_data_horizontal.size_y] + add [wnd_height],eax +@@: + mov eax,[wnd_width] + mov ebx,[wnd_height] + + test [bWasDraw],1 + jz @f + mov esi,ebx + mov edx,eax + mcall 67,-1,-1 +@@: +.end: + ret +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/dat_area.inc b/programs/media/zsea/dat_area.inc new file mode 100644 index 0000000000..254b00cd18 --- /dev/null +++ b/programs/media/zsea/dat_area.inc @@ -0,0 +1,102 @@ +string: +; rb string+257-$ + rb 4096 +;string_1: +; rb 4096 +;---------------------- +path: + rb 4096 +;---------------------- +;plugin_pach_1: +; rb 4096 +;---------------------- +plugin_pach: + rb 4096 +;---------------------- +library_path: + rb 4096 +;---------------------- +Filter: + rb 4096 +;---------------------- +Help_path: + rb 1024 ;4096 +;---------------------- +Editor_path: + rb 1024 ;4096 +;---------------------- +OpenDialog_path: + rb 1024 ;4096 +;---------------------- +key_help_name: + rb 128 +;---------------------- +plugin_0_name: + rb 128 +plugin_1_name: + rb 128 +plugin_2_name: + rb 128 +plugin_3_name: + rb 128 +plugin_4_name: + rb 128 +plugin_5_name: + rb 128 +plugin_6_name: + rb 128 +plugin_7_name: + rb 128 +plugin_8_name: + rb 128 +plugin_9_name: + rb 128 +;---------------------- +file_name: + rb 1024 +;---------------------- +temp_area: + rb 4096 +;---------------------- +procinfo: +process_info: + rb 1024 +;---------------------- +procinfo_threads: + rb 1024 +;---------------------- +; clear bacground thread +; rb 512 +;clear_thread_stack: +;---------------------- +; window option +; rb 1024 ;4096 +;thread_stack_7: +;---------------------- +; window error message +; rb 1024 ;4096 +;thread_stack_6: +;---------------------- +; window set sort mode +; rb 1024 ;4096 +;thread_stack_5: +;---------------------- +; window background +; rb 1024 ;4096 +;thread_stack_4: +;---------------------- +; window about +; rb 1024 ;4096 +;thread_stack_3: +;---------------------- +; file info +; rb 1024 ;4096 +;thread_stack_2: +;---------------------- +; file open +; rb 1024 ;4096 +;thread_stack: +;---------------------- + rb 4096 +stacktop: +;---------------------- \ No newline at end of file diff --git a/programs/media/zsea/data.inc b/programs/media/zsea/data.inc new file mode 100644 index 0000000000..1168e499a7 --- /dev/null +++ b/programs/media/zsea/data.inc @@ -0,0 +1,1710 @@ +;--------------------------------------------------------------------- +; DATA AREA +;--------------------------------------------------------------------- +lsz labelt1,\ + en, 'File',\ + ru, '',\ + de, 'Datei' + db 0 + +;--------------------------------------------------------------------- +lsz labelt2,\ + en, 'File info',\ + ru, 'ଠ 䠩',\ + de, 'Dateiinfo' + db 0 + +lsz fitext,\ + en, 'File name ',\ + en, 'File size ',\ + en, 'X size ',\ + en, 'Y size ',\ + en, 'Resolution ',\ + en, 'Frames total ',\ + \ + ru, ' 䠩 ',\ + ru, ' 䠩 ',\ + ru, 'ਭ ',\ + ru, ' ',\ + ru, ' ᥫ ',\ + ru, 'ᥣ ஢ ',\ + \ + de, 'Datei Namen ',\ + de, 'Fateigroesse ',\ + de, 'X groesse ',\ + de, 'Y groesse ',\ + de, 'Die Tiefe ',\ + de, 'Zahl Frames ' + db 0 +;--------------------------------------------------------------------- +Authors_text: +.1: db 'zSea version: 1.00 RC3 Date: 12/06/2011',0 +.2: db 'Authors:',0 +.3: db 'Marat Zakiyanov aka Mario(Mario79)',0 +.4: db 'zSea program, modules: cnv_bmp.obj,',0 +.5: db 'cnv_png.obj, convert.obj, rotate.obj ',0 +.6: db 'scaling.obj, box_lib.obj, OpenDialog',0 +.7: db 'proc_lib.obj',0 + +.8: db 'Evgeny Grechnikov aka Diamond',0 +.9: db 'modules: cnv_jpeg.obj, cnv_gif.obj,',0 +.10: db 'archiver.obj, sort.obj ',0 + +.11: db 'Alexey Teplov aka ',0 +.12: db 'modules: box_lib.obj, load_lib.mac',0 + +.13: db 'Mihail Semenyako aka Mike.dld',0 +.14: db 'modules: libini.obj, libio.obj',0 +;--------------------------------------------------------------------- +status dd 0 ;bit0=1 if file thread is created +;process dd 0 + +bWasDraw db 0 +vflag: db 'x' +bgrmode: dd 1 + +wnd_width dd 210 +wnd_height dd 53 +;--------------------------------- +lsz labelt3,\ + en, 'About program',\ + ru, ' ணࠬ',\ + de, 'Uber das programm' + db 0 +;--------------------------------- +lsz labelt4,\ + en, 'Set wallpaper',\ + ru, '⠭ 䮭',\ + de, 'Installation hintergrund' + db 0 +;--------------------------------- +lsz labelt5,\ + en, 'Select sorting mode',\ + ru, '஢ ४ਨ',\ + de, 'Regimes der Sortierung' + db 0 +;--------------------------------- +lsz bgrdtext,\ + en, 'Set as background:',\ + ru, ' :',\ + de, 'Als hintergrund' + db 0 +;--------------------------------- +lsz sorttext,\ + en, 'Directory sorting mode:',\ + ru, ' ஢ ४ਨ:',\ + de, 'Regime der Sortierung des Verzeichnisses:' + db 0 +;--------------------------------- +lsz errortext,\ + en, 'File system error:',\ + ru, '訡 䠩 ⥬:',\ + de, 'Fehler files systemes:' + db 0 +;--------------------------------- +lsz optiontext,\ + en, 'Options:',\ + ru, 'ன:',\ + de, 'Optionen:' + db 0 +;--------------------------------- +;lsz tiled,\ +; en, 'Tiled',\ +; ru, '',\ +; de, 'Gekachelt' + +;lsz stretch,\ +; en, 'Stretch',\ +; ru, '',\ +; de, 'Gestreckt' +;--------------------------------- +lsz ok_btn,\ + en, 'Ok',\ + ru, 'Ok',\ + de, 'Ok' + db 0 +;--------------------------------- +lsz slide_show_delay_title,\ + en, 'Slide show delay:',\ + ru, 'প ᫠:',\ + de, 'Verzug der schau:' + db 0 +;--------------------------------- +lsz arrows_offset_title,\ + en, 'Arrows offset:',\ + ru, '饭 ५:',\ + de, 'Bewegung von den zeigern:' + db 0 +;--------------------------------- +slide_show_delay_text: + db '+ -',0 +;--------------------------------------------------------------------- +zoom_auto_factor: + dd 0 +zoom_auto_text: + db 'auto',0 +zoom_factors: + dd zoom_factors.100 +.1: dd 0 +.min: + dd 1 + dd 2 + dd 3 + dd 4 + dd 5 + dd 7 + dd 10 + dd 17 + dd 25 + dd 37 + dd 50 + dd 62 + dd 75 + dd 87 +.100: + dd 100 + dd 125 + dd 150 + dd 175 + dd 200 + dd 225 + dd 250 + dd 275 + dd 300 + dd 350 + dd 400 + dd 450 + dd 500 + dd 600 + dd 700 + dd 800 + dd 900 + dd 1000 + dd 1100 + dd 1200 + dd 1300 + dd 1400 + dd 1500 + dd 1750 + dd 2000 + dd 2250 + dd 2500 + dd 2750 + dd 3000 + dd 3500 + dd 4000 + dd 4500 +.max: + dd 5000 + +zoom_factors_old dd 0 +;--------------------------------------------------------------------- +; not change this section!!! +; start section +;--------------------------------------------------------------------- +align 4 +image_file dd 0 ;+0 +raw_pointer dd 0 ;+4 +return_code dd 0 ;+8 +img_size dd 0 ;+12 +deflate_unpack dd 0 ;+16 +raw_pointer_2 dd 0 ;+20 +;--------------------------------------------------------------------- +; end section +;--------------------------------------------------------------------- +test1 dd 0 ;+24 +test2 dd 0 ;+28 +test3 dd 0 ;+32 +test4 dd 0 ;+36 +test5 dd 0 ;+40 +test6 dd 0 ;+44 +test7 dd 0 ;+48 +;--------------------------------------------------------------------- +align 4 +soi dd 0 +img_width dd 0 +img_width_2 dd 0 +img_high dd 0 +img_high_2 dd 0 +img_resolution dd 0 +img_resolution_2 dd 0 +img_palette dd 0 + +background_color dd 0xffffff + +RAW1_pointer dd 0 +RAW1_size_x dd 0 +RAW1_size dd 0 +Repeat_N dd 0 +Total_Repeat_N dd 1 +previous_frame_pointer dd 0 +Animation_timer dd 0 +Frame_delay dw 0 +Transp_flag db 0 +Transp_index db 0 +Disposal_Method db 0 +RAW1_flag db 0 +no_fill db 0 +redraw_wallpaper_flag db 0 + +calc_next_value_plus db 0 +calc_next_value_minus db 0 +;--------------------------------------------------------------------- +align 4 +;plugin dd 0 +;plugin_1 dd 0 +;plugin_2 dd 0 +;plugin_3 dd 0 + +;plugin_validate dd 0 +;plugin_validate_1 dd 0 +;plugin_validate_2 dd 0 +;plugin_validate_3 dd 0 + +;plugin_format dd 0 +;plugin_format_1 dd 0 +;plugin_format_2 dd 0 +;plugin_format_3 dd 0 + +;plugin_convert dd 0 +;plugin_convert_background dd 0 +;plugin_sort dd 0 +;plugin_rotate dd 0 +;plugin_scaling dd 0 + +slide_show_delay dd 500 ; cost of 0,01 sec. +slide_show_delay_old dd 0 + +sort_type dd 2 +sort_type_old dd 0 +;--------------------------------------------------------------------- +expansion_length dd 0 +expansion_start dd 0 + +timer dd 0 +;--------------------------------------------------------------------- +mouse_scroll_data: + .vertical dw 0 + .horizontal dw 0 + +mouse_position: + .y dw 0 + .x dw 0 + +mouse_position_old: + .y dw 0 + .x dw 0 + +mouse_keys dd 0 +mouse_keys_old dd 0 + +arrows_offset dd 10 +arrows_offset_old dd 10 + +option_pointer dd 0 +plus_pointer dd 0 +minus_pointer dd 0 +space_pointer dd 0 + +;--------------------------------------------------------------------- +pos: dd 6 + +work_area_LR_old dd 0 +work_area_TB_old dd 0 + +scaling_mode dd 100 +scaling_mode_old dd 100 + +window_start_x_old dd 0 +window_start_y_old dd 0 +window_high_old dd 0 +window_width_old dd 0 + +window_start_x dd 0 +window_start_y dd 0 +window_high dd 0 +window_width dd 0 +;skin_high dd 0 +window_status dd 0 +draw_SB db 0 +draw_SB1 db 0 +correct_w db 0 +correct_h db 0 +wa_width dw 0 +wa_high dw 0 + +wa_width_1 dw 0 +wa_width_2 dw 0 + +wa_high_1 dw 0 +wa_high_2 dw 0 + +image_start_coordinates dd 0 +image_draw_size: +.y: dw 0 +.x: dw 0 + +vertical_position_coorect dd 0 +horizontal_position_coorect dd 0 + +fill_color dd 0xffffff +fill_color_old dd 0xffffff + +position_coorect db 0 + +open_file_flag db 0 +sort_directory_flag db 0 +redraw_flag db 0 + +press_Enter_flag db 0 + +capture_image_area_flag db 0 + +correct_scrollbar_100_flag db 0 +;--------------------------------------------------------------------- +;test_area: +;dd test_area.end - test_area +;db 'BMP',0 +;.end: +;db 0,0,0,0,0,0,0,0,0,0,0,0,0 +;--------------------------------------------------------------------- +aApplicationsPaths db 'ApplicationsPaths',0 +aOther db 'Other',0 + +aHelp db 'Help',0 +aEditor db 'Editor',0 +aOpenDialog db 'OpenDialog',0 +akey_help db 'HelpFile',0 + +aConvertPlugins db 'ConvertPlugins',0 + +ConvertPlugins_no_key db 'NoKey',0 + +aCP0 db 'CP0',0 +aCP1 db 'CP1',0 +aCP2 db 'CP2',0 +aCP3 db 'CP3',0 +aCP4 db 'CP4',0 +aCP5 db 'CP5',0 +aCP6 db 'CP6',0 +aCP7 db 'CP7',0 +aCP8 db 'CP8',0 +aCP9 db 'CP9',0 +;--------------------------------------------------------------------- +plugin_BMP_name db 'cnv_bmp.obj',0 +plugin_PNG_name db 'cnv_png.obj',0 +plugin_JPEG_name db 'cnv_jpeg.obj',0 +plugin_GIF_name db 'cnv_gif.obj',0 + +;plugin_convert_name db 'convert.obj',0 +;plugin_sort_name db 'sort.obj',0 +;plugin_rotate_name db 'rotate.obj',0 +;plugin_scaling_name db 'scaling.obj',0 +;plugin_UNPACK_name db 'archiver.obj',0 +;boxlib_name db 'box_lib.obj',0 +;Libini_name db 'libini.obj',0 +plugins_directory db 'plugins/',0 +ini_file_name db 'zsea.ini',0 + +button_name db 'buttons.png',0 +;buttons_passive_name db '1.png',0 +;buttons_active_name db '2.png',0 +;buttons_click_name db '3.png',0 + +buttons_directory db 'buttons/',0 +;UNPACK_function_name db 'deflate_unpack',0 +;UNPACK_function_name_end: +;UNPACK_function_name db 'deflate_unpack2',0 +;UNPACK_function_name_end: + +system_dir_Boxlib db '/sys/lib/box_lib.obj',0 +system_dir_Libini db '/sys/lib/libini.obj',0 +system_dir_Sort db '/sys/lib/sort.obj',0 +system_dir_UNPACK db '/sys/lib/archiver.obj',0 +system_dir_Convert db '/sys/lib/convert.obj',0 +system_dir_Rotate db '/sys/lib/rotate.obj',0 +system_dir_Scaling db '/sys/lib/scaling.obj',0 +system_dir_ProcLib db '/sys/lib/proc_lib.obj',0 + +err_message_found_lib1 db 'box_lib.obj - Not found!',0 +err_message_found_lib2 db 'libini.obj - Not found!',0 +err_message_found_lib3 db 'sort.obj - Not found!',0 +err_message_found_lib4 db 'archiver.obj - Not found!',0 +err_message_found_lib5 db 'convert.obj - Not found!',0 +err_message_found_lib6 db 'rotate.obj - Not found!',0 +err_message_found_lib7 db 'scaling.obj - Not found!',0 +err_message_found_lib8 db 'proc_lib.obj - Not found!',0 + +err_message_import1 db 'box_lib.obj - Wrong import!',0 +err_message_import2 db 'libini.obj - Wrong import!',0 +err_message_import3 db 'sort.obj - Wrong import!',0 +err_message_import4 db 'archiver.obj - Wrong import!',0 +err_message_import5 db 'convert.obj - Wrong import!',0 +err_message_import6 db 'rotate.obj - Wrong import!',0 +err_message_import7 db 'scaling.obj - Wrong import!',0 +err_message_import8 db 'proc_lib.obj - Wrong import!',0 + +head_f_i: +head_f_l db 'Errors of PLugins:',0 + +;--------------------------------------------------------------------- +l_libs_start: +library01 l_libs system_dir_Boxlib+9, path, library_path, system_dir_Boxlib, \ +err_message_found_lib1, head_f_l, Box_lib_import, err_message_import1, head_f_i, plugins_directory + +library02 l_libs system_dir_Libini+9, path, library_path, system_dir_Libini, \ +err_message_found_lib2, head_f_l, Libini_import, err_message_import2, head_f_i, plugins_directory + +library03 l_libs system_dir_Sort+9, path, library_path, system_dir_Sort, \ +err_message_found_lib3, head_f_l, Sort_import, err_message_import3, head_f_i, plugins_directory + +library04 l_libs system_dir_UNPACK+9, path, library_path, system_dir_UNPACK, \ +err_message_found_lib4, head_f_l, UNPACK_import, err_message_import4, head_f_i, plugins_directory + +library05 l_libs system_dir_Convert+9, path, library_path, system_dir_Convert, \ +err_message_found_lib5, head_f_l, Convert_import, err_message_import5, head_f_i, plugins_directory + +library06 l_libs system_dir_Rotate+9, path, library_path, system_dir_Rotate, \ +err_message_found_lib6, head_f_l, Rotate_import, err_message_import6, head_f_i, plugins_directory + +library07 l_libs system_dir_Scaling+9, path, library_path, system_dir_Scaling, \ +err_message_found_lib7, head_f_l, Scaling_import, err_message_import7, head_f_i, plugins_directory + +library08 l_libs system_dir_ProcLib+9, path, library_path, system_dir_ProcLib, \ +err_message_found_lib8, head_f_l, ProcLib_import, err_message_import8, head_f_i, plugins_directory + +end_l_libs: +;--------------------------------------------------------------------- +align 4 +cnv_plugin_name_pointer dd plugin_0_name +cnv_plugin_import_pointer dd Convert_plugin_0 + +system_path db '/sys/lib/' +.1: rb 128 +err_message_found_lib db 'Not found - ' +.1: rb 128 +err_message_import db 'Wrong import - ' +.1: rb 128 +;--------------------------------------------------------------------- +Convert_plugin_0: +.Start dd aCP_Start +.Version dd aCP_Version +.Check dd aCP_Check +.Assoc dd aCP_Assoc + dd 0 + dd 0 +Convert_plugin_1: +.Start dd aCP_Start +.Version dd aCP_Version +.Check dd aCP_Check +.Assoc dd aCP_Assoc + dd 0 + dd 0 +Convert_plugin_2: +.Start dd aCP_Start +.Version dd aCP_Version +.Check dd aCP_Check +.Assoc dd aCP_Assoc + dd 0 + dd 0 +Convert_plugin_3: +.Start dd aCP_Start +.Version dd aCP_Version +.Check dd aCP_Check +.Assoc dd aCP_Assoc + dd 0 + dd 0 +Convert_plugin_4: +.Start dd aCP_Start +.Version dd aCP_Version +.Check dd aCP_Check +.Assoc dd aCP_Assoc + dd 0 + dd 0 +Convert_plugin_5: +.Start dd aCP_Start +.Version dd aCP_Version +.Check dd aCP_Check +.Assoc dd aCP_Assoc + dd 0 + dd 0 +Convert_plugin_6: +.Start dd aCP_Start +.Version dd aCP_Version +.Check dd aCP_Check +.Assoc dd aCP_Assoc + dd 0 + dd 0 +Convert_plugin_7: +.Start dd aCP_Start +.Version dd aCP_Version +.Check dd aCP_Check +.Assoc dd aCP_Assoc + dd 0 + dd 0 +Convert_plugin_8: +.Start dd aCP_Start +.Version dd aCP_Version +.Check dd aCP_Check +.Assoc dd aCP_Assoc + dd 0 + dd 0 +Convert_plugin_9: +.Start dd aCP_Start +.Version dd aCP_Version +.Check dd aCP_Check +.Assoc dd aCP_Assoc + dd 0 + dd 0 +aCP_Start db 'START',0 +aCP_Version db 'version',0 +aCP_Check db 'Check_Header',0 +aCP_Assoc db 'Associations',0 +;--------------------------------------------------------------------- + +file_mount: db 'File N: Amount: Zoom:',0 +.end: + +current_key_code db 0 +old_key_code db 0 +;--------------------------------------------------------------------- +; Tokens +;--------------------------------------------------------------------- +aSortMode db 'SortMode',0 +aSlideShowDelay db 'SlideShowDelay',0 +aArrowsOffset db 'ArrowsOffset',0 +aShowFileName db 'ShowFileName',0 +aFilteringFlag db 'FilteringFlag',0 +;--------------------------------------------------------------------- +;Sections +;--------------------------------------------------------------------- +aVariables db 'Variables',0 +;aVar db 'Var',0 +;aTemp db 'Temp',0 +;--------------------------------------------------------------------- +align 4 +ProcLib_import: +OpenDialog_Init dd aOpenDialog_Init +OpenDialog_Start dd aOpenDialog_Start +;OpenDialog__Version dd aOpenDialog_Version + dd 0 + dd 0 +aOpenDialog_Init db 'OpenDialog_init',0 +aOpenDialog_Start db 'OpenDialog_start',0 +;aOpenDialog_Version db 'Version_OpenDialog',0 +;--------------------------------------------------------------------- +align 4 +Scaling_import: +Scaling_Start dd aScaling_Start +Scaling_Version dd aScaling_Version + dd 0 + dd 0 +aScaling_Start db 'START',0 +aScaling_Version db 'version',0 +;--------------------------------------------------------------------- +align 4 +Rotate_import: +rotate_Start dd aRotate_Start +rotate_Version dd aRotate_Version + dd 0 + dd 0 +aRotate_Start db 'START',0 +aRotate_Version db 'version',0 +;--------------------------------------------------------------------- +align 4 +Convert_import: +convert_Start dd aConvert_Start +convert_Version dd aConvert_Version +convert_Conv_24b dd aConvert_Conv_24b + dd 0 + dd 0 +aConvert_Start db 'START',0 +aConvert_Version db 'version',0 +aConvert_Conv_24b db 'Convert24b',0 +;--------------------------------------------------------------------- +align 4 +UNPACK_import: +;unpack_Version dd aUnpack_Version +;unpack_PluginLoad dd aUnpack_PluginLoad +;unpack_OpenFilePlugin dd aUnpack_OpenFilePlugin +;unpack_ClosePlugin dd aUnpack_ClosePlugin +;unpack_ReadFolder dd aUnpack_ReadFolder +;unpack_SetFolder dd aUnpack_SetFolder +;unpack_GetFiles dd aUnpack_GetFiles +;unpack_GetOpenPluginInfo dd aUnpack_GetOpenPluginInfo +;unpack_Getattr dd aUnpack_Getattr +;unpack_Open dd aUnpack_Open +;unpack_Read dd aUnpack_Read +;unpack_Setpos dd aUnpack_Setpos +;unpack_Close dd aUnpack_Close +;unpack_DeflateUnpack dd aUnpack_DeflateUnpack +unpack_DeflateUnpack2 dd aUnpack_DeflateUnpack2 + dd 0 + dd 0 + +;aUnpack_Version db 'version',0 +;aUnpack_PluginLoad db 'plugin_load',0 +;aUnpack_OpenFilePlugin db 'OpenFilePlugin',0 +;aUnpack_ClosePlugin db 'ClosePlugin',0 +;aUnpack_ReadFolder db 'ReadFolder',0 +;aUnpack_SetFolder db 'SetFolder',0 +;aUnpack_GetFiles db 'GetFiles',0 +;aUnpack_GetOpenPluginInfo db 'GetOpenPluginInfo',0 +;aUnpack_Getattr db 'getattr',0 +;aUnpack_Open db 'open',0 +;aUnpack_Read db 'read',0 +;aUnpack_Setpos db 'setpos',0 +;aUnpack_Close db 'close',0 +;aUnpack_DeflateUnpack db 'deflate_unpack',0 +aUnpack_DeflateUnpack2 db 'deflate_unpack2',0 + +;--------------------------------------------------------------------- +align 4 +Sort_import: +sort_init dd aSort_init +sort_version dd aSort_version +sort_dir dd aSort_SortDir +sort_strcmpi dd aSort_strcmpi + dd 0 + dd 0 + +aSort_init db 'START',0 +aSort_version db 'version',0 +aSort_SortDir db 'SortDir',0 +aSort_strcmpi db 'strcmpi',0 + +;--------------------------------------------------------------------- +align 4 +Libini_import: +lib_init dd aLib_init +version_lib_ini dd aVersion_lib_ini +ini_enum_sections dd aIni_enum_sections +ini_enum_keys dd aIni_enum_keys +ini_get_str dd aIni_get_str +ini_get_int dd aIni_get_int +ini_get_color dd aIni_get_color +ini_set_str dd aIni_set_str +ini_set_int dd aIni_set_int +ini_set_color dd aIni_set_color + dd 0 + dd 0 + +aLib_init db 'lib_init',0 +aVersion_lib_ini db 'version',0 +aIni_enum_sections db 'ini_enum_sections',0 +aIni_enum_keys db 'ini_enum_keys',0 +aIni_get_str db 'ini_get_str',0 +aIni_get_int db 'ini_get_int',0 +aIni_get_color db 'ini_get_color',0 +aIni_set_str db 'ini_set_str',0 +aIni_set_int db 'ini_set_int',0 +aIni_set_color db 'ini_set_color',0 + +;--------------------------------------------------------------------- +align 4 +Box_lib_import: +;init_lib dd a_init +;version_lib dd a_version + +edit_box_draw dd aEdit_box_draw +edit_box_key dd aEdit_box_key +edit_box_mouse dd aEdit_box_mouse +;version_ed dd aVersion_ed + +check_box_draw dd aCheck_box_draw +check_box_mouse dd aCheck_box_mouse +;version_ch dd aVersion_ch + +option_box_draw dd aOption_box_draw +option_box_mouse dd aOption_box_mouse +;version_op dd aVersion_op + +scrollbar_ver_draw dd aScrollbar_ver_draw +scrollbar_ver_mouse dd aScrollbar_ver_mouse +scrollbar_hor_draw dd aScrollbar_hor_draw +scrollbar_hor_mouse dd aScrollbar_hor_mouse +;version_scrollbar dd aVersion_scrollbar + +dinamic_button_draw dd aDbutton_draw +dinamic_button_mouse dd aDbutton_mouse +;version_dbutton dd aVersion_dbutton + +menu_bar_draw dd aMenu_bar_draw +menu_bar_mouse dd aMenu_bar_mouse +menu_bar_activate dd aMenu_bar_activate +;version_menu_bar dd aVersion_menu_bar + +;FileBrowser_draw dd aFileBrowser_draw +;FileBrowser_mouse dd aFileBrowser_mouse +;FileBrowser_key dd aFileBrowser_key +;Version_FileBrowser dd aVersion_FileBrowser + dd 0 + dd 0 + +;a_init db 'lib_init',0 +;a_version db 'version',0 + +aEdit_box_draw db 'edit_box',0 +aEdit_box_key db 'edit_box_key',0 +aEdit_box_mouse db 'edit_box_mouse',0 +;aVersion_ed db 'version_ed',0 + +aCheck_box_draw db 'check_box_draw',0 +aCheck_box_mouse db 'check_box_mouse',0 +;aVersion_ch db 'version_ch',0 + +aOption_box_draw db 'option_box_draw',0 +aOption_box_mouse db 'option_box_mouse',0 +;aVersion_op db 'version_op',0 + +aScrollbar_ver_draw db 'scrollbar_v_draw',0 +aScrollbar_ver_mouse db 'scrollbar_v_mouse',0 +aScrollbar_hor_draw db 'scrollbar_h_draw',0 +aScrollbar_hor_mouse db 'scrollbar_h_mouse',0 +;aVersion_scrollbar db 'version_scrollbar',0 + +aDbutton_draw db 'dbutton_draw',0 +aDbutton_mouse db 'dbutton_mouse',0 +;aVersion_dbutton db 'version_dbutton',0 + +aMenu_bar_draw db 'menu_bar_draw',0 +aMenu_bar_mouse db 'menu_bar_mouse',0 +aMenu_bar_activate db 'menu_bar_activate',0 +;aVersion_menu_bar db 'version_menu_bar',0 + +;aFileBrowser_draw db 'FileBrowser_draw',0 +;aFileBrowser_mouse db 'FileBrowser_mouse',0 +;aFileBrowser_key db 'FileBrowser_key',0 +;aVersion_FileBrowser db 'version_FileBrowser',0 +;--------------------------------------------------------------------- +align 4 +load_directory_pointer dd 0 +file_name_length dd 0 +load_file_number dd 0 +error_fs dd 0 +error_pointer dd 0 +;error_locate dd 0 +error_window_x: dd 100 shl 16 + 300 +error_window_y: dd 100 shl 16 + 100 + +PID dd 0 +PID1 dd 0 +PID2 dd 0 +PID3 dd 0 +PID4 dd 0 +PID5 dd 0 +PID6 dd 0 +PID7 dd 0 +active_process dd 0 +timer_counter dd 0 +draw_scrollbar_counter dd 0 +;--------------------------------------------------------------------- +align 4 +error_fs_text_pointers: + dd error_fs_text_0 + dd error_fs_text_1 + dd error_fs_text_2 + dd error_fs_text_3 + dd error_fs_text_4 + dd error_fs_text_5 + dd error_fs_text_6 + dd error_fs_text_7 + dd error_fs_text_8 + dd error_fs_text_9 + dd error_fs_text_10 + dd error_fs_text_11 + +error_fs_text_0: db 'Success full',0 +error_fs_text_1: db 'Base and/or partition of a hard disk is not defined',0 +error_fs_text_2: db 'Function is not supported for the given file system',0 +error_fs_text_3: db 'Unknown file system',0 +error_fs_text_4: db 'Reserved, is never returned in the current implementation',0 +error_fs_text_5: db 'File not found',0 +error_fs_text_6: db 'End of file, EOF',0 +error_fs_text_7: db 'Pointer lies outside of application memory',0 +error_fs_text_8: db 'Disk is full',0 +error_fs_text_9: db 'FAT table is destroyed',0 +error_fs_text_10: db 'Access denied',0 +error_fs_text_11: db 'Device error',0 +;--------------------------------------------------------------------- +error_type: + db 'File system error',0 +;--------------------------------------------------------------------- +error_not_supported_file: + db 'Unsupported file or corrupt data',0 +;--------------------------------------------------------------------- +error_not_enough_memory: + db 'Not_enough_memory',0 +;--------------------------------------------------------------------- +error_unknown: + db 'Unknown error',0 +;--------------------------------------------------------------------- +extended_key db 0 +no_draw_window db 0 + +shift_flag db 0 +ctrl_flag db 0 +alt_flag db 0 +;--------------------------------------------------------------------- +; for EDITBOX +align 4 +name_editboxes: +edit1 edit_box 200,10,30,0xffffff,0xbbddff,0,0,0,255,string,mouse_dd,ed_focus+ed_always_focus,0 +name_editboxes_end: + +;mouse_flag: dd 0x0 + +mouse_dd rd 1 +;--------------------------------------------------------------------- +align 4 +; option_boxes_bcgr: +op1 option_box option_group1,60,40,6,12,0xFFFFFF,0,0xffffff,op_text.1,op_text.e1-op_text.1 +op2 option_box option_group1,60,55,6,12,0xFFFFFF,0,0xffffff,op_text.2,op_text.e2-op_text.2 +option_boxes_bcgr_end: + +op_text: +.1 db 'Tiled' +.e1: +.2 db 'Stretch' +.e2: + +option_group1 dd op1 + +option_boxes_bcgr: dd op1, op2,0 +;--------------------------------------------------------------------- +align 4 +;option_boxes_sort: +sort0 option_box option_group2,60,40,6,12,0xFFFFFF,0,0xffffff,op_text_1.1,op_text_1.e1-op_text_1.1 +sort2 option_box option_group2,60,55,6,12,0xFFFFFF,0,0xffffff,op_text_1.2,op_text_1.e2-op_text_1.2 +sort4 option_box option_group2,60,70,6,12,0xFFFFFF,0,0xffffff,op_text_1.3,op_text_1.e3-op_text_1.3 +sort6 option_box option_group2,60,85,6,12,0xFFFFFF,0,0xffffff,op_text_1.4,op_text_1.e4-op_text_1.4 +option_boxes_sort_end: + +op_text_1: +.1 db 'Name' +.e1: +.2 db 'Type' +.e2: +.3 db 'Date' +.e3: +.4 db 'Size' +.e4: + +option_group2 dd sort2 +option_group2_old dd 0 + +option_boxes_sort dd sort0, sort2, sort4, sort6,0 +;--------------------------------------------------------------------- +check1 check_box 120,50,6,12,0xFFFFFF,0,0xffffff,check_text1,14,0 ;ch_flag_en + +check_text1 db 'Show file name' + +show_file_name_old dd 0 +;--------------------------------------------------------------------- +check2 check_box 120,70,6,12,0xFFFFFF,0,0xffffff,check_text2,14,0 ;ch_flag_en + +check_text2 db 'Bilinear filtering' + +filtering_flag dd 0 +filtering_flag_old dd 0 +;--------------------------------------------------------------------- +align 4 +scroll_bar_data_vertical: +.x: +.size_x dw 15 ;+0 +.start_x dw 500 ;+2 +.y: +.size_y dw 300 ;+4 +.start_y dw 30 ;+6 +.btn_high dd 15 ;+8 +.type dd 1 ;+12 +.max_area dd 10 ;+16 +.cur_area dd 2 ;+20 +.position dd 0 ;+24 +.bckg_col dd 0xeeeeee ;+28 +.frnt_col dd 0x8aeaa0 ;0xbbddff ;+32 +.line_col dd 0 ;+36 +.redraw dd 0 ;+40 +.delta dw 0 ;+44 +.delta2 dw 0 ;+46 +.run_x: +.r_size_x dw 0 ;+48 +.r_start_x dw 0 ;+50 +.run_y: +.r_size_y dw 0 ;+52 +.r_start_y dw 0 ;+54 +.m_pos dd 0 ;+56 +.m_pos_2 dd 0 ;+60 +.m_keys dd 0 ;+64 +.run_size dd 0 ;+68 +.position2 dd 0 ;+72 +.work_size dd 0 ;+76 +.all_redraw dd 0 ;+80 +.ar_offset dd 10 ;+84 +;--------------------------------------------------------------------- +align 4 +scroll_bar_data_horizontal: +.x: +.size_x dw 300 ;0 ;+0 +.start_x dw 10 ;0 ;+2 +.y: +.size_y dw 15 ;0 ;+4 +.start_y dw 300 ;0 ;+6 +.btn_high dd 15 ;+8 +.type dd 1 ;+12 +.max_area dd 10 ;+16 +.cur_area dd 2 ;+20 +.position dd 0 ;+24 +.bckg_col dd 0xeeeeee ;+28 +.frnt_col dd 0x8aeaa0 ;0xbbddff ;+32 +.line_col dd 0 ;+36 +.redraw dd 0 ;+40 +.delta dw 0 ;+44 +.delta2 dw 0 ;+46 +.run_x: +.r_size_x dw 0 ;+48 +.r_start_x dw 0 ;+50 +.run_y: +.r_size_y dw 0 ;+52 +.r_start_y dw 0 ;+54 +.m_pos dd 0 ;+56 +.m_pos_2 dd 0 ;+60 +.m_keys dd 0 ;+64 +.run_size dd 0 ;+68 +.position2 dd 0 ;+72 +.work_size dd 0 ;+76 +.all_redraw dd 0 ;+80 +.ar_offset dd 10 ;+84 +;--------------------------------------------------------------------- +align 4 +menu_data_1: +.type: dd 0 ;+0 +.x: +.size_x dw 35 ;+4 +.start_x dw 5 ;+6 +.y: +.size_y dw 15 ;+8 +.start_y dw 3 ;+10 +.text_pointer: dd menu_text_area_1 ;0 ;+12 +.pos_pointer: dd menu_text_area_1.1 ;0 ;+16 +.text_end dd menu_text_area_1.end ;0 ;+20 +.ret_key dd 0 ;+24 +.mouse_keys dd 0 ;+28 +.x1: +.size_x1 dw 70 ;+32 +.start_x1 dw 5 ;+34 +.y1: +.size_y1 dw 100 ;+36 +.start_y1 dw 18 ;+38 +.bckg_col dd 0xe5e5e5 ;+40 +.frnt_col dd 0xff ;+44 +.menu_col dd 0xeef0ff ;0xffffff ;+48 +.select dd 0 ;+52 +.out_select dd 0 ;+56 +.buf_adress dd 0 ;+60 +.procinfo dd 0 ;+64 +.click dd 0 ;+68 +.cursor dd 0 ;+72 +.cursor_old dd 0 ;+76 +.interval dd 16 ;+80 +.cursor_max dd 0 ;+84 +.extended_key dd 0 ;+88 +.menu_sel_col dd 0x00cc00 ;+92 +.bckg_text_col dd 0 ; +96 +.frnt_text_col dd 0xffffff ;+100 +.mouse_keys_old dd 0 ;+104 +.font_height dd 8 ;+108 +.cursor_out dd 0 ;+112 +.get_mouse_flag dd 0 ;+116 +;--------------------------------------------------------------------- +menu_text_area_1: +db 'File',0 +.1: +db 'Open',0 +db 'Properties',0 +db 'Exit',0 +.end: +db 0 +;--------------------------------------------------------------------- +align 4 +menu_data_2: +.type: dd 0 ;+0 +.x: +.size_x dw 35 ;+4 +.start_x dw 40 ;+6 +.y: +.size_y dw 15 ;+8 +.start_y dw 3 ;+10 +.text_pointer: dd menu_text_area_2 ;0 ;+12 +.pos_pointer: dd menu_text_area_2.1 ;0 ;+16 +.text_end dd menu_text_area_2.end ;0 ;+20 +.ret_key dd 0 ;+24 +.mouse_keys dd 0 ;+28 +.x1: +.size_x1 dw 90 ;+32 +.start_x1 dw 40 ;+34 +.y1: +.size_y1 dw 100 ;+36 +.start_y1 dw 18 ;+38 +.bckg_col dd 0xe5e5e5 ;+40 +.frnt_col dd 0xff ;+44 +.menu_col dd 0xeef0ff ;0xffffff ;+48 +.select dd 0 ;+52 +.out_select dd 0 ;+56 +.buf_adress dd 0 ;+60 +.procinfo dd 0 ;+64 +.click dd 0 ;+68 +.cursor dd 0 ;+72 +.cursor_old dd 0 ;+76 +.interval dd 16 ;+80 +.cursor_max dd 0 ;+84 +.extended_key dd 0 ;+88 +.menu_sel_col dd 0x00cc00 ;+92 +.bckg_text_col dd 0 ; +96 +.frnt_text_col dd 0xffffff ;+100 +.mouse_keys_old dd 0 ;+104 +.font_height dd 8 ;+108 +.cursor_out dd 0 ;+112 +.get_mouse_flag dd 0 ;+116 +;--------------------------------------------------------------------- +menu_text_area_2: +db 'Edit',0 +.1: +db 'Rotate Clock.',0 +db 'Rotate CClock.',0 +db 'Invert L to R',0 +db 'Invert U to D',0 +.end: +db 0 +;--------------------------------------------------------------------- +align 4 +menu_data_3: +.type: dd 0 ;+0 +.x: +.size_x dw 35 ;+4 +.start_x dw 75 ;+6 +.y: +.size_y dw 15 ;+8 +.start_y dw 3 ;+10 +.text_pointer: dd menu_text_area_3 ;0 ;+12 +.pos_pointer: dd menu_text_area_3.1 ;0 ;+16 +.text_end dd menu_text_area_3.end ;0 ;+20 +.ret_key dd 0 ;+24 +.mouse_keys dd 0 ;+28 +.x1: +.size_x1 dw 90 ;+32 +.start_x1 dw 75 ;+34 +.y1: +.size_y1 dw 100 ;+36 +.start_y1 dw 18 ;+38 +.bckg_col dd 0xe5e5e5 ;+40 +.frnt_col dd 0xff ;+44 +.menu_col dd 0xeef0ff ;0xffffff ;+48 +.select dd 0 ;+52 +.out_select dd 0 ;+56 +.buf_adress dd 0 ;+60 +.procinfo dd 0 ;+64 +.click dd 0 ;+68 +.cursor dd 0 ;+72 +.cursor_old dd 0 ;+76 +.interval dd 16 ;+80 +.cursor_max dd 0 ;+84 +.extended_key dd 0 ;+88 +.menu_sel_col dd 0x00cc00 ;+92 +.bckg_text_col dd 0 ; +96 +.frnt_text_col dd 0xffffff ;+100 +.mouse_keys_old dd 0 ;+104 +.font_height dd 8 ;+108 +.cursor_out dd 0 ;+112 +.get_mouse_flag dd 0 ;+116 +;--------------------------------------------------------------------- +menu_text_area_3: +db 'View',0 +.1: +db 'Sort Directory',0 +db 'Full Screen',0 +db 'Reload',0 +.end: +db 0 +;--------------------------------------------------------------------- +align 4 +menu_data_4: +.type: dd 0 ;+0 +.x: +.size_x dw 35 ;+4 +.start_x dw 110 ;+6 +.y: +.size_y dw 15 ;+8 +.start_y dw 3 ;+10 +.text_pointer: dd menu_text_area_4 ;0 ;+12 +.pos_pointer: dd menu_text_area_4.1 ;0 ;+16 +.text_end dd menu_text_area_4.end ;0 ;+20 +.ret_key dd 0 ;+24 +.mouse_keys dd 0 ;+28 +.x1: +.size_x1 dw 40 ;+32 +.start_x1 dw 110 ;+34 +.y1: +.size_y1 dw 100 ;+36 +.start_y1 dw 18 ;+38 +.bckg_col dd 0xe5e5e5 ;+40 +.frnt_col dd 0xff ;+44 +.menu_col dd 0xeef0ff ;0xffffff ;+48 +.select dd 0 ;+52 +.out_select dd 0 ;+56 +.buf_adress dd 0 ;+60 +.procinfo dd 0 ;+64 +.click dd 0 ;+68 +.cursor dd 0 ;+72 +.cursor_old dd 0 ;+76 +.interval dd 16 ;+80 +.cursor_max dd 0 ;+84 +.extended_key dd 0 ;+88 +.menu_sel_col dd 0x00cc00 ;+92 +.bckg_text_col dd 0 ; +96 +.frnt_text_col dd 0xffffff ;+100 +.mouse_keys_old dd 0 ;+104 +.font_height dd 8 ;+108 +.cursor_out dd 0 ;+112 +.get_mouse_flag dd 0 ;+116 +;--------------------------------------------------------------------- +menu_text_area_4: +db 'Zoom',0 +.1: +db 'Normal',0 +db 'More',0 +db 'Less',0 +db 'Auto',0 +.end: +db 0 +;--------------------------------------------------------------------- +align 4 +menu_data_5: +.type: dd 0 ;+0 +.x: +.size_x dw 40 ;+4 +.start_x dw 145 ;+6 +.y: +.size_y dw 15 ;+8 +.start_y dw 3 ;+10 +.text_pointer: dd menu_text_area_5 ;0 ;+12 +.pos_pointer: dd menu_text_area_5.1 ;0 ;+16 +.text_end dd menu_text_area_5.end ;0 ;+20 +.ret_key dd 0 ;+24 +.mouse_keys dd 0 ;+28 +.x1: +.size_x1 dw 80 ;+32 +.start_x1 dw 145 ;+34 +.y1: +.size_y1 dw 100 ;+36 +.start_y1 dw 18 ;+38 +.bckg_col dd 0xe5e5e5 ;+40 +.frnt_col dd 0xff ;+44 +.menu_col dd 0xeef0ff ;0xffffff ;+48 +.select dd 0 ;+52 +.out_select dd 0 ;+56 +.buf_adress dd 0 ;+60 +.procinfo dd 0 ;+64 +.click dd 0 ;+68 +.cursor dd 0 ;+72 +.cursor_old dd 0 ;+76 +.interval dd 16 ;+80 +.cursor_max dd 0 ;+84 +.extended_key dd 0 ;+88 +.menu_sel_col dd 0x00cc00 ;+92 +.bckg_text_col dd 0 ; +96 +.frnt_text_col dd 0xffffff ;+100 +.mouse_keys_old dd 0 ;+104 +.font_height dd 8 ;+108 +.cursor_out dd 0 ;+112 +.get_mouse_flag dd 0 ;+116 +;--------------------------------------------------------------------- +menu_text_area_5: +db 'Tools',0 +.1: +db 'Image Editor',0 +db 'Wallpaper',0 +db 'Slide Show',0 +db 'Options',0 +.end: +db 0 +;--------------------------------------------------------------------- +align 4 +menu_data_6: +.type: dd 0 ;+0 +.x: +.size_x dw 35 ;+4 +.start_x dw 185 ;+6 +.y: +.size_y dw 15 ;+8 +.start_y dw 3 ;+10 +.text_pointer: dd menu_text_area_6 ;0 ;+12 +.pos_pointer: dd menu_text_area_6.1 ;0 ;+16 +.text_end dd menu_text_area_6.end ;0 ;+20 +.ret_key dd 0 ;+24 +.mouse_keys dd 0 ;+28 +.x1: +.size_x1 dw 50 ;+32 +.start_x1 dw 185 ;+34 +.y1: +.size_y1 dw 100 ;+36 +.start_y1 dw 18 ;+38 +.bckg_col dd 0xe5e5e5 ;+40 +.frnt_col dd 0xff ;+44 +.menu_col dd 0xeef0ff ;0xffffff ;+48 +.select dd 0 ;+52 +.out_select dd 0 ;+56 +.buf_adress dd 0 ;+60 +.procinfo dd 0 ;+64 +.click dd 0 ;+68 +.cursor dd 0 ;+72 +.cursor_old dd 0 ;+76 +.interval dd 16 ;+80 +.cursor_max dd 0 ;+84 +.extended_key dd 0 ;+88 +.menu_sel_col dd 0x00cc00 ;+92 +.bckg_text_col dd 0 ; +96 +.frnt_text_col dd 0xffffff ;+100 +.mouse_keys_old dd 0 ;+104 +.font_height dd 8 ;+108 +.cursor_out dd 0 ;+112 +.get_mouse_flag dd 0 ;+116 +;--------------------------------------------------------------------- +menu_text_area_6: +db 'Help',0 +.1: +db 'Help',0 +db 'About',0 +.end: +db 0 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_1: ; open file +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 230 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_2: ; reload file +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 255 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_3: ; left limit +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 285 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_4: ; left arrow +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 310 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_5: ; slide show +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 335 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_6: ; right arrow +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 360 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_7: ; right limit +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 385 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_8: ; zoom + +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 415 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_9: ; zoom - +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 440 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_10: ; zoom 100% +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 465 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_11: ; rotate clockwise +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 495 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_12: ; rotate counter-clockwise +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 520 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_13: ; file information +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 550 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_14: ; wallpaper +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 575 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dinamic_button_data_15: ; settings +.type dd 0 ;+0 +.x: +.size_x dw 20 ;+4 +.start_x dw 600 ;+6 +.y: +.size_y dw 20 ;+8 +.start_y dw 3 ;+10 +.mouse_pos dd 0 ;+12 +.mouse_keys dd 0 ;+16 +.mouse_keys_old dd 0 ;+20 +.active_raw dd 0 ;+24 +.passive_raw dd 0 ;+28 +.click_raw dd 0 ;+32 +.resolution_raw dd 0 ;+36 +.palette_raw dd 0 ;+40 +.offset_raw dd 0 ;+44 +.select dd 0 ;+48 +.click dd 0 ;+52 +;--------------------------------------------------------------------- +align 4 +dirinfo: +.subfunction dd 1 +.start dd 0 +.flags dd 0 +.size dd 0 +.return dd procinfo + db 0 +.name: dd plugin_pach +;--------------------------------------------------------------------- +align 4 +fileinfo: +.subfunction dd 5 +.Offset dd 0 +.Offset_1 dd 0 +.size dd 0 +.return dd process_info + db 0 +.name: dd string +;--------------------------------------------------------------------- +align 4 +start_appl: +.subfunction dd 7 +.flags dd 0 +.parameter dd library_path +.reserved1 dd 0 +.reserved2 dd 0 + db 0 +.name: dd Help_path +;--------------------------------------------------------------------- +align 4 +dir_header: +.version dd 0 ;+0 +.curn_blocks dd 0 ;+4 +.totl_blocks dd 0 ;+8 +.other rb 20 +;--------------------------------------------------------------------- +OpenDialog_data: +.type dd 0 +.procinfo dd procinfo ;+4 +.com_area_name dd communication_area_name ;+8 +.com_area dd 0 ;+12 +.opendir_pach dd plugin_pach ;+16 +.dir_default_pach dd communication_area_default_pach ;+20 +.start_path dd library_path ;+24 +.draw_window dd draw_window ;+28 +.status dd 0 ;+32 +.openfile_pach dd string ;+36 +.filename_area dd 0 ;+40 +.filter_area dd Filter +.x: +.x_size dw 420 ;+48 ; Window X size +.x_start dw 10 ;+50 ; Window X position +.y: +.y_size dw 320 ;+52 ; Window y size +.y_start dw 10 ;+54 ; Window Y position + +communication_area_name: + db 'FFFFFFFF_open_dialog',0 +open_dialog_name: + db 'opendial',0 +communication_area_default_pach: + db '/rd/1',0 +;communication_area dd 0 +;--------------------------------------------------------------------- +; clear bacground thread +clear_thread_stack: + dd 0 +;---------------------- +; window option +thread_stack_7: + dd 0 +;---------------------- +; window error message +thread_stack_6: + dd 0 +;---------------------- +; window set sort mode +thread_stack_5: + dd 0 +;---------------------- +; window background +thread_stack_4: + dd 0 +;---------------------- +; window about +thread_stack_3: + dd 0 +;---------------------- +; file info +thread_stack_2: + dd 0 +;---------------------- +; file open +thread_stack: + dd 0 +;--------------------------------------------------------------------- +;size_before_open_dir: +; dd 0 +;size_before_open_file: +; dd 0 +;size_after_open_file: +; dd 0 +;size_after_convert: +; dd 0 +;size_after_convert_2: +; dd 0 +;size_before_draw_image: +; dd 0 +;size_after_draw_image: +; dd 0 +;size_before_scaling: +; dd 0 +;size_after_scaling: +; dd 0 \ No newline at end of file diff --git a/programs/media/zsea/dll.inc b/programs/media/zsea/dll.inc new file mode 100644 index 0000000000..aceef7ac97 --- /dev/null +++ b/programs/media/zsea/dll.inc @@ -0,0 +1,144 @@ +;----------------------------------------------------------------------------- +proc dll.Load, import_table:dword + mov esi,[import_table] +.next_lib: + mov edx,[esi] + or edx,edx + jz .exit + push esi + mov esi,[esi+4] + mov edi,s_libdir.fname +@@: + lodsb + stosb + or al,al + jnz @b + mcall 68,19,s_libdir + or eax,eax + jz .fail + stdcall dll.Link,eax,edx + stdcall dll.Init,[eax+4] + pop esi + add esi,8 + jmp .next_lib +.exit: + xor eax,eax + ret +.fail: + add esp,4 + xor eax,eax + inc eax + ret +endp +;----------------------------------------------------------------------------- +proc dll.Link, exp:dword,imp:dword + push eax + mov esi,[imp] + test esi,esi + jz .done +.next: + lodsd + test eax,eax + jz .done + stdcall dll.GetProcAddress,[exp],eax + or eax,eax + jz @f + mov [esi-4],eax + jmp .next +@@: + mov dword[esp],0 +.done: + pop eax + ret +endp +;----------------------------------------------------------------------------- +proc dll.Init, dllentry:dword + pushad + mov eax,mem.Alloc ;libini_alloc + mov ebx,mem.Free ;libini_free + mov ecx,mem.ReAlloc ;libini_realloc + mov edx,dll.Load + stdcall [dllentry] + popad + ret +endp +;----------------------------------------------------------------------------- +proc dll.GetProcAddress, exp:dword,sz_name:dword + mov edx,[exp] + xor eax,eax +.next: + or edx,edx + jz .end + cmp dword[edx],0 + jz .end + stdcall strcmp,[edx],[sz_name] + test eax,eax + jz .ok + add edx,8 + jmp .next +.ok: + mov eax,[edx+4] + .end: + ret +endp +;----------------------------------------------------------------------------- +proc strcmp, str1:dword,str2:dword + push esi edi + mov esi,[str1] + mov edi,[str2] + xor eax,eax +@@: + lodsb + scasb + jne .fail + or al,al + jnz @b + jmp .ok +.fail: + or eax,-1 +.ok: + pop edi esi + ret +endp +;----------------------------------------------------------------------------- +s_libdir: + db '/sys/lib/' + .fname rb 32 +;----------------------------------------------------------------------------- +proc mem.Alloc,size + push ebx ecx + mov ecx,[size] + mcall 68,12 + pop ecx ebx + ret +endp +;----------------------------------------------------------------------------- +proc mem.ReAlloc,mptr,size + push ebx ecx edx + mov ecx,[size] + or ecx,ecx + jz @f +@@: + mov edx,[mptr] + or edx,edx + jz @f +@@: + mcall 68,20 + or eax,eax + jz @f +@@: + pop edx ecx ebx + ret +endp +;----------------------------------------------------------------------------- +proc mem.Free,mptr + push ebx ecx + mov ecx,[mptr] + or ecx,ecx + jz @f +@@: + mcall 68,13 + pop ecx ebx + ret +endp +;----------------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/draw_img.inc b/programs/media/zsea/draw_img.inc new file mode 100644 index 0000000000..4ae74a069a --- /dev/null +++ b/programs/media/zsea/draw_img.inc @@ -0,0 +1,469 @@ +;;**************************************************************************** +;**************************************************************************** +; Draw output part of the image and SCROLLBAR's +;**************************************************************************** +;**************************************************************************** + drawimage: + + + call get_window_param + ;mov edx,5*65536+50 + mov edx,0*65536+28 + mov esi,[img_resolution] ;24 + cmp esi,32 + ja .exit_error ;.exit + mov edi,[img_palette] +;**************************************************************************** +; Calculation of sizes of an output part of the image +;**************************************************************************** + xor eax,eax + mov [draw_SB],al + mov [draw_SB1],al + mov eax,[window_width] +; sub eax,9 + mov [wa_width],ax + mov [wa_width_1],ax + mov [wa_width_2],ax + mov ebx,[img_width] + test ebx,ebx + jz .exit_error ;.exit + cmp ax,bx + jae @f + sub ax,[scroll_bar_data_vertical.size_x] + mov [draw_SB],1 + jmp .size_y +@@: + mov ax,bx + + +.size_y: + mov ebx,[img_high] + test ebx,ebx + jz .exit_error ;.exit + shl eax,16 + add eax,[window_high] + cmp ax,50-22 + jbe @f + sub ax,50-22 +@@: + mov [wa_high],ax + mov [wa_high_1],ax + mov [wa_high_2],ax + cmp ax,bx + jae @f + sub ax,[scroll_bar_data_horizontal.size_y] + mov [draw_SB1],1 + jmp .continue +@@: + mov ax,bx +.continue: + mov ecx,eax +;**************************************************************************** +; +;**************************************************************************** + cmp [draw_SB1],1 + je @f + cmp [draw_SB],0 + je @f + ror ecx,16 + add cx,[scroll_bar_data_vertical.size_x] + rol ecx,16 +@@: + cmp [draw_SB],1 + je @f + cmp [draw_SB1],0 + je @f + add cx,[scroll_bar_data_horizontal.size_y] +@@: +; call check_8bit_less +;.continue_1: +;**************************************************************************** +; Prepare of data for SCROLLBAR's +;**************************************************************************** + call correct_cur_area + + mov eax,[img_width] + push edx + imul eax,[scaling_mode] + mov ebx,100 + xor edx,edx + div ebx + mov [scroll_bar_data_horizontal.max_area],eax + pop edx + + + mov ebx,[img_high] + push eax edx + mov eax,ebx + imul eax,[scaling_mode] + mov ebx,100 + xor edx,edx + div ebx + mov ebx,eax + pop edx eax + mov [scroll_bar_data_vertical.max_area],ebx + +; cmp [scaling_mode],100 +; jne .continue_1 + + call correct_width + call correct_cur_area + + cmp [correct_w],0 + je @f + + call correct_high + call correct_cur_area + jmp .continue_1 + +@@: + call correct_high + call correct_cur_area + + cmp [correct_h],0 + je @f + + call correct_width + call correct_cur_area +@@: + +; call check_8bit_less + +.continue_1: +; mov eax,[window_high] +; sub eax,55 +; ror eax,16 +; mov ax,dx +; rol eax,16 + mov eax,edx + shl eax,16 + mov ax,cx + mov [scroll_bar_data_vertical.y],eax + +; mov eax,[window_width] +; sub eax,10 +; ror eax,16 +; ror edx,16 +; mov ax,dx +; rol edx,16 +; rol eax,16 + mov eax,edx + mov ebx,ecx + shr ebx,16 + mov ax,bx + mov [scroll_bar_data_horizontal.x],eax + + +; mov eax,edx +; mov ebx,ecx +; shr ebx,16 +; shr eax,16 +; add ax,bx + mov eax,[window_width] + sub ax,[scroll_bar_data_vertical.size_x] +; sub ax,4 + mov [scroll_bar_data_vertical.start_x],ax + +; mov eax,edx +; add ax,cx + mov eax,[window_high] + sub ax,[scroll_bar_data_horizontal.size_y] +; sub ax,4 + mov [scroll_bar_data_horizontal.start_y],ax + +;**************************************************************************** +; Check necessity prepare of data +;**************************************************************************** + mov eax,[scroll_bar_data_horizontal.max_area] + mov ebx,[scroll_bar_data_vertical.max_area] + cmp ebx,[scroll_bar_data_vertical.cur_area] + ja @f + cmp eax,[scroll_bar_data_horizontal.cur_area] + ja @f + + mov ebp,0 + mov ebx,[soi] + jmp .end +@@: +;**************************************************************************** +; Calculate offset of next row data relative to previous row data +;**************************************************************************** + mov ebp,eax + mov ebx,ecx + shr ebx,16 + sub ebp,ebx + imul ebp,esi + mov eax,ebp + shr ebp,3 +;**************************************************************************** +; Vertical SCROLLBAR +; At a case of resizing of the window +; Check the position of a runner has crossed a limit +;**************************************************************************** + mov eax,[scroll_bar_data_vertical.max_area] + sub eax,[scroll_bar_data_vertical.cur_area] + cmp eax,[scroll_bar_data_vertical.position] + jae @f + mov [scroll_bar_data_vertical.position],eax +@@: +;**************************************************************************** +; Horizontal SCROLLBAR +; At a case of resizing of the window +; Check the position of a runner has crossed a limit +;**************************************************************************** + mov eax,[scroll_bar_data_horizontal.max_area] + sub eax,[scroll_bar_data_horizontal.cur_area] + cmp eax,[scroll_bar_data_horizontal.position] + jae @f + mov [scroll_bar_data_horizontal.position],eax +@@: +;**************************************************************************** +; Calculate offset from a beginning of a image +;**************************************************************************** + mov ebx,[scroll_bar_data_horizontal.max_area] + imul ebx,esi + mov eax,ebx + shr ebx,3 + imul ebx,[scroll_bar_data_vertical.position] + mov eax,[scroll_bar_data_horizontal.position] + imul eax,esi + shr eax,3 + add ebx,eax + add ebx,[soi] +.end: + cmp [soi],0 + je .exit_error ;.exit +;**************************************************************************** +; Draw image +;**************************************************************************** + cmp [img_resolution_2],15 + jne @f + mov esi,15 +@@: + mov [image_start_coordinates],edx + mov [image_draw_size],ecx + cmp [scaling_mode],dword 100 + je .100 + cmp [scaling_mode],dword 0 + jne @f + call scaling.1 + ret +@@: + mov [correct_scrollbar_100_flag],0 + call zoom_all + ret +.100: + mov al,[correct_scrollbar_100_flag] + test al,al + jnz @r +;****************************** + mov eax,wa_width_1 + mov eax,[eax] + push eax + mov eax,wa_high_1 + mov eax,[eax] + push eax +;****************************** + rol ecx,16 + mov eax,[scroll_bar_data_vertical.max_area] + cmp eax,[scroll_bar_data_vertical.cur_area] + mov ax,[wa_width_1] + jbe @f + sub ax,[scroll_bar_data_vertical.size_x] + mov [wa_width_1],ax +@@: + sub ax,cx + mov [wa_width_2],cx + ror ecx,16 + shr ax,1 + shl eax,16 + add edx,eax + shr eax,16 + test eax,eax + jz @f + call scaling.fill_for_L_R +@@: + mov eax,[scroll_bar_data_horizontal.max_area] + cmp eax,[scroll_bar_data_horizontal.cur_area] + mov ax,[wa_high_1] + jbe @f + sub ax,[scroll_bar_data_horizontal.size_y] + mov [wa_high_1],ax +@@: + sub ax,cx + mov [wa_high_2],cx + shr ax,1 + add edx,eax + test eax,eax + jz @f + call scaling.fill_for_U_D +@@: +;****************************** + mcall 65, ;[soi] +;****************************** + pop eax + mov ebx,wa_high_1 + mov [ebx],eax + + pop eax + mov ebx,wa_width_1 + mov [ebx],eax +;****************************** +.exit: + call draw_file_name_to_work_area + ret + +.exit_error: + xor eax,eax + mov [scroll_bar_data_vertical.cur_area],eax + mov [scroll_bar_data_horizontal.cur_area],eax + ret +;**************************************************************************** +draw_file_name_to_work_area: + mov eax,[check1+32] + test eax,10b + jz @f + mov ebx,[file_name_length] + mov eax,ebx + lea ebx,[ebx*5] + add ebx,eax + add ebx,13 shl 16 + mcall 13,,<59,11>,0xe5e5e5 + mcall 4,<16,60>,0x80000000,file_name,,0xe5e5e5 +@@: + ret +;**************************************************************************** +;check_8bit_less: +; cmp esi,8 +; jae .no_8bit_less +; mov eax,ecx +; ror eax,16 +;; mov ebx,eax +; xor ecx,ecx +; +; inc ecx +; shr ax,1 +; +; cmp esi,4 +; je @f +; +; inc ecx +; shr ax,1 +; +; cmp esi,2 +; je @f +; +; inc ecx +; shr ax,1 +;@@: +;; test ebx,ecx +;; jz @f +;; inc eax +;;@@: +; shl ax,cl +; rol eax,16 +; mov ecx,eax +;.no_8bit_less: +; ret +;**************************************************************************** +correct_width: + mov [correct_w],0 + mov ebx,[scroll_bar_data_vertical.max_area] + cmp ebx,[scroll_bar_data_vertical.cur_area] + jbe @f + mov eax,ecx + shr eax,16 + push eax + mov ax,[scroll_bar_data_vertical.size_x] + sub [wa_width],ax + pop eax + cmp [wa_width],ax + jae @f + ror ecx,16 + mov cx,[wa_width] + rol ecx,16 + mov [correct_w],1 +@@: + ret +;**************************************************************************** +correct_high: + mov [correct_h],0 + mov eax,[scroll_bar_data_horizontal.max_area] + cmp eax,[scroll_bar_data_horizontal.cur_area] + jbe @f + push eax + mov ax,[scroll_bar_data_horizontal.size_y] + sub [wa_high],ax + pop eax + cmp [wa_high],cx + jae @f + mov cx,[wa_high] + mov [correct_h],1 +@@: + ret +;**************************************************************************** +correct_cur_area: + mov eax,ecx + xor ebx,ebx + mov bx,ax + mov [scroll_bar_data_vertical.cur_area],ebx + shr eax,16 + mov [scroll_bar_data_horizontal.cur_area],eax + ret +;**************************************************************************** +; Check draw vertical scrollbar +;**************************************************************************** +draw_scrollbars: + xor eax,eax + mov [draw_scrollbar_counter],eax + mov eax,[scroll_bar_data_vertical.max_area] + cmp eax,[scroll_bar_data_vertical.cur_area] + jbe @f + cmp [scroll_bar_data_vertical.cur_area],0 + je @f + push dword scroll_bar_data_vertical + call [scrollbar_ver_draw] +; draw_scroll_bar_vertical scroll_bar_data_vertical + inc [draw_scrollbar_counter] +@@: +;**************************************************************************** +; Check draw horizontal scrollbar +;**************************************************************************** + mov eax,[scroll_bar_data_horizontal.max_area] + cmp eax,[scroll_bar_data_horizontal.cur_area] + jbe @f + cmp [scroll_bar_data_horizontal.cur_area],0 + je @f + push dword scroll_bar_data_horizontal + call [scrollbar_hor_draw] +; draw_scroll_bar_horizontal scroll_bar_data_horizontal + inc [draw_scrollbar_counter] +@@: +; nodrawimage: + cmp [draw_scrollbar_counter],2 + jne @f + mov ebx,[scroll_bar_data_vertical.x] + mov ecx,[scroll_bar_data_horizontal.y] + mcall 13, , ,0xffffff +@@: + ret +;**************************************************************************** +;debug_1: +; pushad +; mov eax,ecx +; shr eax,16 +; mov ebx,ecx +; shl ebx,16 +; shr ebx,16 +; mov eax,[image_file] +; mov ebx,edi +; mov [temp_eax],eax +; mov [temp_ebx],ebx +; mcall 13,<90,500>,<2,20>,0 +; mcall 47,0xa0000,[temp_eax],<100, 5>,0xffffff +; mcall 47,0xa0000,[temp_ebx],<300, 5>,0xffffff +; popad +; ret +;temp_eax dd 0 +;temp_ebx dd 0 +;**************************************************************************** \ No newline at end of file diff --git a/programs/media/zsea/draw_win.inc b/programs/media/zsea/draw_win.inc new file mode 100644 index 0000000000..d95d6ea2fb --- /dev/null +++ b/programs/media/zsea/draw_win.inc @@ -0,0 +1,248 @@ + +; ********************************************* +; ******* WINDOW DEFINITIONS AND DRAW ******** +; ********************************************* + + +draw_window: + + or [bWasDraw],1 + + mcall 12,1 + + ; DRAW WINDOW + xor eax,eax ; function 0 : define and draw window +; mov ebx,350 ; [x start] *65536 + [x size] +; mov ecx,400 ; [y start] *65536 + [y size] + mov ebx,0*65536+0 + mov ecx,0*65536+0 + add ebx,[wnd_width] + add ecx,[wnd_height] + cmp cx,55 + ja @f + mov cx,55 +@@: + mov edx,0x63ffffff ; color of work area RRGGBB,8->color gl +; pusha + xor esi,esi + mcall +; popa +; imul ecx,[load_file_number],304 +; add ecx,32+40 +; add ecx,[load_directory_pointer] + mov ecx,Authors_text.1 ; communication_area_name +; mov ecx,[communication_area] +; add ecx,4 +; mov ecx,string + mcall 71,1, ;labelt ; plugin_pach ;file_name ;plugin_pach ;plugin_pach + + call get_window_param + + call draw_other + + + push dword menu_data_1 + call [menu_bar_draw] + push dword menu_data_2 + call [menu_bar_draw] + push dword menu_data_3 + call [menu_bar_draw] + push dword menu_data_4 + call [menu_bar_draw] + push dword menu_data_5 + call [menu_bar_draw] + push dword menu_data_6 + call [menu_bar_draw] + +; draw_menu_bar menu_data_1 +; draw_menu_bar menu_data_2 +; draw_menu_bar menu_data_3 +; draw_menu_bar menu_data_4 +; draw_menu_bar menu_data_5 +; draw_menu_bar menu_data_6 + + push dword dinamic_button_data_1 + call [dinamic_button_draw] + push dword dinamic_button_data_2 + call [dinamic_button_draw] + push dword dinamic_button_data_3 + call [dinamic_button_draw] + push dword dinamic_button_data_4 + call [dinamic_button_draw] + push dword dinamic_button_data_5 + call [dinamic_button_draw] + push dword dinamic_button_data_6 + call [dinamic_button_draw] + push dword dinamic_button_data_7 + call [dinamic_button_draw] + push dword dinamic_button_data_8 + call [dinamic_button_draw] + push dword dinamic_button_data_9 + call [dinamic_button_draw] + push dword dinamic_button_data_10 + call [dinamic_button_draw] + push dword dinamic_button_data_11 + call [dinamic_button_draw] + push dword dinamic_button_data_12 + call [dinamic_button_draw] + push dword dinamic_button_data_13 + call [dinamic_button_draw] + push dword dinamic_button_data_14 + call [dinamic_button_draw] + push dword dinamic_button_data_15 + call [dinamic_button_draw] + +; draw_dinamic_button dinamic_button_data_1 ; open file +; draw_dinamic_button dinamic_button_data_2 ; reload file +; draw_dinamic_button dinamic_button_data_3 ; left limit +; draw_dinamic_button dinamic_button_data_4 ; left arrow +; draw_dinamic_button dinamic_button_data_5 ; slide show +; draw_dinamic_button dinamic_button_data_6 ; right arrow +; draw_dinamic_button dinamic_button_data_7 ; right limit +; draw_dinamic_button dinamic_button_data_8 ; zoom + +; draw_dinamic_button dinamic_button_data_9 ; zoom - +; draw_dinamic_button dinamic_button_data_10 ; zoom 100% +; draw_dinamic_button dinamic_button_data_11 ; rotate clockwise +; draw_dinamic_button dinamic_button_data_12 ; rotate counter-clockwise +; draw_dinamic_button dinamic_button_data_13 ; file information +; draw_dinamic_button dinamic_button_data_14 ; wallpaper +; draw_dinamic_button dinamic_button_data_15 ; settings + + mcall 13,<225,2>,<3,22>,0 + mcall ,<280,2> + mcall ,<410,2> + mcall ,<490,2> + mcall ,<545,2> + mcall ,<625,2> + mcall ,<720,2> + ; WINDOW LABEL + +; mov esi, file_mount - file_mount_end + mcall 4,<630,3>,0x80000000, file_mount ;, file_mount - file_mount.end +; cmp [soi],0 +; je @f + + mcall 13,<677,40>,<13,11>,0xe5e5e5 + + mov ecx,[load_directory_pointer] + mov ecx,[ecx+4] + mcall 47,0x80060000, ,<679, 15>,0 + + mcall 8,[dinamic_button_data_5.x],[dinamic_button_data_5.y],0x40000002 +;@@: + mcall 12,2 + + ret +;--------------------------------------------------------------------- +set_draw_scrollbar_all: + xor eax,eax + inc eax + mov [scroll_bar_data_vertical.all_redraw],eax + mov [scroll_bar_data_horizontal.all_redraw],eax + ret +;--------------------------------------------------------------------- +set_nodraw_scrollbar_all: + xor eax,eax + mov [scroll_bar_data_vertical.all_redraw],eax + mov [scroll_bar_data_horizontal.all_redraw],eax + ret +;--------------------------------------------------------------------- +draw_other: + call drawimage +@@: + mov ebx,0 ;5 + shl ebx,16 + add ebx,[window_width] +; sub ebx,9 +; push ebx + xor ecx,ecx +; mov ecx,[skin_high] + shl ecx,16 + add ecx,50-22 +; sub ecx,[skin_high] + mov edx,0xffffff + cmp [no_draw_window],0 + jne @f + mcall 13 ; fill top area +@@: + mov eax,[soi] + test eax,eax + jnz @f + mov ecx,[window_high] + sub ecx,28 ;50+4 + add ecx,(50-22) shl 16 + mcall 13 +@@: + + call draw_number_of_file + + call draw_zoom_factors + + cmp [scaling_mode],dword 0 + jne @f +; pop ebx + ret +@@: +; mov ecx,[scroll_bar_data_vertical.cur_area] +; mov ebx,[scroll_bar_data_horizontal.cur_area] +; push ecx +; add ebx,5 +; mov ax,bx +; shl ebx,16 +; add ebx,[window_width] +; sub ebx,4 +; sub bx,ax +; cmp bx,0 +; jbe @f +; add ecx,50 shl 16 +; mcall 13, , ,0xffffff +; +;@@: +; pop ecx +; pop ebx + +; add ecx,50 +; mov ax,cx +; shl ecx,16 +; add ecx,[window_high] +; sub cx,ax +; sub ecx,4 +; cmp cx,0 +; jbe @f +; mcall 13, , ,0xffffff + +;@@: + call set_draw_scrollbar_all + call draw_scrollbars + call set_nodraw_scrollbar_all + + ret +;--------------------------------------------------------------------- +draw_number_of_file: + + mcall 13,<630,42>,<13,11>,0xe5e5e5 + + xor ecx,ecx + mov eax,[load_directory_pointer] + cmp [eax+4],dword 0 + je @f + mov ecx,[load_file_number] + inc ecx +@@: + mcall 47,0x80060000, ,<632, 15>,0 + ret +;--------------------------------------------------------------------- +draw_zoom_factors: + mcall 13,<725,30>,<13,11>,0xe5e5e5 + + mov ecx,[zoom_factors] + mov ecx,[ecx] + mov [scaling_mode],ecx + test ecx,ecx + jnz @f + mcall 4,<727,14>,0x80000000, zoom_auto_text + ret +@@: + mcall 47,0x80060000, ,<727, 15>,0 + ret +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/full_win.inc b/programs/media/zsea/full_win.inc new file mode 100644 index 0000000000..7eb32fa175 --- /dev/null +++ b/programs/media/zsea/full_win.inc @@ -0,0 +1,446 @@ +;--------------------------------------------------------------------- +full_screen: + xor eax,eax + mov [Repeat_N],eax + + xor eax,eax + mov [press_Enter_flag],al + + mov eax,[zoom_factors] + mov [zoom_factors_old],eax + + mov eax,[scaling_mode] + mov [scaling_mode_old],eax + + call get_window_param_1 + mov eax,[window_start_x] + mov [window_start_x_old],eax + mov eax,[window_start_y] + mov [window_start_y_old],eax + mov eax,[window_high] + mov [window_high_old],eax + mov eax,[window_width] + mov [window_width_old],eax +;---------------------------------------- +; get current work area + mcall 48,5 + mov [work_area_LR_old],eax + mov [work_area_TB_old],ebx +;---------------------------------------- + mov eax,[soi] + test eax,eax + jz still + mov eax,scaling_mode + xor ebx,ebx + mov [eax],ebx ;dword 0 + mov [zoom_factors],dword zoom_factors.1 + + mcall 14 + xor ebx,ebx + xor ecx,ecx + mov edx,eax + shr edx,16 + xor esi,esi + mov si,ax + inc ax + mov [wa_high_1],ax + mov [wa_high_2],ax + shr eax,16 + inc ax + mov [wa_width_1],ax + mov [wa_width_2],ax + mcall 67 +;---------------------------------------- +; set max work area + mov ecx,edx + mov dx,si + mcall 48,6 +;---------------------------------------- + mov eax,[fill_color] + mov [fill_color_old],eax + xor eax,eax + mov [fill_color],eax + + jmp .still +;---------------------------------------- +.red: + call .draw_window +.still: + cmp [RAW1_flag],1 + je .animation_handler + mcall 10 + cmp eax,1 ; ? + je .red ; - red + cmp eax,2 ; ? + je .key ; - key + cmp eax,3 ; ? + je .button ; - button + jmp .still ; - +;---------------------------------------- +.animation_handler: + mcall 23,1 +; pusha +; mcall 26,9 +; cmp [Animation_timer],eax +; ja @f +; call animation_handler.draw_image +;@@: +; popa + cmp eax,1 ; ? + je .red ; - red + cmp eax,2 ; ? + je .key ; - key + cmp eax,3 ; ? + je .button ; - button + mcall 26,9 + cmp [Animation_timer],eax + ja .animation_handler + + mov al,[Disposal_Method] + cmp al,2 + jne @f + call restore_background + jmp .first_frame +@@: + cmp al,3 + jne @f + call restore_previous_frame +@@: +.first_frame: + + call copy_next_frame + mov [no_fill],1 + call .draw_image + mov [no_fill],0 +; call animation_handler.draw_image + jmp .still +;---------------------------------------- +.key: + mcall 2 + cmp [extended_key],1 + je .extended_key + test al, al + jnz .still + cmp ah, 0xE0 + jne @f + mov [extended_key],1 + jmp .still +@@: + cmp ah,1 ; Esc + je .restore_main_window + cmp ah,156 ; Enter + je .restore_main_window_1 + jmp .still +;---------------------------------------- +.extended_key: + mov [extended_key],0 + mov [current_key_code],ah + cmp ah,73 + je move_to_left_1 + cmp ah,81 + je move_to_right_1 + cmp ah,71 + je left_limit_1 + cmp ah,79 + je right_limit_1 + + cmp ah,156 ; Enter + je .restore_main_window_1 + + cmp ah,183 ; Print Screen - Slides Show + je slide_show_1.3 + jmp .still +;---------------------------------------- +.button: + mcall 17 + cmp ah,1 ; button id=1 ? +; je START.exit +; jmp .still ;red_1 + jne .still +.exit: + call restore_work_area + jmp START.exit +;--------------------------------------------------------------------- +.restore_main_window_1: + cmp [press_Enter_flag],1 + je .restore_main_window + inc [press_Enter_flag] + jmp .still +;--------------------------------------------------------------------- +.restore_main_window: + call restore_work_area + + mov eax,[zoom_factors_old] + mov [zoom_factors],eax + + mov eax,[scaling_mode_old] + mov [scaling_mode],eax + + mov ebx,[window_start_x_old] + mov ecx,[window_start_y_old] + mov edx,[window_width_old] + mov esi,[window_high_old] + mcall 67 + +; call get_window_param + mov eax,[fill_color_old] + mov [fill_color],eax + + xor eax,eax + mov [Repeat_N],eax + +; mcall 15,3 + + mov [redraw_wallpaper_flag],1 + jmp still ;red_1 +;--------------------------------------------------------------------- +.draw_window: + mcall 12,1 + mcall 0,<0,800>,<0,600>,0x41000000,0,0 +; call get_window_param_1 +; mcall 8,0,0,1,0 + call .draw_image + mcall 12,2 + ret +;--------------------------------------------------------------------- +.draw_image: + mcall 14 + inc ax + mov [wa_high_1],ax + mov [wa_high_2],ax + shr eax,16 + inc ax + mov [wa_width_1],ax + mov [wa_width_2],ax + mov [image_start_coordinates],0 + mov [background_color],0 + call scaling.1 + mov [background_color],0xffffff + ret +;--------------------------------------------------------------------- +get_window_param_1: + mcall 9, procinfo, -1 + mov eax,[ebx+34] + mov [window_start_x],eax + mov eax,[ebx+38] + mov [window_start_y],eax + mov eax,[ebx+46] + mov [window_high],eax + mov eax,[ebx+42] + mov [window_width],eax + mov eax,[ebx+70] + mov [window_status],eax + ret +;---------------------------------------- +restore_work_area: +; restore old work area + mov ecx,[work_area_LR_old] + mov edx,[work_area_TB_old] + mcall 48,6 + ret +;--------------------------------------------------------------------- +move_to_left_1: + xor eax,eax + cmp [load_file_number],eax + je full_screen.still + dec [load_file_number] + jmp right_limit_1.2 +;---------------------------------------- +move_to_right_1: + mov eax,[load_directory_pointer] + mov eax,[eax+4] + test eax,eax + jz @f + dec eax +@@: + cmp [load_file_number],eax + je full_screen.still + inc [load_file_number] + jmp right_limit_1.2 +;---------------------------------------- +left_limit_1: + xor eax,eax + jmp right_limit_1.1 +;---------------------------------------- +right_limit_1: + mov eax,[load_directory_pointer] + mov eax,[eax+4] + test eax,eax + jz @f + dec eax +@@: +.1: + cmp [load_file_number],eax + je full_screen.still + mov [load_file_number],eax +.2: + imul ebx,[load_file_number],304 + add ebx,32+40 + add ebx,[load_directory_pointer] + + mov esi,string + mov edi,plugin_pach + call copy_file_path + + mov esi,plugin_pach + mov edi,string + mov ecx,4096/4 + cld + rep movsd + +; jmp kopen + mov [open_file_flag],0 + mov ecx,-1 + call getappinfo + call load_image + test eax,eax + jnz kopen_1.err + + call convert + + call load_directory.copy_dir_path + +; call get_window_param +; test [window_status],1b +; jz @f ;draw_still +; mov [no_draw_window],1 +;*** call draw_other +; mov [no_draw_window],0 +; jmp .3 +; +;@@: +; call .draw_window + call full_screen.draw_image +.3: + mov al,[old_key_code] + mov ah,[current_key_code] + mov [old_key_code],ah + cmp al,ah + jne full_screen.still ;key.extended_key ;still +.still: + mcall 2 + cmp [extended_key],1 + je .extended_key + test al, al + jnz full_screen.still + cmp ah, 0xE0 + jne @f + mov [extended_key],1 + jmp .still +@@: + jmp full_screen.still +.extended_key: + mov [extended_key],0 + mov [current_key_code],ah + jmp .3 +.4: + mov ah,[current_key_code] + mov [old_key_code],ah + jmp full_screen.extended_key ;key.extended_key +;--------------------------------------------------------------------- +slide_show_1: + mov eax,[load_directory_pointer] + cmp [eax+4],dword 1 + jbe full_screen.still + mcall 26,9 + cmp [timer],eax + jbe .1 + jmp .still +.red: + call full_screen.draw_window +.still: + mcall 23,10 + cmp eax,1 + je .red + cmp eax,2 + je .key + cmp eax,3 + je .button +; mcall 68,1 + jmp slide_show_1 +;------------------------------------------- +.key: + mcall 2 + cmp [extended_key],1 + je .extended_key + test al, al + jnz .still + cmp ah, 0xE0 + jne @f + mov [extended_key],1 + jmp .still +@@: + cmp ah,1 ; Esc + je full_screen.still + cmp ah,185 ; Space + je full_screen.still + jmp .still +.extended_key: + mov [extended_key],0 + mov [current_key_code],ah + jmp .still +;------------------------------------------- +.button: ; button + mov eax,17 ; get id + mcall + cmp ah,1 ; button id=1 ? + je full_screen.exit ;START.exit +.noclose: + cmp ah,2 + je full_screen.still + jmp slide_show_1 +;------------------------------------------- +.1: +; mcall 26,9 +; add eax,[slide_show_delay] ;500 +; mov [timer],eax + + mov eax,[load_directory_pointer] + mov eax,[eax+4] + test eax,eax + jz @f + dec eax +@@: + cmp [load_file_number],eax + je full_screen.still + inc [load_file_number] + imul ebx,[load_file_number],304 + add ebx,32+40 + add ebx,[load_directory_pointer] + + mov esi,string + mov edi,plugin_pach + call copy_file_path + + mov esi,plugin_pach + mov edi,string + mov ecx,4096/4 + cld + rep movsd + mov [open_file_flag],0 + mov ecx,-1 + call getappinfo + call load_image + + test eax,eax + jnz kopen_1.err + + call convert +; call get_window_param +; test [window_status],1b +; jz @f ;draw_still +; mov [no_draw_window],1 +; call draw_other +; mov [no_draw_window],0 +; jmp slide_show_1 ;.3 +;@@: +; call draw_window + call load_directory.copy_dir_path + call full_screen.draw_image +; jmp slide_show_1 +.3: + mcall 26,9 + add eax,[slide_show_delay] ;500 + mov [timer],eax + jmp slide_show_1 +;--------------------------------------------------------------------- diff --git a/programs/media/zsea/key.inc b/programs/media/zsea/key.inc new file mode 100644 index 0000000000..66570d97c4 --- /dev/null +++ b/programs/media/zsea/key.inc @@ -0,0 +1,427 @@ +;--------------------------------------------------------------------- + key: ; key + mcall 2 + cmp [extended_key],1 + je .extended_key + test al, al + jnz still + cmp ah, 0xE0 + jne @f + mov [extended_key],1 + jmp still +@@: + cmp ah,151 ; i - file information + je kinfo + cmp ah,152 ; o - application options + je check_key_O ;k_option + cmp ah,159 ; s - sort mode + je k_sort_directory + cmp ah,145 ; w - wallpaper + je k_background + cmp ah,183 ; * - scaling to window + je scaling + cmp ah,139 ; 0 - scaling to window + je scaling + cmp ah,202 ; "-" - zoom minus + je zoom_minus + cmp ah,140 ; "-" - zoom minus + je zoom_minus + cmp ah,206 ; "+" - zoom plus + je zoom_plus + cmp ah,141 ; "+" - zoom plus + je zoom_plus + cmp ah,171 ; "\" - zoom 100% + je no_scaling + + cmp ah,72 ; up arrow + je key_up_arrow + cmp ah,80 ; down arrow + je key_down_arrow + cmp ah,75 ; left arrow + je key_left_arrow + cmp ah,77 ; right arrow + je key_right_arrow + + cmp ah,28 ; Enter + je full_screen + cmp ah,187 ; F1 + je select_menu ;key_alt_down + + cmp ah,42 + je key_shift_up + cmp ah,54 + je key_shift_up + cmp ah,170 + je key_shift_down + cmp ah,182 + je key_shift_down + cmp ah,29 + je key_ctrl_up + cmp ah,157 + je key_ctrl_down + cmp ah,56 + je key_alt_up + cmp ah,184 + je key_alt_down + + jmp still +.extended_key: + mov [extended_key],0 + mov [current_key_code],ah +; push eax +; mcall 26,9 +; mov [timer_counter],eax +; pop eax + +; mov al,ah +; cmp al,130 ; 1 +; je kfile +; cmp al,131 ; 2 +; je kopen +; cmp al,132 ; 3 +; je kinfo +; cmp al,133 ; 4 +; je kbgrd + cmp ah,73 + je move_to_left + cmp ah,81 + je move_to_right + cmp ah,71 + je left_limit + cmp ah,79 + je right_limit + cmp ah,181 ; / - zoom 100% + je no_scaling + + cmp ah,72 ; up arrow + je key_up_arrow + cmp ah,80 ; down arrow + je key_down_arrow + cmp ah,75 ; left arrow + je key_left_arrow + cmp ah,77 ; right arrow + je key_right_arrow + + cmp ah,28 ; Enter + je full_screen + + cmp ah,183 ; Print Screen - Slides Show + je slide_show.3 + + cmp ah,29 + je key_ctrl_up + cmp ah,157 + je key_ctrl_down + cmp ah,56 + je key_alt_up + cmp ah,184 + je key_alt_down + jmp still +;--------------------------------------------------------------------- +key_shift_up: + mov [shift_flag],1 + jmp still +;--------------------------------------------------------------------- +key_shift_down: + mov [shift_flag],0 + jmp still +;--------------------------------------------------------------------- +key_ctrl_up: + mov [ctrl_flag],1 + jmp still +;--------------------------------------------------------------------- +key_ctrl_down: + mov [ctrl_flag],0 + jmp still +;--------------------------------------------------------------------- +key_alt_up: + mov [alt_flag],1 + jmp still +;--------------------------------------------------------------------- +key_alt_down: + mov [alt_flag],0 + jmp still +;--------------------------------------------------------------------- +check_key_O: + cmp [ctrl_flag],0 + jne kfile + jmp k_option +;--------------------------------------------------------------------- +move_to_left: + xor eax,eax + cmp [load_file_number],eax + je still + dec [load_file_number] + jmp right_limit.2 +;---------------------------------------- +move_to_right: + mov eax,[load_directory_pointer] + mov eax,[eax+4] + test eax,eax + jz @f + dec eax +@@: + cmp [load_file_number],eax + je still + inc [load_file_number] + jmp right_limit.2 +;---------------------------------------- +left_limit: + xor eax,eax + jmp right_limit.1 +;---------------------------------------- +right_limit: + mov eax,[load_directory_pointer] + mov eax,[eax+4] + test eax,eax + jz @f + dec eax +@@: +.1: + cmp [load_file_number],eax + je still + mov [load_file_number],eax +.2: + imul ebx,[load_file_number],304 + add ebx,32+40 + add ebx,[load_directory_pointer] + + mov esi,string + mov edi,plugin_pach + call copy_file_path + + mov esi,plugin_pach + mov edi,string + mov ecx,4096/4 + cld + rep movsd + +; jmp kopen + mov [open_file_flag],0 + mov ecx,-1 + call getappinfo + call load_image + test eax,eax + jnz kopen_1.err + + call convert + + call load_directory.copy_dir_path + + call get_window_param + test [window_status],1b + jz @f ;draw_still + mov [no_draw_window],1 + call draw_other + mov [no_draw_window],0 + jmp .3 + +@@: + call draw_window +.3: + mov al,[old_key_code] + mov ah,[current_key_code] + mov [old_key_code],ah + cmp al,ah + jne still ;key.extended_key ;still +.still: + mcall 2 + cmp [extended_key],1 + je .extended_key + test al, al + jnz still + cmp ah, 0xE0 + jne @f + mov [extended_key],1 + jmp .still +@@: + jmp still +.extended_key: + mov [extended_key],0 + mov [current_key_code],ah + jmp .3 +.4: + mov ah,[current_key_code] + mov [old_key_code],ah + jmp key.extended_key +;--------------------------------------------------------------------- +slide_show: + mov eax,[load_directory_pointer] + cmp [eax+4],dword 1 + jbe still + mcall 26,9 + cmp [timer],eax + jbe .1 + jmp .still +.red: + call draw_window +.still: + mcall 23,10 + cmp eax,1 ; ? + je .red + cmp eax,2 ; ? + je .key ; - key + cmp eax,3 ; ? + je .button ; - button +; mcall 68,1 + jmp slide_show +;------------------------------------------- +.key: + mcall 2 + cmp [extended_key],1 + je .extended_key + test al, al + jnz .still + cmp ah, 0xE0 + jne @f + mov [extended_key],1 + jmp .still +@@: + cmp ah,1 ; Esc + je still + cmp ah,185 ; Space + je still + jmp .still +.extended_key: + mov [extended_key],0 + mov [current_key_code],ah + jmp .still +;------------------------------------------- +.button: ; button + mov eax,17 ; get id + mcall + cmp ah,1 ; button id=1 ? + je START.exit +.noclose: + cmp ah,2 + je still + jmp slide_show +;------------------------------------------- +.1: +; mcall 26,9 +; add eax,[slide_show_delay] ;500 +; mov [timer],eax + + mov eax,[load_directory_pointer] + mov eax,[eax+4] + test eax,eax + jz @f + dec eax +@@: + cmp [load_file_number],eax + je still + inc [load_file_number] + imul ebx,[load_file_number],304 + add ebx,32+40 + add ebx,[load_directory_pointer] + + mov esi,string + mov edi,plugin_pach + call copy_file_path + + mov esi,plugin_pach + mov edi,string + mov ecx,4096/4 + cld + rep movsd + mov [open_file_flag],0 + mov ecx,-1 + call getappinfo + call load_image + + test eax,eax + jnz kopen_1.err + + call convert + call load_directory.copy_dir_path + + call get_window_param + test [window_status],1b + jz @f ;draw_still + mov [no_draw_window],1 + call draw_other + mov [no_draw_window],0 + jmp .3 ;slide_show +@@: + call draw_window +; jmp slide_show +.3: + mcall 26,9 + add eax,[slide_show_delay] ;500 + mov [timer],eax + jmp slide_show +;--------------------------------------------------------------------- +key_up_arrow: + mov eax,[scroll_bar_data_vertical.ar_offset] + mov ebx,scroll_bar_data_vertical.position + cmp [ebx],eax + jbe @f + sub [ebx],eax + jmp .1 +@@: + xor eax,eax + cmp [ebx],eax + je still + mov [ebx],eax +.1: + call drawimage + call draw_scrollbars + jmp still +;--------------------------------------------------------------------- +key_down_arrow: + mov ecx,[scroll_bar_data_vertical.ar_offset] + mov ebx,scroll_bar_data_vertical.position + mov eax,[scroll_bar_data_vertical.max_area] + sub eax,[scroll_bar_data_vertical.cur_area] + cmp [ebx],eax + je still + push eax + sub eax,ecx + cmp [ebx],eax + pop eax + jae @f + add [ebx],ecx + jmp key_up_arrow.1 +@@: + mov [ebx],eax + jmp key_up_arrow.1 +;--------------------------------------------------------------------- +key_left_arrow: + mov eax,[scroll_bar_data_horizontal.ar_offset] + mov ebx,scroll_bar_data_horizontal.position + cmp [ebx],eax + jbe @f + sub [ebx],eax + jmp key_up_arrow.1 +@@: + xor eax,eax + cmp [ebx],eax + je still + mov [ebx],eax + jmp key_up_arrow.1 +;--------------------------------------------------------------------- +key_right_arrow: + mov ecx,[scroll_bar_data_horizontal.ar_offset] + mov ebx,scroll_bar_data_horizontal.position + mov eax,[scroll_bar_data_horizontal.max_area] + sub eax,[scroll_bar_data_horizontal.cur_area] + cmp [ebx],eax + je still + push eax + sub eax,ecx + cmp [ebx],eax + pop eax + jae @f + add [ebx],ecx + jmp key_up_arrow.1 +@@: + mov [ebx],eax + +; xor eax,eax +; mov ax,[scroll_bar_data_horizontal.size_x] +; sub eax,[scroll_bar_data_horizontal.btn_high] +; sub eax,[scroll_bar_data_horizontal.btn_high] +; sub eax,[scroll_bar_data_horizontal.run_size] +; mov [scroll_bar_data_horizontal.position2],eax + jmp key_up_arrow.1 +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/libini.inc b/programs/media/zsea/libini.inc new file mode 100644 index 0000000000..9c14fb2710 --- /dev/null +++ b/programs/media/zsea/libini.inc @@ -0,0 +1,115 @@ +;--------------------------------------------------------------------- +Get_ini: + + stdcall dll.Init,[lib_init] + + mov ebx,ini_file_name + mov esi,path + mov edi,plugin_pach + call copy_file_path + + invoke ini_get_int,plugin_pach,aVariables,aSortMode,2 + cmp eax,0 + jb .error_aSortMode + cmp eax,13 + jb @f +.error_aSortMode: + mov eax,2 +@@: + mov [sort_type],eax + invoke ini_get_int,plugin_pach,aVariables,aArrowsOffset,10 + cmp eax,1 + jb .error_aArrowsOffset + cmp eax,100 + jb @f +.error_aArrowsOffset: + mov eax,10 +@@: + mov [arrows_offset],eax + invoke ini_get_int,plugin_pach,aVariables,aSlideShowDelay,300 + cmp eax,1 + jb .error_aSlideShowDelay + cmp eax,99990 + jb @f +.error_aSlideShowDelay: + mov eax,300 +@@: + mov [slide_show_delay],eax + invoke ini_get_int,plugin_pach,aVariables,aShowFileName,0 + cmp eax,0 + jb .error_aShowFileName + cmp eax,1 + jb @f +.error_aShowFileName: + mov eax,1 +@@: + shl eax,1 + mov [check1+32],eax + invoke ini_get_int,plugin_pach,aVariables,aFilteringFlag,0 + cmp eax,0 + jb .error_aFilteringFlag + cmp eax,1 + jb @f +.error_aFilteringFlag: + mov eax,1 +@@: + mov [filtering_flag],eax + shl eax,1 + mov [check2+32],eax + +; get convert plugins names + invoke ini_get_str,plugin_pach,aConvertPlugins,aCP0,plugin_0_name,127,ConvertPlugins_no_key + invoke ini_get_str,plugin_pach,aConvertPlugins,aCP1,plugin_1_name,127,ConvertPlugins_no_key + invoke ini_get_str,plugin_pach,aConvertPlugins,aCP2,plugin_2_name,127,ConvertPlugins_no_key + invoke ini_get_str,plugin_pach,aConvertPlugins,aCP3,plugin_3_name,127,ConvertPlugins_no_key + invoke ini_get_str,plugin_pach,aConvertPlugins,aCP4,plugin_4_name,127,ConvertPlugins_no_key + invoke ini_get_str,plugin_pach,aConvertPlugins,aCP5,plugin_5_name,127,ConvertPlugins_no_key + invoke ini_get_str,plugin_pach,aConvertPlugins,aCP6,plugin_6_name,127,ConvertPlugins_no_key + invoke ini_get_str,plugin_pach,aConvertPlugins,aCP7,plugin_7_name,127,ConvertPlugins_no_key + invoke ini_get_str,plugin_pach,aConvertPlugins,aCP8,plugin_8_name,127,ConvertPlugins_no_key + invoke ini_get_str,plugin_pach,aConvertPlugins,aCP9,plugin_9_name,127,ConvertPlugins_no_key + + invoke ini_get_str,plugin_pach,aApplicationsPaths,aHelp,Help_path,1023,ConvertPlugins_no_key + invoke ini_get_str,plugin_pach,aApplicationsPaths,aEditor,Editor_path,1023,ConvertPlugins_no_key + invoke ini_get_str,plugin_pach,aApplicationsPaths,aOpenDialog,OpenDialog_path,1023,ConvertPlugins_no_key + invoke ini_get_str,plugin_pach,aOther,akey_help,key_help_name,127,ConvertPlugins_no_key + ret +;--------------------------------------------------------------------- +Set_ini: + mov ebx,ini_file_name + mov esi,path + mov edi,plugin_pach + call copy_file_path + + invoke ini_set_int,plugin_pach,aVariables,aSortMode,[sort_type] + invoke ini_set_int,plugin_pach,aVariables,aArrowsOffset,[arrows_offset] + invoke ini_set_int,plugin_pach,aVariables,aSlideShowDelay,[slide_show_delay] + mov eax,[check1+32] + shr eax,1 + mov [check1+32],eax + invoke ini_set_int,plugin_pach,aVariables,aShowFileName,[check1+32] + invoke ini_set_int,plugin_pach,aVariables,aFilteringFlag,[filtering_flag] + ret +;--------------------------------------------------------------------- +;libini_alloc: +; push ecx +; mov ecx, [esp+8] +; mcall 68,12 +; pop ecx +; ret 4 +;--------------------------------------------------------------------- +;libini_free: +; push ecx +; mov ecx, [esp+8] +; mcall 68,13 +; pop ecx +; ret 4 +;--------------------------------------------------------------------- +;libini_realloc: +; push ecx edx +; mov edx, [esp+8+4] +; mov ecx, [esp+8+8] +; mcall 68,20 +; pop edx ecx +; ret 8 +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/load.inc b/programs/media/zsea/load.inc new file mode 100644 index 0000000000..8f1c299d3a --- /dev/null +++ b/programs/media/zsea/load.inc @@ -0,0 +1,886 @@ +;--------------------------------------------------------------------- +load_plugins: + +load_libraries l_libs_start,end_l_libs + + test eax,eax + jnz START.exit_1 +;--------------------------------------------------------------------- +; Get ini values + call Get_ini +; jmp last_plugin +;--------------------------------------------------------------------- +; mov [cnv_plugin_name_pointer],plugin_0_name +load_convert_plugins: + mov ecx,10 +.1: + push ecx + mov esi,[cnv_plugin_name_pointer] + cmp [esi],dword 'NoKe' + je clear_current_load_convert_plugins_area ;last_plugin + mov edi,system_path.1 + mov ecx,128/4 + cld + rep movsd + + mov esi,[cnv_plugin_name_pointer] + mov edi,err_message_found_lib.1 + mov ecx,128/4 + rep movsd + + mov esi,[cnv_plugin_name_pointer] + mov edi,err_message_import.1 + mov ecx,128/4 + rep movsd + +load_library system_path.1, path, library_path, system_path, \ +err_message_found_lib, head_f_l, \ +[cnv_plugin_import_pointer], err_message_import, head_f_i, plugins_directory + + test eax,eax + jnz START.exit_1 +load_convert_plugins_next: + add [cnv_plugin_import_pointer],dword 24 + add [cnv_plugin_name_pointer],128 + pop ecx + dec ecx + jnz load_convert_plugins.1 + +; jmp load_convert_plugins + +last_plugin: +; initialize sort + push dword 1 + call dword [sort_init] +; unpack deflate + mov eax,[unpack_DeflateUnpack2] + mov [deflate_unpack],eax + ret +;----------------------------------------- +clear_current_load_convert_plugins_area: + xor eax,eax + mov edi,[cnv_plugin_import_pointer] + cld + push ecx + mov ecx,24/4 + rep stosd + pop ecx + jmp load_convert_plugins_next +;--------------------------------------------------------------------- +copy_path_my: + xor eax,eax +@@: + cld + lodsb + stosb + test eax,eax + jnz @b + mov esi,edi +@@: + std + lodsb + cmp al,'/' + jnz @b + mov edi,esi + add edi,2 + mov esi,ebx +@@: + cld + lodsb + stosb + test eax,eax + jnz @b + mov esi,ecx + dec edi +@@: + cld + lodsb + stosb + test eax,eax + jnz @b + ret +;--------------------------------------------------------------------- +load_image: + + call delete_RAW1 + mov [fileinfo+0],dword 5 + mov [fileinfo+12],dword 0 + mov [fileinfo+16],dword process_info + + cmp [soi],0 + je @f + mov ecx,[raw_pointer] + mcall 68, 13, + mov [soi],0 +@@: +; cmp [raw_pointer_2],dword 0 +; je @f +; mov ecx,[raw_pointer_2] ;[soi] +; mcall 68, 13, +; mov [raw_pointer_2],0 +;@@: +.1: + mcall 70, fileinfo + test eax,eax + jnz .end + + mov [fileinfo+0],dword 0 + + mov ecx,[process_info+32] + +; for Diamond emulator, and broken files - size = 0 +; test ecx,ecx +; jnz @f + cmp ecx,32 + jae @f + mov eax,6 + jmp .end +@@: + mov [fileinfo+12],ecx + mov [img_size],ecx + + mcall 68, 12 + + mov [fileinfo+16],eax + mov [image_file],eax + + mcall 70, fileinfo +.end: + mov [error_fs],eax + + ret +;--------------------------------------------------------------------- +delete_RAW1: + cmp [RAW1_pointer],0 + jne @f + ret +@@: + mcall 68, 13,[previous_frame_pointer] + xor eax,eax + mov [Repeat_N],eax + +@@: + mov edx,[Repeat_N] + shl edx,4 + add edx,[RAW1_pointer] + mov ecx,[edx+16] + call .1 + + inc [Repeat_N] + mov eax,[Repeat_N] + cmp [Total_Repeat_N],eax + ja @r + + mov ecx,[RAW1_pointer] + call .1 + + xor eax,eax + mov [RAW1_pointer],eax + ret +.1: + mcall 68, 13, + ret +;--------------------------------------------------------------------- +load_buttons: + + mov esi,path + mov edi,plugin_pach + mov ebx,buttons_directory + mov ecx,button_name ;buttons_passive_name + call copy_path_my + + mov [fileinfo.name], dword plugin_pach + + xor eax,eax + mov [raw_pointer_2],eax + + call load_image + mov eax,[error_fs] + test eax,eax + jnz START.exit_1 + + call convert_plugin_invoke + mov eax,[return_code] + test eax,eax + jnz START.exit_1 + + + mov ebx,[raw_pointer] + mov eax,[ebx+4] + mov [dinamic_button_data_1.size_x],ax + mov [dinamic_button_data_1.size_y],ax + mov [dinamic_button_data_2.size_x],ax + mov [dinamic_button_data_2.size_y],ax + mov [dinamic_button_data_3.size_x],ax + mov [dinamic_button_data_3.size_y],ax + mov [dinamic_button_data_4.size_x],ax + mov [dinamic_button_data_4.size_y],ax + mov [dinamic_button_data_5.size_x],ax + mov [dinamic_button_data_5.size_y],ax + mov [dinamic_button_data_6.size_x],ax + mov [dinamic_button_data_6.size_y],ax + mov [dinamic_button_data_7.size_x],ax + mov [dinamic_button_data_7.size_y],ax + mov [dinamic_button_data_8.size_x],ax + mov [dinamic_button_data_8.size_y],ax + mov [dinamic_button_data_9.size_x],ax + mov [dinamic_button_data_9.size_y],ax + mov [dinamic_button_data_10.size_x],ax + mov [dinamic_button_data_10.size_y],ax + mov [dinamic_button_data_11.size_x],ax + mov [dinamic_button_data_11.size_y],ax + mov [dinamic_button_data_12.size_x],ax + mov [dinamic_button_data_12.size_y],ax + mov [dinamic_button_data_13.size_x],ax + mov [dinamic_button_data_13.size_y],ax + mov [dinamic_button_data_14.size_x],ax + mov [dinamic_button_data_14.size_y],ax + mov [dinamic_button_data_15.size_x],ax + mov [dinamic_button_data_15.size_y],ax + mov eax,[ebx+12] + mov [dinamic_button_data_1.resolution_raw],eax + mov [dinamic_button_data_2.resolution_raw],eax + mov [dinamic_button_data_3.resolution_raw],eax + mov [dinamic_button_data_4.resolution_raw],eax + mov [dinamic_button_data_5.resolution_raw],eax + mov [dinamic_button_data_6.resolution_raw],eax + mov [dinamic_button_data_7.resolution_raw],eax + mov [dinamic_button_data_8.resolution_raw],eax + mov [dinamic_button_data_9.resolution_raw],eax + mov [dinamic_button_data_10.resolution_raw],eax + mov [dinamic_button_data_11.resolution_raw],eax + mov [dinamic_button_data_12.resolution_raw],eax + mov [dinamic_button_data_13.resolution_raw],eax + mov [dinamic_button_data_14.resolution_raw],eax + mov [dinamic_button_data_15.resolution_raw],eax + mov eax,[ebx+20] + add eax,ebx + mov [dinamic_button_data_1.palette_raw],eax + mov [dinamic_button_data_2.palette_raw],eax + mov [dinamic_button_data_3.palette_raw],eax + mov [dinamic_button_data_4.palette_raw],eax + mov [dinamic_button_data_5.palette_raw],eax + mov [dinamic_button_data_6.palette_raw],eax + mov [dinamic_button_data_7.palette_raw],eax + mov [dinamic_button_data_8.palette_raw],eax + mov [dinamic_button_data_9.palette_raw],eax + mov [dinamic_button_data_10.palette_raw],eax + mov [dinamic_button_data_11.palette_raw],eax + mov [dinamic_button_data_12.palette_raw],eax + mov [dinamic_button_data_13.palette_raw],eax + mov [dinamic_button_data_14.palette_raw],eax + mov [dinamic_button_data_15.palette_raw],eax + mov eax,[ebx+28] + add eax,ebx + push eax + mov [dinamic_button_data_1.passive_raw],eax + mov ecx,[ebx+4] + imul ecx,[ebx+4] + imul ecx,[ebx+12] + shr ecx,3 + add eax,ecx + mov [dinamic_button_data_2.passive_raw],eax + add eax,ecx + mov [dinamic_button_data_3.passive_raw],eax + add eax,ecx + mov [dinamic_button_data_4.passive_raw],eax + add eax,ecx + mov [dinamic_button_data_5.passive_raw],eax + add eax,ecx + mov [dinamic_button_data_6.passive_raw],eax + add eax,ecx + mov [dinamic_button_data_7.passive_raw],eax + add eax,ecx + mov [dinamic_button_data_8.passive_raw],eax + add eax,ecx + mov [dinamic_button_data_9.passive_raw],eax + add eax,ecx + mov [dinamic_button_data_10.passive_raw],eax + add eax,ecx + mov [dinamic_button_data_11.passive_raw],eax + add eax,ecx + mov [dinamic_button_data_12.passive_raw],eax + add eax,ecx + mov [dinamic_button_data_13.passive_raw],eax + add eax,ecx + mov [dinamic_button_data_14.passive_raw],eax + add eax,ecx + mov [dinamic_button_data_15.passive_raw],eax +;------------------------------------ + movzx ebx,word [dinamic_button_data_1.size_x] + movzx eax,word [dinamic_button_data_1.size_y] + imul eax,ebx + imul eax,15 + mov ebx,[dinamic_button_data_1.resolution_raw] + shr ebx,3 + imul ebx,eax + + pop eax + add eax,ebx + push eax + mov [dinamic_button_data_1.active_raw],eax + add eax,ecx + mov [dinamic_button_data_2.active_raw],eax + add eax,ecx + mov [dinamic_button_data_3.active_raw],eax + add eax,ecx + mov [dinamic_button_data_4.active_raw],eax + add eax,ecx + mov [dinamic_button_data_5.active_raw],eax + add eax,ecx + mov [dinamic_button_data_6.active_raw],eax + add eax,ecx + mov [dinamic_button_data_7.active_raw],eax + add eax,ecx + mov [dinamic_button_data_8.active_raw],eax + add eax,ecx + mov [dinamic_button_data_9.active_raw],eax + add eax,ecx + mov [dinamic_button_data_10.active_raw],eax + add eax,ecx + mov [dinamic_button_data_11.active_raw],eax + add eax,ecx + mov [dinamic_button_data_12.active_raw],eax + add eax,ecx + mov [dinamic_button_data_13.active_raw],eax + add eax,ecx + mov [dinamic_button_data_14.active_raw],eax + add eax,ecx + mov [dinamic_button_data_15.active_raw],eax +;------------------------------------ + pop eax + add eax,ebx + mov [dinamic_button_data_1.click_raw],eax + add eax,ecx + mov [dinamic_button_data_2.click_raw],eax + add eax,ecx + mov [dinamic_button_data_3.click_raw],eax + add eax,ecx + mov [dinamic_button_data_4.click_raw],eax + add eax,ecx + mov [dinamic_button_data_5.click_raw],eax + add eax,ecx + mov [dinamic_button_data_6.click_raw],eax + add eax,ecx + mov [dinamic_button_data_7.click_raw],eax + add eax,ecx + mov [dinamic_button_data_8.click_raw],eax + add eax,ecx + mov [dinamic_button_data_9.click_raw],eax + add eax,ecx + mov [dinamic_button_data_10.click_raw],eax + add eax,ecx + mov [dinamic_button_data_11.click_raw],eax + add eax,ecx + mov [dinamic_button_data_12.click_raw],eax + add eax,ecx + mov [dinamic_button_data_13.click_raw],eax + add eax,ecx + mov [dinamic_button_data_14.click_raw],eax + add eax,ecx + mov [dinamic_button_data_15.click_raw],eax +;------------------------------------ + mov [fileinfo.name], dword string + xor eax,eax + mov [img_size],eax + ret +;--------------------------------------------------------------------- +load_directory: + cmp [load_directory_pointer],dir_header ;dword 0 + je @f + mcall 68, 13, [load_directory_pointer] +@@: + call .copy_dir_path + mov [dirinfo.size],dword 0 + mov [dirinfo.return],dir_header ;procinfo + mcall 70, dirinfo + test eax,eax + jnz .end_err + + mov ecx,[dir_header.totl_blocks] ;[procinfo+8] + mov [dirinfo.size],ecx + imul ecx,304 + add ecx,32 + mcall 68, 12 + mov [dirinfo.return],eax + mov [load_directory_pointer],eax + + mcall 70, dirinfo + test eax,eax + jnz .end_err + call delete_unsupported_BDFE +.sort: + call sort_directory +; add [load_directory_pointer],2*304+32+40 + mov ebp,[load_directory_pointer] + mov ebp,[ebp+4] +; check ebp = 0 + test ebp,ebp + jz .end_1 ;.start + dec ebp + jz .end_1 + +.start: + mov esi,file_name + mov ecx,[file_name_length] + imul edi,ebp,304 + add edi,32+40 + add edi,[load_directory_pointer] +@@: + cld + lodsb + call char_todown + xchg ah,al + xchg edi,esi + cld + lodsb + call char_todown +; xchg ah,al + xchg edi,esi + dec ecx + jz .end + cmp ah,al + je @r + + dec ebp + jnz .start +.end_1: + xor eax,eax + mov [load_file_number],eax + ret +.end: + mov [load_file_number],ebp + xor eax,eax +.end_err: + ret +;------------------------------------------- +.copy_dir_path: + mov esi,string ;path + mov edi,plugin_pach + mov ebx,file_name + call copy_dir_path + mov [file_name_length],ebx + ret +;--------------------------------------------------------------------- +sort_directory: +; pusha + push dword [sort_type] ;2 ; + mov eax,[load_directory_pointer] + push dword [eax+4] ;[dirdata+4] ; + ; push ebx, + ; int 0x40 + add eax,32 + push eax ;dirdata+32 ; +; call [plugin_sort] + call [sort_dir] +; popa + ret +;--------------------------------------------------------------------- +delete_unsupported_BDFE: + + mov [fileinfo.subfunction],dword 0 + mov [fileinfo.size],dword 32 + mov [fileinfo.name], dword plugin_pach + + mov eax,process_info + mov [fileinfo.return],eax + mov [image_file],eax + + mov ebx,[load_directory_pointer] + add ebx,4 + xor ecx,ecx + dec ecx + + mov eax,[load_directory_pointer] + add eax,32+40 + sub eax,304 +.start: + inc ecx + add eax,304 +.1: + cmp [ebx],ecx + je .end + cmp [eax],byte '.' + jne @f + cmp [eax+1],byte 0 + je .delete +@@: + cmp [eax],word '..' + jne @f + cmp [eax+2],byte 0 + je .delete +@@: + test [eax-40],byte 0x10 + jnz .delete + + push eax ebx + mov esi,eax + call search_expansion + test eax,eax + pop ebx eax + jnz .delete + +; mov edi,[test_area+4] +; cmp [esi],edi +; je .start + + mov edi,plugin_0_name + cmp [edi],dword 'NoKe' + je .delete + + push eax ebx ecx esi + mov edi,[Convert_plugin_0.Assoc] + test edi,edi + jnz @f + pop esi ecx ebx eax + jmp .delete +@@: + call compare_expansion + test eax,eax + pop esi ecx ebx eax + jz .start + + mov edi,plugin_1_name + cmp [edi],dword 'NoKe' + je .delete + + push eax ebx ecx esi + mov edi,[Convert_plugin_1.Assoc] + test edi,edi + jnz @f + pop esi ecx ebx eax + jmp .delete +@@: + call compare_expansion + test eax,eax + pop esi ecx ebx eax + jz .start + + mov edi,plugin_2_name + cmp [edi],dword 'NoKe' + je .delete + + push eax ebx ecx esi + mov edi,[Convert_plugin_2.Assoc] + test edi,edi + jnz @f + pop esi ecx ebx eax + jmp .delete +@@: + call compare_expansion + test eax,eax + pop esi ecx ebx eax + jz .start + + mov edi,plugin_3_name + cmp [edi],dword 'NoKe' + je .delete + + push eax ebx ecx esi + mov edi,[Convert_plugin_3.Assoc] + test edi,edi + jnz @f + pop esi ecx ebx eax + jmp .delete +@@: + call compare_expansion + test eax,eax + pop esi ecx ebx eax + jz .start + + mov edi,plugin_4_name + cmp [edi],dword 'NoKe' + je .delete + + push eax ebx ecx esi + mov edi,[Convert_plugin_4.Assoc] + test edi,edi + jnz @f + pop esi ecx ebx eax + jmp .delete +@@: + call compare_expansion + test eax,eax + pop esi ecx ebx eax + jz .start + + mov edi,plugin_5_name + cmp [edi],dword 'NoKe' + je .delete + + push eax ebx ecx esi + mov edi,[Convert_plugin_5.Assoc] + test edi,edi + jnz @f + pop esi ecx ebx eax + jmp .delete +@@: + call compare_expansion + test eax,eax + pop esi ecx ebx eax + jz .start + + mov edi,plugin_6_name + cmp [edi],dword 'NoKe' + je .delete + + push eax ebx ecx esi + mov edi,[Convert_plugin_6.Assoc] + test edi,edi + jnz @f + pop esi ecx ebx eax + jmp .delete +@@: + call compare_expansion + test eax,eax + pop esi ecx ebx eax + jz .start + + mov edi,plugin_7_name + cmp [edi],dword 'NoKe' + je .delete + + push eax ebx ecx esi + mov edi,[Convert_plugin_7.Assoc] + test edi,edi + jnz @f + pop esi ecx ebx eax + jmp .delete +@@: + call compare_expansion + test eax,eax + pop esi ecx ebx eax + jz .start + + mov edi,plugin_8_name + cmp [edi],dword 'NoKe' + je .delete + + push eax ebx ecx esi + mov edi,[Convert_plugin_8.Assoc] + test edi,edi + jnz @f + pop esi ecx ebx eax + jmp .delete +@@: + call compare_expansion + test eax,eax + pop esi ecx ebx eax + jz .start + + mov edi,plugin_9_name + cmp [edi],dword 'NoKe' + je .delete + + push eax ebx ecx esi + mov edi,[Convert_plugin_9.Assoc] + test edi,edi + jnz @f + pop esi ecx ebx eax + jmp .delete +@@: + call compare_expansion + test eax,eax + pop esi ecx ebx eax + jz .start +;------------------------------------------- +.delete: + dec dword [ebx] + mov esi,[ebx] + sub esi,ecx + + push ecx + mov ecx,esi + imul ecx,304/4 + mov edi,eax + sub edi,40 + mov esi,edi + add esi,304 + cld + rep movsd + pop ecx + + jmp .1 +.end: + mov [fileinfo.name], dword string + ret +;--------------------------------------------------------------------- +image_editor: + mov [start_appl.parameter],dword string + mov [start_appl.name],dword Editor_path + mcall 70, start_appl + jmp still +;--------------------------------------------------------------------- +open_help: + mov ebx,key_help_name + mov esi,path + mov edi,library_path + call copy_file_path + mov [start_appl.parameter],dword library_path + mov [start_appl.name],dword Help_path + mcall 70, start_appl + jmp still +;--------------------------------------------------------------------- +char_todown: +; convert character to uppercase, using cp866 encoding +; in: al=symbol +; out: al=converted symbol + cmp al, 'A' + jb .ret + cmp al, 'Z' + jbe .az + cmp al, '' + jb .ret + cmp al, '' + jb .rus1 + cmp al, '' + ja .ret +; 0x90-0x9F -> 0xE0-0xEF + add al, ''-'' +.ret: + ret +.rus1: +; 0x80-0x8F -> 0xA0-0xAF +.az: + add al, 0x20 + ret +;--------------------------------------------------------------------- +copy_dir_path: + xor eax,eax + cmp [esi],al + jne @f + mov [edi],al + mov [ebx],al + xor ebx,ebx + inc ebx + ret +@@: + cld + lodsb + stosb + test eax,eax + jnz @b + mov esi,edi + dec esi +@@: + std + lodsb + cmp al,'/' + jnz @b + + push esi + add esi,2 + mov edi,ebx ;file_name + xor ebx,ebx +@@: + cld + lodsb + stosb + inc ebx + test eax,eax + jnz @b + pop esi + + mov [esi+1], byte 0 + cld + ret +;--------------------------------------------------------------------- +copy_file_path: + xor eax,eax +@@: + cld + lodsb + stosb + test eax,eax + jnz @b + mov esi,edi + dec esi +@@: + std + lodsb + cmp al,'/' + jnz @b + mov edi,esi + add edi,2 + mov esi,ebx +@@: + cld + lodsb + stosb + test eax,eax + jnz @b + ret +;--------------------------------------------------------------------- +search_expansion: + mov edi,esi + xor eax,eax +@@: + cld + lodsb + test eax,eax + jnz @b + mov ebx,esi + dec esi +@@: + std + lodsb + cmp esi,edi + jb .end_err + cmp al,'.' + jne @b + + add esi,2 + sub ebx,esi + dec ebx + mov [expansion_length],ebx + cld + xor eax,eax + ret + +.end_err: + cld + xor eax,eax + inc eax + ret +;--------------------------------------------------------------------- +compare_expansion: + mov ebx,[edi] + add ebx,edi + add edi,3 +.start: + cmp ebx,edi + jb .end_err + mov ecx,[expansion_length] + inc edi + + push esi edi +@@: + cld + lodsb + xchg esi,edi + shl eax,8 + lodsb + xchg esi,edi + call char_todown + xchg al,ah + call char_todown + cmp al,ah + jne @f + dec ecx + jnz @b + jmp .end +@@: + pop edi esi + jmp .start + +; jnz .start +.end: + pop edi esi + xor eax,eax + ret + +.end_err: + xor eax,eax + inc eax + ret +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/menu_key.inc b/programs/media/zsea/menu_key.inc new file mode 100644 index 0000000000..edf22a1c59 --- /dev/null +++ b/programs/media/zsea/menu_key.inc @@ -0,0 +1,171 @@ +select_menu: + call check_alt +.1: + xor eax,eax + mov [menu_data_1.ret_key],eax + + push dword menu_data_1 + call [menu_bar_activate] + + call clear_control_key_flag + + mov eax,[menu_data_1.ret_key] + mov [menu_data_1.ret_key],dword 0 + cmp eax,1 + je .6 + + cmp eax,2 + je .2 + + cmp [menu_data_1.click],dword 1 + jne still + + cmp [menu_data_1.cursor_out],dword 0 + jne analyse_out_menu_1 + jmp still +;--------------------------------------------------------------------- +.2: + xor eax,eax + mov [menu_data_2.ret_key],eax + + push dword menu_data_2 + call [menu_bar_activate] + + call clear_control_key_flag + + mov eax,[menu_data_2.ret_key] + mov [menu_data_2.ret_key],dword 0 + cmp eax,1 + je .1 + + cmp eax,2 + je .3 + + + cmp [menu_data_2.click],dword 1 + jne still + + cmp [menu_data_2.cursor_out],dword 0 + jne analyse_out_menu_2 + jmp still +;--------------------------------------------------------------------- +.3: + xor eax,eax + mov [menu_data_3.ret_key],eax + + push dword menu_data_3 + call [menu_bar_activate] + + call clear_control_key_flag + + mov eax,[menu_data_3.ret_key] + mov [menu_data_3.ret_key],dword 0 + cmp eax,1 + je .2 + + cmp eax,2 + je .4 + + + cmp [menu_data_3.click],dword 1 + jne still + + cmp [menu_data_3.cursor_out],dword 0 + jne analyse_out_menu_3 + jmp still +;--------------------------------------------------------------------- +.4: + xor eax,eax + mov [menu_data_4.ret_key],eax + + push dword menu_data_4 + call [menu_bar_activate] + + call clear_control_key_flag + + mov eax,[menu_data_4.ret_key] + mov [menu_data_4.ret_key],dword 0 + cmp eax,1 + je .3 + + cmp eax,2 + je .5 + + + cmp [menu_data_4.click],dword 1 + jne still + + cmp [menu_data_4.cursor_out],dword 0 + jne analyse_out_menu_4 + jmp still +;--------------------------------------------------------------------- +.5: + xor eax,eax + mov [menu_data_5.ret_key],eax + + push dword menu_data_5 + call [menu_bar_activate] + + call clear_control_key_flag + + mov eax,[menu_data_5.ret_key] + mov [menu_data_5.ret_key],dword 0 + cmp eax,1 + je .4 + + cmp eax,2 + je .6 + + + cmp [menu_data_5.click],dword 1 + jne still + + cmp [menu_data_5.cursor_out],dword 0 + jne analyse_out_menu_5 + jmp still +;--------------------------------------------------------------------- +.6: + xor eax,eax + mov [menu_data_6.ret_key],eax + + push dword menu_data_6 + call [menu_bar_activate] + + call clear_control_key_flag + + mov eax,[menu_data_6.ret_key] + mov [menu_data_6.ret_key],dword 0 + cmp eax,1 + je .5 + + cmp eax,2 + je .1 + + + cmp [menu_data_6.click],dword 1 + jne still + + cmp [menu_data_6.cursor_out],dword 0 + jne analyse_out_menu_6 + jmp still +;--------------------------------------------------------------------- +clear_control_key_flag: + push eax + xor eax,eax + mov [shift_flag],al + mov [ctrl_flag],al + mov [alt_flag],al + pop eax + ret +;--------------------------------------------------------------------- +check_alt: + xor eax,eax + mov al,[alt_flag] + test eax,eax + jz @f + xor ebx,ebx + ret +@@: + add esp,4 + jmp still +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/mouse.inc b/programs/media/zsea/mouse.inc new file mode 100644 index 0000000000..3d6fbc255d --- /dev/null +++ b/programs/media/zsea/mouse.inc @@ -0,0 +1,596 @@ +;--------------------------------------------------------------------- +mouse: + mcall 18,7 + cmp [active_process],eax + jne still + + mcall 37,7 + mov [mouse_scroll_data],eax + + mov eax,[mouse_position] + mov [mouse_position_old],eax + mcall 37,1 + mov [mouse_position],eax + + mov eax,[mouse_keys] + mov [mouse_keys_old],eax + mcall 37,2 + mov [mouse_keys],eax + + cmp [soi],dword 0 + je .menu_bar + cmp [scaling_mode],dword 0 + je .menu_bar + + cmp [capture_image_area_flag],1 + je capture_image_area +;----------------------------------------------------- + cmp [scroll_bar_data_vertical.delta2],0 + jne .vertical +.horizontal: + mov eax,[scroll_bar_data_horizontal.max_area] + cmp eax,[scroll_bar_data_horizontal.cur_area] + jbe .vertical + + push dword scroll_bar_data_horizontal + call [scrollbar_hor_mouse] + + ; mouse_scroll_bar_horizontal scroll_bar_data_horizontal + cmp [scroll_bar_data_horizontal.redraw],0 + je @f + + mov [scroll_bar_data_horizontal.redraw],0 + jmp .draw +@@: + cmp [scroll_bar_data_horizontal.delta2],0 + jne still +;----------------------------------------------------- +.vertical: + mov eax,[scroll_bar_data_vertical.max_area] + cmp eax,[scroll_bar_data_vertical.cur_area] + jbe .menu_bar + + push dword scroll_bar_data_vertical + call [scrollbar_ver_mouse] + +; mouse_scroll_bar_vertical scroll_bar_data_vertical + cmp [scroll_bar_data_vertical.redraw],0 + je .menu_bar ;still + mov [scroll_bar_data_vertical.redraw],0 +.draw: + call drawimage + jmp still +;--------------------------------------------------- +.clear_mouse_keys_old: + xor eax,eax + mov [mouse_keys],eax + mov [mouse_keys_old],eax + ret +;--------------------------------------------------- +.menu_bar: + cmp [scroll_bar_data_vertical.delta2],0 + jne still + cmp [scroll_bar_data_horizontal.delta2],0 + jne still +; xor eax,eax +; mov [menu_data_1.get_mouse_flag],eax +; mov [menu_data_2.get_mouse_flag],eax +; mov [menu_data_3.get_mouse_flag],eax +; mov [menu_data_4.get_mouse_flag],eax +; mov [menu_data_5.get_mouse_flag],eax +; mov [menu_data_6.get_mouse_flag],eax + +.menu_bar_1: + call .set_mouse_flag +@@: + push dword menu_data_1 + call [menu_bar_mouse] +; mouse_menubar menu_data_1 + cmp [menu_data_1.click],dword 1 + jne .menu_bar_2 + call .clear_mouse_keys_old + cmp [menu_data_1.cursor_out],dword 0 + jne analyse_out_menu_1 + jmp .menu_bar_1 +;-------------------------------------------- +.menu_bar_2: +; Edit + push dword menu_data_2 + call [menu_bar_mouse] +; mouse_menubar menu_data_2 + cmp [menu_data_2.click],dword 1 + jne .menu_bar_3 + call .clear_mouse_keys_old + cmp [menu_data_2.cursor_out],dword 0 + jne analyse_out_menu_2 + jmp .menu_bar_1 +;-------------------------------------------- +.menu_bar_3: +; View + push dword menu_data_3 + call [menu_bar_mouse] +; mouse_menubar menu_data_3 + cmp [menu_data_3.click],dword 1 + jne .menu_bar_4 + call .clear_mouse_keys_old + cmp [menu_data_3.cursor_out],dword 0 + jne analyse_out_menu_3 ;still + jmp .menu_bar_1 +;-------------------------------------------- +.menu_bar_4: +; Zoom + push dword menu_data_4 + call [menu_bar_mouse] +; mouse_menubar menu_data_4 + cmp [menu_data_4.click],dword 1 + jne .menu_bar_5 + call .clear_mouse_keys_old + cmp [menu_data_4.cursor_out],dword 0 + jne analyse_out_menu_4 + jmp .menu_bar_1 +;-------------------------------------------- +.menu_bar_5: +; Tools + push dword menu_data_5 + call [menu_bar_mouse] +; mouse_menubar menu_data_5 + cmp [menu_data_5.click],dword 1 + jne .menu_bar_6 + call .clear_mouse_keys_old + cmp [menu_data_5.cursor_out],dword 0 + jne analyse_out_menu_5 + jmp .menu_bar_1 +;-------------------------------------------- +.menu_bar_6: +; Help + push dword menu_data_6 + call [menu_bar_mouse] +; mouse_menubar menu_data_6 + cmp [menu_data_6.click],dword 1 + jne .mouse_dinamic_button + call .clear_mouse_keys_old + cmp [menu_data_6.cursor_out],dword 0 + jne analyse_out_menu_6 + jmp .menu_bar_1 +;--------------------------------------------------- +.mouse_dinamic_button: +; open file + push dword dinamic_button_data_1 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_1 + mov eax,dinamic_button_data_1.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp kfile +;------------------------------------------------- +@@: +; reload file + push dword dinamic_button_data_2 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_2 + mov eax,dinamic_button_data_2.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp kopen +;------------------------------------------------- +@@: +; left limit + push dword dinamic_button_data_3 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_3 + mov eax,dinamic_button_data_3.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp left_limit +;------------------------------------------------- +@@: +; left arrow + push dword dinamic_button_data_4 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_4 + mov eax,dinamic_button_data_4.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp move_to_left +;------------------------------------------------- +@@: +; slide show + push dword dinamic_button_data_5 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_5 + mov eax,dinamic_button_data_5.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp slide_show.3 +;------------------------------------------------- +@@: +; right arrow + push dword dinamic_button_data_6 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_6 + mov eax,dinamic_button_data_6.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp move_to_right +;------------------------------------------------- +@@: +; right limit + push dword dinamic_button_data_7 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_7 + mov eax,dinamic_button_data_7.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp right_limit +;------------------------------------------------- +@@: +; zoom + + push dword dinamic_button_data_8 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_8 + mov eax,dinamic_button_data_8.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp zoom_plus ;still +;------------------------------------------------- +@@: +; zoom - + push dword dinamic_button_data_9 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_9 + mov eax,dinamic_button_data_9.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp zoom_minus ;still +;------------------------------------------------- +@@: +; zoom 100% + push dword dinamic_button_data_10 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_10 + mov eax,dinamic_button_data_10.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp no_scaling ;still +;------------------------------------------------- +@@: +; rotate clockwise + push dword dinamic_button_data_11 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_11 + mov eax,dinamic_button_data_11.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp rotate_clockwise +;------------------------------------------------- +@@: +; rotate counter-clockwise + push dword dinamic_button_data_12 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_12 + mov eax,dinamic_button_data_12.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp rotate_counter_clockwise +;------------------------------------------------- +@@: +; file information + push dword dinamic_button_data_13 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_13 + mov eax,dinamic_button_data_13.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp kinfo +;------------------------------------------------- +@@: +; wallpaper + push dword dinamic_button_data_14 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_14 + mov eax,dinamic_button_data_14.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp k_background +;------------------------------------------------- +@@: +; settings + push dword dinamic_button_data_15 + call [dinamic_button_mouse] +; mouse_dinamic_button dinamic_button_data_15 + mov eax,dinamic_button_data_15.click + cmp [eax],dword 1 + jne @f + mov [eax],dword 0 + jmp k_option ;still +;------------------------------------------------- +@@: + jmp check_scroll_event +; jmp still +;--------------------------------------------------------------------- +.set_mouse_flag: + xor eax,eax + inc eax + mov [menu_data_1.get_mouse_flag],eax + mov [menu_data_2.get_mouse_flag],eax + mov [menu_data_3.get_mouse_flag],eax + mov [menu_data_4.get_mouse_flag],eax + mov [menu_data_5.get_mouse_flag],eax + mov [menu_data_6.get_mouse_flag],eax + ret +;--------------------------------------------------------------------- +analyse_out_menu_1: +; File + mov eax,[menu_data_1.cursor_out] + cmp eax,dword 1 + je kfile + cmp eax,dword 2 + je kinfo + cmp eax,dword 3 + je START.exit + jmp still +;--------------------------------------------------------------------- +analyse_out_menu_2: +; Edit + mov eax,[menu_data_2.cursor_out] + cmp eax,dword 1 + je rotate_clockwise + cmp eax,dword 2 + je rotate_counter_clockwise + cmp eax,dword 3 + je invert_left_to_right + cmp eax,dword 4 + je invert_up_to_down + jmp still +;--------------------------------------------------------------------- +analyse_out_menu_3: +; View + mov eax,[menu_data_3.cursor_out] + cmp eax,dword 1 + je k_sort_directory + cmp eax,dword 2 + je full_screen + cmp eax,dword 3 + je kopen + jmp still +;--------------------------------------------------------------------- +analyse_out_menu_4: +; Zoom + mov eax,[menu_data_4.cursor_out] + cmp eax,dword 1 + je no_scaling + cmp eax,dword 2 + je zoom_plus + cmp eax,dword 3 + je zoom_minus + cmp eax,dword 4 + je scaling + jmp still +;--------------------------------------------------------------------- +analyse_out_menu_5: +; Tools + mov eax,[menu_data_5.cursor_out] + cmp eax,dword 1 + je image_editor + cmp eax,dword 2 + je k_background + cmp eax,dword 3 + je slide_show.3 + cmp eax,dword 4 + je k_option + jmp still +;--------------------------------------------------------------------- +analyse_out_menu_6: +; Help + cmp [menu_data_6.cursor_out],dword 1 + je open_help + cmp [menu_data_6.cursor_out],dword 2 + je kabout + jmp still +;--------------------------------------------------------------------- +check_scroll_event: +; jmp capture_image_area + mov eax,[mouse_scroll_data] + test eax,eax + jz capture_image_area ;still + test ax,0x8000 + jnz .decr + shr eax,16 + test ax,0x8000 + jnz .decr_1 + pusha + mov eax,[scaling_mode] + test eax,eax + jnz .continue_1 + call calculation_next_value_minus + mov [calc_next_value_minus],1 +.continue_1: + popa + mov eax,zoom_factors + cmp [eax],dword zoom_factors.min + jbe still + xor ecx,ecx + mov cx,[mouse_scroll_data.vertical] + test ecx,ecx + jnz @f + mov cx,[mouse_scroll_data.horizontal] + test ecx,ecx + jz still +@@: +;---------------------------------------- + cmp [calc_next_value_minus],1 + jne @f + mov [calc_next_value_minus],0 + dec ecx + jz zoom_plus.1 +@@: + mov ebx,4 +@@: + cmp [eax],dword zoom_factors.min + jbe @f + sub [eax],ebx + dec ecx + jnz @r + jmp zoom_plus.1 +@@: + mov [eax],dword zoom_factors.min + jmp zoom_plus.1 +;---------------------------------------- +.decr: + xor ebx,ebx + mov bx,[mouse_scroll_data.vertical] + jmp @f +.decr_1: + xor ebx,ebx + mov bx,[mouse_scroll_data.horizontal] +@@: + pusha + mov eax,[scaling_mode] + test eax,eax + jnz .continue_2 + call calculation_next_value_plus + mov [calc_next_value_plus],1 +.continue_2: + popa + mov eax,zoom_factors + cmp [eax],dword zoom_factors.max + jae still + mov ecx,0xffff + sub ecx,ebx + inc ecx +;--------------------------------------- + cmp [calc_next_value_plus],1 + jne @f + mov [calc_next_value_plus],0 + dec ecx + jz zoom_plus.1 +@@: + mov ebx,4 +@@: + cmp [eax],dword zoom_factors.max + jae @f + add [eax],ebx + dec ecx + jnz @r + jmp zoom_plus.1 +@@: + mov [eax],dword zoom_factors.max + jmp zoom_plus.1 +;--------------------------------------------------------------------- +capture_image_area: + cmp [scroll_bar_data_vertical.delta2],0 + jne .no_capture + cmp [scroll_bar_data_horizontal.delta2],0 + jne .no_capture + xor eax,eax + mov [draw_scrollbar_counter],eax + mov eax,[scroll_bar_data_vertical.max_area] + cmp eax,[scroll_bar_data_vertical.cur_area] + jbe @f + inc [draw_scrollbar_counter] +@@: + mov eax,[scroll_bar_data_horizontal.max_area] + cmp eax,[scroll_bar_data_horizontal.cur_area] + jbe @f + inc [draw_scrollbar_counter] +@@: + cmp [draw_scrollbar_counter],0 + je still + + mov eax,[mouse_position] + xor ebx,ebx + mov bx,ax ; EBX mouse y + shr eax,16 ; EAX mouse x + + mov ecx,[image_start_coordinates] + xor edx,edx + mov dx,cx ; EDX start y + shr ecx,16 ; ECX start x + + cmp ax,cx + jb still ; min x + + cmp bx,dx + jb still ; min y + + add cx,[wa_width_2] + cmp ax,cx + ja still ; max x + + add dx,[wa_high_2] + cmp bx,dx + ja still ; max y + + mov ecx,[mouse_keys] + test ecx,1b ; left button + jz .no_capture ;still + + mov ecx,[mouse_keys_old] + test ecx,1b ; left button old + jz .no_capture ;still + + mov [capture_image_area_flag],1 + + mov ecx,[mouse_position_old] + xor edx,edx + mov dx,cx ; EDX mouse y old + shr ecx,16 ; ECX mouse x old + + cmp eax,ecx + je .y + ja @f + sub ecx,eax + add [scroll_bar_data_horizontal.position],ecx + jmp .y +@@: + sub eax,ecx + cmp eax,[scroll_bar_data_horizontal.position] + jb @f + xor eax,eax + mov [scroll_bar_data_horizontal.position],eax + jmp .y +@@: + sub [scroll_bar_data_horizontal.position],eax + +.y: + cmp ebx,edx + je .draw + ja @f + sub edx,ebx + add [scroll_bar_data_vertical.position],edx + jmp .draw +@@: + sub ebx,edx + + cmp ebx,[scroll_bar_data_vertical.position] + jb @f + xor eax,eax + mov [scroll_bar_data_vertical.position],eax + jmp .draw +@@: + sub [scroll_bar_data_vertical.position],ebx + +.draw: + call drawimage + call draw_scrollbars + jmp still + +.no_capture: + mov [capture_image_area_flag],0 +.end: + jmp still +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/plugins/bmp/build.bat b/programs/media/zsea/plugins/bmp/build.bat new file mode 100644 index 0000000000..b024f4a47e --- /dev/null +++ b/programs/media/zsea/plugins/bmp/build.bat @@ -0,0 +1,3 @@ +@fasm -m 16384 cnv_bmp.asm cnv_bmp.obj +@kpack cnv_bmp.obj +@pause \ No newline at end of file diff --git a/programs/media/zsea/plugins/bmp/build.sh b/programs/media/zsea/plugins/bmp/build.sh new file mode 100644 index 0000000000..4897e7722b --- /dev/null +++ b/programs/media/zsea/plugins/bmp/build.sh @@ -0,0 +1,10 @@ +#!/bin/bash +# This script does for Linux the same as build.bat for DOS, +# it compiles the current KolibriOS applications + + fasm -m 16384 cnv_bmp.asm cnv_bmp.obj + kpack cnv_bmp.obj + exit 0 + + + diff --git a/programs/media/zsea/plugins/bmp/cnv_bmp.asm b/programs/media/zsea/plugins/bmp/cnv_bmp.asm new file mode 100644 index 0000000000..46a0a106ea --- /dev/null +++ b/programs/media/zsea/plugins/bmp/cnv_bmp.asm @@ -0,0 +1,660 @@ +;***************************************************************************** +; BMP to RAW convert plugin - for zSea image viewer +; Copyright (c) 2008-2011, Marat Zakiyanov aka Mario79, aka Mario +; All rights reserved. +; +; Redistribution and use in source and binary forms, with or without +; modification, are permitted provided that the following conditions are met: +; * Redistributions of source code must retain the above copyright +; notice, this list of conditions and the following disclaimer. +; * Redistributions in binary form must reproduce the above copyright +; notice, this list of conditions and the following disclaimer in the +; documentation and/or other materials provided with the distribution. +; * Neither the name of the nor the +; names of its contributors may be used to endorse or promote products +; derived from this software without specific prior written permission. +; +; THIS SOFTWARE IS PROVIDED BY Marat Zakiyanov ''AS IS'' AND ANY +; EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +; WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +; DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY +; DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +; (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +; ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +; (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +; SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +;***************************************************************************** + +format MS COFF + +public EXPORTS + +section '.flat' code readable align 16 + +;include 'macros.inc' +include '../../../../macros.inc' +;--------------------------------------------------------------------- +START: + pushad + mov eax,dword [esp+36] + call .check_header + je @f +.no_bmp_file: + xor eax,eax + mov [raw_area],eax + inc eax ; data corrupt eax = 1 + jmp .ret + +.check_header: + mov [pointer],eax + mov eax,[eax] + mov [image_file],eax + cmp [eax],word 'BM' + ret +;--------------------------------------------------------------------- +@@: + mov [MinusHeight],byte 0 + mov edx,[eax+22] + test edx,0x80000000 + jz @f + neg edx + mov [eax+22],edx + mov [MinusHeight],byte 1 +@@: + xor edx,edx + mov dx,[eax+28] ; color resolution 1,4,8,16,24,32 bits +; mov [ebx+16],edx ; store resolution BMP + mov [resolution],edx + mov ecx,[eax+30] + mov [compression],ecx +;--------------------------------------------------------------------- + mov ecx,[eax+18] ; width BMP + imul ecx,edx ;[resolution] + mov edi,ecx + shr ecx,3 + test edi,7 + jz @f + inc ecx +@@: + imul ecx,[eax+22] ; size of pixels data area +;--------------------------------------------------------------------- + cmp edx,16 + jae .get_memory ; no palette + + mov eax,4 + xchg cl,dl + shl eax,cl + xchg cl,dl + add ecx,eax ; palette size +;--------------------------------------------------------------------- +.get_memory: + add ecx,44 ; header + mcall 68,12 + cmp eax,0 + jne @f + xor eax,eax + mov [raw_area],eax + mov eax,2 ; not enough memory + jmp .ret +@@: + mov [raw_area],eax +;--------------------------------------------------------------------- + mov edi,eax + xor eax,eax + shr ecx,2 + cld + rep stosd ; clear memory +;--------------------------------------------------------------------- +; Create RAW header +;--------------------------------------------------------------------- + mov eax,[raw_area] + mov [eax],dword 'RAW ' + mov ebx,[image_file] +;--------------------------------------------------------------------- + mov ecx,[ebx+18] ; width BMP + mov [eax+4],ecx ; width RAW +;--------------------------------------------------------------------- + mov ecx,[ebx+22] ; high BMP + mov [eax+8],ecx ; high RAW +;--------------------------------------------------------------------- + mov ecx,[resolution] ; color resolution BMP + mov [eax+12],ecx ; color resolution RAW +;--------------------------------------------------------------------- + mov ecx,[resolution] + cmp ecx,16 + jb .1 + push eax + mov eax,ecx + mov ecx,3 + xor edx,edx + div ecx + cmp eax,8 + jbe @f + mov eax,8 +@@: + mov ecx,eax + pop eax +.1: + mov [eax+16],cx ; channel color resolution RAW +;--------------------------------------------------------------------- + mov ecx,[resolution] + cmp ecx,16 + jae @f + mov [eax+18],word 1 ; channels amount RAW + jmp .2 +@@: + mov [eax+18],word 3 ; channels amount RAW +.2: +;--------------------------------------------------------------------- + xor edx,edx + cmp ecx,16 + jae @f + add edx,44 +@@: + mov [eax+20],edx ; palette pointer (offset from file start) +;--------------------------------------------------------------------- + mov ecx,[resolution] + cmp ecx,16 + jae @f + mov ecx,[resolution] + push eax + mov eax,1 + shl eax,cl + mov ecx,eax + pop eax + shl ecx,2 + jmp .3 +@@: + xor ecx,ecx +.3: + mov [eax+24],ecx ; palette area size +;--------------------------------------------------------------------- + add ecx,dword 44 + mov [eax+28],ecx ; pixels pointer (offset from file start) +;--------------------------------------------------------------------- + mov ecx,[ebx+18] ; width BMP + imul ecx,[resolution] + mov edi,ecx + shr ecx,3 + test edi,7 + jz @f + inc ecx +@@: + imul ecx,[ebx+22] ; high BMP + mov [eax+32],ecx ; pixels area size +;--------------------------------------------------------------------- + xor ecx,ecx ; Stub!!! + mov [eax+36],ecx ; Transparency pointer (offset from file start) + mov [eax+40],ecx ; Transparency area size + +;--------------------------------------------------------------------- +; Finish create RAW header +;--------------------------------------------------------------------- +; mov ebx,[pointer] +; mov [ebx+4],eax ; store [soi] pointer of image area +; mov ecx,eax +.convert: + cmp [resolution],16 + jae .no_palette +; mov [ebx+24],eax +; mov edi,eax + mov edi,[raw_area] + mov edi,[edi+20] ; palette pointer (offset from file start) + add edi,[raw_area] + mov esi,[image_file] + add esi,54 + mov ecx,[resolution] + mov eax,1 + shl eax,cl + mov ecx,eax + rep movsd + +; mov [ebx+4],edi ; store [soi] pointer of image area +.no_palette: + mov ecx,[raw_area] + mov ecx,[ecx+28] ; pixels pointer (offset from file start) + add ecx,[raw_area] +;--------------------------------------------------------------------- + mov eax,[image_file] + mov ebp,[eax+18] ; width BMP +; mov [ebx+8],ebp ; store width + imul ebp,[resolution] + mov edi,ebp + shr ebp,3 ; ebp = size of output scanline + test edi,7 + jz @f + inc ebp +@@: + mov eax,[eax+22] ; high BMP +; mov [ebx+12],eax ; store high + dec eax + mul ebp + add eax,ecx + + mov edi,ecx + mov bl,[MinusHeight] + test bl,bl + jnz @f + mov edi,eax ; edi points to last scanline +@@: + mov esi,[image_file] + add esi,[esi+10] ; start of pixels data + mov ebx,[image_file] + mov edx,[ebx+22] ; high BMP + add ebx,54 + lea eax,[ebp*2] + mov [delta],eax + test edx,edx + jz .ret + jns @f + neg edx + and [delta], 0 + mov edi,ecx +@@: +;--------------------------------------------------------------------- + cmp [compression],3 + je .BI_BITFIELDS ; @f + cmp [compression],2 + je RLE4 + cmp [compression],1 + je RLE8 + cmp [compression],0 + je @f + jmp .no_bmp_file +;--------------------------------------------------------------------- +@@: + cmp [resolution],16 + jne .continue + mov ebx,[raw_area] + mov [ebx+12],dword 15 + jmp .continue +;--------------------------------------------------------------------- +.BI_BITFIELDS: + cmp [resolution],32 + je .32 + cmp [resolution],16 + jne .continue + mov ebx,[raw_area] + mov eax,[image_file] + cmp [eax+54],dword 0x7C00 + jne @f + mov [ebx+12],dword 15 + jmp .continue +;--------------------------------------------------------------------- +@@: + cmp [eax+54],dword 0xF800 + jne @f + mov [ebx+12],dword 16 + jmp .continue +;--------------------------------------------------------------------- +@@: + cmp [eax+54],dword 0xF00 + jne .no_bmp_file ; @f + mov [ebx+12],dword 15 + +@@: + mov ebx,ebp + neg ebx + and ebx,3 + mov [aligner],ebx + shr ebp,1 + mov cl,[MinusHeight] + test cl,cl + jnz .start_16_1 +align 4 +.start_16: + mov ecx,ebp + call .process_16b_x4r4g4b4 + sub edi,[delta] + add esi,[aligner] + dec edx + jnz .start_16 + jmp .ret_ok +;--------------------------------------------------------------------- +.process_16b_x4r4g4b4: + cld +@@: + lodsw + xor ebx,ebx + mov bx,ax + xor eax,eax + ror ebx,8 + and bl,0xf + mov al,bl + shl eax,6 + rol ebx,4 + and bx,0xf + shl bl,1 + add ax,bx + shl eax,5 + rol ebx,4 + and bx,0xf + shl bl,1 + add ax,bx + stosw + dec ecx + jnz @r + ret +;--------------------------------------------------------------------- +.start_16_1: ;negative value of Height + mov ecx,ebp + call .process_16b_x4r4g4b4 + add esi,[aligner] + dec edx + jnz .start_16_1 + jmp .ret_ok +;--------------------------------------------------------------------- +.32: + mov eax,[image_file] + cmp [eax+54],dword 0xFF000000 + jne .no_bmp_file + shr ebp,2 + + mov al,[MinusHeight] + test al,al + jnz .start_32_1 +align 4 +.start_32: + mov ecx,ebp +@@: + cld + lodsd + shr eax,8 + stosd + dec ecx + jnz @r + sub edi,[delta] + dec edx + jnz .start_32 + jmp .ret_ok +;--------------------------------------------------------------------- +.start_32_1: ;negative value of Height + mov ecx,ebp + imul ecx,edx +@@: + cld + lodsd + shr eax,8 + stosd + dec ecx + jnz @r + jmp .ret_ok +;--------------------------------------------------------------------- +.continue: + mov eax,ebp + neg eax + and eax,3 + mov cl,[MinusHeight] + test cl,cl + jz .start_24 + cld +align 4 +@@: ;negative value of Height + mov ecx,ebp + rep movsb + add esi,eax + dec edx + jnz @r + jmp .ret_ok +;--------------------------------------------------------------------- +align 4 +.start_24: +@@: + mov ecx,ebp + rep movsb + sub edi,[delta] + add esi,eax + dec edx + jnz .start_24 ; @r +.ret_ok: + mov eax,0 ; convert OK +.ret: + mov ebx,[pointer] + mov [ebx+8],eax ; store return code + mov eax,[raw_area] + mov [ebx+4],eax ; store RAW pointer + popad + ret 4 +;--------------------------------------------------------------------- +RLE4: + cmp [resolution],4 + jne START.no_bmp_file + xor ebx,ebx + xor edx,edx +align 4 +.start: + cld + lodsb + cmp al,0 + jnz .Encoded_Mode + cld + lodsb + cmp al,0 + jz .end_line + cmp al,1 + jz START.ret_ok ; .end_bitmap + cmp al,2 + jz .Delta + +.Absolute_Mode: + xor ecx,ecx + mov cl,al + add ebx,ecx + cmp dl,0 + je @f + mov dh,[esi] + shr dh,4 + mov dl,[edi-1] + and dl,11110000b + add dl,dh + mov [edi-1],dl + dec ecx + xor edx,edx + mov dh,1 +@@: + test cl,1b + jz @f + inc ecx + inc edx +@@: + shr ecx,1 + cmp dh,1 + je .1 + mov eax,ecx + cld + rep movsb + test eax,1b + jz @f + inc esi +@@: + jmp .start +;--------------------------------------------------------------------- +.1: + mov dh,cl +@@: + cld + lodsb + mov ah,[esi] + shl al,4 + shr ah,4 + add al,ah + cld + stosb + dec ecx + jnz @r + test dh,1b + jz @f + inc esi +@@: + xor dh,dh + jmp .start +;--------------------------------------------------------------------- +.Encoded_Mode: + xor ecx,ecx + mov cl,al + add ebx,ecx + cld + lodsb + cmp dl,0 + je @f + rol al,4 + mov dh,al + and dh,00001111b + mov dl,[edi-1] + and dl,11110000b + add dl,dh + mov [edi-1],dl + dec ecx + xor edx,edx +@@: + test cl,1b + jz @f + inc ecx + inc edx +@@: + shr ecx,1 + cld + rep stosb + cmp dl,0 + je @f + mov al,[edi-1] + and al,11110000b + mov [edi-1],al +@@: + jmp .start +;--------------------------------------------------------------------- +.Delta: + xor eax,eax + cld + lodsb + add ebx,eax + cmp dl,0 + je @f + dec eax + xor edx,edx +@@: + test al,1b + jz @f + inc eax + inc edx +@@: + shr eax,1 + add edi,eax + cld + lodsb + imul eax,ebp + sub edi,eax + jmp .start +;--------------------------------------------------------------------- +.end_line: + mov eax,ebp + test ebx,1b + jz @f + inc ebx +@@: + shr ebx,1 + sub eax,ebx + add edi,eax + sub edi,[delta] + xor ebx,ebx + xor edx,edx + jmp .start +;--------------------------------------------------------------------- +RLE8: + cmp [resolution],8 + jne START.no_bmp_file + xor ebx,ebx +align 4 +.start: + cld + lodsb + cmp al,0 + jnz .Encoded_Mode + cld + lodsb + cmp al,0 + jz .end_line + cmp al,1 + jz START.ret_ok ; .end_bitmap + cmp al,2 + jz .Delta + +.Absolute_Mode: + xor ecx,ecx + mov cl,al + add ebx,ecx + mov eax,ecx + cld + rep movsb + test eax,1b + jz @f + inc esi +@@: + jmp .start +;--------------------------------------------------------------------- +.Encoded_Mode: + xor ecx,ecx + mov cl,al + add ebx,ecx + cld + lodsb + rep stosb + jmp .start +;--------------------------------------------------------------------- +.Delta: + xor eax,eax + cld + lodsb + add edi,eax + add ebx,eax + cld + lodsb + imul eax,ebp + sub edi,eax + jmp .start +;--------------------------------------------------------------------- +.end_line: + mov eax,ebp + sub eax,ebx + add edi,eax + xor ebx,ebx + sub edi,[delta] + jmp .start +;--------------------------------------------------------------------- +Check_Header: + pushad + mov eax,dword [esp+36] + call START.check_header + jne START.no_bmp_file + popad + ret 4 +;--------------------------------------------------------------------- +Associations: + dd Associations.end - Associations + db 'BMP',0 +.end: + db 0 +;--------------------------------------------------------------------- +align 16 +EXPORTS: + dd szStart, START + dd szVersion, 0x00010002 + dd szCheck, Check_Header + dd szAssoc, Associations + dd 0 + +pointer dd 0 +image_file dd 0 +delta dd 0 +aligner dd 0 +resolution dd 0 +compression dd 0 +raw_area dd 0 +MinusHeight db 0 + +szStart db 'START',0 +szVersion db 'version',0 +szCheck db 'Check_Header',0 +szAssoc db 'Associations',0 +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/plugins/convert/build.bat b/programs/media/zsea/plugins/convert/build.bat new file mode 100644 index 0000000000..2d3ab7d7f2 --- /dev/null +++ b/programs/media/zsea/plugins/convert/build.bat @@ -0,0 +1,3 @@ +@fasm -m 16384 convert.asm convert.obj +@kpack convert.obj +@pause \ No newline at end of file diff --git a/programs/media/zsea/plugins/convert/build.sh b/programs/media/zsea/plugins/convert/build.sh new file mode 100644 index 0000000000..1db4896ffd --- /dev/null +++ b/programs/media/zsea/plugins/convert/build.sh @@ -0,0 +1,10 @@ +#!/bin/bash +# This script does for Linux the same as build.bat for DOS, +# it compiles the current KolibriOS applications + + fasm -m 16384 convert.asm convert.obj + kpack convert.obj + exit 0 + + + diff --git a/programs/media/zsea/plugins/convert/convert.asm b/programs/media/zsea/plugins/convert/convert.asm new file mode 100644 index 0000000000..c82e17bff5 --- /dev/null +++ b/programs/media/zsea/plugins/convert/convert.asm @@ -0,0 +1,496 @@ +;***************************************************************************** +; RAW to RAW convert plugin - for zSea image viewer +; Copyright (c) 2008-2011, Marat Zakiyanov aka Mario79, aka Mario +; All rights reserved. +; +; Redistribution and use in source and binary forms, with or without +; modification, are permitted provided that the following conditions are met: +; * Redistributions of source code must retain the above copyright +; notice, this list of conditions and the following disclaimer. +; * Redistributions in binary form must reproduce the above copyright +; notice, this list of conditions and the following disclaimer in the +; documentation and/or other materials provided with the distribution. +; * Neither the name of the nor the +; names of its contributors may be used to endorse or promote products +; derived from this software without specific prior written permission. +; +; THIS SOFTWARE IS PROVIDED BY Marat Zakiyanov ''AS IS'' AND ANY +; EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +; WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +; DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY +; DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +; (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +; ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +; (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +; SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +;***************************************************************************** + +; Convert: +; 16b in 8b +; 1b,2b,3b in 8b + +format MS COFF + +public EXPORTS + +section '.flat' code readable align 16 + +;include 'macros.inc' +include '../../../../macros.inc' +;--------------------------------------------------------------------- +START: + pushad + mov [pointer],eax + mov eax,[eax+4] + mov [image_file],eax + mov esi,[eax+28] + add esi,eax + mov edi,esi + mov ecx,[eax+32] +; xor ebx,ebx +; mov [raw_area],ebx + +; mov ebx,[pointer] +; movzx eax,word [eax+18] +; mov [ebx+24],eax +; jmp .ret_ok + + cmp [eax+16],word 16 + je .16b + cmp [eax+12],dword 1 + je .1b + cmp [eax+12],dword 2 + je .2b + cmp [eax+12],dword 4 + je .4b +;--------------------------------------------------------------------- +.ret_ok: +; mov ebx,[pointer] +; mov eax,[raw_area] +; mov [ebx+20],eax ; store RAW pointer +; mov [ebx+24],ecx + + mov ebx,[image_file] + cmp [ebx+18],word 2 + jne @f + mov eax,[ebx+12] + shr eax,1 + mov [ebx+12],eax +@@: + + popad + ret +;--------------------------------------------------------------------- +.less_8b: + mov edx,[image_file] + mov ecx,[area_size] + add ecx,[edx+28] + mcall 68,20 + mov [image_file],eax + + + mov ecx,[area_size] + mov eax,ecx + shr ecx,2 + test eax,3 + jz @f + inc ecx +@@: + mov esi,[raw_area] + mov edi,[image_file] + add edi,[edi+28] + cld + rep movsd + + mov ecx,[raw_area] + mcall 68,13 + mov eax,[image_file] + mov ebx,[pointer] + mov [ebx+4],eax + popad + ret +;--------------------------------------------------------------------- +.16b: + cmp [eax+18],word 3 + je @f ;.convert_16_in_8 + cmp [eax+18],word 4 + jne .16b_1 +@@: + xor ebx,ebx + mov bx,[eax+18] + + xchg eax,ecx + xor edx,edx + div ebx + xchg ecx,eax + + shr ecx,1 + + mov [eax+16],word 8 + mov ebx,[eax+12] + shr ebx,1 + mov [eax+12],ebx + + mov ebx,eax +; jmp .ret_ok + +.convert_16_in_8: ; converting 16 bit sample to 8 bit + cld + lodsw + mov al,ah + stosb + + lodsw + mov al,ah + stosb + + lodsw + mov al,ah + stosb + + cmp [ebx+18],word 4 + jne @f + lodsw + mov al,ah + stosb +@@: + dec ecx + jnz .convert_16_in_8 + jmp .16b_end +;--------------------------------------------------------------------- +.16b_1: + cmp [eax+18],word 1 + je @f ;.convert_16_in_8_1 + cmp [eax+18],word 2 + jne .16b_end +@@: + shr ecx,1 + + mov [eax+16],word 8 + mov ebx,[eax+12] + shr ebx,1 + mov [eax+12],ebx + +.convert_16_in_8_1: + cld + lodsw +; shr ax,8 +; mov al,ah + stosb + dec ecx + jnz .convert_16_in_8_1 +;--------------------------------------------------------------------- +.16b_end: + xor eax,eax + mov [raw_area],eax + jmp .ret_ok +;--------------------------------------------------------------------- +.4b: + call .get_memory + mov edx,ebx + inc ebx + shr ebx,1 +.4b_1: + push ebx edi +@@: + cld + lodsb + shl eax,8 + mov al,ah + and ah,0xf + shr al,4 + stosw + + dec ebx + jnz @b + pop edi ebx + add edi,edx + dec ecx + jnz .4b_1 + + jmp .less_8b ;.ret_ok +;--------------------------------------------------------------------- +.2b: + call .get_memory +; jmp .ret_ok +; shr ecx,1 + mov edx,ebx + mov eax,ebx + shr ebx,2 + test eax,3 + jz @f + inc ebx +@@: + mov ebp,ebx +.2b_1: + push ebp edi +@@: + cld + lodsb + + mov bl,al + + and al,11b + shl ax,8 + + mov al,bl + shr al,2 + and al,11b + shl eax,8 + + mov al,bl + shr al,4 + and al,11b + shl eax,8 + + mov al,bl + shr al,6 + and al,11b + + stosd + + dec ebp + jnz @b + pop edi ebp + + add edi,edx + dec ecx + jnz .2b_1 + + jmp .less_8b ;.ret_ok +;--------------------------------------------------------------------- +.1b: + call .get_memory + mov edx,ebx + mov eax,ebx + shr ebx,3 + test eax,7 + jz @f + inc ebx +@@: + mov ebp,ebx +.1b_1: + push ebp edi +@@: + cld + lodsb + + mov bl,al + shr al,4 + and al,1b + shl ax,8 + + mov al,bl + shr al,5 + and al,1b + shl eax,8 + + mov al,bl + shr al,6 + and al,1b + shl eax,8 + + mov al,bl + shr al,7 +; and al,1b +; shl eax,8 + + stosd + + mov al,bl + and al,1b + shl ax,8 + + mov al,bl + shr al,1 + and al,1b + shl eax,8 + + mov al,bl + shr al,2 + and al,1b + shl eax,8 + + mov al,bl + shr al,3 + and al,1b + + stosd + + dec ebp + jnz @b + pop edi ebp + + add edi,edx + dec ecx + jnz .1b_1 + jmp .less_8b ;.ret_ok +;--------------------------------------------------------------------- +.get_memory: + mov ebx,dword 8 + mov [eax+16],bx + mov [eax+12],ebx +; mov esi,[eax+28] +; add esi,eax +; push ecx + mov ecx,[eax+4] + imul ecx,[eax+8] + push eax + mov [area_size],ecx + mcall 68,12 +; pop ecx + mov [raw_area],eax + mov edi,eax + pop eax + mov ebx,[eax+4] + mov ecx,[eax+8] + ret +;--------------------------------------------------------------------- +Convert24b: + pushad + mov [pointer],eax + mov eax,[eax+4] + mov [image_file],eax + + mov esi,[eax+28] + add esi,eax + + mov ebp,[eax+20] + add ebp,eax + + mov ecx,[eax+4] + imul ecx,[eax+8] + push eax ecx + lea ecx,[ecx*3] + mcall 68,12 + mov [raw_area],eax + mov edi,eax + pop ecx eax + + cmp [eax+12],dword 32 + je .32b + cmp [eax+12],dword 16 + je .16b + cmp [eax+12],dword 15 + je .15b + cmp [eax+12],dword 8 + je .8b + +.ret_ok: + mov ebx,[pointer] + mov eax,[raw_area] + mov [ebx+20],eax ; store RAW pointer + popad + ret + +;--------------------------------------------------------------------- +.32b: + cld + lodsd + + stosw + shr eax,16 + stosb + + dec ecx + jnz .32b + + jmp .ret_ok +;--------------------------------------------------------------------- +.16b: + cld + lodsw + + xor ebx,ebx + ror ax,11 + mov bl,al + and bl,11111b + shl bl,3 + shl ebx,8 + rol ax,6 + mov bl,al + and bl,111111b + shl bl,2 + shl ebx,8 + rol ax,5 + mov bl,al + and bl,11111b + shl bl,3 + mov eax,ebx + + cld + stosw + shr eax,16 + stosb + + dec ecx + jnz .16b + + jmp .ret_ok +;--------------------------------------------------------------------- +.15b: + cld + lodsw + + xor ebx,ebx + ror ax,10 + mov bl,al + and bl,11111b + shl bl,3 + shl ebx,8 + rol ax,5 + mov bl,al + and bl,11111b + shl bl,3 + shl ebx,8 + rol ax,5 + mov bl,al + and bl,11111b + shl bl,3 + mov eax,ebx + + cld + stosw + shr eax,16 + stosb + + dec ecx + jnz .15b + + jmp .ret_ok +;--------------------------------------------------------------------- +.8b: + xor eax,eax + cld + lodsb + shl eax,2 + mov eax,[eax+ebp] + + cld + stosw + shr eax,16 + stosb + + dec ecx + jnz .8b + + jmp .ret_ok +;--------------------------------------------------------------------- +align 16 +EXPORTS: + dd szStart, START + dd szVersion, 0x00010001 + dd szConv_24b, Convert24b + dd 0 + +szStart db 'START',0 +szVersion db 'version',0 +szConv_24b db 'Convert24b',0 +pointer dd 0 +image_file dd 0 +;delta dd 0 +;resolution dd 0 +;compression dd 0 +raw_area dd 0 +area_size dd 0 \ No newline at end of file diff --git a/programs/media/zsea/plugins/gif/build.bat b/programs/media/zsea/plugins/gif/build.bat new file mode 100644 index 0000000000..fd251be2eb --- /dev/null +++ b/programs/media/zsea/plugins/gif/build.bat @@ -0,0 +1,3 @@ +@fasm -m 16384 cnv_gif.asm cnv_gif.obj +@kpack cnv_gif.obj +@pause \ No newline at end of file diff --git a/programs/media/zsea/plugins/gif/build.sh b/programs/media/zsea/plugins/gif/build.sh new file mode 100644 index 0000000000..844984a50a --- /dev/null +++ b/programs/media/zsea/plugins/gif/build.sh @@ -0,0 +1,10 @@ +#!/bin/bash +# This script does for Linux the same as build.bat for DOS, +# it compiles the current KolibriOS applications + + fasm -m 16384 cnv_gif.asm cnv_gif.obj + kpack cnv_gif.obj + exit 0 + + + diff --git a/programs/media/zsea/plugins/gif/cnv_gif.asm b/programs/media/zsea/plugins/gif/cnv_gif.asm new file mode 100644 index 0000000000..f54174b643 --- /dev/null +++ b/programs/media/zsea/plugins/gif/cnv_gif.asm @@ -0,0 +1,534 @@ +;***************************************************************************** +; GIF to RAW1 convert plugin - for zSea image viewer +; Copyright (c) 2009, Evgeny Grechnikov aka Diamond +; All rights reserved. +; +; Redistribution and use in source and binary forms, with or without +; modification, are permitted provided that the following conditions are met: +; * Redistributions of source code must retain the above copyright +; notice, this list of conditions and the following disclaimer. +; * Redistributions in binary form must reproduce the above copyright +; notice, this list of conditions and the following disclaimer in the +; documentation and/or other materials provided with the distribution. +; * Neither the name of the nor the +; names of its contributors may be used to endorse or promote products +; derived from this software without specific prior written permission. +; +; THIS SOFTWARE IS PROVIDED BY Evgeny Grechnikov ''AS IS'' AND ANY +; EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +; WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +; DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY +; DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +; (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +; ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +; (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +; SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +;***************************************************************************** +; Based on gif_lite.inc (c) Ivuskin Andrey aka Willow and Diamond 2004-2007 +;***************************************************************************** +; Some small changes (c) 2011 Marat Zakiyanov aka Mario79, aka Mario +;***************************************************************************** + +format MS COFF + +public EXPORTS + +section '.flat' code readable align 16 + +START: + pushad + mov eax,dword [esp+36] + mov esi, [eax] ; esi -> GIF data + mov ebp, [eax+12] ; ebp = file size + xor ebx, ebx ; ebx -> list of images, not allocated yet + call check_header_1 + jz ReadGIF +ReadGIF.end: +; general exit from the function + xor eax, eax + cmp ebx, eax + jz .bad + cmp dword [ebx+4], eax + jnz ReadGIF.ret + mov ecx, ebx + push 68 + pop eax + push 13 + pop ebx + int 40h + xor ebx, ebx +.bad: + inc eax ; bad image +ReadGIF.ret: + mov ecx, [esp+28] + mov [ecx+4], ebx ; save RAW data ptr + mov [ecx+8], eax ; save result + popad + ret 4 +ReadGIF.animated.ret: + mov ebx, [ReadGIF.gifList] + jmp ReadGIF.ret +_null fix 0x1000 +ReadGIF: +; allocate one page for list of images + mov ecx, 0x1000 + push 68 + pop eax + push 12 + pop ebx + int 40h + xchg eax, ebx + test ebx, ebx + jnz @f + mov al, 2 ; no memory + jmp .ret +@@: + mov dword[ebx],'RAW1' + xor eax,eax + mov [.globalColor],eax + mov [.globalColorSize],eax + mov [.curImageIndex],eax + sub ebp,0xd + jb .end + movzx eax,word[esi+6] + mov [ebx+8],eax + movzx eax,word[esi+8] + mov [ebx+12],eax + mov cl,[esi+0xa] + add esi,0xd + test cl,cl + jns .nextblock + mov [.globalColor],esi + push ebx + call .Gif_skipmap + mov [.globalColorSize],ebx + pop ebx + jb .end + .nextblock: + dec ebp + js .end + cmp byte[esi],0x21 + jne .noextblock + inc esi + cmp byte[esi],0xf9 ; Graphic Control Ext + jne .no_gc + sub ebp,7 + jc .end + mov ecx,[ebx+4] + shl ecx,4 + add ecx,ebx + mov eax,[esi+3] + mov [ecx+16+12],ax +; test byte[esi+2],1 +; setnz byte[ecx+16+14] + mov al,[esi+2] + mov [ecx+16+14], al + + mov al,[esi+5] + mov [ecx+16+15],al + add esi,7 + jmp .nextblock + .no_gc: + inc esi + xor eax,eax + .block_skip: + dec ebp + js .end + lodsb + add esi,eax + sub ebp,eax + jc .end2 + test eax,eax + jnz .block_skip + jmp .nextblock + .noextblock: + cmp byte[esi],0x2c ; image beginning + jne .end + inc esi + sub ebp,11 + jc .end2 + movzx ecx,word[esi+4] ; ecx = width + jecxz .end2 + mov [.width],ecx + movzx eax,word[esi+6] ; eax = height + test eax,eax + jz .end2 + push eax ecx + imul ecx,eax + cmp ecx,4000000h + jb @f + pop ecx eax +.end2: + jmp .end +@@: + push ebx + push ecx + add ecx,44+256*4 + push 68 + pop eax + push 12 + pop ebx + int 0x40 + pop ecx + pop ebx + test eax,eax + jnz @f + pop ecx ecx + jmp .end2 +@@: + xchg eax,edi + inc dword[ebx+4] + mov [edi+32],ecx ; size of pixels area + mov byte[edi+20],44 ; pointer to palette + mov byte[edi+24+1],4 ; size of palette=256*4 + mov dword[edi+28],44+256*4 ; pointer to RAW data + pop ecx eax + mov dword[edi], 'RAW ' ; signature + mov dword[edi+4],ecx ; width + mov dword[edi+8],eax ; height + mov byte[edi+12],8 ; total pixel size + mov byte[edi+16],8 ; 8 bits per component + mov byte[edi+18],1 ; number of components + mov eax,[ebx+4] + shl eax,4 + add eax,ebx + mov [eax],edi + movzx ecx,word[esi] + mov [eax+4],ecx + movzx ecx,word[esi+2] + mov [eax+8],ecx + mov eax,[edi+32] + mov [.img_end],eax + inc eax + mov [.row_end],eax + and [.pass],0 + test byte[esi+8],40h + jz @f + mov ecx,[edi+4] + mov [.row_end],ecx +@@: + mov cl,[esi+8] + add esi,9 + add edi,44 + push edi + test cl,cl + js .uselocal + push esi + mov esi,[.globalColor] + mov ecx,[.globalColorSize] + call .swap_palette + pop esi + jmp .setPal + .uselocal: + push ebx + call .Gif_skipmap + jnc @f + pop ebx + pop edi + jmp .end +@@: + sub esi,ebx + mov ecx,ebx + pop ebx + call .swap_palette + .setPal: + movzx ecx,byte[esi] + inc ecx + mov [.codesize],ecx + dec ecx + inc esi + mov edi,.gif_workarea + xor eax,eax + lodsb ; eax - block_count + add eax,esi + mov [.block_ofs],eax + mov [.bit_count],8 + mov eax,1 + shl eax,cl + mov [.CC],eax + mov ecx,eax + inc eax + mov [.EOI],eax + mov eax, _null shl 16 + .filltable: + stosd + inc eax + loop .filltable + pop edi + add edi,256*4 + mov [.img_start],edi + add [.img_end],edi + add [.row_end],edi + mov [.ebx],ebx + .reinit: + mov edx,[.EOI] + inc edx + push [.codesize] + pop [.compsize] + call .Gif_get_sym + cmp eax,[.CC] + je .reinit + call .Gif_output + .cycle: + movzx ebx,ax + call .Gif_get_sym + cmp eax,edx + jae .notintable + cmp eax,[.CC] + je .reinit + cmp eax,[.EOI] + je .unpend + call .Gif_output + .add: + mov dword [.gif_workarea+edx*4],ebx + cmp edx,0xFFF + jae .cycle + inc edx + bsr ebx,edx + cmp ebx,[.compsize] + jne .noinc + inc [.compsize] + .noinc: + jmp .cycle + .notintable: + push eax + mov eax,ebx + call .Gif_output + push ebx + movzx eax,bx + call .Gif_output + pop ebx eax + jmp .add +.unpend: + mov ebx,[.ebx] + add ebp,esi + mov esi,[.block_ofs] + sub ebp,esi + jc .end2 + xor eax,eax +@@: + dec ebp + js .end2 + lodsb + test eax,eax + jz @f + sub ebp,eax + jc .end2 + add esi,eax + jmp @b +@@: + test ebp,ebp + jz .end2 + cmp byte[esi],0x3b + jz .end2 +; next image + mov ecx,[ebx+4] + cmp cl,0xFF + jnz .noresize + mov edx,ebx + inc ecx + inc ecx + shl ecx,4 + push 68 + pop eax + push 20 + pop ebx + int 40h + test eax,eax + jnz @f + mov ebx,edx + jmp .end2 + @@: + xchg ebx,eax + .noresize: + jmp .nextblock + +.Gif_skipmap: +; in: ecx - image descriptor, esi - pointer to colormap +; out: edi - pointer to area after colormap + + and ecx,111b ; color map size + mov ebx,3*2 + shl ebx,cl + add esi,ebx + sub ebp,ebx + ret + +.Gif_get_sym: + mov ecx,[.compsize] + push ecx + xor eax,eax + .shift: + ror byte[esi],1 + rcr eax,1 + dec [.bit_count] + jnz .loop1 + inc esi + cmp esi,[.block_ofs] + jb .noblock + push eax + xor eax,eax + dec ebp + js .dataend + lodsb + test eax,eax + jnz .nextbl + mov eax,[.EOI] + sub esi,2 + add esp,8 + jmp .exx + .nextbl: + add eax,esi + mov [.block_ofs],eax + pop eax + .noblock: + mov [.bit_count],8 + .loop1: + loop .shift + pop ecx + rol eax,cl + .exx: + xor ecx,ecx + ret + +.dataend: + pop eax eax + mov ebx, [.ebx] + jmp .end2 + +.Gif_output: + push esi eax edx + mov edx,.gif_workarea + .next: + push word[edx+eax*4] + mov ax,word[edx+eax*4+2] + inc ecx + cmp ax,_null + jnz .next + shl ebx,16 + mov bx,[esp] + .loop2: + pop ax + + stosb + + cmp edi,[.row_end] + jb .norowend + mov eax,[.width] + push eax + sub edi,eax + add eax,eax + cmp [.pass],3 + jz @f + add eax,eax + cmp [.pass],2 + jz @f + add eax,eax +@@: + add edi,eax + pop eax + cmp edi,[.img_end] + jb .nextrow + mov edi,[.img_start] + inc [.pass] + add edi,eax + cmp [.pass],3 + jz @f + add edi,eax + cmp [.pass],2 + jz @f + add edi,eax + add edi,eax +@@: +.nextrow: + add eax,edi + mov [.row_end],eax + xor eax,eax +.norowend: + + loop .loop2 + pop edx eax esi + ret + +.swap_palette: + xor eax,eax +@@: + lodsb + mov ah,al + lodsb + shl eax,8 + lodsb + stosd + sub ecx,3 + jnz @b + ret +;--------------------------------------------------------------------- +check_header_1: + and dword [eax+8], 0 + cmp dword [eax+12], 6 + jb .err + push eax + mov eax, [eax] + cmp dword [eax], 'GIF8' + jnz .errpop + cmp byte [eax+5], 'a' + jnz .errpop + cmp byte [eax+4], '7' + jz @f + cmp byte [eax+4], '9' + jnz .errpop +@@: + pop eax + ret +.errpop: + pop eax +.err: + inc dword [eax+8] + ret +;--------------------------------------------------------------------- +check_header: + pushad + mov eax,dword [esp+36] + call check_header_1 + popad + ret 4 +;--------------------------------------------------------------------- +Associations: +dd Associations.end - Associations +db 'GIF',0 +.end: +db 0 +;--------------------------------------------------------------------- +align 4 +EXPORTS: + dd szStart, START + dd szVersion, 0x00010002 + dd szCheck, check_header + dd szAssoc, Associations + dd 0 + +szStart db 'START',0 +szVersion db 'version',0 +szCheck db 'Check_Header',0 +szAssoc db 'Associations',0 + +section '.data' data readable writable align 16 + ReadGIF.globalColor rd 1 + ReadGIF.globalColorSize rd 1 + ReadGIF.cur_info rd 1 ; image table pointer + ReadGIF.codesize rd 1 + ReadGIF.compsize rd 1 + ReadGIF.bit_count rd 1 + ReadGIF.CC rd 1 + ReadGIF.EOI rd 1 + ReadGIF.block_ofs rd 1 + ReadGIF.row_end rd 1 + ReadGIF.img_end rd 1 + ReadGIF.img_start rd 1 + ReadGIF.pass rd 1 + ReadGIF.width rd 1 + ReadGIF.ebx rd 1 + ReadGIF.gifList rd 1 + ReadGIF.curImageIndex rd 1 + ReadGIF.gif_workarea rb 16*1024 diff --git a/programs/media/zsea/plugins/jpeg/build.bat b/programs/media/zsea/plugins/jpeg/build.bat new file mode 100644 index 0000000000..35cf3e4f03 --- /dev/null +++ b/programs/media/zsea/plugins/jpeg/build.bat @@ -0,0 +1,3 @@ +@fasm -m 16384 cnv_jpeg.asm cnv_jpeg.obj +@kpack cnv_jpeg.obj +@pause \ No newline at end of file diff --git a/programs/media/zsea/plugins/jpeg/build.sh b/programs/media/zsea/plugins/jpeg/build.sh new file mode 100644 index 0000000000..2b9efbe564 --- /dev/null +++ b/programs/media/zsea/plugins/jpeg/build.sh @@ -0,0 +1,10 @@ +#!/bin/bash +# This script does for Linux the same as build.bat for DOS, +# it compiles the current KolibriOS applications + + fasm -m 16384 cnv_jpeg.asm cnv_jpeg.obj + kpack cnv_jpeg.obj + exit 0 + + + diff --git a/programs/media/zsea/plugins/jpeg/cnv_jpeg.asm b/programs/media/zsea/plugins/jpeg/cnv_jpeg.asm new file mode 100644 index 0000000000..c6eb93f29b --- /dev/null +++ b/programs/media/zsea/plugins/jpeg/cnv_jpeg.asm @@ -0,0 +1,2378 @@ +;***************************************************************************** +; JPEG to RAW convert plugin - for zSea image viewer +; Copyright (c) 2008, 2009, Evgeny Grechnikov aka Diamond +; All rights reserved. +; +; Redistribution and use in source and binary forms, with or without +; modification, are permitted provided that the following conditions are met: +; * Redistributions of source code must retain the above copyright +; notice, this list of conditions and the following disclaimer. +; * Redistributions in binary form must reproduce the above copyright +; notice, this list of conditions and the following disclaimer in the +; documentation and/or other materials provided with the distribution. +; * Neither the name of the nor the +; names of its contributors may be used to endorse or promote products +; derived from this software without specific prior written permission. +; +; THIS SOFTWARE IS PROVIDED BY Evgeny Grechnikov ''AS IS'' AND ANY +; EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +; WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +; DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY +; DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +; (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +; ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +; (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +; SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +;***************************************************************************** +; Some small changes (c) 2011 Marat Zakiyanov aka Mario79, aka Mario +;***************************************************************************** + +format MS COFF + +public EXPORTS + +section '.flat' code readable align 16 + +START: + pushad + finit + mov eax,dword [esp+36] + mov esi, [eax] ; esi -> JPEG data + mov ebp, [eax+12] ; ebp = file size + mov [_esp], esp +; initialize constant tables, if not yet + cmp [color_table_1+4], 0 + jnz @f + call initialize_color_table +@@: + xor ebx, ebx ; ebx -> RAW data, not allocated yet + mov [dct_buffer], ebx + mov [_ebx], ebx +; check for SOI [Start-Of-Image] marker + call get_marker + jc .end + cmp al, 0xD8 ; SOI? + jz .soi_ok +.end: +; general exit from the function +; for progressive mode: convert loaded DCT coefficients to image + call handle_progressive +; convert full-color images to RGB + call convert_to_rgb + xor eax, eax + test ebx, ebx + jnz @f + inc eax ; ebx=0 => bad image +@@: +.ret: + mov ecx, [esp+28] + mov [ecx+4], ebx ; save RAW data ptr + mov [ecx+8], eax ; save result + popad + ret 4 +.soi_ok: + mov [restart_interval], ebx + mov [adobe_ycck], 0 +; loop until start of frame (real data), parse markers +.markers_loop: + call get_marker + jc .end +; markers RSTn do not have parameters +; N.B. They can not exist in this part of JPEG, but let's be liberal :) + cmp al, 0xD0 + jb @f + cmp al, 0xD8 + jb .markers_loop +@@: + cmp al, 0xD9 ; EOI? [invalid here] + jz .end +; ok, this is marker segment +; first word is length of the segment + cmp ebp, 2 + jb .end + xor edx, edx + mov dl, [esi+1] + mov dh, [esi] ; edx = marker length, al = marker value + sub ebp, edx + jb .end + cmp al, 0xDB ; DQT? + jz .dqt + cmp al, 0xC4 ; DHT? + jz .dht + cmp al, 0xCC ; DAC? [ignored - no arithmetic coding] + jz .next_marker + cmp al, 0xDD ; DRI? + jz .dri + cmp al, 0xDA ; SOS? + jz .sos + cmp al, 0xC0 + jb @f + cmp al, 0xD0 + jb .sofn +@@: + cmp al, 0xEE ; APP14? + jz .app14 +; unrecognized marker; let's skip it and hope for the best +.next_marker: + add esi, edx + jmp .markers_loop +.app14: +; check for special Adobe marker + cmp dx, 14 + jb .next_marker + cmp byte [esi+2], 'A' + jnz .next_marker + cmp dword [esi+3], 'dobe' + jnz .next_marker + cmp byte [esi+13], 2 + setz [adobe_ycck] + jmp .next_marker +.dqt: +; DQT marker found +; length: 2 bytes for length field + 65 bytes per table + sub edx, 2 + jc .end + lodsw +.dqt_loop: + test edx, edx + jz .markers_loop + sub edx, 1+64 + jc .end + lodsb +; 8-bit DCT-based process shall not use a 16-bit precision quantization table. + test al, 0xF0 + jnz .end + and eax, 3 + mov [eax+quant_tables_defined], 1 + shl eax, 8 + lea edi, [eax+quant_tables] + xor ecx, ecx +@@: + xor eax, eax + lodsb + push eax + fild dword [esp] + pop eax + movzx eax, byte [zigzag+ecx] + add eax, eax + push eax + and eax, 7*4 + fmul dword [idct_pre_table+eax] + pop eax + push eax + shr eax, 3 + and eax, 7*4 + fmul dword [idct_pre_table+eax] + pop eax + fstp dword [edi+eax] + inc ecx + cmp ecx, 64 + jb @b + jmp .dqt_loop +.dri: +; DRI marker found + cmp edx, 4 ; length must be 4 + jnz .end2 + movzx eax, word [esi+2] + xchg al, ah + mov [restart_interval], eax + jmp .next_marker +.dht: +; DHT marker found + sub edx, 2 + jc .end2 + lodsw +.dht_loop: + test edx, edx + jz .markers_loop + sub edx, 17 + jc .end2 +; next Huffman table; find place for it + lodsb + mov edi, eax + and eax, 0x10 + and edi, 3 + shr eax, 2 + or edi, eax + mov [dc_huffman_defined+edi], 1 +; shl edi, 11 + imul edi, max_hufftable_size + add edi, dc_huffman ; edi -> destination table +; get table size + xor eax, eax + push 16 + pop ecx +@@: + add al, [esi] + adc ah, 0 + inc esi + loop @b + cmp ax, 0x100 + ja .end2 + sub edx, eax + jc .end2 +; construct Huffman tree + push ebx edx + ; lea eax, [edi+256*8] + ; push eax + ; push 16 + ; mov edx, esi +; @@: + ; cmp byte [edx-1], 0 + ; jnz @f + ; dec edx + ; dec dword [esp] + ; jmp @b +; @@: + ; sub edx, [esp] + ; lea eax, [edi+8] + ; push 2 + ; pop ecx +; .lenloop: + ; mov bl, byte [edx] + ; test bl, bl + ; jz .len1done + ; push eax + ; xor eax, eax +; .len1loop: + ; dec ecx + ; js .dhterr + ; cmp edi, [esp+8] + ; jae .dhterr + ; lodsb + ; stosd + ; dec bl + ; jnz .len1loop + ; pop eax +; .len1done: + ; jecxz .len2done + ; push ecx +; .len2loop: + ; cmp eax, [esp+8] + ; jb @f + ; or eax, -1 +; @@: + ; cmp edi, [esp+8] + ; jae .dhterr + ; stosd + ; add eax, 8 + ; jnb @f + ; or eax, -1 +; @@: + ; loop .len2loop + ; pop ecx +; .len2done: + ; add ecx, ecx + ; inc edx + ; dec dword [esp] + ; jnz .lenloop + ; pop eax + ; pop eax + ; sub eax, edi + ; shr eax, 2 + ; cmp eax, ecx + ; ja @f + ; mov ecx, eax +; @@: + ; or eax, -1 + ; rep stosd + ; pop edx ebx + ; jmp .dht_loop +; .dhterr: + ; ;pop eax eax eax edx ebx + ; add esp, 5*4 + lea eax, [edi+256*2] + push eax + lea edx, [esi-16] + mov ah, 1 + mov ecx, 128 +.dht_l1: + movzx ebx, byte [edx] + inc edx + test ebx, ebx + jz .dht_l3 +.dht_l2: + cmp edi, [esp] + jae .dhterr1 + lodsb + xchg al, ah + push ecx + rep stosw + pop ecx + xchg al, ah + dec ebx + jnz .dht_l2 +.dht_l3: + inc ah + shr ecx, 1 + jnz .dht_l1 + push edi + mov edi, [esp+4] + push edi + mov eax, 0x00090100 + mov cl, 8 +.dht_l4: + movzx ebx, byte [edx] + inc edx + test ebx, ebx + jz .dht_l6 +.dht_l5: + cmp edi, [esp] + jb @f + mov edi, [esp+4] + rol eax, 16 + cmp edi, [esp+8] + jae .dhterr2 + stosw + inc ah + mov [esp+4], edi + pop edi + push edi + rol eax, 16 + add dword [esp], 16*2 +@@: + lodsb + xchg al, ah + push ecx + rep stosw + pop ecx + xchg al, ah + dec ebx + jnz .dht_l5 +.dht_l6: + inc ah + shr ecx, 1 + jnz .dht_l4 + push edi + movzx ebx, byte [edx] + add ebx, ebx + add bl, [edx+1] + adc bh, 0 + add ebx, ebx + add bl, [edx+2] + adc bh, 0 + add ebx, ebx + add bl, [edx+3] + adc bh, 0 + add ebx, 15 + shr ebx, 4 + mov cl, 8 + lea ebx, [edi+ebx*2] + sub ebx, [esp+12] + add ebx, 31 + shr ebx, 5 + mov edi, ebx + shl edi, 5 + add edi, [esp+12] + xor ebx, 9 + shl ebx, 16 + xor eax, ebx + push edi +.dht_l7: + movzx ebx, byte [edx] + inc edx + test ebx, ebx + jz .dht_l10 +.dht_l8: + cmp edi, [esp] + jb .dht_l9 + mov edi, [esp+4] + cmp edi, [esp+8] + jb @f + mov edi, [esp+12] + cmp edi, [esp+16] + jae .dhterr3 + mov al, 9 + stosb + rol eax, 8 + stosb + inc eax + ror eax, 8 + mov [esp+12], edi + mov edi, [esp+8] + add dword [esp+8], 16*2 +@@: + mov al, 9 + stosb + rol eax, 16 + stosb + inc eax + ror eax, 16 + mov [esp+4], edi + pop edi + push edi + add dword [esp], 16*2 +.dht_l9: + lodsb + xchg al, ah + push ecx + rep stosw + pop ecx + xchg al, ah + dec ebx + jnz .dht_l8 +.dht_l10: + inc ah + shr ecx, 1 + jnz .dht_l7 + push -1 + pop eax + pop ecx + sub ecx, edi + rep stosb + pop edi + pop ecx + sub ecx, edi + rep stosb + pop edi + pop ecx + sub ecx, edi + rep stosb + pop edx ebx + jmp .dht_loop +.dhterr3: + pop eax eax +.dhterr2: + pop eax eax +.dhterr1: + pop eax + pop edx ebx +.end2: + jmp .end +.sofn: +; SOFn marker found + test ebx, ebx + jnz .end2 ; only one frame is allowed +; only SOF0 [baseline sequential], SOF1 [extended sequential], SOF2 [progressive] +; nobody supports other compression methods + cmp al, 0xC2 + ja .end2 + setz [progressive] +; Length must be at least 8 + sub edx, 8 + jb .end2 +; Sample precision in JFIF must be 8 bits + cmp byte [esi+2], 8 + jnz .end2 +; Color space in JFIF is either YCbCr (color images, 3 components) +; or Y (grey images, 1 component) + movzx eax, byte [esi+7] + cmp al, 1 + jz @f + cmp al, 3 + jz @f +; Adobe products sometimes use YCCK color space with 4 components + cmp al, 4 + jnz .end2 + cmp [adobe_ycck], 0 + jz .end2 +@@: + mov edi, eax ; edi = number of components + lea eax, [eax*3] + sub edx, eax + jnz .end2 +; get width and height +; width must be nonzero +; height must be nonzero - nobody supports DNL markers + mov ah, [esi+3] + mov al, [esi+4] ; eax = height + test eax, eax + jz .end2 + xor ecx, ecx + mov ch, [esi+5] + mov cl, [esi+6] ; ecx = width + jecxz .end3 + push eax ecx + imul ecx, eax + cmp ecx, 4000000h + jb @f + pop ecx eax +.end3: + jmp .end2 +@@: + imul ecx, edi + push ecx + add ecx, 44+1 +; for grayscale images, allocate additional memory for palette + cmp edi, 1 + jnz @f + add ecx, 256*4-1 +@@: + push 68 + pop eax + push 12 + pop ebx + int 0x40 + mov ebx, eax + test eax, eax + jnz @f + pop ecx + mov al, 2 + jmp .ret +@@: +; OS zeroes all allocated memory +; push edx edi +; mov edi, eax +; mov edx, ecx +; shr ecx, 2 +; xor eax, eax +; rep stosd +; mov ecx, edx +; and ecx, 3 +; rep stosb +; mov ecx, edx +; pop edi edx + mov [_ebx], ebx + pop dword [ebx+32] ; size of pixels area + push 44 + pop eax + mov dword [ebx+28], eax ; pointer to RGB data +; create grayscale palette if needed + cmp edi, 1 + jnz .no_create_palette + mov dword [ebx+20], eax + mov ecx, 256*4 + mov dword [ebx+24], ecx + add dword [ebx+28], ecx + push edi + shr ecx, 2 + xor eax, eax + lea edi, [ebx+44] +@@: + stosd + add eax, 0x010101 + loop @b + pop edi +.no_create_palette: +; other image characteristics + pop ecx eax + mov dword [ebx], 'RAW ' ; signature + mov dword [ebx+4], ecx ; width + mov dword [ebx+8], eax ; height + mov eax, edi + shl eax, 3 + mov dword [ebx+12], eax ; total pixel size + mov byte [ebx+16], 8 ; 8 bits per component + mov word [ebx+18], di ; number of components + mov [delta_x], eax + mov [pixel_size], edi + ;mov eax, edi + imul eax, ecx + mov [delta_y], eax + shr eax, 3 + mov [line_size], eax +; and dword [ebx+36], 0 ; transparency data pointer = NULL +; and dword [ebx+40], 0 ; transparency data size + add esi, 8 + mov ecx, edi + mov edi, components + xor eax, eax + xor edx, edx +.sof_parse_comp: + movsb ; db ComponentIdentifier + lodsb + mov ah, al + and al, 0xF + jz .end3 + shr ah, 4 + jz .end3 + stosd ; db V, db H, db ?, db ? (will be filled later) + cmp dl, al + ja @f + mov dl, al +@@: + cmp dh, ah + ja @f + mov dh, ah +@@: + movsb ; db QuantizationTableID + loop .sof_parse_comp + mov word [max_v], dx + movzx eax, dh + movzx edx, dl + push eax edx + shl eax, 3 + shl edx, 3 + mov [block_width], eax + mov [block_height], edx + pop edx eax + push eax edx + imul eax, [delta_x] + mov [block_delta_x], eax + imul edx, [delta_y] + mov [block_delta_y], edx + mov eax, [ebx+4] + add eax, [block_width] + dec eax + xor edx, edx + div [block_width] + mov [x_num_blocks], eax + mov eax, [ebx+8] + add eax, [block_height] + dec eax + xor edx, edx + div [block_height] + mov [y_num_blocks], eax + mov cl, [ebx+18] + pop edx + mov edi, components +@@: + mov eax, edx + div byte [edi+1] ; VMax / V_i = VFactor_i + mov byte [edi+3], al ; db VFactor + pop eax + push eax + div byte [edi+2] ; HMax / H_i = HFactor_i + mov byte [edi+4], al ; db HFactor + add edi, 6 + loop @b + pop eax + cmp [progressive], 0 + jz .sof_noprogressive + mov eax, [x_num_blocks] + mul [block_width] + mul [y_num_blocks] + mul [block_height] + add eax, eax + mov [dct_buffer_size], eax + mul [pixel_size] + xchg eax, ecx + push ebx + push 68 + pop eax + push 12 + pop ebx + int 0x40 + pop ebx + test eax, eax + jnz @f + mov ecx, ebx + push 68 + pop eax + push 13 + pop ebx + int 0x40 + xor ebx, ebx + jmp .end +@@: + mov [dct_buffer], eax +.sof_noprogressive: + jmp .markers_loop +.sos: +; SOS marker found +; frame must be already opened + test ebx, ebx + jz .end3 + cmp edx, 6 + jb .end3 +; parse marker + movzx eax, byte [esi+2] ; number of components in this scan + test eax, eax + jz .end3 ; must be nonzero + cmp al, [ebx+18] + ja .end3 ; must be <= total number of components +; mov [ns], eax + cmp al, 1 + setz [not_interleaved] + lea ecx, [6+eax+eax] + cmp edx, ecx + jnz .end3 + mov ecx, eax + mov edi, cur_components + add esi, 3 +.sos_find_comp: + lodsb ; got ComponentID, look for component info + push ecx esi + mov cl, [ebx+18] + mov esi, components + and dword [edi+48], 0 + and dword [edi+52], 0 +@@: + cmp [esi], al + jz @f + inc dword [edi+52] + add esi, 6 + loop @b +@@: + mov eax, [esi+1] + mov dl, [esi+5] + pop esi ecx + jnz .end3 ; bad ComponentID + cmp [not_interleaved], 0 + jz @f + mov ax, 0x0101 +@@: + stosd ; db V, db H, db VFactor, db HFactor + xor eax, eax + mov al, byte [edi-1] ; get HFactor + mul byte [ebx+18] ; number of components + stosd ; HIncrement_i = HFactor_i * sizeof(pixel) + mov al, byte [edi-4-2] ; get VFactor + mul byte [ebx+18] ; number of components + imul eax, [ebx+4] ; image width + stosd ; VIncrement_i = VFactor_i * sizeof(row) + xchg eax, edx + and eax, 3 + cmp [quant_tables_defined+eax], 0 + jz .end3 + shl eax, 8 + add eax, quant_tables + stosd ; dd QuantizationTable + lodsb + movzx eax, al + mov edx, eax + shr eax, 4 + and edx, 3 + and eax, 3 + cmp [dc_huffman_defined+eax], 0 + jnz .dc_table_ok + cmp [progressive], 0 + jz .end3 + xor eax, eax + jmp .dc_table_done +.dc_table_ok: +; shl eax, 11 + imul eax, max_hufftable_size + add eax, dc_huffman +.dc_table_done: + cmp [ac_huffman_defined+edx], 0 + jnz .ac_table_ok + cmp [progressive], 0 + jz .end3 + xor edx, edx + jmp .ac_table_done +.ac_table_ok: +; shl edx, 11 + imul edx, max_hufftable_size + add edx, ac_huffman +.ac_table_done: + stosd ; dd DCTable + xchg eax, edx + stosd ; dd ACTable + push ecx + mov eax, [ebx+4] + movzx ecx, byte [edi-21] ; get HFactor + cdq ; edx:eax = width (width<0x10000, so as dword it is unsigned) + div ecx + stosd ; dd width / HFactor_i + stosd + xchg eax, ecx + inc eax + sub eax, edx + stosd ; dd HFactor_i+1 - (width % HFactor_i) + mov eax, [ebx+8] + movzx ecx, byte [edi-34] ; get VFactor + cdq + div ecx + stosd ; dd height / VFactor_i + stosd + xchg eax, ecx + inc eax + sub eax, edx + stosd ; dd VFactor_i+1 - (height % VFactor_i) + pop ecx + scasd ; dd DCPrediction + cmp dword [edi], 0 + setnp al + ror al, 1 + mov byte [edi-1], al + scasd ; dd ComponentOffset + dec ecx + jnz .sos_find_comp + mov [cur_components_end], edi + mov edi, ScanStart + movsb + cmp byte [esi], 63 + ja .end3 + movsb + lodsb + push eax + and al, 0xF + stosb + pop eax + shr al, 4 + stosb +; now unpack data + call init_limits + and [decoded_MCUs], 0 + mov [cur_rst_marker], 7 + and [huffman_bits], 0 + cmp [progressive], 0 + jz .sos_noprogressive +; progressive mode - only decode DCT coefficients +; initialize pointers to coefficients data +; zero number of EOBs for AC coefficients +; redefine HIncrement and VIncrement + mov edi, cur_components +.coeff_init: + mov eax, [dct_buffer_size] + mul dword [edi+52] + add eax, [dct_buffer] + mov [edi+12], eax + and dword [edi+52], 0 + cmp [ScanStart], 0 + jz .scan_dc + cmp dword [edi+20], 0 + jz .end3 + jmp @f +.scan_dc: + cmp dword [edi+16], 0 + jz .end3 +@@: + movzx eax, byte [edi+1] + shl eax, 7 + mov [edi+4], eax + mov eax, [edi+28] + mov cl, [edi+3] + cmp cl, [edi+32] + sbb eax, -7-1 + shr eax, 3 + shl eax, 7 + mov [edi+8], eax + add edi, 56 + cmp edi, [cur_components_end] + jb .coeff_init +; unpack coefficients +; N.B. Speed optimization has sense here. + push ebx +.coeff_decode_loop: + mov edx, cur_components +.coeff_components_loop: + mov edi, [edx+12] + movzx ecx, byte [edx] + push dword [edx+40] + push edi +.coeff_y_loop: + push ecx + movzx eax, byte [edx+1] + push dword [edx+28] + push edi +.coeff_x_loop: + cmp dword [edx+40], 0 + jl @f + cmp dword [edx+28], 0 + jge .realdata +@@: + cmp [not_interleaved], 0 + jnz .norealdata + push eax edi + mov edi, dct_coeff + call decode_progressive_coeff + pop edi eax + jmp .norealdata +.realdata: + push eax + call decode_progressive_coeff + add edi, 64*2 + pop eax +.norealdata: + sub dword [edx+28], 8 + sub eax, 1 + jnz .coeff_x_loop + pop edi + pop dword [edx+28] + add edi, [edx+8] + pop ecx + sub dword [edx+40], 8 + sub ecx, 1 + jnz .coeff_y_loop + movzx eax, byte [edx+1] + shl eax, 3 + pop edi + add edi, [edx+4] + pop dword [edx+40] + sub [edx+28], eax + mov [edx+12], edi + add edx, 56 + cmp edx, [cur_components_end] + jnz .coeff_components_loop + call next_MCU + jc .norst + sub [cur_x], 1 + jnz .coeff_decode_loop + call next_line + mov edx, cur_components +@@: + mov eax, [max_x] + imul eax, [edx+4] + sub [edx+12], eax + movzx eax, byte [edx] + imul eax, [edx+8] + add [edx+12], eax + add edx, 56 + cmp edx, [cur_components_end] + jnz @b + sub [cur_y], 1 + jnz .coeff_decode_loop + pop ebx + jmp .markers_loop +.norst: + pop ebx + jmp .end4 +.sos_noprogressive: +; normal mode - unpack JPEG image + mov edi, [ebx+28] + add edi, ebx + mov [cur_out_ptr], edi +; N.B. Speed optimization has sense here. +.decode_loop: + call decode_MCU + call next_MCU + jc .end4 + sub [cur_x], 1 + jnz .decode_loop + call next_line + sub [cur_y], 1 + jnz .decode_loop + jmp .markers_loop +.end4: + jmp .end3 +;--------------------------------------------------------------------- +get_marker: +; in: esi -> data +; out: CF=0, al=marker value - ok +; CF=1 - no marker + sub ebp, 1 + jc .ret + lodsb +if 1 + cmp al, 0xFF + jae @f +; Some stupid men, which do not read specifications and manuals, +; sometimes create markers with length field two less than true +; value (in JPEG length of marker = length of data INCLUDING +; length field itself). To open such files, allow 2 bytes +; before next marker. + cmp ebp, 2 + jb .ret + lodsb + lodsb +end if + cmp al, 0xFF + jb .ret +@@: + sub ebp, 1 + jc .ret + lodsb + cmp al, 0xFF + jz @b + clc +.ret: + ret +;--------------------------------------------------------------------- +align 16 +decode_MCU: + mov edx, cur_components +.components_loop: +; decode each component + push [cur_out_ptr] + movzx ecx, byte [edx] + push dword [edx+40] +; we have H_i * V_i blocks of packed data, decode them +.y_loop_1: + push [cur_out_ptr] + push ecx + movzx eax, byte [edx+1] + push dword [edx+28] +.x_loop_1: + push eax + call decode_data_unit + cmp dword [edx+40], 0 + jl .nocopyloop + cmp dword [edx+28], 0 + jl .nocopyloop +; now we have decoded block 8*8 in decoded_data +; H_i * V_i packed blocks 8*8 make up one block (8*HMax) * (8*VMax) +; so each pixel in packed block corresponds to HFact * VFact pixels + movzx ecx, byte [edx+2] + push esi ebp + mov edi, [cur_out_ptr] + add edi, [edx+52] +.y_loop_2: + push ecx edi + cmp ecx, [edx+44] + mov ecx, [edx+40] + sbb ecx, 8-1 + sbb eax, eax + and ecx, eax + add ecx, 8 + jz .skip_x_loop_2 + movzx eax, byte [edx+3] +.x_loop_2: + push eax ecx edi + cmp eax, [edx+32] + mov eax, [edx+28] + sbb eax, 8-1 + sbb ebp, ebp + and eax, ebp + mov ebp, .copyiter_all + mov esi, decoded_data + sub ebp, eax + sub ebp, eax + sub ebp, eax + mov eax, [edx+4] + sub eax, 1 +.copyloop: + push esi edi + jmp ebp +.copyiter_all: + movsb +repeat 7 + add edi, eax + movsb +end repeat + nop + nop + pop edi esi + add edi, [edx+8] + add esi, 8 + sub ecx, 1 + jnz .copyloop + pop edi ecx eax + add edi, [pixel_size] + sub eax, 1 + jnz .x_loop_2 +.skip_x_loop_2: + pop edi ecx + add edi, [line_size] + sub ecx, 1 + jnz .y_loop_2 + pop ebp esi +.nocopyloop: + mov eax, [delta_x] + add [cur_out_ptr], eax + pop eax + sub dword [edx+28], 8 + sub eax, 1 + jnz .x_loop_1 + pop dword [edx+28] + pop ecx + pop eax + sub dword [edx+40], 8 + add eax, [delta_y] + mov [cur_out_ptr], eax + sub ecx, 1 + jnz .y_loop_1 + movzx eax, byte [edx+1] + pop dword [edx+40] + shl eax, 3 + pop [cur_out_ptr] + sub dword [edx+28], eax + add edx, 56 + cmp edx, [cur_components_end] + jb .components_loop + mov eax, [cur_block_dx] + add [cur_out_ptr], eax + ret + +align 16 +next_MCU: + add [decoded_MCUs], 1 + mov eax, [restart_interval] + test eax, eax + jz .no_restart + cmp [decoded_MCUs], eax + jb .no_restart + and [decoded_MCUs], 0 + and [huffman_bits], 0 + cmp [cur_x], 1 + jnz @f + cmp [cur_y], 1 + jz .no_restart +@@: +; restart marker must be present + sub ebp, 2 + js .error + cmp byte [esi], 0xFF + jnz .error + mov al, [cur_rst_marker] + inc eax + and al, 7 + mov [cur_rst_marker], al + add al, 0xD0 + cmp [esi+1], al + jnz .error + add esi, 2 +; handle restart marker - zero all DC predictions + mov edx, cur_components +@@: + and word [edx+48], 0 + add edx, 56 + cmp edx, [cur_components_end] + jb @b +.no_restart: + clc + ret +.error: + stc + ret + +next_line: + mov eax, [max_x] + mov [cur_x], eax + mul [cur_block_dx] + sub eax, [cur_block_dy] + sub [cur_out_ptr], eax + mov edx, cur_components +@@: + mov eax, [edx+24] + mov [edx+28], eax + movzx eax, byte [edx] + shl eax, 3 + sub [edx+40], eax + add edx, 56 + cmp edx, [cur_components_end] + jb @b + ret + +init_limits: + push [x_num_blocks] + pop [max_x] + push [y_num_blocks] + pop [max_y] + push [block_delta_x] + pop [cur_block_dx] + push [block_delta_y] + pop [cur_block_dy] + cmp [not_interleaved], 0 + jz @f + mov eax, dword [cur_components+28] + movzx ecx, byte [cur_components+3] + cmp cl, [cur_components+32] + sbb eax, -7-1 + shr eax, 3 + mov [max_x], eax + mov eax, dword [cur_components+40] + movzx edx, byte [cur_components+2] + cmp dl, [cur_components+44] + sbb eax, -7-1 + shr eax, 3 + mov [max_y], eax + imul ecx, [delta_x] + mov [cur_block_dx], ecx + imul edx, [delta_y] + mov [cur_block_dy], edx +@@: + push [max_x] + pop [cur_x] + push [max_y] + pop [cur_y] + ret + +;macro get_bit +;{ +;local .l1,.l2,.marker +; add cl, cl +; jnz .l1 +; sub ebp, 1 +; js decode_data_unit.eof +; mov cl, [esi] +; cmp cl, 0xFF +; jnz .l2 +;.marker: +; add esi, 1 +; sub ebp, 1 +; js decode_data_unit.eof +; cmp byte [esi], 0xFF +; jz .marker +; cmp byte [esi], 0 +; jnz decode_data_unit.eof +;.l2: +; sub esi, -1 +; adc cl, cl +;.l1: +;} +macro get_bit +{ +local .l1,.l2,.marker + sub cl, 1 + jns .l1 + sub ebp, 1 + js .eof + mov ch, [esi] + cmp ch, 0xFF + jnz .l2 +.marker: + add esi, 1 + sub ebp, 1 + js .eof + cmp byte [esi], 0xFF + jz .marker + cmp byte [esi], 0 + jnz .eof +.l2: + add esi, 1 + mov cl, 7 +.l1: + add ch, ch +} +macro get_bits restore_edx +{ +local .l1,.l2,.l3,.marker2 + movzx eax, ch + mov dl, cl + shl eax, 24 + neg cl + push ebx + add cl, 24 +.l1: + cmp bl, dl + jbe .l2 + sub bl, dl + sub ebp, 1 + js .eof + mov ch, [esi] + cmp ch, 0xFF + jnz .l3 +.marker2: + add esi, 1 + sub ebp, 1 + js .eof + cmp byte [esi], 0xFF + jz .marker2 + cmp byte [esi], 0 + jnz .eof +.l3: + movzx edx, ch + add esi, 1 + shl edx, cl + sub cl, 8 + or eax, edx + mov dl, 8 + jmp .l1 +.l2: + mov cl, bl + sub dl, bl + shl ch, cl + pop ebx + cmp eax, 80000000h + rcr eax, 1 + mov cl, 31 + sub cl, bl + sar eax, cl + mov cl, dl +if restore_edx eq true + pop edx +end if + add eax, 80000000h + adc eax, 80000000h +} +; macro get_huffman_code +; { +; local .l1 + ; xor ebx, ebx +; .l1: + ; get_bit + ; adc ebx, ebx + ; mov eax, [eax+4*ebx] + ; xor ebx, ebx + ; cmp eax, -1 + ; jz .eof + ; cmp eax, 0x1000 + ; jae .l1 + ; mov ebx, eax +; } +macro get_huffman_code +{ +local .l1,.l2,.l3,.l4,.l5,.l6,.nomarker1,.marker1,.nomarker2,.marker2,.nomarker3,.marker3,.done +; 1. (First level in Huffman table) Does the current Huffman code fit in 8 bits +; and have we got enough bits? + movzx ebx, ch + cmp byte [eax+ebx*2], cl + jbe .l1 +; 2a. No; load next byte + sub ebp, 1 + js .eof + mov ch, [esi] + movzx edx, ch + cmp ch, 0xFF + jnz .nomarker1 +.marker1: + add esi, 1 + sub ebp, 1 + js .eof + cmp byte [esi], 0xFF + jz .marker1 + cmp byte [esi], 0 + jnz .eof +.nomarker1: + shr edx, cl + add esi, 1 + or ebx, edx +; 3a. (First level in Huffman table, >=8 bits known) Does the current Huffman code fit in 8 bits? + cmp byte [eax+ebx*2], 8 + jbe .l2 + jl .eof +; 4aa. No; go to next level + movzx ebx, byte [eax+ebx*2+1] + mov dl, ch + shl ebx, 5 + ror edx, cl + lea ebx, [eax+ebx+0x200] + shr edx, 24 + push edx + shr edx, 4 +; 5aa. (Second level in Huffman table) Does the current Huffman code fit in 12 bits +; and have we got enough bits? + cmp byte [ebx+edx*2], cl + jbe .l3 +; 6aaa. No; have we got 12 bits? + cmp cl, 4 + jae .l4 +; 7aaaa. No; load next byte + pop edx + sub ebp, 1 + js .eof + mov ch, [esi] + cmp ch, 0xFF + jnz .nomarker2 +.marker2: + add esi, 1 + sub ebp, 1 + js .eof + cmp byte [esi], 0xFF + jz .marker2 + cmp byte [esi], 0 + jnz .eof +.nomarker2: + push ecx + shr ch, cl + add esi, 1 + or dl, ch + pop ecx + push edx + shr edx, 4 +; 8aaaa. (Second level in Huffman table) Does the current Huffman code fit in 12 bits? + cmp byte [ebx+edx*2], 4 + jbe .l5 + jl .eof +; 9aaaaa. No; go to next level + movzx ebx, byte [ebx+edx*2+1] + pop edx + shl ebx, 5 + and edx, 0xF + lea ebx, [eax+ebx+0x200] +; 10aaaaa. Get current code length and value + sub cl, [ebx+edx*2] + movzx eax, byte [ebx+edx*2+1] + neg cl + shl ch, cl + neg cl + add cl, 8 + jmp .done +.l5: +; 9aaaab. Yes; get current code length and value + sub cl, [ebx+edx*2] + movzx eax, byte [ebx+edx*2+1] + neg cl + pop edx + shl ch, cl + neg cl + add cl, 8 + jmp .done +.l4: +; 7aaab. Yes; go to next level + movzx ebx, byte [ebx+edx*2+1] + pop edx + shl ebx, 5 + and edx, 0xF + lea ebx, [eax+ebx+0x200] +; 8aaab. (Third level in Huffman table) Have we got enough bits? + cmp [ebx+edx*2], cl + jbe .l6 +; 9aaaba. No; load next byte + sub ebp, 1 + js .eof + mov ch, [esi] + cmp ch, 0xFF + jnz .nomarker3 +.marker3: + add esi, 1 + sub ebp, 1 + js .eof + cmp byte [esi], 0xFF + jz .marker3 + cmp byte [esi], 0 + jnz .eof +.nomarker3: + push ecx + shr ch, cl + add esi, 1 + or dl, ch + pop ecx +; 10aaaba. Get current code length and value + sub cl, [ebx+edx*2] + movzx eax, byte [ebx+edx*2+1] + neg cl + shl ch, cl + neg cl + add cl, 8 + jmp .done +.l3: +; 6aab. Yes; get current code length and value + pop eax +.l6: +; 9aaabb. Yes; get current code length and value + sub cl, [ebx+edx*2] + movzx eax, byte [ebx+edx*2+1] + xor cl, 7 + shl ch, cl + xor cl, 7 + add ch, ch + jmp .done +.l2: +; 3ab. Yes; get current code length and value + sub cl, [eax+ebx*2] + movzx eax, byte [eax+ebx*2+1] + neg cl + shl ch, cl + neg cl + add cl, 8 + jmp .done +.l1: +; 3b. Yes; get current code length and value + mov dl, [eax+ebx*2] + movzx eax, byte [eax+ebx*2+1] + xchg cl, dl + sub dl, cl + shl ch, cl + mov cl, dl +.done: + mov ebx, eax +} +; Decode DCT coefficients for one 8*8 block in progressive mode +; from input stream, given by pointer esi and length ebp +; N.B. Speed optimization has sense here. +align 16 +decode_progressive_coeff: + mov ecx, [huffman_bits] + cmp [ScanStart], 0 + jnz .ac +; DC coefficient + cmp [ApproxPosHigh], 0 + jz .dc_first +; DC coefficient, subsequent passes + xor eax, eax + get_bit + adc eax, eax + mov [huffman_bits], ecx + mov cl, [ApproxPosLow] + shl eax, cl + or [edi], ax + ret +.dc_first: +; DC coefficient, first pass + mov eax, [edx+16] + push edx + get_huffman_code + get_bits true + add eax, [edx+48] + mov [edx+48], ax + mov [huffman_bits], ecx + mov cl, [ApproxPosLow] + shl eax, cl + mov [edi], ax + ret +.ac: +; AC coefficients + movzx eax, [ScanStart] + cmp al, [ScanEnd] + ja .ret + cmp dword [edx+52], 0 + jnz .was_eob +.acloop: + push edx + push eax + mov eax, [edx+20] + get_huffman_code + pop eax + test ebx, 15 + jz .band + push eax ebx + and ebx, 15 + get_bits false + pop ebx + xchg eax, [esp] + shr ebx, 4 +.zeroloop1: + push eax ebx + movzx eax, byte [zigzag+eax] + xor ebx, ebx + cmp word [edi+eax], bx + jz .zeroloop2 + get_bit + jnc @f + push ecx + mov cl, [ApproxPosLow] + xor ebx, ebx + cmp byte [edi+eax+1], 80h + adc ebx, 0 + add ebx, ebx + sub ebx, 1 + shl ebx, cl + pop ecx + add [edi+eax], bx +@@: + pop ebx eax +@@: + add eax, 1 + cmp al, [ScanEnd] + ja decode_data_unit.eof + jmp .zeroloop1 +.zeroloop2: + pop ebx eax + sub ebx, 1 + jns @b +.nozero1: + pop ebx + test ebx, ebx + jz @f + push eax + movzx eax, byte [zigzag+eax] + push ecx + mov cl, [ApproxPosLow] + shl ebx, cl + pop ecx + mov [edi+eax], bx + pop eax +@@: + add eax, 1 + pop edx + cmp al, [ScanEnd] + jbe .acloop + mov [huffman_bits], ecx +.ret: + ret +.eof: + jmp decode_data_unit.eof +.band: + shr ebx, 4 + cmp ebx, 15 + jnz .eob + push 0 + jmp .zeroloop1 +.eob: + pop edx + push eax + mov eax, 1 + test ebx, ebx + jz .eob0 +@@: + get_bit + adc eax, eax + sub ebx, 1 + jnz @b +.eob0: + mov [edx+52], eax + pop eax +.was_eob: + sub dword [edx+52], 1 + cmp al, [ScanEnd] + ja .ret2 +.zeroloop3: + push eax + movzx eax, byte [zigzag+eax] + xor ebx, ebx + cmp word [edi+eax], bx + jz @f + get_bit + jnc @f + push ecx + mov cl, [ApproxPosLow] + xor ebx, ebx + cmp byte [edi+eax+1], 80h + adc ebx, 0 + add ebx, ebx + sub ebx, 1 + shl ebx, cl + pop ecx + add [edi+eax], bx +@@: + pop eax + add eax, 1 + cmp al, [ScanEnd] + jbe .zeroloop3 +.ret2: + mov [huffman_bits], ecx + ret + +handle_progressive: + cmp [dct_buffer], 0 + jnz @f + ret +@@: +; information for all components + mov esi, components + xor ebp, ebp + movzx ecx, byte [ebx+18] +.next_component: + mov edi, cur_components + lodsb ; ComponentID + lodsd + mov ax, 0x0101 + stosd ; db V, db H, db VFactor, db HFactor + xor eax, eax + mov al, byte [edi-1] ; get HFactor + mul byte [ebx+18] ; number of components + stosd ; HIncrement_i = HFactor_i * sizeof(pixel) + mov al, byte [edi-4-2] ; get VFactor + mul byte [ebx+18] ; number of components + mul dword [ebx+4] ; image width + stosd ; VIncrement_i = VFactor_i * sizeof(row) + lodsb + and eax, 3 + cmp [quant_tables_defined+eax], 0 + jz .error + shl eax, 8 + add eax, quant_tables + stosd ; dd QuantizationTable + stosd ; dd DCTable - ignored + mov eax, ebp + mul [dct_buffer_size] + add eax, [dct_buffer] + stosd ; instead of dd ACTable - pointer to current DCT coefficients + push ecx + mov eax, [ebx+4] + movzx ecx, byte [edi-21] ; get HFactor +; cdq ; edx = 0 as a result of previous mul + div ecx + stosd ; dd width / HFactor_i + stosd + xchg eax, ecx + inc eax + sub eax, edx + stosd ; dd HFactor_i+1 - (width % HFactor_i) + mov eax, [ebx+8] + movzx ecx, byte [edi-34] ; get VFactor + cdq + div ecx + stosd ; dd height / VFactor_i + stosd + xchg eax, ecx + inc eax + sub eax, edx + stosd ; dd VFactor_i+1 - (height % VFactor_i) + pop ecx + xor eax, eax + test ebp, ebp + setnp al + ror eax, 1 + stosd ; dd DCPrediction + mov eax, ebp + stosd ; dd ComponentOffset + inc ebp + push ecx + mov [cur_components_end], edi + lea edx, [edi-56] +; do IDCT and unpack + mov edi, [ebx+28] + add edi, ebx + mov [cur_out_ptr], edi + mov [not_interleaved], 1 + call init_limits +.decode_loop: + call decode_MCU + sub [cur_x], 1 + jnz .decode_loop + call next_line + sub [cur_y], 1 + jnz .decode_loop + pop ecx + dec ecx + jnz .next_component +; image unpacked, return +.error: + push ebx + push 68 + pop eax + push 13 + pop ebx + mov ecx, [dct_buffer] + int 0x40 + pop ebx + ret + +; Support for YCbCr -> RGB conversion +; R = Y + 1.402 * (Cr - 128) +; G = Y - 0.34414 * (Cb - 128) - 0.71414 * (Cr - 128) +; B = Y + 1.772 * (Cb - 128) +; When converting YCbCr -> RGB, we need to do some multiplications; +; to be faster, we precalculate the table for all 256 possible values +; Also we approximate fractions with N/65536, this gives sufficient precision +initialize_color_table: +; 1.402 = 1 + 26345/65536, -0.71414 = -46802/65536 +; -0.34414 = -22554/65536, 1.772 = 1 + 50594/65536 + mov edi, color_table_1 + mov ecx, 128 +; 1. Cb -> 1.772*Cb + xor eax, eax + mov dx, 8000h +.l1: + push ecx +@@: + stosd + add dx, 50594 + adc eax, 1 + loop @b + neg dx + adc eax, -1 + neg eax + pop ecx + jnz .l1 +; 2. Cb -> -0.34414*Cb + mov ax, dx +.l2: + push ecx +@@: + stosd + sub eax, 22554 + loop @b + neg eax + pop ecx + cmp ax, dx + jnz .l2 + xor eax, eax +; 3. Cr -> -0.71414*Cr +.l3: + push ecx +@@: + stosd + sub eax, 46802 + loop @b + neg eax + pop ecx + jnz .l3 +; 4. Cr -> 1.402*Cr +.l4: + push ecx +@@: + stosd + add dx, 26345 + adc eax, 1 + loop @b + neg dx + adc eax, -1 + neg eax + pop ecx + jnz .l4 + ret + +; this function is called in the end of image loading +convert_to_rgb: +; some checks + test ebx, ebx ; image exists? + jz .ret + cmp byte [ebx+18], 3 ; full-color image? + jz .ycc2rgb + cmp byte [ebx+18], 4 + jz .ycck2rgb +.ret: + ret +.ycc2rgb: +; conversion is needed + mov esi, [ebx+4] + imul esi, [ebx+8] + lea edi, [ebx+44] + push ebx +; N.B. Speed optimization has sense here. +align 16 +.loop: +; mov ebx, [edi] +; mov edx, ebx +; mov ecx, ebx +; movzx ebx, bl ; ebx = Y +; shr edx, 16 +; mov eax, ebx +; movzx edx, dl ; edx = Cr +; movzx ecx, ch ; ecx = Cb + movzx ebx, byte [edi] + movzx ecx, byte [edi+1] + mov eax, ebx + movzx edx, byte [edi+2] +; B = Y + color_table_1[Cb] + add eax, [color_table_1+ecx*4] + mov ebp, [color_table_2+ecx*4] + cmp eax, 80000000h + sbb ecx, ecx + and eax, ecx + add ebp, [color_table_3+edx*4] + cmp eax, 0x100 + sbb ecx, ecx + not ecx + sar ebp, 16 + or eax, ecx + mov [edi], al +; G = Y + color_table_2[Cb] + color_table_3[Cr] + lea eax, [ebx+ebp] + cmp eax, 80000000h + sbb ecx, ecx + and eax, ecx + cmp eax, 0x100 + sbb ecx, ecx + not ecx + or eax, ecx + mov [edi+1], al +; R = Y + color_table_4[Cr] + mov eax, ebx + add eax, [color_table_4+edx*4] + cmp eax, 80000000h + sbb ecx, ecx + and eax, ecx + cmp eax, 0x100 + sbb ecx, ecx + not ecx + or eax, ecx + mov [edi+2], al + add edi, 3 + sub esi, 1 + jnz .loop + pop ebx + ret +.ycck2rgb: +; conversion is needed + mov esi, [ebx+4] + imul esi, [ebx+8] + push ebx + push esi + lea edi, [ebx+44] + mov esi, edi +; N.B. Speed optimization has sense here. +align 16 +.kloop: +; mov ebx, [esi] +; mov edx, ebx +; mov ecx, ebx +; movzx ebx, bl ; ebx = Y +; shr edx, 16 +; mov eax, ebx +; movzx edx, dl ; edx = Cr +; movzx ecx, ch ; ecx = Cb + movzx ebx, byte [esi] + movzx ecx, byte [esi+1] + mov eax, ebx + movzx edx, byte [esi+2] +; B = Y + color_table_1[Cb] + add eax, [color_table_1+ecx*4] + mov ebp, [color_table_2+ecx*4] + cmp eax, 80000000h + sbb ecx, ecx + and eax, ecx + add ebp, [color_table_3+edx*4] + cmp eax, 0x100 + sbb ecx, ecx + not ecx + sar ebp, 16 + or eax, ecx + xor al, 0xFF + mul byte [esi+3] + add al, ah + adc ah, 0 + add al, 80h + adc ah, 0 + mov byte [edi], ah +; G = Y + color_table_2[Cb] + color_table_3[Cr] + lea eax, [ebx+ebp] + cmp eax, 80000000h + sbb ecx, ecx + and eax, ecx + cmp eax, 0x100 + sbb ecx, ecx + not ecx + or eax, ecx + xor al, 0xFF + mul byte [esi+3] + add al, ah + adc ah, 0 + add al, 80h + adc ah, 0 + mov byte [edi+1], ah +; R = Y + color_table_4[Cr] + mov eax, ebx + add eax, [color_table_4+edx*4] + cmp eax, 80000000h + sbb ecx, ecx + and eax, ecx + cmp eax, 0x100 + sbb ecx, ecx + not ecx + or eax, ecx + xor al, 0xFF + mul byte [esi+3] + add al, ah + adc ah, 0 + add al, 80h + adc ah, 0 + mov byte [edi+2], ah + add esi, 4 + add edi, 3 + sub dword [esp], 1 + jnz .kloop + pop eax + pop ebx +; now correct values in RAW header + mov byte [ebx+12], 24 + mov byte [ebx+18], 3 + mov ecx, [ebx+32] + shr ecx, 2 + lea ecx, [ecx*3] + mov [ebx+22], ecx +; release some memory - must succeed because we decrease size + add ecx, 44+1 + mov edx, ebx + push 68 + pop eax + push 20 + pop ebx + int 0x40 + mov ebx, eax + ret + +; Decodes one data unit, that is, 8*8 block, +; from input stream, given by pointer esi and length ebp +; N.B. Speed optimization has sense here. +align 16 +decode_data_unit: +; edx -> component data + cmp [progressive], 0 + jz @f + mov edi, [edx+20] + add dword [edx+20], 64*2 + jmp .coeff_decoded +@@: + mov edi, dct_coeff + mov ecx, 64*2/4 + xor eax, eax + rep stosd + mov edi, zigzag+1 + mov ecx, [huffman_bits] +; read DC coefficient + mov eax, [edx+16] + push edx + get_huffman_code + get_bits true + add eax, [edx+48] + mov [dct_coeff], ax + mov [edx+48], ax +; read AC coefficients +@@: + mov eax, [edx+20] + push edx + get_huffman_code + shr eax, 4 + and ebx, 15 + jz .band + add edi, eax + cmp edi, zigzag+64 + jae .eof + get_bits true + movzx ebx, byte [edi] + mov [dct_coeff+ebx], ax + add edi, 1 + cmp edi, zigzag+64 + jb @b + jmp .do_idct +.band: + pop edx + cmp al, 15 + jnz .do_idct + add edi, 16 + cmp edi, zigzag+64 + jb @b +; jmp .eof +.do_idct: + mov edi, dct_coeff + mov [huffman_bits], ecx +; coefficients loaded, now IDCT +.coeff_decoded: + mov eax, [edx+12] + mov ebx, idct_tmp_area +.idct_loop1: + mov cx, word [edi+1*16] +repeat 6 + or cx, word [edi+(%+1)*16] +end repeat + jnz .real_transform + fild word [edi] + fmul dword [eax] + fstp dword [ebx] + mov ecx, [ebx] +repeat 7 + mov [ebx+%*32], ecx +end repeat + jmp .idct_next1 +.real_transform: +; S0,...,S7 - transformed values, s0,...,s7 - sought-for values +; S0,...,S7 are dequantized; +; dequantization table elements were multiplied to [idct_pre_table], +; so S0,S1,... later denote S0/2\sqrt{2},S1*\cos{\pi/16}/2,... +; sqrt2 = \sqrt{2}, cos = 2\cos{\pi/8}, +; cos_sum = -2(\cos{\pi/8}+\cos{3\pi/8}), cos_diff = 2(\cos{\pi/8}-\cos{3\pi/8}) +; Now formulas: +; s0 = ((S0+S4)+(S2+S6)) + ((S1+S7)+(S3+S5)) +; s7 = ((S0+S4)+(S2+S6)) - ((S1+S7)+(S3+S5)) +; val0 = ((cos-1)S1-(cos+cos_sum+1)S3+(cos+cos_sum-1)S5-(cos+1)S7) +; s1 = ((S0-S4)+((sqrt2-1)S2-(sqrt2+1)S6)) + val0 +; s6 = ((S0-S4)+((sqrt2-1)S2-(sqrt2+1)S6)) - val0 +; val1 = (S1+S7-S3-S5)sqrt2 - val0 +; s2 = ((S0-S4)-((sqrt2-1)S2-(sqrt2+1)S6)) + val1 +; s5 = ((S0-S4)-((sqrt2-1)S2-(sqrt2+1)S6)) - val1 +; val2 = (S1-S7)cos_diff - (S1-S3+S5-S7)cos + val1 +; s3 = ((S0+S4)-(S2+S6)) - val2 +; s4 = ((S0+S4)-(S2+S6)) + val2 + fild word [edi+3*16] + fmul dword [eax+3*32] + fild word [edi+5*16] + fmul dword [eax+5*32] ; st0=S5,st1=S3 + fadd st1,st0 + fadd st0,st0 + fsub st0,st1 ; st0=S5-S3,st1=S5+S3 + fild word [edi+1*16] + fmul dword [eax+1*32] + fild word [edi+7*16] + fmul dword [eax+7*32] ; st0=S7,st1=S1 + fsub st1,st0 + fadd st0,st0 + fadd st0,st1 ; st0=S1+S7,st1=S1-S7,st2=S5-S3,st3=S5+S3 + fadd st3,st0 + fadd st0,st0 + fsub st0,st3 ; st0=S1-S3-S5+S7,st1=S1-S7,st2=S5-S3,st3=S1+S3+S5+S7 + fmul [idct_sqrt2] + fld st2 + fadd st0,st2 + fmul [idct_cos] ; st0=(S1-S3+S5-S7)cos,st1=(S1-S3-S5+S7)sqrt2, + ; st2=S1-S7,st3=S5-S3,st4=S1+S3+S5+S7 + fxch st2 + fmul [idct_cos_diff] + fsub st0,st2 ; st0=(S1-S7)cos_diff - (S1-S3+S5-S7)cos + fxch st3 + fmul [idct_cos_sum] + fadd st0,st2 ; st0=(S5-S3)cos_sum+(S1-S3+S5-S7)cos + fsub st0,st4 ; st0=val0 + fsub st1,st0 ; st0=val0,st1=val1,st2=(S1-S3+S5-S7)cos, + ; st3=(S1-S7)cos_diff-(S1-S3+S5-S7)cos,st4=S1+S3+S5+S7 + fxch st2 + fstp st0 + fadd st2,st0 ; st0=val1,st1=val0,st2=val2,st3=S1+S3+S5+S7 + + fild word [edi+0*16] + fmul dword [eax+0*32] + fild word [edi+4*16] + fmul dword [eax+4*32] ; st0=S4,st1=S0 + fsub st1,st0 + fadd st0,st0 + fadd st0,st1 ; st0=S0+S4,st1=S0-S4 + fild word [edi+6*16] + fmul dword [eax+6*32] + fild word [edi+2*16] + fmul dword [eax+2*32] ; st0=S2,st1=S6 + fadd st1,st0 + fadd st0,st0 + fsub st0,st1 ; st0=S2-S6,st1=S2+S6 + fmul [idct_sqrt2] + fsub st0,st1 + fsub st3,st0 + fadd st0,st0 + fadd st0,st3 ; st0=(S0-S4)+((S2-S6)sqrt2-(S2+S6)) + ; st3=(S0-S4)-((S2-S6)sqrt2-(S2+S6)) + fxch st1 + fsub st2,st0 + fadd st0,st0 + fadd st0,st2 ; st0=(S0+S4)+(S2+S6),st1=(S0-S4)+((S2-S6)sqrt2-(S2+S6)), + ; st2=(S0+S4)-(S2+S6),st3=(S0-S4)-((S2-S6)sqrt2-(S2+S6)) + ; st4=val1,st5=val0,st6=val2,st7=S1+S3+S5+S7 + fsubr st7,st0 + fadd st0,st0 + fsub st0,st7 + fstp dword [ebx+0*32] + fsubr st4,st0 + fadd st0,st0 + fsub st0,st4 + fstp dword [ebx+1*32] + fadd st4,st0 + fadd st0,st0 + fsub st0,st4 + fstp dword [ebx+3*32] + fsubr st1,st0 + fadd st0,st0 + fsub st0,st1 + fstp dword [ebx+2*32] + fstp dword [ebx+5*32] + fstp dword [ebx+6*32] + fstp dword [ebx+4*32] + fstp dword [ebx+7*32] +.idct_next1: + add ebx, 4 + add edi, 2 + add eax, 4 + cmp ebx, idct_tmp_area+8*4 + jb .idct_loop1 + sub ebx, 8*4 +.idct_loop2: + fld dword [ebx+3*4] + fld dword [ebx+5*4] + fadd st1,st0 + fadd st0,st0 + fsub st0,st1 ; st0=S5-S3,st1=S5+S3 + fld dword [ebx+1*4] + fld dword [ebx+7*4] + fsub st1,st0 + fadd st0,st0 + fadd st0,st1 ; st0=S1+S7,st1=S1-S7,st2=S5-S3,st3=S5+S3 + fadd st3,st0 + fadd st0,st0 + fsub st0,st3 ; st0=S1-S3-S5+S7,st1=S1-S7,st2=S5-S3,st3=S1+S3+S5+S7 + fmul [idct_sqrt2] + fld st2 + fadd st0,st2 + fmul [idct_cos] ; st0=(S1-S3+S5-S7)cos,st1=(S1-S3-S5+S7)sqrt2, + ; st2=S1-S7,st3=S5-S3,st4=S1+S3+S5+S7 + fxch st2 + fmul [idct_cos_diff] + fsub st0,st2 ; st0=(S1-S7)cos_diff - (S1-S3+S5-S7)cos + fxch st3 + fmul [idct_cos_sum] + fadd st0,st2 ; st0=(S5-S3)cos_sum+(S1-S3+S5-S7)cos + fsub st0,st4 ; st0=val0 + fsub st1,st0 ; st0=val0,st1=val1,st2=(S1-S3+S5-S7)cos, + ; st3=(S1-S7)cos_diff-(S1-S3+S5-S7)cos,st4=S1+S3+S5+S7 + fxch st2 + fstp st0 + fadd st2,st0 ; st0=val1,st1=val0,st2=val2,st3=S1+S3+S5+S7 + + fld dword [ebx+0*4] + fld dword [ebx+4*4] + fsub st1,st0 + fadd st0,st0 + fadd st0,st1 ; st0=S0+S4,st1=S0-S4 + fld dword [ebx+6*4] + fld dword [ebx+2*4] + fadd st1,st0 + fadd st0,st0 + fsub st0,st1 ; st0=S2-S6,st1=S2+S6 + fmul [idct_sqrt2] + fsub st0,st1 + fsub st3,st0 + fadd st0,st0 + fadd st0,st3 ; st0=(S0-S4)+((S2-S6)sqrt2-(S2+S6)) + ; st3=(S0-S4)-((S2-S6)sqrt2-(S2+S6)) + fxch st1 + fsub st2,st0 + fadd st0,st0 + fadd st0,st2 ; st0=(S0+S4)+(S2+S6),st1=(S0-S4)+((S2-S6)sqrt2-(S2+S6)), + ; st2=(S0+S4)-(S2+S6),st3=(S0-S4)-((S2-S6)sqrt2-(S2+S6)) + ; st4=val1,st5=val0,st6=val2,st7=S1+S3+S5+S7 + fsubr st7,st0 + fadd st0,st0 + fsub st0,st7 + fistp dword [ebx+0*4] + fsubr st4,st0 + fadd st0,st0 + fsub st0,st4 + fistp dword [ebx+1*4] + fadd st4,st0 + fadd st0,st0 + fsub st0,st4 + fistp dword [ebx+3*4] + fsubr st1,st0 + fadd st0,st0 + fsub st0,st1 + fistp dword [ebx+2*4] + fistp dword [ebx+5*4] + fistp dword [ebx+6*4] + fistp dword [ebx+4*4] + fistp dword [ebx+7*4] + + add ebx, 32 + cmp ebx, idct_tmp_area+32*8 + jb .idct_loop2 + + mov ecx, idct_tmp_area + mov edi, decoded_data - 1 +.idct_loop3: + mov eax, [ecx] + add ecx, 4 + add eax, 80h + cmp eax, 80000000h + sbb ebx, ebx + add edi, 1 + and eax, ebx + cmp eax, 100h + sbb ebx, ebx + not ebx + or eax, ebx + sub al, [edx+51] + cmp ecx, idct_tmp_area+64*4 + mov [edi], al + jb .idct_loop3 +; done + mov ebx, [_ebx] + ret + +.eof: +; EOF or incorrect data during scanning + mov esp, [_esp] + mov ebx, [_ebx] + jmp START.end +;--------------------------------------------------------------------- +check_header: + pushad + mov eax,dword [esp+36] + push eax + and dword [eax+8], 0 + mov esi, [eax] + mov ebp, [eax+12] + call get_marker + jc .err + cmp al, 0xD8 + jnz .err + pop eax + popad + ret 4 +.err: + pop eax + inc dword [eax+8] + popad + ret 4 +;--------------------------------------------------------------------- +zigzag: +; (x,y) -> 2*(x+y*8) +repeat 8 + .cur = % + if .cur and 1 + repeat % + db 2*((%-1) + (.cur-%)*8) + end repeat + else + repeat % + db 2*((.cur-%) + (%-1)*8) + end repeat + end if +end repeat +repeat 7 + .cur = % + if .cur and 1 + repeat 8-% + db 2*((%+.cur-1) + (8-%)*8) + end repeat + else + repeat 8-% + db 2*((8-%) + (%+.cur-1)*8) + end repeat + end if +end repeat + +align 4 +idct_pre_table: +; c_0 = 1/(2\sqrt{2}), c_i = cos(i*\pi/16)/2 + dd 0.35355339, 0.49039264, 0.461939766, 0.41573481 + dd 0.35355339, 0.27778512, 0.19134172, 0.09754516 +idct_sqrt2 dd 1.41421356 ; \sqrt{2} +idct_cos dd 1.847759065 ; 2\cos{\pi/8} +idct_cos_sum dd -2.61312593 ; -2(\cos{\pi/8} + \cos{3\pi/8}) +idct_cos_diff dd 1.08239220 ; 2(\cos{\pi/8} - \cos{3\pi/8}) +;--------------------------------------------------------------------- +Associations: +dd Associations.end - Associations +db 'JPEG',0 +db 'JPG',0 +db 'JPE',0 +.end: +db 0 +;--------------------------------------------------------------------- +align 4 +EXPORTS: + dd szStart, START + dd szVersion, 0x00010002 + dd szCheck, check_header + dd szAssoc, Associations + dd 0 + +szStart db 'START',0 +szVersion db 'version',0 +szCheck db 'Check_Header',0 +szAssoc db 'Associations',0 + +section '.data' data readable writable align 16 + +; up to 4 quantization tables +quant_tables rd 4*64 +quant_tables_defined rb 4 + +; Huffman tables +dc_huffman_defined rb 4 +ac_huffman_defined rb 4 +; up to 4 DC Huffman tables +;dc_huffman rd 4*256*2 +; up to 4 AC Huffman tables +;ac_huffman rd 4*256*2 +max_hufftable_size = (256 + (9+128)*16)*2 +dc_huffman rb 4*max_hufftable_size +ac_huffman rb 4*max_hufftable_size + +; restart interval +restart_interval dd ? +decoded_MCUs dd ? + +; base esp,ebx values +_esp dd ? +_ebx dd ? + +; components information, up to 4 components +; db ComponentIdentifier, db V, db H, db VFactor, db HFactor, db QuantizationTable +components rb 4*6 +max_v db ? +max_h db ? +cur_rst_marker db ? + db ? +huffman_bits dd ? +block_width dd ? +block_height dd ? +block_delta_x dd ? +block_delta_y dd ? +cur_block_dx dd ? +cur_block_dy dd ? +x_num_blocks dd ? +y_num_blocks dd ? +delta_x dd ? +delta_y dd ? +pixel_size dd ? +line_size dd ? +cur_x dd ? +cur_y dd ? +max_x dd ? +max_y dd ? +cur_out_ptr dd ? +dct_buffer dd ? +dct_buffer_size dd ? +;ns dd ? +; +0: db V, db H, db VFactor, db HFactor, dd HIncrement, dd VIncrement, +; +12: dd QuantizationTable, dd DCTable, dd ACTable, +; +24: dd width/HFactor, dd width/HFactor-8k, dd HFactor+1-(width%HFactor), +; +36: dd height/VFactor, dd height/VFactor-8m, dd VFactor+1-(height%VFactor), +; +48: dw DCPrediction, db ?, db (0 for Y, 80h for Cb,Cr), dd ComponentOffset +cur_components rb 4*56 +cur_components_end dd ? +; progressive JPEG? +progressive db ? +; one component in the scan? +not_interleaved db ? +; Adobe YCCK file? +adobe_ycck db ? + rb 1 +; parameters for progressive scan +ScanStart db ? +ScanEnd db ? +ApproxPosLow db ? +ApproxPosHigh db ? +; Fourier coefficients +dct_coeff rw 64 +; Temporary space for IDCT +idct_tmp_area rd 64 +; decoded block 8*8 +decoded_data rb 8*8 +; data for YCbCr -> RGB translation +color_table_1 rd 256 +color_table_2 rd 256 +color_table_3 rd 256 +color_table_4 rd 256 diff --git a/programs/media/zsea/plugins/png/build.bat b/programs/media/zsea/plugins/png/build.bat new file mode 100644 index 0000000000..ea8ed4d969 --- /dev/null +++ b/programs/media/zsea/plugins/png/build.bat @@ -0,0 +1,3 @@ +@fasm -m 16384 cnv_png.asm cnv_png.obj +@kpack cnv_png.obj +@pause \ No newline at end of file diff --git a/programs/media/zsea/plugins/png/build.sh b/programs/media/zsea/plugins/png/build.sh new file mode 100644 index 0000000000..f194035d93 --- /dev/null +++ b/programs/media/zsea/plugins/png/build.sh @@ -0,0 +1,10 @@ +#!/bin/bash +# This script does for Linux the same as build.bat for DOS, +# it compiles the current KolibriOS applications + + fasm -m 16384 cnv_png.asm cnv_png.obj + kpack cnv_png.obj + exit 0 + + + diff --git a/programs/media/zsea/plugins/png/cnv_png.asm b/programs/media/zsea/plugins/png/cnv_png.asm new file mode 100644 index 0000000000..ba11d366a6 --- /dev/null +++ b/programs/media/zsea/plugins/png/cnv_png.asm @@ -0,0 +1,896 @@ +;***************************************************************************** +; PNG to RAW convert plugin - for zSea image viewer +; Copyright (c) 2008-2011, Marat Zakiyanov aka Mario79, aka Mario +; All rights reserved. +; +; Redistribution and use in source and binary forms, with or without +; modification, are permitted provided that the following conditions are met: +; * Redistributions of source code must retain the above copyright +; notice, this list of conditions and the following disclaimer. +; * Redistributions in binary form must reproduce the above copyright +; notice, this list of conditions and the following disclaimer in the +; documentation and/or other materials provided with the distribution. +; * Neither the name of the nor the +; names of its contributors may be used to endorse or promote products +; derived from this software without specific prior written permission. +; +; THIS SOFTWARE IS PROVIDED BY Marat Zakiyanov ''AS IS'' AND ANY +; EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +; WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +; DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY +; DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +; (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +; ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +; (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +; SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +;***************************************************************************** + +format MS COFF + +public EXPORTS + +section '.flat' code readable align 16 + +;include 'macros.inc' +include '../../../../macros.inc' +;--------------------------------------------------------------------- +START: + pushad + mov eax,dword [esp+36] + call check_header_1 + je header_OK +;--------------------------------------------------------------------- +no_png_file: + xor eax,eax + mov [raw_area],eax + inc eax ; data corrupt eax = 1 + jmp header_OK.ret +;--------------------------------------------------------------------- +check_header_1: + mov [pointer],eax + mov ebx,[eax] + mov [image_file],ebx + cmp [ebx],dword 0x474E5089 ; check main label p.1 + jne @f ;no_png_file + cmp [ebx+4],dword 0x0A1A0A0D ; check main label p.2 + ret +@@: + add esp,4 + jmp no_png_file +;--------------------------------------------------------------------- +header_OK: + mov ebx,[eax+12] ; file size + mov [file_size],ebx +;--------------------------------------------------------------------- + mov ebx,[eax+16] + mov [deflate_unpack],ebx +;--------------------------------------------------------------------- + mov ebx,[pointer] +;--------------------------------------------------------------------- + xor eax,eax +; mov [IDAT.pointer],eax +; mov [IDAT.size],eax + mov [deflate_start_offset],eax + mov eax,[image_file] + mov [next_Chunk],eax + call search_IHDR + call search_IDAT +; call search_IEND +;--------------------------------------------------------------------- + mov eax,[IHDR.pointer] + mov ecx,[eax] ; get width PNG + call convert_NBO_to_PC + mov [IHDR_data.Width],ecx ; store width PNG + mov [Image_Width],ecx + mov ecx,[eax+4] ; get height PNG + call convert_NBO_to_PC + mov [IHDR_data.Height],ecx ; store height PNG + mov [Image_Height],ecx + mov ecx,[eax+9] ; Color type + ; Compression method + ; Filter method + ; Interlace method + mov [IHDR_data.Color_type],ecx + xor ecx,ecx + mov cl,[eax+8] ; Bit depth + mov [IHDR_data.Bit_depth],cl +;--------------------------------------------------------------------- + mov al,[eax+9] ; check Color type + cmp al,byte 0 ; Each pixel is a grayscale sample. + je .resolution + cmp al,byte 2 ; Each pixel is an R,G,B triple. + je .Bit_depth_2 + cmp al,byte 3 ; Each pixel is a palette index + ; a PLTE chunk must appear. + jne .no_PLTE + call search_PLTE + jmp .resolution +.no_PLTE: + cmp al,byte 4 ; Each pixel is a grayscale sample, + ; followed by an alpha sample. + je .Bit_depth_4 + cmp al,byte 6 ; Each pixel is an R,G,B triple, + ; followed by an alpha sample. + jne no_png_file +;--------------------------------------------------------------------- +.Bit_depth_6: + shl ecx,1 + +.Bit_depth_4: + shl ecx,1 + jmp .resolution + +.Bit_depth_2: + lea ecx,[ecx*3] + +.resolution: +;--------------------------------------------------------------------- + cmp [IHDR_data.Compression_method], byte 0 ; check Compression method + jne no_png_file + + cmp [IHDR_data.Filter_method], byte 0 ; check Filtering method + jne no_png_file + + cmp [IHDR_data.Interlace_method], byte 0 ; No Interlaced + je @f + cmp [IHDR_data.Interlace_method], byte 1 ; Interlaced + jne no_png_file +@@: +;--------------------------------------------------------------------- + mov [resolution],ecx + imul ecx,[IHDR_data.Width] + mov edi,ecx + shr ecx,3 + test edi,7 + jz @f + inc ecx +@@: + imul ecx,[IHDR_data.Height] + cmp [IHDR_data.Color_type],byte 3 + jne @f + mov eax,[PLTE.size] + mov ebx,3 + xor edx,edx + div ebx + shl eax,2 + add ecx,eax ; PLTE table area + jmp .RAW_header +;-------------------------------------- +@@: + cmp [IHDR_data.Color_type],byte 0 + je @f + cmp [IHDR_data.Color_type],byte 4 + jne .RAW_header +@@: + push ecx + mov eax,1 + movzx ecx,byte [IHDR_data.Bit_depth] + cmp ecx,16 + jne @f + shr ecx,1 +@@: + shl eax,cl + shl eax,2 + pop ecx + add ecx,eax +; mov ebx,[pointer] +; mov [ebx+20],eax +;-------------------------------------- +.RAW_header: + add ecx,44 ; RAW header +; mov ebx,[pointer] +; mov [ebx+24],ecx +; shl ecx,1 + mcall 68, 12 + cmp eax,0 + jne @f + xor eax,eax + mov [raw_area],eax ; store pointer of image area + mov eax,2 ; not enough memory + jmp .ret +@@: + mov [raw_area],eax +; mov ebx,[pointer] +; mov [ebx+28],eax +;--------------------------------------------------------------------- + mov edi,eax + xor eax,eax + shr ecx,2 + cld + rep stosd ; clear memory +;--------------------------------------------------------------------- +; Create RAW header +;--------------------------------------------------------------------- + mov eax,[raw_area] + mov [eax],dword 'RAW ' +;--------------------------------------------------------------------- + mov ecx,[IHDR_data.Width] ; width BMP + mov [eax+4],ecx ; width RAW +;--------------------------------------------------------------------- + mov ecx,[IHDR_data.Height] ; high BMP + mov [eax+8],ecx ;high RAW +;--------------------------------------------------------------------- + mov ecx,[resolution] ; color resolution BMP + mov [eax+12],ecx ;color resolution RAW +;--------------------------------------------------------------------- + xor ecx,ecx + mov cl,[IHDR_data.Bit_depth] + mov [eax+16],cx ;channel color resolution RAW +;--------------------------------------------------------------------- + mov ecx,[IHDR_data.Color_type] + xor ebx,ebx + inc ebx + cmp cl,byte 0 ; Each pixel is a grayscale sample. + je .1 + cmp cl,byte 2 ; Each pixel is an R,G,B triple. + je .Bit_depth_2_1 + cmp cl,byte 3 ; Each pixel is a palette index + ; a PLTE chunk must appear. + je .1 + cmp cl,byte 4 ; Each pixel is a grayscale sample, + ; followed by an alpha sample. + je .Bit_depth_4_1 + cmp cl,byte 6 + jne no_png_file +.Bit_depth_6_1: + shl ebx,1 +.Bit_depth_4_1: + shl ebx,1 + jmp .1 +.Bit_depth_2_1: + lea ebx,[ebx*3] +.1: + mov [eax+18],bx ; channels amount RAW +;--------------------------------------------------------------------- + xor edx,edx + cmp cl,byte 3 ; Each pixel is a palette index + ; a PLTE chunk must appear. + je @f + cmp cl,0 + je @f + cmp cl,4 + jne .no_PLTE_1 +@@: + add edx,44 + mov [eax+20],edx ; palette pointer (offset from file start) +;--------------------------------------------------------------------- + cmp cl,0 + je @f + cmp cl,4 + jne .PLTE +@@: + mov ecx,256*4 + jmp .PLTE_1 +.PLTE: + push eax + mov eax,[PLTE.size] + xor edx,edx + mov ebx,3 + div ebx + shl eax,2 + mov ecx,eax + pop eax +.PLTE_1: + mov [eax+24],ecx ; palette area size + jmp @f +.no_PLTE_1: + xor ecx,ecx +@@: +;--------------------------------------------------------------------- + add ecx,dword 44 + mov [eax+28],ecx ; pixels pointer (offset from file start) +; mov ebx,[pointer] +; mov [ebx+44],ecx +;--------------------------------------------------------------------- + mov ecx, [IHDR_data.Width] ; width BMP + imul ecx,[resolution] + mov edi,ecx + shr ecx,3 + test edi,7 + jz @f + inc ecx +@@: + imul ecx,[IHDR_data.Height] ; high BMP + mov [eax+32],ecx ; pixels area size +;--------------------------------------------------------------------- + xor ecx,ecx ; Stub!!! + mov [eax+36],ecx ;Transparency pointer (offset from file start) + mov [eax+40],ecx ;Transparency area size + +;--------------------------------------------------------------------- +; Finish create RAW header +;--------------------------------------------------------------------- + + mov eax,[raw_area] + mov edi,[eax+20] ; palette pointer (offset from file start) + add edi,eax + + mov esi,[PLTE.pointer] + mov eax,[PLTE.size] + xor edx,edx + mov ebx,3 + div ebx + mov ecx,eax + mov eax,[IHDR_data.Color_type] + cmp al,byte 0 + je .grayscale_palette + cmp al,byte 4 + je .grayscale_palette + cmp al,byte 3 ; Each pixel is a palette index + ; a PLTE chunk must appear. + jne .no_palette +@@: + cld + lodsd + dec esi + and eax,0xffffff + + mov bl,al + shr eax,8 + xchg ah,bl + shl eax,8 + mov al,bl + + cld + stosd + dec ecx + jnz @r + jmp .no_palette +;------------------------------- +.grayscale_palette: +; cmp [IHDR_data.Bit_depth], dword 1 +; jne @f +; xor eax,eax +; cld +; stosd +; dec eax +; and eax,0xffffff +; cld +; stosd +; jmp .no_palette +@@: + mov eax,1 + mov ecx,[resolution] + cmp ecx,8 + jbe @f + mov ecx,8 +@@: + shl eax,cl + mov ecx,eax + mov eax,256 +; mov ebx,[resolution] + xor edx,edx + div ecx ;ebx + mov edx,eax + cmp edx,0 + jne @f + inc edx +@@: + xor eax,eax +; mov eax,0xffffff +; mov ecx,256 + +@@: + cld + stosd +; inc ah + add ah,dl +; inc al + add al,dl + shl eax,8 + mov al,ah + +; dec ah +; dec al +; shl eax,8 +; mov al,ah + + and eax,0xffffff + dec ecx + jnz @r + + sub edi,4 + xor eax,eax + dec eax + and eax,0xffffff + cld + stosd +;------------------------------- +.no_palette: + +;--------------------------------------------------------------------- + mov ebx,[IDAT.pointer] + mov al,[ebx] + mov [IDAT_CMF],al ; Compression Method and flags + mov ah,al + and al,1111b + mov [IDAT_],al ; Compression method + shr ah,4 + mov [IDAT_CINFO],ah ; Compression info + mov al,[ebx+1] + mov [IDAT_FLG],al ; FLaGs + mov ah,al + and al,11111b + mov [IDAT_FCHECK],al + mov al,ah + and al,100000b + shr al,5 + mov [IDAT_FDICT],al ; Preset dictionary + shr ah,6 + mov [IDAT_FLEVEL],ah ; Compression level + mov al,[IDAT_] +; test al,1000b ; Compression method = 8 ? + cmp al,8 + jnz no_png_file + add [IDAT.pointer],2 + sub [IDAT.size],2 +; xor eax,eax +; mov ah,[IDAT_FLG] +; mov al,[IDAT_CMF] +; imul eax,31 +; shr eax,16 +; cmp [IDAT_FCHECK],al +; jne no_png_file + +; +; cmp [IDAT_FDICT],1 +; jne .no_IDAT_FDICT +; mov ecx,[ebx+2] +; jmp .IDAT_DICT +;.no_IDAT_FDICT: +; mov eax,[IDAT.pointer] +; add eax,[IDAT.size] +; mov ecx,[eax] +;.IDAT_DICT: +; call convert_NBO_to_PC +; mov [IDAT_DICT],ecx +; jmp .ret_ok + +; jmp no_png_file + +; mov ecx,[file_size] +; mcall 68, 12 +; mov [IDAT_raw_area],eax ; store pointer of image area +;--------------------------------------------------------------------- +.start_Deflate_unpack: + push eax ; *pUnpackedLength + ; , + ; push <> + push esp ; pUnpackedLength + push esi ; - + push deflate_callback + call [deflate_unpack] + pop ecx ; UnpackedLength +; , eax = , ecx = + mov [unpacked_data],eax + mov esi,eax +;--------------------------------------------------------------------- + mov eax,[raw_area] + mov edi,[eax+28] ; pixels pointer (offset from file start) + add edi,eax +; mov ecx,edx + sub ecx,[IHDR_data.Height] + mov [first_line],byte 1 + cmp [IHDR_data.Color_type],byte 0 + je .PLTE_and_grayscale + cmp [IHDR_data.Color_type],byte 3 + je .PLTE_and_grayscale + cmp [IHDR_data.Color_type],byte 4 + je .PLTE_and_grayscale +;--------------------------------------------------------------------- +; Processing filtering RGB; type 2 and 6, sample 8b +;--------------------------------------------------------------------- + mov eax,ecx +; sub eax,[IHDR_data.Height] + xor edx,edx + mov ebx,3 + cmp [IHDR_data.Color_type],byte 6 + jne @f + inc ebx +@@: + cmp [IHDR_data.Bit_depth],byte 16 + jne @f + shl ebx,1 +@@: + div ebx + mov ecx,eax + cmp [IHDR_data.Bit_depth],byte 16 + je .filter_Bit_depth_16 +; jmp .ret_ok +;--------------------------------------------------------------------- + cmp [IHDR_data.Interlace_method], byte 0 ; Interlaced + je @f + call filtering_RGB_Interlaced + jmp .converting_MSB_to_LSB +@@: +;--------------------------------------------------------------------- + push edi + call filtering_RGB + pop edi +;--------------------------------------------------------------------- +; converting MSB to LSB +; 24b = 1B x 3 sample +; 32b = 1B x 4 sample +.converting_MSB_to_LSB: + call .calculate_all_pixels + mov ebx,3 + cmp [IHDR_data.Color_type],byte 6 + jne @f + inc ebx +@@: + sub edi,ebx +@@: + add edi,ebx + mov al,[edi] + mov ah,[edi+2] + mov [edi+2],al + mov [edi],ah + dec ecx + jnz @r + jmp .ret_ok +;--------------------------------------------------------------------- +.calculate_all_pixels: + mov ecx,[Image_Height] + imul ecx,[Image_Width] + ret +;--------------------------------------------------------------------- +; Processing filtering RGB; type 2 and 6, sample 16b +;--------------------------------------------------------------------- +.filter_Bit_depth_16: + cmp [IHDR_data.Interlace_method], byte 0 ; Interlaced + je @f + call filtering_RGB_16_Interlaced + jmp .converting_MSB_to_LSB_16 +@@: +;--------------------------------------------------------------------- + push edi + call filtering_RGB_16 + pop edi +;--------------------------------------------------------------------- +; converting MSB to LSB 48 or 64b +; 48b = 2B x 3 sample +; 64b = 2B x 4 sample +.converting_MSB_to_LSB_16: + call .calculate_all_pixels + mov ebx,3 + cmp [IHDR_data.Color_type],byte 6 + jne @f + inc ebx +@@: + shl ebx,1 + + sub edi,ebx +@@: + add edi,ebx + + mov ax,[edi] + xchg al,ah + shl eax,16 + mov ax,[edi+4] + xchg al,ah + mov [edi],ax + shr eax,16 + mov [edi+4],ax + + mov ax,[edi+2] + xchg al,ah + mov [edi+2],ax + +; mov ax,[edi+6] +; xchg al,ah +; mov [edi+6],al + + dec ecx + jnz @r + jmp .ret_ok +;--------------------------------------------------------------------- +; Processing filtering Grayscale and RGB; type 2, 3 and 4, sample 8b +;--------------------------------------------------------------------- +.PLTE_and_grayscale: + cmp [IHDR_data.Color_type],byte 4 + jne @f + shr ecx,1 +@@: + cmp [IHDR_data.Bit_depth],byte 16 + jne @f + shr ecx,1 + jmp .filter_grayscale_Bit_depth_16_1 +@@: +;--------------------------------------------------------------------- + cmp [IHDR_data.Interlace_method], byte 0 ; Interlaced + je @f + call filtering_grayscale_Interlaced + jmp .continue_1 +@@: +;--------------------------------------------------------------------- + push edi + call filtering_grayscale + pop edi +;--------------------------------------------------------------------- +.continue_1: + cmp [IHDR_data.Color_type],byte 4 + jne .ret_ok +;------------------------------- +; 8b or less + mov esi,edi + call .calculate_all_pixels +.convert_transp_to_notransp: + cld + lodsw + stosb + dec ecx + jnz .convert_transp_to_notransp + + jmp .ret_ok +;--------------------------------------------------------------------- +; Processing filtering Grayscale and RGB; type 2, 3 and 4, sample 16b +;--------------------------------------------------------------------- +.filter_grayscale_Bit_depth_16_1: + cmp [IHDR_data.Interlace_method], byte 0 ; Interlaced + je @f + call filtering_grayscale_16_Interlaced + jmp .continue_2 +@@: +;--------------------------------------------------------------------- + push edi + call filtering_grayscale_16 + pop edi +;--------------------------------------------------------------------- +.continue_2: + cmp [IHDR_data.Color_type],byte 4 + jne .ret_ok +;------------------------------- +; 16b + mov esi,edi + call .calculate_all_pixels +.convert_transp_to_notransp_1: + cld + lodsd + stosw + dec ecx + jnz .convert_transp_to_notransp_1 +;--------------------------------------------------------------------- +.ret_ok: + mov ecx,[unpacked_data] + mcall 68, 13, + xor eax,eax +;--------------------------------------------------------------------- +.ret: + mov ebx,[pointer] + mov [ebx+8],eax ; store return code + mov eax,[raw_area] + mov [ebx+4],eax ; store RAW pointer + popad + ret 4 +;--------------------------------------------------------------------- +include 'filter.inc' +include 'proced.inc' +include 'fl_call.inc' +include 'interlac.inc' +;--------------------------------------------------------------------- +Check_Header: + pushad + mov eax,dword [esp+36] + call check_header_1 + jne no_png_file + popad + ret 4 +;--------------------------------------------------------------------- +Associations: + dd Associations.end - Associations + db 'PNG',0 +.end: + db 0 +;--------------------------------------------------------------------- +align 4 +EXPORTS: + dd szStart, START + dd szVersion, 0x00010002 + dd szCheck, Check_Header + dd szAssoc, Associations + dd 0 + +szStart db 'START',0 +szVersion db 'version',0 +szCheck db 'Check_Header',0 +szAssoc db 'Associations',0 + +;***************************************************************************** +; Chunks names +;***************************************************************************** +; Critical chunks +IHDR_name: db 'IHDR' ; Image header +PLTE_name: db 'PLTE' ; Palette +IDAT_name: db 'IDAT' ; Image data +IEND_name: db 'IEND' ; Image trailer + +; Ancillary chunks +;tRNS_name: db 'tRNS' ; Transparency + +;; Color space information +;gAMA_name: db 'gAMA' ; Image gamma +;cHRM_name: db 'cHRM' ; Primary chromaticities +;sRGB_name: db 'sRGB' ; Standard RGB color space +;iCCP_name: db 'iCCP' ; Embedded ICC profile + +;; Textual information +;tEXt_name: db 'tEXt' ; Textual data +;zTXt_name: db 'zTXt' ; Compressed textual data +;iTXt_name: db 'iTXt' ; International textual data + +;; Miscellaneous information +;bKGD_name: db 'bKGD' ; Background color +;pHYs_name: db 'pHYs' ; Physical pixel dimensions +;sBIT_name: db 'sBIT' ; Significant bits +;sPLT_name: db 'sPLT' ; Suggested palette +;hIST_name: db 'hIST' ; Palette histogram +;tIME_name: db 'tIME' ; Imagelast-modification time +;***************************************************************************** +calculate_Interlaced_counters: +.1: dd calculate_Interlaced_1 +.2: dd calculate_Interlaced_2 +.3: dd calculate_Interlaced_3 +.4: dd calculate_Interlaced_4 +.5: dd calculate_Interlaced_5 +.6: dd calculate_Interlaced_6 +.7: dd calculate_Interlaced_7 + +deflate_start_offset dd 0 + +pointer dd 0 +image_file dd 0 +file_size dd 0 +raw_area dd 0 +resolution dd 0 + +Chunk_pointer dd 0 +next_Chunk dd 0 + +deflate_unpack dd 0 + +unpacked_data dd 0 +;IDAT_raw_area dd 0 +;IDAT_raw_counter dd 0 + +Interlaced_area dd 0 + +Starting_Row: dd 0 +Starting_Col: dd 0 +Row_Increment: dd 0 +Col_Increment: dd 0 + +Interlaced_step dd 0 + + +counter_IDAT_Chunk dd 0 + +;CRC32 dd 0 +;CRC32table: rd 256 +;Adler32 dd 0 + +Image_Width dd 0 +Image_Height dd 0 + +IHDR_data: +.Width dd 0 ;+0 +.Height dd 0 ;+4 +.Bit_depth: db 0 ;+8 +.Color_type: db 0 ;+9 +.Compression_method: db 0 ;+10 +.Filter_method: db 0 ;+11 +.Interlace_method: db 0 ;+12 + +IDAT_CMF db 0 ; Compression Method and flags + IDAT_ db 0 ; Compression method + IDAT_CINFO db 0 ; Compression info +IDAT_FLG db 0 ; FLaGs + IDAT_FCHECK db 0 ; + IDAT_FDICT db 0 ; Preset dictionary + IDAT_FLEVEL db 0 ; Compression level + ; "deflate" method (CM = 8) sets these flags: + ; 0 - compressor used fastest algorithm + ; 1 - compressor used fast algorithm + ; 2 - compressor used default algorithm + ; 3 - compressor used maximum compression, slowest algorithm +IDAT_DICT dd 0 ; dictionary identifier = Adler-32 checksum +BFINAL db 0 ; set 1 only if this is the last block of the data set +BTYPE db 0 ; specifies how the data are compressed: + ; 00 - no compression + ; 01 - compressed with fixed Huffman codes + ; 10 - compressed with dynamic Huffman codes + ; 11 - reserved (error) + +line_filter_type dd 0 ; 0 None + ; 1 Sub + ; 2 Up + ; 3 Averag + ; 4 Paeth +first_line db 0 +first_pixel db 0 + +previous_pixel_value: + rb 8 + +Paeth_filter: +.a: dw 0 +.b: dw 0 +.c: dw 0 +.p dd 0 +.pa dd 0 +.pb dd 0 +.pc dd 0 +;***************************************************************************** +; Chunks pointer +;***************************************************************************** +IHDR: +.pointer dd 0 +.size dd 0 + +PLTE: +.pointer dd 0 +.size dd 0 + +IDAT: +.pointer dd 0 +.size dd 0 + +IEND: +.pointer dd 0 +.size dd 0 + +;tRNS: +;.pointer dd 0 +;.size dd 0 + +;gAMA: +;.pointer dd 0 +;.size dd 0 + +;cHRM: +;.pointer dd 0 +;.size dd 0 + +;sRGB: +;.pointer dd 0 +;.size dd 0 + +;iCCP: +;.pointer dd 0 +;.size dd 0 + +;tEXt: +;.pointer dd 0 +;.size dd 0 + +;zTXt: +;.pointer dd 0 +;.size dd 0 + +;iTXt: +;.pointer dd 0 +;.size dd 0 + +;bKGD: +;.pointer dd 0 +;.size dd 0 + +;pHYs: +;.pointer dd 0 +;.size dd 0 + +;sBIT: +;.pointer dd 0 +;.size dd 0 + +;sPLT: +;.pointer dd 0 +;.size dd 0 + +;hIST: +;.pointer dd 0 +;.size dd 0 + +;tIME: +;.pointer dd 0 +;.size dd 0 diff --git a/programs/media/zsea/plugins/png/filter.inc b/programs/media/zsea/plugins/png/filter.inc new file mode 100644 index 0000000000..a7e1662fae --- /dev/null +++ b/programs/media/zsea/plugins/png/filter.inc @@ -0,0 +1,472 @@ +;***************************************************************************** +; PNG to RAW convert plugin - for zSea image viewer +; Copyright (c) 2008, 2009, Marat Zakiyanov aka Mario79, aka Mario +; All rights reserved. +; +; Redistribution and use in source and binary forms, with or without +; modification, are permitted provided that the following conditions are met: +; * Redistributions of source code must retain the above copyright +; notice, this list of conditions and the following disclaimer. +; * Redistributions in binary form must reproduce the above copyright +; notice, this list of conditions and the following disclaimer in the +; documentation and/or other materials provided with the distribution. +; * Neither the name of the nor the +; names of its contributors may be used to endorse or promote products +; derived from this software without specific prior written permission. +; +; THIS SOFTWARE IS PROVIDED BY Marat Zakiyanov ''AS IS'' AND ANY +; EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +; WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +; DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY +; DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +; (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +; ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +; (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +; SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +;--------------------------------------------------------------------- +filtering: + push eax ecx edx + mov ebp,[line_filter_type] + cmp ebp,0 + je .end + cmp ebp,1 + je .Sub + cmp ebp,2 + je .Up + cmp ebp,3 + je .Averag + cmp ebp,4 + je .Paeth + jmp .end +;--------------------------------------------------------------------- +.Sub: + cmp [IHDR_data.Bit_depth],byte 16 + jne @f + mov eax,ebx + shr eax,16 + add bl,al + add bh,ah + jmp .end +@@: + add bl,bh + jmp .end +;--------------------------------------------------------------------- +.Up: + cmp [first_line],byte 0 + jne .end + mov eax,[IHDR_data.Width] + cmp [IHDR_data.Color_type],byte 0 + je .Up_Color_type_0_and_3 + cmp [IHDR_data.Color_type],byte 3 + je .Up_Color_type_0_and_3 + cmp [IHDR_data.Color_type],byte 4 + je @f + lea eax,[eax*3] +@@: + cmp [IHDR_data.Color_type],byte 4 + je .Up_Alpfa + cmp [IHDR_data.Color_type],byte 6 + jne @f +.Up_Alpfa: + add eax,[IHDR_data.Width] + +@@: +.Up_8: + cmp [IHDR_data.Bit_depth],byte 16 + je .Up_16 + mov ebp,edi + sub ebp,eax + mov bh,[ebp] + add bl,bh + jmp .end + +.Up_Color_type_0_and_3: + cmp [IHDR_data.Bit_depth],byte 16 + je .Up_16 + call .Bit_depth_less_8 + jmp .Up_8 + +.Bit_depth_less_8: +; imul eax,[resolution] + cmp [resolution],8 + jne @f + ret +@@: + cmp [resolution],4 + jne @f + shl eax,2 + jmp .continue_Bit_depth_less_8 +@@: + cmp [resolution],2 + jne .continue_Bit_depth_less_8 + shl eax,1 +.continue_Bit_depth_less_8: + push ebx + mov ebx,eax + shr eax,3 + test ebx,7 + jz @f + inc eax +@@: + pop ebx + ret + +.Up_16: + shl eax,1 + mov ebp,edi + sub ebp,eax + mov ax,[ebp] + add bl,al + add bh,ah + jmp .end +;--------------------------------------------------------------------- +.Averag: + cmp [first_line],byte 0 + je @f + xor eax,eax + cmp [IHDR_data.Bit_depth],byte 16 + je .Averag_2 + jmp .Averag_1 +@@: + mov eax,[IHDR_data.Width] + cmp [IHDR_data.Color_type],byte 0 + je .Averag_Color_type_0_and_3 ;@f + cmp [IHDR_data.Color_type],byte 3 + je .Averag_Color_type_0_and_3 ;@f + cmp [IHDR_data.Color_type],byte 4 + je @f + lea eax,[eax*3] +@@: + cmp [IHDR_data.Color_type],byte 4 + je .Averag_Alpfa + cmp [IHDR_data.Color_type],byte 6 + jne @f +.Averag_Alpfa: + add eax,[IHDR_data.Width] + +@@: +.Averag_8: + cmp [IHDR_data.Bit_depth],byte 16 + je .Averag_16 + mov ebp,edi + sub ebp,eax + xor eax,eax + mov al,[ebp] +.Averag_1: + movzx ebp,bh + add eax,ebp + shr eax,1 + add bl,al + jmp .end + +.Averag_Color_type_0_and_3: + cmp [IHDR_data.Bit_depth],byte 16 + je .Averag_16 + call .Bit_depth_less_8 + jmp .Averag_8 + +.Averag_16: + shl eax,1 + mov ebp,edi + sub ebp,eax + xor eax,eax + mov ax,[ebp] +.Averag_2: + mov ebp,ebx + shr ebp,16 + mov ecx,ebp + and ecx,0xff + mov edx,eax + and edx,0xff + add ecx,edx + shr ecx,1 + add bl,cl + shr ebp,8 + shr eax,8 + add eax,ebp + shr eax,1 + add bh,al + jmp .end +;--------------------------------------------------------------------- +.Paeth: + cmp [first_line],byte 0 + je @f + xor eax,eax + cmp [IHDR_data.Bit_depth],byte 16 + je .Paeth_16_1 + jmp .Paeth_1 +@@: + mov eax,[IHDR_data.Width] + cmp [IHDR_data.Color_type],byte 0 + je .Paeth_Color_type_0_and_3 ;@f + cmp [IHDR_data.Color_type],byte 3 + je .Paeth_Color_type_0_and_3 ;@f + cmp [IHDR_data.Color_type],byte 4 + je @f + lea eax,[eax*3] +@@: + cmp [IHDR_data.Color_type],byte 4 + je .Paeth_Alpfa + cmp [IHDR_data.Color_type],byte 6 + jne @f +.Paeth_Alpfa: + add eax,[IHDR_data.Width] + +@@: + cmp [IHDR_data.Bit_depth],byte 16 + je .Paeth_16 +.Paeth_8: + mov ebp,edi + sub ebp,eax + xor eax,eax + mov al,[ebp] +.Paeth_1: + mov [Paeth_filter.b],al + + cmp [first_line],byte 0 + jne @f + cmp [first_pixel],0 + jne @f + mov ah,[ebp-1] + cmp [IHDR_data.Color_type],byte 0 + je @f + cmp [IHDR_data.Color_type],byte 3 + je @f + mov ah,[ebp-2] + cmp [IHDR_data.Color_type],byte 4 + je @f + mov ah,[ebp-3] + cmp [IHDR_data.Color_type],byte 2 + je @f + mov ah,[ebp-4] +@@: + mov [Paeth_filter.c],ah + mov [Paeth_filter.a],bh + + xor eax,eax + mov al,[Paeth_filter.a] + mov ebp,eax + mov al,[Paeth_filter.b] + add ebp,eax + mov al,[Paeth_filter.c] + sub ebp,eax + mov [Paeth_filter.p],ebp +;---------------------------------------- + mov al,[Paeth_filter.a] + sub ebp,eax + test ebp,0x80000000 + jz @f + neg ebp +@@: + mov [Paeth_filter.pa],ebp + + mov ebp,[Paeth_filter.p] + mov al,[Paeth_filter.b] + sub ebp,eax + test ebp,0x80000000 + jz @f + neg ebp +@@: + mov [Paeth_filter.pb],ebp + + mov ebp,[Paeth_filter.p] + mov al,[Paeth_filter.c] + sub ebp,eax + test ebp,0x80000000 + jz @f + neg ebp +@@: + mov [Paeth_filter.pc],ebp + + mov eax,[Paeth_filter.pa] + mov ebp,[Paeth_filter.pb] + cmp eax,ebp + ja .no_return_a + cmp eax,[Paeth_filter.pc] + ja .no_return_a + add bl,[Paeth_filter.a] + jmp .end +.no_return_a: + cmp ebp,[Paeth_filter.pc] + ja .no_return_b + add bl,[Paeth_filter.b] + jmp .end +.no_return_b: + add bl,[Paeth_filter.c] +.end: + pop edx ecx eax + ret +;---------------------------------------- +.Paeth_Color_type_0_and_3: + cmp [IHDR_data.Bit_depth],byte 16 + je .Paeth_16 + call .Bit_depth_less_8 + jmp .Paeth_8 +;---------------------------------------- +.Paeth_16: + shl eax,1 + mov ebp,edi + sub ebp,eax + xor eax,eax + mov ax,[ebp] +.Paeth_16_1: + mov [Paeth_filter.b],ax + xor eax,eax + cmp [first_line],byte 0 + jne @f + cmp [first_pixel],0 + jne @f + mov ax,[ebp-2] + cmp [IHDR_data.Color_type],byte 0 + je @f + mov ax,[ebp-4] + cmp [IHDR_data.Color_type],byte 4 + je @f + mov ax,[ebp-6] + cmp [IHDR_data.Color_type],byte 2 + je @f + mov ax,[ebp-8] +@@: + mov [Paeth_filter.c],ax + mov eax,ebx + shr eax,16 + mov [Paeth_filter.a],ax +;---------------------------------------- + xor eax,eax + mov ax,[Paeth_filter.a] + shr ax,8 + mov bp,ax + mov ax,[Paeth_filter.b] + shr ax,8 + add bp,ax + mov ax,[Paeth_filter.c] + shr ax,8 + sub bp,ax + shl ebp,16 + + xor eax,eax + mov al,[Paeth_filter.a] + mov bp,ax + mov al,[Paeth_filter.b] + add bp,ax + mov al,[Paeth_filter.c] + sub bp,ax + + mov [Paeth_filter.p],ebp +;---------------------------------------- + xor eax,eax + mov ax,[Paeth_filter.a] + mov ecx,ebp + mov dx,ax + shr ecx,16 + shr dx,8 + sub cx,dx + test cx,0x8000 + jz @f + neg cx +@@: + shl ecx,16 + + and ebp,0xffff + and eax,0xff + sub bp,ax + test bp,0x8000 + jz @f + neg bp +@@: + add ebp,ecx + mov [Paeth_filter.pa],ebp +;---------------------------------------- + xor eax,eax + mov ebp,[Paeth_filter.p] + mov ax,[Paeth_filter.b] + mov ecx,ebp + mov dx,ax + shr ecx,16 + shr dx,8 + sub cx,dx + test cx,0x8000 + jz @f + neg cx +@@: + shl ecx,16 + + and ebp,0xffff + and eax,0xff + sub bp,ax + test bp,0x8000 + jz @f + neg bp +@@: + add ebp,ecx + mov [Paeth_filter.pb],ebp +;---------------------------------------- + xor eax,eax + mov ebp,[Paeth_filter.p] + mov ax,[Paeth_filter.c] + mov ecx,ebp + mov dx,ax + shr ecx,16 + shr dx,8 + sub cx,dx + test cx,0x8000 + jz @f + neg cx +@@: + shl ecx,16 + + and ebp,0xffff + and eax,0xff + sub bp,ax + test bp,0x8000 + jz @f + neg bp +@@: + add ebp,ecx + mov [Paeth_filter.pc],ebp +;---------------------------------------- + mov eax,[Paeth_filter.pa] + mov ebp,[Paeth_filter.pb] + mov ecx,[Paeth_filter.pc] + shr eax,16 + shr ebp,16 + shr ecx,16 + cmp ax,bp + ja .no_return_a_1 + cmp ax,cx + ja .no_return_a_1 + mov ax,[Paeth_filter.a] + add bh,ah + jmp .end_1 +.no_return_a_1: + cmp bp,cx + ja .no_return_b_1 + mov ax,[Paeth_filter.b] + add bh,ah + jmp .end_1 +.no_return_b_1: + mov ax,[Paeth_filter.c] + add bh,ah +.end_1: +;---------------------------------------- + mov eax,[Paeth_filter.pa] + mov ebp,[Paeth_filter.pb] + mov ecx,[Paeth_filter.pc] + cmp ax,bp + ja .no_return_a_2 + cmp ax,cx + ja .no_return_a_2 + add bl,[Paeth_filter.a] + jmp .end_2 +.no_return_a_2: + cmp bp,cx + ja .no_return_b_2 + add bl,[Paeth_filter.b] + jmp .end_2 +.no_return_b_2: + add bl,[Paeth_filter.c] +.end_2: + pop edx ecx eax + ret +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/plugins/png/fl_call.inc b/programs/media/zsea/plugins/png/fl_call.inc new file mode 100644 index 0000000000..2d7f890198 --- /dev/null +++ b/programs/media/zsea/plugins/png/fl_call.inc @@ -0,0 +1,225 @@ +;***************************************************************************** +; PNG to RAW convert plugin - for zSea image viewer +; Copyright (c) 2008, 2009, Marat Zakiyanov aka Mario79, aka Mario +; All rights reserved. +; +; Redistribution and use in source and binary forms, with or without +; modification, are permitted provided that the following conditions are met: +; * Redistributions of source code must retain the above copyright +; notice, this list of conditions and the following disclaimer. +; * Redistributions in binary form must reproduce the above copyright +; notice, this list of conditions and the following disclaimer in the +; documentation and/or other materials provided with the distribution. +; * Neither the name of the nor the +; names of its contributors may be used to endorse or promote products +; derived from this software without specific prior written permission. +; +; THIS SOFTWARE IS PROVIDED BY Marat Zakiyanov ''AS IS'' AND ANY +; EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +; WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +; DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY +; DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +; (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +; ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +; (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +; SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +;--------------------------------------------------------------------- +filtering_RGB: + mov ecx,[IHDR_data.Height] + test ecx,ecx + jz .filter_end +.filter: + mov edx,[IHDR_data.Width] + test edx,edx + jz .filter_end + xor eax,eax + mov [previous_pixel_value],eax + mov [first_pixel],byte 1 + mov al,[esi] + mov [line_filter_type],eax + inc esi + +.filter_x: + + mov bh,[previous_pixel_value] + call filtering_sample_8 + mov [previous_pixel_value],bl + + mov bh,[previous_pixel_value+1] + call filtering_sample_8 + mov [previous_pixel_value+1],bl + + mov bh,[previous_pixel_value+2] + call filtering_sample_8 + mov [previous_pixel_value+2],bl + + cmp [IHDR_data.Color_type],byte 6 + jne @f + + mov bh,[previous_pixel_value+3] + call filtering_sample_8 + mov [previous_pixel_value+3],bl +@@: + mov [first_pixel],byte 0 + dec edx + jnz .filter_x + mov [first_line],byte 0 + dec ecx + jnz .filter +.filter_end: + ret +;------------------------------- +filtering_sample_8: + cld + lodsb + mov bl,al + call filtering + mov al,bl + cld + stosb + ret +;--------------------------------------------------------------------- +filtering_RGB_16: + mov ecx,[IHDR_data.Height] + test ecx,ecx + jz .filter_end_16 +.filter_16: + mov edx,[IHDR_data.Width] + test edx,edx + jz .filter_end_16 + xor eax,eax + mov [previous_pixel_value],eax + mov [previous_pixel_value+4],eax + mov [first_pixel],byte 1 + mov al,[esi] + mov [line_filter_type],eax + inc esi +.filter_x_16: + mov bx,[previous_pixel_value] + call filtering_sample_16 + mov [previous_pixel_value],bx + + mov bx,[previous_pixel_value+2] + call filtering_sample_16 + mov [previous_pixel_value+2],bx + + mov bx,[previous_pixel_value+4] + call filtering_sample_16 + mov [previous_pixel_value+4],bx + + cmp [IHDR_data.Color_type],byte 6 + jne @f + + mov bx,[previous_pixel_value+6] + call filtering_sample_16 + mov [previous_pixel_value+6],bx +@@: + mov [first_pixel],byte 0 + dec edx + jnz .filter_x_16 + mov [first_line],byte 0 + dec ecx + jnz .filter_16 +.filter_end_16: + ret +;------------------------------- +filtering_sample_16: + shl ebx,16 + cld + lodsw + mov bx,ax + call filtering + mov ax,bx + cld + stosw + ret +;--------------------------------------------------------------------- +filtering_grayscale: + mov ecx,[IHDR_data.Height] + test ecx,ecx + jz .filter_end_grayscale + + mov edx,[IHDR_data.Width] + test edx,edx + jz .filter_end_grayscale + cmp [IHDR_data.Color_type],byte 4 + je @f + imul edx,[resolution] + mov eax,edx + shr edx,3 + test eax,7 + jz @f + inc edx +@@: + +.filter_grayscale: + push edx + xor eax,eax + mov [previous_pixel_value],eax + mov [first_pixel],byte 1 + mov al,[esi] + mov [line_filter_type],eax + inc esi + +.filter_x_grayscale: + + mov bh,[previous_pixel_value] + call filtering_sample_8 + mov [previous_pixel_value],bl + + cmp [IHDR_data.Color_type],byte 4 + jne @f + + mov bh,[previous_pixel_value+1] + call filtering_sample_8 + mov [previous_pixel_value+1],bl +@@: + mov [first_pixel],byte 0 + dec edx + jnz .filter_x_grayscale + pop edx + + mov [first_line],byte 0 + dec ecx + jnz .filter_grayscale +.filter_end_grayscale: + ret +;--------------------------------------------------------------------- +filtering_grayscale_16: + mov ecx,[IHDR_data.Height] + test ecx,ecx + jz .filter_end_grayscale_16 + +.filter_grayscale_Bit_depth_16: + + mov edx,[IHDR_data.Width] + test edx,edx + jz .filter_end_grayscale_16 + xor eax,eax + mov [previous_pixel_value],eax + mov [first_pixel],byte 1 + mov al,[esi] + mov [line_filter_type],eax + inc esi +.filter_x_grayscale_16: + mov bx,[previous_pixel_value] + call filtering_sample_16 + mov [previous_pixel_value],bx + + cmp [IHDR_data.Color_type],byte 4 + jne @f + mov bx,[previous_pixel_value+2] + call filtering_sample_16 + mov [previous_pixel_value+2],bx + +@@: + mov [first_pixel],byte 0 + dec edx + jnz .filter_x_grayscale_16 + mov [first_line],byte 0 + dec ecx + jnz .filter_grayscale_Bit_depth_16 +.filter_end_grayscale_16: + ret +;--------------------------------------------------------------------- diff --git a/programs/media/zsea/plugins/png/interlac.inc b/programs/media/zsea/plugins/png/interlac.inc new file mode 100644 index 0000000000..75db60b056 --- /dev/null +++ b/programs/media/zsea/plugins/png/interlac.inc @@ -0,0 +1,1089 @@ +;***************************************************************************** +; PNG to RAW convert plugin - for zSea image viewer +; Copyright (c) 2008, 2009, Marat Zakiyanov aka Mario79, aka Mario +; All rights reserved. +; +; Redistribution and use in source and binary forms, with or without +; modification, are permitted provided that the following conditions are met: +; * Redistributions of source code must retain the above copyright +; notice, this list of conditions and the following disclaimer. +; * Redistributions in binary form must reproduce the above copyright +; notice, this list of conditions and the following disclaimer in the +; documentation and/or other materials provided with the distribution. +; * Neither the name of the nor the +; names of its contributors may be used to endorse or promote products +; derived from this software without specific prior written permission. +; +; THIS SOFTWARE IS PROVIDED BY Marat Zakiyanov ''AS IS'' AND ANY +; EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +; WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +; DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY +; DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +; (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +; ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +; (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +; SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +;--------------------------------------------------------------------- +filtering_RGB_Interlaced: + mov edx,dword filtering_RGB + mov ebp,dword move_Interlaced_RGB + jmp filtering_All +;--------------------------------------------------------------------- +filtering_RGB_16_Interlaced: + mov edx,dword filtering_RGB_16 + mov ebp,dword move_Interlaced_RGB + jmp filtering_All +;--------------------------------------------------------------------- +filtering_grayscale_Interlaced: + mov edx,dword filtering_grayscale + mov ebp,dword move_Interlaced_grayscale + jmp filtering_All +;--------------------------------------------------------------------- +filtering_grayscale_16_Interlaced: + mov edx,dword filtering_grayscale_16 + mov ebp,dword move_Interlaced_grayscale + jmp filtering_All +;--------------------------------------------------------------------- +pass dd 0 +filtering_All: + push edi + + mov ecx,[resolution] + imul ecx,[IHDR_data.Width] + mov eax,ecx + shr ecx,3 + test eax,7 + jz @f + inc ecx +@@: + mov eax,[IHDR_data.Height] + shr eax,1 + inc eax + imul ecx,eax + mcall 68, 12 + mov [Interlaced_area],eax +; jmp .3 + mov eax,dword calculate_Interlaced_counters + mov ecx,7 +@@: + mov [pass],ecx + mov [Interlaced_step],eax + push ecx + push eax edx edi ebp eax + call dword [eax] ;calculate_Interlaced_1 +; cmp [pass],1 +; jbe .2 + call edx +;.2: + pop eax ebp edi + push ebp +; cmp [pass],1 +; jbe .1 + call ebp +;.1: + pop ebp edx eax + add eax,4 + pop ecx + dec ecx + jnz @r +;.3: + mov ecx,[Interlaced_area] + mcall 68, 13 + + pop edi + ret +;--------------------------------------------------------------------- +move_Interlaced_RGB: + push edi esi + mov esi,[Interlaced_area] + + mov ecx,[IHDR_data.Height] + test ecx,ecx + jz .end + + mov edx,[IHDR_data.Width] + test edx,edx + jz .end + + mov ebx,[Image_Width] + imul ebx,[resolution] + shr ebx,3 + + mov eax,[Starting_Col] + imul eax,[resolution] + shr eax,3 + add edi,eax + + mov eax,[Starting_Row] + imul eax,ebx + add edi,eax + + imul ebx,[Row_Increment] + + mov ebp,[resolution] + imul ebp,[Col_Increment] + shr ebp,3 + +.filter: + mov edx,[IHDR_data.Width] + push edi + +.filter_x: + cmp [IHDR_data.Bit_depth],byte 8 + jne @f + call .Interlaced_RGB_8 + jmp .1 +@@: + call .Interlaced_RGB_16 +.1: + dec edx + jnz .filter_x + + pop edi + + add edi,ebx + dec ecx + jnz .filter +.end: + pop esi edi + ret +;------------------------------------------- +.Interlaced_RGB_8: + cld + lodsw + mov [edi],ax + lodsb + mov [edi+2],al + cmp [IHDR_data.Color_type],byte 6 + jne @f + lodsb + mov [edi+3],al +@@: + add edi,ebp + ret +;------------------------------------------- +.Interlaced_RGB_16: + cld + lodsd + mov [edi],eax + lodsw + mov [edi+4],ax + cmp [IHDR_data.Color_type],byte 6 + jne @f + lodsw + mov [edi+6],al +@@: + add edi,ebp + ret +;--------------------------------------------------------------------- +move_Interlaced_grayscale: +; cmp [eax],dword calculate_Interlaced_1 +; jne @f +; ret +;@@: +; cmp [eax],dword calculate_Interlaced_2 +; jne @f +; ret +;@@: +; cmp [eax],dword calculate_Interlaced_3 +; jne @f +; ret +;@@: +; cmp [eax],dword calculate_Interlaced_4 +; jne @f +; ret +;@@: +; cmp [eax],dword calculate_Interlaced_5 +; jne @f +; ret +;@@: +; cmp [eax],dword calculate_Interlaced_6 +; jne @f +; ret +;@@: +; cmp [eax],dword calculate_Interlaced_7 +; jne @f +; ret +;@@: + + push edi esi + mov esi,[Interlaced_area] + + mov ecx,[IHDR_data.Height] + test ecx,ecx + jz .end + + mov edx,[IHDR_data.Width] + test edx,edx + jz .end + + mov ebx,[Image_Width] + imul ebx,[resolution] + mov eax,ebx + shr ebx,3 + test eax,7 + jz @f + inc ebx +@@: +; ebx = Width in bytes, need correct for resolution less 4b + + mov eax,[Starting_Col] + imul eax,[resolution] +; mov ebp,eax + shr eax,3 +; test ebp,7 +; jz @f +; inc eax +;@@: +; eax = Starting Colummn in bytes + add edi,eax + + mov eax,[Starting_Row] + imul eax,ebx +; eax = Starting Row in bytes, no need correct! + add edi,eax + + imul ebx,[Row_Increment] +; ebx = Row Increment in bytes, no need correct! + + mov eax,[IHDR_data.Width] + imul eax,[resolution] + mov ebp,eax + shr eax,3 + test ebp,7 + jz @f + inc eax +@@: +; eax = Width in bytes for Interlaced, +; need correct for resolution less 4b + + mov ebp,[resolution] + imul ebp,[Col_Increment] +; mov eax,ebp + shr ebp,3 +; test eax,7 +; jz @f +; inc ebp +;@@: +; ebp = Column Increment in bytes + +.filter_grayscale: + mov edx,[IHDR_data.Width] + cmp [resolution],8 + jae .filter_grayscale_1 + +.resolution_4: + cmp [resolution],4 + jne .resolution_2 + test edx,1 + jnz @f + inc edx +@@: + shr edx,1 + jmp .filter_grayscale_1 + +.resolution_2: + cmp [resolution],2 + jne .resolution_1 + test edx,3 + jnz @f + add edx,4 +@@: + shr edx,2 + jmp .filter_grayscale_1 + +.resolution_1: + push eax + mov eax,edx + shr edx,3 + test eax,7 + jz @f + inc edx +@@: + pop eax +.filter_grayscale_1: + push eax edi esi + +.filter_x_grayscale: + cmp [IHDR_data.Bit_depth],byte 16 + jne @f + call .Interlaced_grayscale_16 + jmp .1 +@@: + cmp [IHDR_data.Bit_depth],byte 8 + jne @f + call .Interlaced_grayscale_8 + jmp .1 +@@: + cmp [IHDR_data.Bit_depth],byte 4 + jne @f + call .Interlaced_grayscale_4 + jmp .1 +@@: + cmp [IHDR_data.Bit_depth],byte 2 + jne @f + call .Interlaced_grayscale_2 + jmp .1 +@@: + call .Interlaced_grayscale_1 + jmp .1 +.1: + + dec edx + jnz .filter_x_grayscale + pop esi edi eax + add esi,eax + + add edi,ebx + dec ecx + jnz .filter_grayscale +.end: + pop esi edi + ret +;----------------------------------- +.Interlaced_grayscale_1: + mov eax,[Interlaced_step] + cmp eax,calculate_Interlaced_counters.1 + je .step_1 + cmp eax,calculate_Interlaced_counters.2 + je .step_2 + cmp eax,calculate_Interlaced_counters.3 + je .step_3 + cmp eax,calculate_Interlaced_counters.4 + je .step_4 + cmp eax,calculate_Interlaced_counters.5 + je .step_5 + cmp eax,calculate_Interlaced_counters.6 + je .step_6 + cld + movsb + ret +;-------------------- +.step_6: + push ebx + cld + lodsb + mov ah,al + + call @f + + shl ah,4 + mov al,ah + + call @f + + pop ebx + ret +;-------------------- +@@: + shr al,1 + and al,64 + + mov bl,ah + shr bl,2 + and bl,16 + add al,bl + + mov bl,ah + shr bl,3 + and bl,4 + add al,bl + + mov bl,ah + shr bl,4 + and bl,1 + add al,bl + + add al,[edi] + stosb + ret +;-------------------- +.step_5: + push ebx + cld + lodsb + + mov ah,al + + call @f + + shl ah,4 + mov al,ah + + call @f + + pop ebx + ret +;-------------------- +@@: + and al,128 + + mov bl,ah + shr bl,1 + and bl,32 + add al,bl + + mov bl,ah + shr bl,2 + and bl,8 + add al,bl + + mov bl,ah + shr bl,3 + and bl,2 + add al,bl + + add al,[edi] + stosb + ret +;-------------------- +.step_4: + push ebx + cld + lodsb + + mov ah,al + shr al,2 + and al,32 + mov bl,ah + shr bl,5 + call @f + + mov al,ah + and al,32 + mov bl,ah + shr bl,3 + call @f + + mov al,ah + shl al,2 + and al,32 + mov bl,ah + shr bl,1 + call @f + + mov al,ah + shl al,4 + and al,32 + mov bl,ah + shl bl,1 + call @f + pop ebx + ret +;-------------------- +@@: + and bl,2 + add al,bl + add al,[edi] + stosb + ret +;-------------------- +.step_3: + push ebx + cld + lodsb + + mov ah,al + and al,128 + mov bl,ah + shr bl,3 + call @f + + mov al,ah + shl al,2 + and al,128 + mov bl,ah + shr bl,1 + call @f + + mov al,ah + shl al,4 + and al,128 + mov bl,ah + shl bl,1 + call @f + + mov al,ah + shl al,6 + and al,128 + mov bl,ah + shl bl,3 + call @f + pop ebx + ret +;-------------------- +@@: + and bl,8 + add al,bl + add al,[edi] + stosb + ret +;-------------------- +.step_2: + cld + lodsb + + mov ah,al + shr al,4 + and al,8 + add al,[edi] + stosb + + mov al,ah + shr al,3 + and al,8 + add al,[edi] + stosb + + mov al,ah + shr al,2 + and al,8 + add al,[edi] + stosb + + mov al,ah + shr al,1 + and al,8 + add al,[edi] + stosb + + mov al,ah + and al,8 + add al,[edi] + stosb + + mov al,ah + shl al,1 + and al,8 + add al,[edi] + stosb + + mov al,ah + shl al,2 + and al,8 + add al,[edi] + stosb + + mov al,ah + shl al,3 + and al,8 + add al,[edi] + stosb + + ret +;-------------------- +.step_1: + cld + lodsb + mov ah,al + and al,128 + stosb + mov al,ah + shl al,1 + and al,128 + stosb + mov al,ah + shl al,2 + and al,128 + stosb + mov al,ah + shl al,3 + and al,128 + stosb + mov al,ah + shl al,4 + and al,128 + stosb + mov al,ah + shl al,5 + and al,128 + stosb + mov al,ah + shl al,6 + and al,128 + stosb + mov al,ah + shl al,7 + and al,128 + stosb + ret +;----------------------------------- +.Interlaced_grayscale_2: + mov eax,[Interlaced_step] + cmp eax,calculate_Interlaced_counters.1 + je .step_1_1 + cmp eax,calculate_Interlaced_counters.2 + je .step_2_1 + cmp eax,calculate_Interlaced_counters.3 + je .step_3_1 + cmp eax,calculate_Interlaced_counters.4 + je .step_4_1 + cmp eax,calculate_Interlaced_counters.5 + je .step_5_1 + cmp eax,calculate_Interlaced_counters.6 + je .step_6_1 + cld + movsb + ret + +.step_6_1: + push ebx + cld + lodsb + mov ah,al + + shr al,2 + and al,48 + mov bl,ah + shr bl,4 + and bl,3 + add al,bl + add al,[edi] + stosb + + mov al,ah + shl al,2 + and al,48 + mov bl,ah + and bl,3 + add al,bl + add al,[edi] + stosb + pop ebx + ret + +.step_5_1: + push ebx + cld + lodsb + mov ah,al + + and al,192 + mov bl,ah + shr bl,2 + and bl,12 + add al,bl + add al,[edi] + stosb + + mov al,ah + shl al,4 + and al,192 + mov bl,ah + shl bl,2 + and bl,12 + add al,bl + add al,[edi] + stosb + pop ebx + ret + +.step_4_1: + cld + lodsb + mov ah,al + + shr al,4 + and al,12 + add al,[edi] + stosb + + mov al,ah + shr al,2 + and al,12 + add al,[edi] + stosb + + mov al,ah + and al,12 + add al,[edi] + stosb + + mov al,ah + shl al,2 + and al,12 + add al,[edi] + stosb + + ret + +.step_3_1: + cld + lodsb + mov ah,al + + and al,192 + stosb + + mov al,ah + shl al,2 + and al,192 + stosb + + mov al,ah + shl al,4 + and al,192 + stosb + + mov al,ah + shl al,6 + and al,192 + stosb + + ret + +.step_2_1: + cld + lodsb + mov ah,al + + and al,192 + stosb + inc edi + + mov al,ah + shl al,2 + and al,192 + stosb + inc edi + + mov al,ah + shl al,4 + and al,192 + stosb + inc edi + + mov al,ah + shl al,6 + and al,192 + stosb + inc edi + + ret + +.step_1_1: + cld + lodsb + + mov ah,al + and al,192 + stosb + inc edi + + mov al,ah + shl al,2 + and al,192 + stosb + inc edi + + mov al,ah + shl al,4 + and al,192 + stosb + inc edi + + mov al,ah + shl al,6 + and al,192 + stosb + inc edi + + ret +;----------------------------------- +.Interlaced_grayscale_4: + mov al,[esi] + mov ah,[edi] + test ebp,ebp + jnz @f + call .even_2 + jmp .2 +@@: + test [Starting_Col],byte 1 + jz @f + call .even_1 + jmp .2 +@@: + call .odd_1 +.2: + add al,ah + mov [edi],al + add edi,ebp + + mov al,[esi] + mov ah,[edi] + test ebp,ebp + jnz @f + call .odd_1 + jmp .3 +@@: + test [Starting_Col],byte 1 + jz @f + call .even_2 + jmp .3 +@@: + call .odd_2 +.3: + add al,ah + mov [edi],al + add edi,ebp + + inc esi + test ebp,ebp + jnz @f + inc edi +@@: + ret +;--------------------- +.even_1: + shr al,4 + and ah,11110000b + ret +;--------------------- +.even_2: + and al,1111b + and ah,11110000b + ret +;--------------------- +.odd_1: + and al,11110000b + and ah,1111b + ret +;--------------------- +.odd_2: + shl al,4 + and ah,1111b + ret +;----------------------------------- +.Interlaced_grayscale_8: + cld + lodsb + mov [edi],al + cmp [IHDR_data.Color_type],byte 4 + jne @f + cld + lodsb + mov [edi+1],al +@@: + add edi,ebp + ret +;----------------------------------- +.Interlaced_grayscale_16: + cld + lodsw + mov [edi],ax + cmp [IHDR_data.Color_type],byte 4 + jne @f + cld + lodsw + mov [edi+2],ax +@@: + add edi,ebp + ret +;--------------------------------------------------------------------- +calculatte_Interlaced_data_1: + mov [first_line],byte 1 + mov edi,[Interlaced_area] + mov eax,[Image_Width] + mov ebx,dword Starting_Row + ret +;--------------------------------------------------------------------- +calculate_Interlaced_1: + call calculatte_Interlaced_data_1 + mov [ebx+0],dword 0 ;Starting_Row + mov [ebx+4],dword 0 ;Starting_Col + mov [ebx+8],dword 8 ;Row_Increment + mov [ebx+12],dword 8 ;Col_Increment + mov ebx,eax + shr eax,3 + test ebx,7 + jz @f + inc eax +@@: + mov [IHDR_data.Width],eax + + mov eax,[Image_Height] + mov ebx,eax + shr eax,3 + test ebx,7 + jz @f + inc eax +@@: + mov [IHDR_data.Height],eax + ret +;--------------------------------------------------------------------- +calculate_Interlaced_2: + call calculatte_Interlaced_data_1 + mov [ebx+0],dword 0 ;Starting_Row + mov [ebx+4],dword 4 ;Starting_Col + mov [ebx+8],dword 8 ;Row_Increment + mov [ebx+12],dword 8 ;Col_Increment + cmp eax,4 + ja @f + mov eax,4 +@@: + sub eax,4 + mov ebx,eax + shr eax,3 + test ebx,7 + jz @f + inc eax +@@: + mov [IHDR_data.Width],eax + + mov eax,[Image_Height] + mov ebx,eax + shr eax,3 + test ebx,7 + jz @f + inc eax +@@: + mov [IHDR_data.Height],eax + ret +;--------------------------------------------------------------------- +calculate_Interlaced_3: + call calculatte_Interlaced_data_1 + mov [ebx+0],dword 4 ;Starting_Row + mov [ebx+4],dword 0 ;Starting_Col + mov [ebx+8],dword 8 ;Row_Increment + mov [ebx+12],dword 4 ;Col_Increment + mov ebx,eax + shr eax,2 + test ebx,3 + jz @f + inc eax +@@: + mov [IHDR_data.Width],eax + + mov eax,[Image_Height] + cmp eax,4 + ja @f + mov eax,4 +@@: + sub eax,4 + mov ebx,eax + shr eax,3 + test ebx,7 + jz @f + inc eax +@@: + mov [IHDR_data.Height],eax + ret +;--------------------------------------------------------------------- +calculate_Interlaced_4: + call calculatte_Interlaced_data_1 + mov [ebx+0],dword 0 ;Starting_Row + mov [ebx+4],dword 2 ;Starting_Col + mov [ebx+8],dword 4 ;Row_Increment + mov [ebx+12],dword 4 ;Col_Increment + cmp eax,2 + ja @f + mov eax,2 +@@: + sub eax,2 + mov ebx,eax + shr eax,2 + test ebx,3 + jz @f + inc eax +@@: + mov [IHDR_data.Width],eax + + mov eax,[Image_Height] + mov ebx,eax + shr eax,2 + test ebx,3 + jz @f + inc eax +@@: + mov [IHDR_data.Height],eax + ret +;--------------------------------------------------------------------- +calculate_Interlaced_5: + call calculatte_Interlaced_data_1 + mov [ebx+0],dword 2 ;Starting_Row + mov [ebx+4],dword 0 ;Starting_Col + mov [ebx+8],dword 4 ;Row_Increment + mov [ebx+12],dword 2 ;Col_Increment + mov ebx,eax + shr eax,1 + test ebx,1 + jz @f + inc eax +@@: + mov [IHDR_data.Width],eax + + mov eax,[Image_Height] + cmp eax,2 + ja @f + mov eax,2 +@@: + sub eax,2 + mov ebx,eax + shr eax,2 + test ebx,3 + jz @f + inc eax +@@: + mov [IHDR_data.Height],eax + ret +;--------------------------------------------------------------------- +calculate_Interlaced_6: + call calculatte_Interlaced_data_1 + mov [ebx+0],dword 0 ;Starting_Row + mov [ebx+4],dword 1 ;Starting_Col + mov [ebx+8],dword 2 ;Row_Increment + mov [ebx+12],dword 2 ;Col_Increment + cmp eax,1 + ja @f + mov eax,1 +@@: + dec eax + mov ebx,eax + shr eax,1 + test ebx,1 + jz @f + inc eax +@@: + mov [IHDR_data.Width],eax + + mov eax,[Image_Height] + mov ebx,eax + shr eax,1 + test ebx,1 + jz @f + inc eax +@@: + mov [IHDR_data.Height],eax + ret +;--------------------------------------------------------------------- +calculate_Interlaced_7: + call calculatte_Interlaced_data_1 + mov [ebx+0],dword 1 ;Starting_Row + mov [ebx+4],dword 0 ;Starting_Col + mov [ebx+8],dword 2 ;Row_Increment + mov [ebx+12],dword 1 ;Col_Increment + + mov [IHDR_data.Width],eax +; mov ebx,[raw_area] +; mov [ebx+4],eax + + mov eax,[Image_Height] + cmp eax,1 + ja @f + mov eax,1 +@@: + dec eax + mov ebx,eax + shr eax,1 + test ebx,1 + jz @f + inc eax +@@: + mov [IHDR_data.Height],eax + +; mov ebx,[raw_area] +; mov eax,[Image_Height] +; mov [ebx+8],eax + ret +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/plugins/png/proced.inc b/programs/media/zsea/plugins/png/proced.inc new file mode 100644 index 0000000000..a971a90521 --- /dev/null +++ b/programs/media/zsea/plugins/png/proced.inc @@ -0,0 +1,159 @@ +;***************************************************************************** +; PNG to RAW convert plugin - for zSea image viewer +; Copyright (c) 2008, 2009, Marat Zakiyanov aka Mario79, aka Mario +; All rights reserved. +; +; Redistribution and use in source and binary forms, with or without +; modification, are permitted provided that the following conditions are met: +; * Redistributions of source code must retain the above copyright +; notice, this list of conditions and the following disclaimer. +; * Redistributions in binary form must reproduce the above copyright +; notice, this list of conditions and the following disclaimer in the +; documentation and/or other materials provided with the distribution. +; * Neither the name of the nor the +; names of its contributors may be used to endorse or promote products +; derived from this software without specific prior written permission. +; +; THIS SOFTWARE IS PROVIDED BY Marat Zakiyanov ''AS IS'' AND ANY +; EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +; WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +; DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY +; DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +; (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +; ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +; (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +; SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +;--------------------------------------------------------------------- +deflate_callback: + cmp [deflate_start_offset],1 + je @f + mov [deflate_start_offset],1 + jmp .1 +@@: + mov eax,[IDAT.pointer] + add eax,[IDAT.size] + mov ebx,[image_file] + add ebx,[file_size] + sub ebx,32 + cmp ebx,eax + jbe @f + mov [next_Chunk],eax + call search_IDAT + jmp .1 +@@: + xor eax,eax + mov [IDAT.size],eax + mov [IDAT.pointer],eax +.1: + mov ecx, [esp+8] + mov eax,[IDAT.size] + mov [ecx], eax ;length + mov eax,[IDAT.pointer] ; buffer + ret 8 +;--------------------------------------------------------------------- +search_IHDR: + mov [Chunk_pointer],IHDR_name + call get_Chunk_data_pointer + mov eax,[Chunk_pointer] + cmp eax,0 + je .no_png_file + mov [IHDR.pointer],eax + mov ecx,[eax-8] + call convert_NBO_to_PC + mov [IHDR.size],ecx + ret +.no_png_file: + add esp,4 + jmp no_png_file +;--------------------------------------------------------------------- +search_PLTE: + push eax ecx + mov [Chunk_pointer],PLTE_name + call get_Chunk_data_pointer + mov eax,[Chunk_pointer] + cmp eax,0 + je .no_png_file + mov [PLTE.pointer],eax + mov ecx,[eax-8] + call convert_NBO_to_PC + mov [PLTE.size],ecx + pop ecx eax + ret +.no_png_file: + add esp,12 + jmp no_png_file +;--------------------------------------------------------------------- +search_IDAT: + mov [Chunk_pointer],IDAT_name + call get_Chunk_data_pointer + mov eax,[Chunk_pointer] + cmp eax,0 + je .no_IDAT_next + mov [IDAT.pointer],eax + mov ecx,[eax-8] + call convert_NBO_to_PC + mov [IDAT.size],ecx + xor eax,eax + ret +.no_IDAT_next: +; add esp,4 +; jmp no_png_file + mov eax,1 + ret +;--------------------------------------------------------------------- +search_IEND: + mov [Chunk_pointer],IEND_name + call get_Chunk_data_pointer + mov eax,[Chunk_pointer] + cmp eax,0 + je .no_png_file + mov [IEND.pointer],eax + mov ecx,[eax-8] + call convert_NBO_to_PC + mov [IEND.size],ecx + ret +.no_png_file: + add esp,4 + jmp no_png_file +;--------------------------------------------------------------------- +convert_NBO_to_PC: ;network byte order value to PC value + push eax + mov al,ch + mov ah,cl + shl eax,16 + shr ecx,16 + mov al,ch + mov ah,cl + mov ecx,eax + pop eax + ret +;--------------------------------------------------------------------- +get_Chunk_data_pointer: + pushad + mov ebp,4 +; mov edi,[image_file] + mov edi,[next_Chunk] + mov edx,[image_file] ;edi + add edx,[file_size] + dec edi +.search_Chunk: + cmp edx,edi + jbe .end + mov esi,[Chunk_pointer] + mov ecx,ebp + inc edi + mov ebx,edi + cld + rep cmpsb + mov edi,ebx + jne .search_Chunk + add edi,ebp + mov [Chunk_pointer],edi + popad + ret +.end: + mov [Chunk_pointer],0 + popad + ret +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/plugins/rotate/build.bat b/programs/media/zsea/plugins/rotate/build.bat new file mode 100644 index 0000000000..dc7eeb397c --- /dev/null +++ b/programs/media/zsea/plugins/rotate/build.bat @@ -0,0 +1,3 @@ +@fasm -m 16384 rotate.asm rotate.obj +@kpack rotate.obj +@pause \ No newline at end of file diff --git a/programs/media/zsea/plugins/rotate/build.sh b/programs/media/zsea/plugins/rotate/build.sh new file mode 100644 index 0000000000..2843977bb5 --- /dev/null +++ b/programs/media/zsea/plugins/rotate/build.sh @@ -0,0 +1,10 @@ +#!/bin/bash +# This script does for Linux the same as build.bat for DOS, +# it compiles the current KolibriOS applications + + fasm -m 16384 rotate.asm rotate.obj + kpack rotate.obj + exit 0 + + + diff --git a/programs/media/zsea/plugins/rotate/rotate.asm b/programs/media/zsea/plugins/rotate/rotate.asm new file mode 100644 index 0000000000..343d98f531 --- /dev/null +++ b/programs/media/zsea/plugins/rotate/rotate.asm @@ -0,0 +1,301 @@ +;***************************************************************************** +; Rotate RAW image plugin - for zSea image viewer +; Copyright (c) 2009 - 2011, Marat Zakiyanov aka Mario79, aka Mario +; All rights reserved. +; +; Redistribution and use in source and binary forms, with or without +; modification, are permitted provided that the following conditions are met: +; * Redistributions of source code must retain the above copyright +; notice, this list of conditions and the following disclaimer. +; * Redistributions in binary form must reproduce the above copyright +; notice, this list of conditions and the following disclaimer in the +; documentation and/or other materials provided with the distribution. +; * Neither the name of the nor the +; names of its contributors may be used to endorse or promote products +; derived from this software without specific prior written permission. +; +; THIS SOFTWARE IS PROVIDED BY Marat Zakiyanov ''AS IS'' AND ANY +; EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +; WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +; DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY +; DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +; (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +; ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +; (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +; SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +;***************************************************************************** +; Rotate 32b, 24b, 16b, 8b + +format MS COFF + +public EXPORTS + +section '.flat' code readable align 16 + +;include 'macros.inc' +include '../../../../macros.inc' +;--------------------------------------------------------------------- +START: + pushad + mov [pointer],eax +; ebx - direction +; 1 - clockwise, 2 - counter clockwise +; 3 - Left&Right, 4 - Up&Down + mov [direction],ebx + mov eax,[eax+4] + mov [image_file],eax + + mov esi,[eax+28] + add esi,eax +; mov ecx,[eax+32] +; xor ebx,ebx +; mov [raw_area],ebx + mov ebx,[eax+12] + cmp ebx,32 + jne @f + mov ebp,dword START.32 + jmp .1 +@@: + cmp ebx,24 + jne @f + mov ebp,dword START.24 + jmp .1 +@@: + cmp ebx,16 + jne @f + mov ebp,dword START.16 + jmp .1 +@@: + cmp ebx,15 + jne @f + inc ebx + mov ebp,dword START.16 + jmp .1 +@@: + cmp ebx,8 + jne @f + mov ebp,dword START.8 +@@: +.1: + shr ebx,3 + mov [bytes_to_pixel],ebx + mov ebx,[eax+4] + imul ebx,[bytes_to_pixel] + mov [size_x],ebx + mov ebx,[eax+8] + imul ebx,[bytes_to_pixel] + mov [size_y],ebx + + call .get_memory + + cmp [direction],1 + jne @f + call .clockwise + jmp .end +@@: + cmp [direction],2 + jne @f + call .counter_clockwise + jmp .end +@@: + cmp [direction],3 + jne @f + call .Left_Right + jmp .end +@@: + cmp [direction],4 + jne .exit + call .Up_Down +.end: + xchg esi,edi + mov ecx,[image_file] + mov eax,[ecx+4] + imul eax,[bytes_to_pixel] + imul eax,[ecx+8] + + mov ecx,eax + cld + rep movsb + + mov ecx,[raw_area] + mcall 68,13 +;--------------------------------------------------------------------- +.ret_ok: + cmp [direction],1 + jne @f + call .XY_data_exchange + jmp .exit +@@: + cmp [direction],2 + jne .exit + call .XY_data_exchange +.exit: + popad + ret +;--------------------------------------------------------------------- +.XY_data_exchange: + mov ecx,[image_file] + mov eax,[ecx+4] + mov ebx,[ecx+8] + mov [ecx+8],eax + mov [ecx+4],ebx + ret +;--------------------------------------------------------------------- +.clockwise: + push edi esi + + add edi,[size_y] + sub edi,[bytes_to_pixel] +.y: + push edi + push ebx +.x: + call ebp + add edi,[size_y] + dec ebx + jnz .x + + pop ebx + pop edi + + sub edi,[bytes_to_pixel] + dec ecx + jnz .y + + pop esi edi + ret +;--------------------------------------------------------------------- +.counter_clockwise: + push edi esi + + mov eax,[eax+4] + dec eax + imul eax,[size_y] + add edi,eax +.y1: + push edi + push ebx +.x1: + call ebp + sub edi,[size_y] + dec ebx + jnz .x1 + + pop ebx + pop edi + + add edi,[bytes_to_pixel] + dec ecx + jnz .y1 + + pop esi edi + ret +;--------------------------------------------------------------------- +.Left_Right: + push edi esi + add edi,[size_x] +.y2: + push edi + push ebx +.x2: + sub edi,[bytes_to_pixel] + call ebp + dec ebx + jnz .x2 + + pop ebx + pop edi + + add edi,[size_x] + dec ecx + jnz .y2 + + pop esi edi + ret +;--------------------------------------------------------------------- +.Up_Down: + push edi esi + + mov eax,[eax+8] + dec eax + imul eax,[size_x] + add edi,eax +.y3: + push edi + push ebx +.x3: + call ebp + add edi,[bytes_to_pixel] + dec ebx + jnz .x3 + + pop ebx + pop edi + + sub edi,[size_x] + dec ecx + jnz .y3 + + pop esi edi + ret +;--------------------------------------------------------------------- +.32: + cld + lodsd + mov [edi],eax + + ret +;--------------------------------------------------------------------- +.24: + cld + lodsw + mov [edi],ax + lodsb + mov [edi+2],al + ret +;--------------------------------------------------------------------- +.16: + cld + lodsw + mov [edi],ax + ret +;--------------------------------------------------------------------- +.8: + cld + lodsb + mov [edi],al + ret +;--------------------------------------------------------------------- +.get_memory: + mov ecx,[eax+4] + imul ecx,[eax+8] + imul ecx,[bytes_to_pixel] + push eax + mcall 68,12 + mov [raw_area],eax + mov edi,eax + pop eax + mov ebx,[eax+4] + mov ecx,[eax+8] + ret +;--------------------------------------------------------------------- +align 16 +EXPORTS: + dd szStart, START + dd szVersion, 0x00010001 + dd 0 + +szStart db 'START',0 +szVersion db 'version',0 + +pointer dd 0 +image_file dd 0 +direction dd 0 +size_x dd 0 +size_y dd 0 +bytes_to_pixel dd 0 +;delta dd 0 +;resolution dd 0 +;compression dd 0 +raw_area dd 0 \ No newline at end of file diff --git a/programs/media/zsea/plugins/scaling/b_filter.inc b/programs/media/zsea/plugins/scaling/b_filter.inc new file mode 100644 index 0000000000..c0ead5e112 --- /dev/null +++ b/programs/media/zsea/plugins/scaling/b_filter.inc @@ -0,0 +1,1001 @@ +;--------------------------------------------------------------------- +align 4 +.check_filtering_24: + cmp [filtering],0 + je .24_1 + + mov ebx,[temp_y1] + inc ebx + cmp ebx,[y] + jae .last_y_24 ;.24_1 + + mov ebx,[temp_x1] + push eax + mov eax,[x] + dec eax + lea eax,[eax*3] + cmp ebx,eax + pop eax + jae .last_x_24 ;.24_1 + +; mov ebx,[esp+4] +;; test ebx,ebx +;; jz .24_1 +; inc ebx +; cmp bx,[new_size.y1] +; jae .last_y ;.24_1 + +; mov ebx,[esp] +;; test ebx,ebx +;; jz .24_1 +; inc ebx +; cmp bx,[new_size.x1] +; jae .last_x ;.24_1 + +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[ecx+3] + call .mix_RGB +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + add ecx,[size_x] + mov eax,[ecx] + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[ecx+3] + call .mix_RGB + + call .RGB_to_EAX + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB +;---------------------------- + call .RGB_to_EAX1 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB + call .RGB_to_EAX +.24_1: + ret +;--------------------------------------------------------------------- +align 4 +.last_y_24: + mov ebx,[temp_x1] + push eax + mov eax,[x] + dec eax + lea eax,[eax*3] + cmp ebx,eax + pop eax + jae .last_x_y_24 ;.24_1 + + mov ebx,[esp+4] +; test ebx,ebx +; jz .24_1 + inc ebx + cmp bx,[new_size.x1] + jae .last_x_y_24 ;.24_1 +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[ecx+3] + call .mix_RGB +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + mov eax,[background_color] + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + call .mix_RGB + + call .RGB_to_EAX + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB +;---------------------------- + call .RGB_to_EAX1 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB + call .RGB_to_EAX +;--------------------------------------- + ret +;--------------------------------------------------------------------- +align 4 +.last_x_24: + mov ebx,[temp_y1] + inc ebx + cmp ebx,[y] + jae .last_x_y_24 ;.24_1 + + mov ebx,[esp+8] +; test ebx,ebx +; jz .24_1 + inc ebx + cmp bx,[new_size.y1] + jae .last_x_y_24 ;.24_1 +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + call .mix_RGB +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + add ecx,[size_x] + mov eax,[ecx] + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + call .mix_RGB + + call .RGB_to_EAX + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB +;---------------------------- + call .RGB_to_EAX1 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB + call .RGB_to_EAX + ret +;--------------------------------------------------------------------- +align 4 +.last_x_y_24: +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + call .mix_RGB +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + mov eax,[background_color] + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + call .mix_RGB + + call .RGB_to_EAX + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB +;---------------------------- + call .RGB_to_EAX1 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB + call .RGB_to_EAX + ret +;--------------------------------------------------------------------- +align 4 +.copy_RGB_to_RGB1: + mov eax,[B_sample] + mov [B_sample_1],eax + mov eax,[G_sample] + mov [G_sample_1],eax + mov eax,[R_sample] + mov [R_sample_1],eax + ret +;--------------------------------------- +align 4 +.mix_RGB: + xor ebx,ebx + mov bl,al + imul ebx,edx + add [B_sample],ebx + shr eax,8 + xor ebx,ebx + mov bl,al + imul ebx,edx + add [G_sample],ebx + shr eax,8 + xor ebx,ebx + mov bl,al + imul ebx,edx + add [R_sample],ebx + ret +;--------------------------------------- +align 4 +.mix_RGB_16: + xor ebx,ebx + mov bl,al + and bl,0x1F + imul ebx,edx + add [B_sample],ebx + shr eax,5 + xor ebx,ebx + mov bl,al + cmp [resolution],16 + jne @f + and bl,0x3F + shr eax,6 + jmp .mix_RGB_16_G_sample +align 4 +@@: + and bl,0x1F + shr eax,5 +align 4 +.mix_RGB_16_G_sample: + imul ebx,edx + add [G_sample],ebx + xor ebx,ebx + mov bl,al + and bl,0x1F + imul ebx,edx + add [R_sample],ebx + ret +;--------------------------------------- +align 4 +.clear_RGB: + xor ebx,ebx + mov [B_sample],ebx + mov [G_sample],ebx + mov [R_sample],ebx + ret +;--------------------------------------- +align 4 +.RGB_to_EAX: + mov eax,[R_sample] + shr eax,7 + and eax,0xff + shl eax,8 + mov ebx,[G_sample] + shr ebx,7 + mov al,bl + shl eax,8 + mov ebx,[B_sample] + shr ebx,7 + mov al,bl + ret +;--------------------------------------- +align 4 +.RGB_to_EAX_16: + mov eax,[R_sample] + shr eax,7 + and eax,0x1F + mov ebx,[G_sample] + shr ebx,7 + cmp [resolution],16 + jne @f + shl eax,6 + and ebx,0x3F + jmp .RGB_to_EAX_16_G_sample +align 4 +@@: + shl eax,5 + and ebx,0x1F +align 4 +.RGB_to_EAX_16_G_sample: + add eax,ebx + shl eax,5 + mov ebx,[B_sample] + shr ebx,7 + and ebx,0x1F + add eax,ebx + ret +;--------------------------------------- +align 4 +.RGB_to_EAX1: + mov eax,[R_sample_1] + shr eax,7 + and eax,0xff + shl eax,8 + mov ebx,[G_sample_1] + shr ebx,7 + mov al,bl + shl eax,8 + mov ebx,[B_sample_1] + shr ebx,7 + mov al,bl + ret +;--------------------------------------- +align 4 +.RGB_to_EAX1_16: + mov eax,[R_sample_1] + shr eax,7 + and eax,0x1F + mov ebx,[G_sample_1] + shr ebx,7 + cmp [resolution],16 + jne @f + shl eax,6 + and ebx,0x3F + jmp .RGB_to_EAX1_16_G_sample +align 4 +@@: + shl eax,5 + and ebx,0x1F +align 4 +.RGB_to_EAX1_16_G_sample: + add eax,ebx + shl eax,5 + mov ebx,[B_sample_1] + shr ebx,7 + and ebx,0x1F + add eax,ebx + ret +;--------------------------------------------------------------------- +align 4 +.check_filtering_32: + cmp [filtering],0 + je .32_1 + + mov ebx,[temp_y1] + inc ebx + cmp ebx,[y] + jae .last_y_32 ;.24_1 + + mov ebx,[temp_x1] + push eax + mov eax,[x] + dec eax + shl eax,2 + cmp ebx,eax + pop eax + jae .last_x_32 ;.24_1 + +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[ecx+4] + call .mix_RGB +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + add ecx,[size_x] + mov eax,[ecx] + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[ecx+4] + call .mix_RGB + + call .RGB_to_EAX + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB +;---------------------------- + call .RGB_to_EAX1 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB + call .RGB_to_EAX +.32_1: + ret +;--------------------------------------------------------------------- +align 4 +.last_y_32: + mov ebx,[temp_x1] + push eax + mov eax,[x] + dec eax + shl eax,2 + cmp ebx,eax + pop eax + jae .last_x_y_32 ;.32_1 + + mov ebx,[esp+4] +; test ebx,ebx +; jz .24_1 + inc ebx + cmp bx,[new_size.x1] + jae .last_x_y_32 ;.32_1 +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[ecx+4] + call .mix_RGB +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + mov eax,[background_color] + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + call .mix_RGB + + call .RGB_to_EAX + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB +;---------------------------- + call .RGB_to_EAX1 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB + call .RGB_to_EAX + ret +;--------------------------------------------------------------------- +align 4 +.last_x_32: + mov ebx,[temp_y1] + inc ebx + cmp ebx,[y] + jae .last_x_y_32 ;.32_1 + + mov ebx,[esp+8] +; test ebx,ebx +; jz .24_1 + inc ebx + cmp bx,[new_size.y1] + jae .last_x_y_32 ;.32_1 +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + call .mix_RGB +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + add ecx,[size_x] + mov eax,[ecx] + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + call .mix_RGB + + call .RGB_to_EAX + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB +;---------------------------- + call .RGB_to_EAX1 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB + call .RGB_to_EAX + ret +;--------------------------------------------------------------------- +align 4 +.last_x_y_32: +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + call .mix_RGB +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + mov eax,[background_color] + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + call .mix_RGB + + call .RGB_to_EAX + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB +;---------------------------- + call .RGB_to_EAX1 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB + call .RGB_to_EAX + ret +;--------------------------------------------------------------------- +align 4 +.check_filtering_16: + cmp [filtering],0 + je .16_1 + + mov ebx,[temp_y1] + inc ebx + cmp ebx,[y] + jae .last_y_16 ;.24_1 + + mov ebx,[temp_x1] + push eax + mov eax,[x] + dec eax + shl eax,1 + cmp ebx,eax + pop eax + jae .last_x_16 ;.24_1 + +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB_16 + + mov edx,[next_pixel_x] + xor eax,eax + mov ax,[ecx+2] + call .mix_RGB_16 +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + add ecx,[size_x] + xor eax,eax + mov ax,[ecx] + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB_16 + + mov edx,[next_pixel_x] + xor eax,eax + mov ax,[ecx+2] + call .mix_RGB_16 + + call .RGB_to_EAX_16 + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB_16 +;---------------------------- + call .RGB_to_EAX1_16 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB_16 + call .RGB_to_EAX_16 +.16_1: + ret +;--------------------------------------------------------------------- +align 4 +.last_y_16: + mov ebx,[temp_x1] + push eax + mov eax,[x] + dec eax + shl eax,1 + cmp ebx,eax + pop eax + jae .last_x_y_16 ;.16_1 + + mov ebx,[esp+4] +; test ebx,ebx +; jz .24_1 + inc ebx + cmp bx,[new_size.x1] + jae .last_x_y_16 ;.16_1 +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB_16 + + mov edx,[next_pixel_x] + xor eax,eax + mov ax,[ecx+2] + call .mix_RGB_16 +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + mov eax,[background_color] + and eax,0xffff + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB_16 + + mov edx,[next_pixel_x] + mov eax,[background_color] + and eax,0xffff + call .mix_RGB_16 + + call .RGB_to_EAX_16 + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB_16 +;---------------------------- + call .RGB_to_EAX1_16 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB_16 + call .RGB_to_EAX_16 + ret +;--------------------------------------------------------------------- +align 4 +.last_x_16: + mov ebx,[temp_y1] + inc ebx + cmp ebx,[y] + jae .last_x_y_16 ;.16_1 + + mov ebx,[esp+8] +; test ebx,ebx +; jz .24_1 + inc ebx + cmp bx,[new_size.y1] + jae .last_x_y_16 ;.16_1 +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB_16 + + mov edx,[next_pixel_x] + mov eax,[background_color] + and eax,0xffff + call .mix_RGB_16 +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + add ecx,[size_x] + xor eax,eax + mov ax,[ecx] + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB_16 + + mov edx,[next_pixel_x] + mov eax,[background_color] + and eax,0xffff + call .mix_RGB_16 + + call .RGB_to_EAX_16 + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB_16 +;---------------------------- + call .RGB_to_EAX1_16 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB_16 + call .RGB_to_EAX_16 + ret +;--------------------------------------------------------------------- +align 4 +.last_x_y_16: +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB_16 + + mov edx,[next_pixel_x] + mov eax,[background_color] + and eax,0xffff + call .mix_RGB_16 +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + mov eax,[background_color] + and eax,0xffff + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB_16 + + mov edx,[next_pixel_x] + mov eax,[background_color] + and eax,0xffff + call .mix_RGB_16 + + call .RGB_to_EAX_16 + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB_16 +;---------------------------- + call .RGB_to_EAX1_16 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB_16 + call .RGB_to_EAX_16 + ret +;--------------------------------------------------------------------- +align 4 +.get_palette: + shl eax,2 + add eax,[palette] + mov eax,[eax] + ret +;--------------------------------------------------------------------- +align 4 +.check_filtering_8: + xor eax,eax + mov al,[ecx] + call .get_palette + + mov ebx,[temp_y1] + inc ebx + cmp ebx,[y] + jae .last_y_8 + + mov ebx,[temp_x1] + push eax + mov eax,[x] + dec eax + cmp ebx,eax + pop eax + jae .last_x_8 + +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + xor eax,eax + mov al,[ecx+1] + call .get_palette + call .mix_RGB +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + add ecx,[size_x] + xor eax,eax + mov al,[ecx] + call .get_palette + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + xor eax,eax + mov al,[ecx+1] + call .get_palette + call .mix_RGB + + call .RGB_to_EAX + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB +;---------------------------- + call .RGB_to_EAX1 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB + call .RGB_to_EAX +.8_1: + ret +;--------------------------------------------------------------------- +align 4 +.last_y_8: + mov ebx,[temp_x1] + push eax + mov eax,[x] + dec eax + cmp ebx,eax + pop eax + jae .last_x_y_8 ;.8_1 + + mov ebx,[esp+4] +; test ebx,ebx +; jz .24_1 + inc ebx + cmp bx,[new_size.x1] + jae .last_x_y_8 ;.8_1 +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + xor eax,eax + mov al,[ecx+1] + call .get_palette + call .mix_RGB +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + mov eax,[background_color] + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + call .mix_RGB + + call .RGB_to_EAX + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB +;---------------------------- + call .RGB_to_EAX1 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB + call .RGB_to_EAX +;--------------------------------------- + ret +;--------------------------------------------------------------------- +align 4 +.last_x_8: + mov ebx,[temp_y1] + inc ebx + cmp ebx,[y] + jae .last_x_y_8 ;.8_1 + + mov ebx,[esp+8] +; test ebx,ebx +; jz .24_1 + inc ebx + cmp bx,[new_size.y1] + jae .last_x_y_8 ;.8_1 +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + call .mix_RGB +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + add ecx,[size_x] + xor eax,eax + mov al,[ecx] + call .get_palette + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + + call .mix_RGB + + call .RGB_to_EAX + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB +;---------------------------- + call .RGB_to_EAX1 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB + call .RGB_to_EAX + ret +;--------------------------------------------------------------------- +align 4 +.last_x_y_8: +;---------------------------- + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + call .mix_RGB +;---------------------------- + call .copy_RGB_to_RGB1 +;---------------------------- + mov eax,[background_color] + + call .clear_RGB + mov edx,128 ;100 + sub edx,[next_pixel_x] + call .mix_RGB + + mov edx,[next_pixel_x] + mov eax,[background_color] + + call .mix_RGB + + call .RGB_to_EAX + + call .clear_RGB + mov edx,[next_pixel_y] + call .mix_RGB +;---------------------------- + call .RGB_to_EAX1 +;---------------------------- + mov edx,128 ;100 + sub edx,[next_pixel_y] + call .mix_RGB + call .RGB_to_EAX + ret +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/plugins/scaling/build.bat b/programs/media/zsea/plugins/scaling/build.bat new file mode 100644 index 0000000000..b4f4d02bc8 --- /dev/null +++ b/programs/media/zsea/plugins/scaling/build.bat @@ -0,0 +1,3 @@ +@fasm -m 16384 scaling.asm scaling.obj +@kpack scaling.obj +@pause \ No newline at end of file diff --git a/programs/media/zsea/plugins/scaling/build.sh b/programs/media/zsea/plugins/scaling/build.sh new file mode 100644 index 0000000000..c72e3e6e5c --- /dev/null +++ b/programs/media/zsea/plugins/scaling/build.sh @@ -0,0 +1,10 @@ +#!/bin/bash +# This script does for Linux the same as build.bat for DOS, +# it compiles the current KolibriOS applications + + fasm -m 16384 scaling.asm scaling.obj + kpack scaling.obj + exit 0 + + + diff --git a/programs/media/zsea/plugins/scaling/macros.inc b/programs/media/zsea/plugins/scaling/macros.inc new file mode 100644 index 0000000000..6df8eca325 --- /dev/null +++ b/programs/media/zsea/plugins/scaling/macros.inc @@ -0,0 +1,269 @@ +; new application structure +macro meos_app_start + { + use32 + org 0x0 + + db 'MENUET01' + dd 0x01 + dd __start + dd __end + dd __memory + dd __stack + + if used __params & ~defined __params + dd __params + else + dd 0x0 + end if + + dd 0x0 + } +MEOS_APP_START fix meos_app_start + +macro code + { + __start: + } +CODE fix code + +macro data + { + __data: + } +DATA fix data + +macro udata + { + if used __params & ~defined __params + __params: + db 0 + __end: + rb 255 + else + __end: + end if + __udata: + } +UDATA fix udata + +macro meos_app_end + { + align 32 + rb 2048 + __stack: + __memory: + } +MEOS_APP_END fix meos_app_end + + +; macro for defining multiline text data +struc mstr [sstring] + { + forward + local ssize + virtual at 0 + db sstring + ssize = $ + end virtual + dd ssize + db sstring + common + dd -1 + } + + +; strings +macro sz name,[data] { ; from MFAR [mike.dld] + common + if used name + label name + end if + forward + if used name + db data + end if + common + if used name + .size = $-name + end if +} + +macro lsz name,[lng,data] { ; from MFAR [mike.dld] + common + if used name + label name + end if + forward + if (used name)&(lang eq lng) + db data + end if + common + if used name + .size = $-name + end if +} + + + +; easy system call macro +macro mpack dest, hsrc, lsrc +{ + if (hsrc eqtype 0) & (lsrc eqtype 0) + mov dest, (hsrc) shl 16 + lsrc + else + if (hsrc eqtype 0) & (~lsrc eqtype 0) + mov dest, (hsrc) shl 16 + add dest, lsrc + else + mov dest, hsrc + shl dest, 16 + add dest, lsrc + end if + end if +} + +macro __mov reg,a,b { ; mike.dld + if (~a eq)&(~b eq) + mpack reg,a,b + else if (~a eq)&(b eq) + mov reg,a + end if +} + +macro mcall a,b,c,d,e,f { ; mike.dld + __mov eax,a + __mov ebx,b + __mov ecx,c + __mov edx,d + __mov esi,e + __mov edi,f + int 0x40 +} + + + +; optimize the code for size +__regs fix + +macro add arg1,arg2 + { + if (arg2 eqtype 0) + if (arg2) = 1 + inc arg1 + else + add arg1,arg2 + end if + else + add arg1,arg2 + end if + } + +macro sub arg1,arg2 + { + if (arg2 eqtype 0) + if (arg2) = 1 + dec arg1 + else + sub arg1,arg2 + end if + else + sub arg1,arg2 + end if + } + +macro mov arg1,arg2 + { + if (arg1 in __regs) & ((arg2 eqtype 0) | (arg2 eqtype '0')) + if (arg2) = 0 + xor arg1,arg1 + else if (arg2) = 1 + xor arg1,arg1 + inc arg1 + else if (arg2) = -1 + or arg1,-1 + else if (arg2) > -128 & (arg2) < 128 + push arg2 + pop arg1 + else + mov arg1,arg2 + end if + else + mov arg1,arg2 + end if + } + + +macro struct name + { + virtual at 0 + name name + sizeof.#name = $ - name + end virtual + } + +; structures used in MeOS +struc process_information + { + .cpu_usage dd ? ; +0 + .window_stack_position dw ? ; +4 + .window_stack_value dw ? ; +6 + .not_used1 dw ? ; +8 + .process_name rb 12 ; +10 + .memory_start dd ? ; +22 + .used_memory dd ? ; +26 + .PID dd ? ; +30 + .x_start dd ? ; +34 + .y_start dd ? ; +38 + .x_size dd ? ; +42 + .y_size dd ? ; +46 + .slot_state dw ? ; +50 + dw ? ; +52 - reserved + .client_left dd ? ; +54 + .client_top dd ? ; +58 + .client_width dd ? ; +62 + .client_height dd ? ; +66 + .wnd_state db ? ; +70 + rb (1024-71) + } +;struct process_information + +struc system_colors + { + .frame dd ? + .grab dd ? + .grab_button dd ? + .grab_button_text dd ? + .grab_text dd ? + .work dd ? + .work_button dd ? + .work_button_text dd ? + .work_text dd ? + .work_graph dd ? + } +;struct system_colors + + +; constants + +; events +EV_IDLE = 0 +EV_TIMER = 0 +EV_REDRAW = 1 +EV_KEY = 2 +EV_BUTTON = 3 +EV_EXIT = 4 +EV_BACKGROUND = 5 +EV_MOUSE = 6 +EV_IPC = 7 +EV_STACK = 8 + +; event mask bits for function 40 +EVM_REDRAW = 1b +EVM_KEY = 10b +EVM_BUTTON = 100b +EVM_EXIT = 1000b +EVM_BACKGROUND = 10000b +EVM_MOUSE = 100000b +EVM_IPC = 1000000b +EVM_STACK = 10000000b \ No newline at end of file diff --git a/programs/media/zsea/plugins/scaling/scaling.asm b/programs/media/zsea/plugins/scaling/scaling.asm new file mode 100644 index 0000000000..4ee7d44840 --- /dev/null +++ b/programs/media/zsea/plugins/scaling/scaling.asm @@ -0,0 +1,481 @@ +;***************************************************************************** +; Scaling RAW image plugin - for zSea image viewer +; Copyright (c) 2009 - 2011, Marat Zakiyanov aka Mario79, aka Mario +; All rights reserved. +; +; Redistribution and use in source and binary forms, with or without +; modification, are permitted provided that the following conditions are met: +; * Redistributions of source code must retain the above copyright +; notice, this list of conditions and the following disclaimer. +; * Redistributions in binary form must reproduce the above copyright +; notice, this list of conditions and the following disclaimer in the +; documentation and/or other materials provided with the distribution. +; * Neither the name of the nor the +; names of its contributors may be used to endorse or promote products +; derived from this software without specific prior written permission. +; +; THIS SOFTWARE IS PROVIDED BY Marat Zakiyanov ''AS IS'' AND ANY +; EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +; WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +; DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY +; DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +; (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +; ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +; (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +; SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +;***************************************************************************** +; Scaling 32b, 24b, 16b, 8b + +format MS COFF + +public EXPORTS + +section '.flat' code readable align 16 + +include 'macros.inc' +include '../../../../macros.inc' +;--------------------------------------------------------------------- +START: + pushad + mov [pointer],eax + test bx,bx + jnz @f + inc bx +@@: + ror ebx,16 + test bx,bx + jnz @f + inc bx +@@: + rol ebx,16 + mov [new_size],ebx + mov [start_coordinates],ecx + mov [scaling_mode],edx + mov [filtering],esi + mov [background_color],edi + mov eax,[eax+4] + mov [image_file],eax + + mov esi,[eax+28] + add esi,eax + + mov ebx,[eax+20] + add ebx,eax + mov [palette],ebx + + mov ebx,[eax+12] + mov [resolution],ebx + cmp ebx,32 + jne @f + mov ebp,dword START.32 + jmp .1 +@@: + cmp ebx,24 + jne @f + mov ebp,dword START.24 + jmp .1 +@@: + cmp ebx,16 + jne @f + mov ebp,dword START.16 + jmp .1 +@@: + cmp ebx,15 + jne @f + inc ebx + mov ebp,dword START.16 + jmp .1 +@@: + cmp ebx,8 + jne @f + mov ebp,dword START.8 +@@: +.1: + shr ebx,3 + mov [bytes_to_pixel],ebx + + mov ebx,[eax+8] + mov [y],ebx + mov ebx,[eax+4] + mov [x],ebx + imul ebx,[bytes_to_pixel] + mov [size_x],ebx + + mov eax,100 + shl eax,12 + mov ebx,[scaling_mode] + test ebx,ebx + jnz @f + inc ebx +@@: + xor edx,edx + div ebx + mov [scaling_delta],eax + + call .get_memory + cmp [scaling_mode],0 + jne @f + call .scaling + jmp .ret_ok +@@: + call .scaling_2 + +;--------------------------------------------------------------------- +.ret_ok: + mcall 68,13,[area_for_x] + mov ebx,[pointer] + mov eax,[raw_area] + mov [ebx+20],eax ; store RAW pointer +; movzx eax,word [new_size.x1] +; mov [ebx+24],esi ;eax +; movzx eax,word [new_size.y1] +; mov [ebx+28],eax +; mov eax,[size_x] +; mov [ebx+32],eax +; mov eax,[bytes_to_pixel] +; mov [ebx+36],eax +; mov eax,[x] +; mov [ebx+40],eax +; mov eax,[y] +; mov [ebx+44],eax +.exit: + popad + ret +;--------------------------------------------------------------------- +align 4 +.scaling: + xor ecx,ecx +.y: + xor ebx,ebx +;------------------------- +.x: + call ebp + inc ebx + cmp bx,[new_size.x1] + jb .x +;------------------------- + inc ecx + cmp cx,[new_size.y1] + jb .y + ret +;--------------------------------------------------------------------- +align 4 +.scaling_2: + xor eax,eax + mov ax,[start_coordinates.y] + imul eax,[size_x] + add esi,eax + xor eax,eax + mov ax,[start_coordinates.x] + imul eax,[bytes_to_pixel] + add esi,eax + + xor eax,eax + dec eax + mov [temp_y],eax + + xor ecx,ecx +align 4 +.y_2: + xor ebx,ebx +;------------------------- +align 4 +.x_2: + call ebp + inc ebx + cmp bx,[new_size.x1] + jb .x_2 +;------------------------- + inc ecx + cmp cx,[new_size.y1] + jb .y_2 + ret +;--------------------------------------------------------------------- +align 4 +.32: + push ecx ebx + call .calculate_pixel + mov eax,[ecx] + call .check_filtering_32 + pop ebx ecx + cld + stosd + ret +;--------------------------------------------------------------------- +align 4 +.24: + push ecx ebx + call .calculate_pixel + mov eax,[ecx] + call .check_filtering_24 + cld + stosw + shr eax,16 + pop ebx ecx + cld + stosb + ret +;--------------------------------------------------------------------- +align 4 +.16: + push ecx ebx + call .calculate_pixel + xor eax,eax + mov ax,[ecx] + call .check_filtering_16 + pop ebx ecx + cld + stosw + ret +;--------------------------------------------------------------------- +align 4 +.8: + push ecx ebx + call .calculate_pixel + cmp [filtering],0 + jne @f + mov al,[ecx] + pop ebx ecx + cld + stosb + ret +@@: + call .check_filtering_8 + cld + stosw + shr eax,16 + pop ebx ecx + cld + stosb + ret + +;--------------------------------------------------------------------- +align 4 +.calculate_pixel: + test ecx,ecx + jz .offset_x +;.offset_y: + mov eax,ecx + + mov ecx,[temp_y] + cmp eax,ecx + jne .new_y + mov eax,[temp_y_offset] + mov ecx,eax + jmp .offset_x +;-------------------------------- +align 4 +.new_y: + mov [temp_y],eax + + mov ebx,[scaling_mode] + test ebx,ebx + jz @f + imul eax,[scaling_delta] +;-------------------------------- + push ebx + mov ebx,eax + shr eax,12 + and ebx,0xFFF + shl ebx,7 ;multiply 128 + shr ebx,12 + mov [next_pixel_y],ebx + pop ebx +;-------------------------------- + jmp .ex_1 +align 4 +@@: +;-------------------------------- + imul eax,dword [y] + mov bx,word [new_size.y1] +;-------------------------------- +align 4 +.y_div: + test ebx,ebx + jnz @f + inc ebx +align 4 +@@: + xor edx,edx + div ebx +;-------------------------------- + push eax + mov eax,edx + shl eax,7 ;multiply 128 + xor edx,edx + div ebx + mov [next_pixel_y],eax + pop eax +;-------------------------------- +align 4 +.ex_1: + mov [temp_y1],eax + imul eax,[size_x] + + mov [temp_y_offset],eax + mov ecx,eax +align 4 +.offset_x: + test ebx,ebx + jz .finish + mov eax,[esp+4] ;ebx + + mov edx,[esp+8] + test edx,edx + jz .continue + shl eax,3 + add eax,[area_for_x] + mov edx,[eax+4] + mov [next_pixel_x],edx + mov eax,[eax] + jmp .ex_3 +;-------------------------------- +align 4 +.continue: + mov ebx,[scaling_mode] + test ebx,ebx + jz @f + imul eax,[scaling_delta] +;-------------------------------- + mov ebx,eax + shr eax,12 + and ebx,0xFFF + shl ebx,7 ;multiply 128 + shr ebx,12 + mov [next_pixel_x],ebx +;-------------------------------- + jmp .ex_2 +;-------------------------------- +align 4 +@@: + imul eax,dword [x] + mov bx,word [new_size.x1] +;-------------------------------- +align 4 +.x_div: + test ebx,ebx + jnz @f + inc ebx +align 4 +@@: + xor edx,edx + div ebx +;-------------------------------- + push eax + mov eax,edx + shl eax,7 ;multiply 128 + xor edx,edx + div ebx + mov [next_pixel_x],eax + pop eax +;-------------------------------- +align 4 +.ex_2: + mov edx,[bytes_to_pixel] + mov ebx,eax + xor eax,eax +align 4 +@@: + add eax,ebx + dec edx + jnz @r + + mov ebx,[esp+4] + shl ebx,3 + add ebx,[area_for_x] + mov [ebx],eax + mov edx,[next_pixel_x] + mov [ebx+4],edx +align 4 +.ex_3: + mov [temp_x1],eax + add ecx,eax +align 4 +.finish: + add ecx,esi + ret +;--------------------------------------------------------------------- +align 4 +.get_memory: + + xor ecx,ecx + mov cx,[new_size.x1] + shl ecx,3 + mcall 68,12 + mov [area_for_x],eax + + xor ecx,ecx + mov ebx,[new_size] + mov cx,bx + shr ebx,16 + imul ecx,ebx ;[eax+8] + mov eax,[bytes_to_pixel] + cmp eax,1 + jne @f + mov eax,3 +@@: + imul ecx,eax + mcall 68,12 + mov [raw_area],eax + mov edi,eax + ret +;--------------------------------------------------------------------- +include 'b_filter.inc' +;--------------------------------------------------------------------- +align 4 +EXPORTS: + dd szStart, START + dd szVersion, 0x00010001 + dd 0 + +szStart db 'START',0 +szVersion db 'version',0 + +align 4 +pointer dd 0 +image_file dd 0 +new_size: +.y1: dw 0 +.x1: dw 0 + +x: dd 0 +y: dd 0 + +size_x dd 0 +bytes_to_pixel dd 0 + +start_coordinates: +.y dw 0 +.x dw 0 + +scaling_mode dd 0 +raw_area dd 0 +scaling_delta dd 0 + +area_for_x dd 0 + +temp_y dd 0 +temp_y_offset dd 0 + +resolution dd 0 + +filtering dd 0 + +next_pixel_y dd 0 +next_pixel_x dd 0 + +temp_y1 dd 0 +temp_x1 dd 0 + +B_sample dd 0 +G_sample dd 0 +R_sample dd 0 + +B_sample_1 dd 0 +G_sample_1 dd 0 +R_sample_1 dd 0 + +palette dd 0 + +background_color dd 0 \ No newline at end of file diff --git a/programs/media/zsea/plugins/scaling/scaling.obj b/programs/media/zsea/plugins/scaling/scaling.obj new file mode 100644 index 0000000000..ad6f329394 Binary files /dev/null and b/programs/media/zsea/plugins/scaling/scaling.obj differ diff --git a/programs/media/zsea/w_about.inc b/programs/media/zsea/w_about.inc new file mode 100644 index 0000000000..d3a06b22be --- /dev/null +++ b/programs/media/zsea/w_about.inc @@ -0,0 +1,128 @@ +;--------------------------------------------------------------------- + kabout: + test dword [status],4 + jnz still + or dword [status],4 + + call get_memory_for_tread_stack + mov [thread_stack_3],eax + mcall 51,1,thread3 ;,thread_stack_3 + jmp still +;--------------------------------------------------------------------- +thread3: ; start of bgrd thread + mcall 9, procinfo_threads, -1 + mov eax,[ebx+30] + mov [PID3],eax + mcall 40, 0x7 +.red: + call .draw_window + +.still: + + mov eax,10 ; wait here for event + mcall + + cmp eax,1 ; redraw request ? + je .red + cmp eax,2 ; key in buffer ? + je .close ;.key + cmp eax,3 ; button in buffer ? + je .button + + jmp .still + +; .key: +; mcall +; cmp ah,27 +; je .close +; jmp .still + + +.button: ; button + mov eax,17 ; get id + mcall + + cmp ah,1 ; button id=1 ? + je .close + cmp ah,2 + jne .still ;noclose3 +.close: +; btr dword [status],3 +; bts dword [status],2 + xor dword [status],4 + xor eax,eax + mov [PID3],eax + mcall 68,13,[thread_stack_3] + mov eax,-1 ; close this program + mcall +; .noclose: +; jmp still3 + + + + +; ********************************************* +; ******* WINDOW DEFINITIONS AND DRAW ******** +; ********************************************* + + +.draw_window: + + + mov eax,12 ; function 12:tell os about windowdraw + mov ebx,1 ; 1, start of draw + mcall + + ; DRAW WINDOW + xor eax,eax ; function 0 : define and draw window + mov ebx,100*65536+300 ; [x start] *65536 + [x size] + mov ecx,100*65536+240 ; [y start] *65536 + [y size] + mov edx,0x03eeeeee ; color of work area RRGGBB,8->color gl + mcall + + mov ebx,120*65536+40 + mov ecx,210*65536+20 + mov edx,2 + mov esi,0xdddddd + mcall 8 + + pusha + mcall 4,<20,30>,0x80000000,Authors_text.1 + mcall ,<30,45>, ,Authors_text.2 + + mcall ,<30,60>, ,Authors_text.3 + mcall ,<60,70>, ,Authors_text.4 + mcall ,<60,80>, ,Authors_text.5 + mcall ,<60,90>, ,Authors_text.6 + mcall ,<60,100>, ,Authors_text.7 + + mcall ,<30,115>, ,Authors_text.8 + mcall ,<60,125>, ,Authors_text.9 + mcall ,<60,135>, ,Authors_text.10 + + mcall ,<30,150>, ,Authors_text.11 + mcall ,<60,160>, ,Authors_text.12 + + mcall ,<30,175>, ,Authors_text.13 + mcall ,<60,185>, ,Authors_text.14 + popa + + add ebx,15 shl 16 + shr ecx,16 + mov bx,cx + add ebx,6 + + mov ecx,0 + mov edx, ok_btn + mov esi, ok_btn.size ;2 + mcall 4 + + ; WINDOW LABEL + mcall 71,1, labelt3 +; mcall 47,0x80000,[PID3],<200, 5>,0xffffff + mov eax,12 ; function 12:tell os about windowdraw + mov ebx,2 ; 2, end of draw + mcall + + ret +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/w_error.inc b/programs/media/zsea/w_error.inc new file mode 100644 index 0000000000..04bf78eddd --- /dev/null +++ b/programs/media/zsea/w_error.inc @@ -0,0 +1,92 @@ +error_window: + test dword [status],32 + jnz still + or dword [status],32 + mcall 9, procinfo, -1 + mov eax,[ebx+46] + test eax,eax + jnz @f + mov eax,100 + mov [error_window_y+2],ax + mov [error_window_x+2],ax + jmp .end +@@: + shr eax,1 + add eax,[ebx+38] + sub eax,50 + mov [error_window_y+2],ax + mov eax,[ebx+42] + shr eax,1 + add eax,[ebx+34] + sub eax,150 + mov [error_window_x+2],ax +.end: + call get_memory_for_tread_stack + mov [thread_stack_6],eax + mcall 51,1,thread6 ;,thread_stack_6 + ret +;--------------------------------------------------------------------- +thread6: + mcall 9, procinfo_threads, -1 + mov eax,[ebx+30] + mov [PID6],eax + mcall 40, 0x7 + mov [error_pointer],string +.red: + call .draw_error_window +.still: + mcall 10 + cmp eax,1 + je .red + cmp eax,2 ; key in buffer ? + je .key + cmp eax,3 + je .button + jmp .still +.key: ; key +.button: + xor dword [status],32 + xor eax,eax + mov [PID6],eax + + mcall 68,13,[thread_stack_6] + mcall -1 + jmp .still +;--------------------------------------------------------------------- +.draw_error_window: + mcall 12, 1 + mcall 0,[error_window_x] ,[error_window_y], 0x03ff0000 + mcall 71,1, errortext + mcall 4,<10,30>,0x80ffffff,[error_pointer] + cmp [return_code],0 + je .continue + cmp [return_code],1 + jne @f + mcall 4,<10,50>,0x90ffffff,error_not_supported_file + jmp .end +@@: + cmp [return_code],2 + jne @f + mcall 4,<10,50>,0x90ffffff,error_not_enough_memory + jmp .end +@@: + mcall 4,<10,50>,0x90ffffff,error_unknown + jmp .end +.continue: + mcall 4,<10,50>,0x90ffffff,error_type + mcall 47,0x800a0000,[error_fs],<140,50>,0x10ffffff + mov edx,[error_fs] + cmp edx,0 + jb .end + cmp edx,11 + ja .end + shl edx,2 + add edx,error_fs_text_pointers + mov edx,[edx] + mcall 4,<10,70>,0x90ffffff, +; mcall 47,0x800a0000,[error_locate],<140,5>,0x10ffffff +.end: +; mcall 47,0x80000,[PID6],<200, 5>,0xffffff + mcall 12, 2 + ret +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/win_bcgr.inc b/programs/media/zsea/win_bcgr.inc new file mode 100644 index 0000000000..48e8217f0b --- /dev/null +++ b/programs/media/zsea/win_bcgr.inc @@ -0,0 +1,143 @@ +;--------------------------------------------------------------------- +k_background: + test dword [status],8 + jnz still + or dword [status],8 + + call get_memory_for_tread_stack + mov [thread_stack_4],eax + mcall 51,1,thread4 ;, thread_stack_4 + jmp still +;--------------------------------------------------------------------- +thread4: ; start of bgrd thread + mcall 9, procinfo_threads, -1 + mov eax,[ebx+30] + mov [PID4],eax + mcall 40, 0x27 +.red: + call .draw_window + +.still: + + mov eax,10 ; wait here for event + mcall + + cmp eax,1 ; redraw request ? + je .red + cmp eax,2 ; key in buffer ? + je .key + cmp eax,3 ; button in buffer ? + je .button + cmp eax,6 ; mouse in buffer ? + je .mouse + jmp .still + +.mouse: + push dword option_boxes_bcgr + call [option_box_mouse] + + cmp [option_group1],op1 + jne @f + mov [bgrmode],dword 1 + jmp .still +@@: + mov [bgrmode],dword 2 + jmp .still + +.key: + mcall + cmp ah,27 + je .close + cmp ah,13 + je .kok + cmp ah,178 ;up + jne .nofup + cmp dword [bgrmode],1 + je .fdn +.fup: + dec dword [bgrmode] + jmp .flagcont +.nofup: + cmp ah,177 ;down + jne .still + cmp dword [bgrmode],2 + je .fup +.fdn: + inc dword [bgrmode] +.flagcont: + cmp [bgrmode],dword 1 + jne @f + mov [option_group1],op1 + call .draw_opt_boxes + jmp .still +@@: + mov [option_group1],op2 + call .draw_opt_boxes + jmp .still + + +.button: ; button + mov eax,17 ; get id + mcall + + cmp ah,1 ; button id=1 ? + jne .noclose +.close: + xor dword [status],8 + xor eax,eax + mov [PID4],eax + + mcall 68,13,[thread_stack_4] + mov eax,-1 ; close this program + mcall +.noclose: +.kok: + call background + jmp .close + +; ********************************************* +; ******* WINDOW DEFINITIONS AND DRAW ******** +; ********************************************* + + +.draw_window: + mcall 12,1 + ; DRAW WINDOW + xor eax,eax ; function 0 : define and draw window + mov ebx,100*65536+200 ; [x start] *65536 + [x size] + mov ecx,100*65536+100 ; [y start] *65536 + [y size] + mov edx,0x03909090 ; color of work area RRGGBB,8->color gl + mcall + + mov eax,8 + mov ebx,70*65536+40 + mov ecx,70*65536+20 + mov edx,4 + mov esi,0xdddddd + mcall + + ; WINDOW LABEL + mcall 71,1, labelt4 + + mov eax,4 ; function 4 : write text to window + mov ebx,46*65536+28 ; [x start] *65536 + [y start] + mov ecx,0xffffff + mov edx, bgrdtext + mov esi, bgrdtext.size + mcall + add ebx,40*65536+48 + mov edx, ok_btn + mov esi, ok_btn.size ;2 + mov ecx,0 + mcall + + call .draw_opt_boxes +; mcall 47,0x80000,[PID4],<200, 5>,0xffffff + mcall 12,2 + + ret +;--------------------------------------------------------------------- +.draw_opt_boxes: + push dword option_boxes_bcgr + call [option_box_draw] + ret \ No newline at end of file diff --git a/programs/media/zsea/win_file.inc b/programs/media/zsea/win_file.inc new file mode 100644 index 0000000000..2f00c5aca4 --- /dev/null +++ b/programs/media/zsea/win_file.inc @@ -0,0 +1,195 @@ +;--------------------------------------------------------------------- +kfile: + test dword [status],1 + jnz still + or dword [status],1 + + call load_directory.copy_dir_path + +; call get_filter_data + + + cmp [OpenDialog_path],dword 'NoKe' + je @f + mov [OpenDialog_data.start_path],dword OpenDialog_path + jmp .start_OpenDialog +@@: + mov ebx,open_dialog_name + mov esi,path + mov edi,library_path + call copy_file_path + +.start_OpenDialog: + +;start_OpenDialog OpenDialog_data + push dword OpenDialog_data + call [OpenDialog_Start] + + call clear_control_key_flag + + cmp [OpenDialog_data.status],2 + je thread1_start + cmp [OpenDialog_data.status],1 + jne @f + xor dword [status],1 + jmp kopen_1 +@@: + xor dword [status],1 + jmp still + +thread1_start: + + call get_memory_for_tread_stack + mov [thread_stack],eax + mcall 51,1,thread1 ;, thread_stack + jmp still +;--------------------------------------------------------------------- +get_filter_data: + mov edi,Filter+4 + xor eax,eax + mov ecx,10 + cld +@@: + mov esi,10 + sub esi,ecx + lea esi,[esi+esi*2] ; x 3 + shl esi,3 ; x 8 + add esi,dword Convert_plugin_0.Assoc + mov esi,[esi] + add esi,4 + + test esi,esi + jz @f + call .start + dec ecx + jnz @r +@@: + mov [edi],byte 0 + mov eax,Filter + sub edi,eax + mov [eax],edi + + ret +.start: +@@: + lodsb + stosb + test eax,eax + jnz @r + cmp [esi],ah + jne @r + ret +;--------------------------------------------------------------------- +thread1: ; start of thread1 + mcall 9, procinfo_threads, -1 + mov eax,[ebx+30] + mov [PID1],eax + mcall 40, 0x27 + + or ecx,-1 ; get information about me + call getappinfo + + mov esi,string +@@: + cld + lodsb + test al,al + jne @r + sub esi,string + mov eax,esi + dec eax + mov edi, edit1 + mov [edi+48], eax ;ed_size + mov [edi+52], eax ;ed_pos +.red: + call .draw_window + +.still: + + mcall 10 ; wait here for event + + cmp eax,1 ; redraw request ? + je .red + cmp eax,2 ; key in buffer ? + je .key + cmp eax,3 ; button in buffer ? + je .button + + push dword name_editboxes + call [edit_box_mouse] +; mouse_edit_box name_editboxes +; mouse_menubar menu_data_2 + jmp .still + +.key: ; key + mcall 2 + cmp ah,13 + je .close_with_open_file + cmp ah,27 + je .close + + push dword name_editboxes + call [edit_box_key] +; key_edit_box name_editboxes + jmp .still + +.close_with_open_file: + mov [open_file_flag],byte 1 + jmp .close + +.button: ; button + mov eax,17 ; get id + mcall + + cmp ah,1 ; button id=1 ? + jne .still +.close: +; bts dword [status],2 +; btr dword [status],0 + xor dword [status],1 + xor eax,eax + mov [PID1],eax + mcall 68,13,[thread_stack] + mov eax,-1 ; close this program + mcall + + jmp .still + +; ********************************************* +; ******* WINDOW DEFINITIONS AND DRAW ******** +; ********************************************* + + +.draw_window: + + + mov eax,12 ; function 12:tell os about windowdraw + mov ebx,1 ; 1, start of draw + mcall + + ; DRAW WINDOW + xor eax,eax ; function 0 : define and draw window + mov ebx,100*65536+300 ; [x start] *65536 + [x size] + mov ecx,100*65536+80 ; [y start] *65536 + [y size] + mov edx,0x03eeeeee ; color of work area RRGGBB,8->color gl + mcall + + ; WINDOW LABEL + + mcall 71,1, labelt1 + + push dword name_editboxes + call [edit_box_draw] +; draw_edit_box name_editboxes +; mcall 47,0x80000,[PID1],<200, 5>,0xffffff +; mcall 71,1, proverka +; mcall 47,0x80001,0,<300, 5>,0xffffff +; draw_menu_bar menu_data_2 + mov eax,12 ; function 12:tell os about windowdraw + mov ebx,2 ; 2, end of draw + mcall + + ret + + +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/win_info.inc b/programs/media/zsea/win_info.inc new file mode 100644 index 0000000000..f177950c4c --- /dev/null +++ b/programs/media/zsea/win_info.inc @@ -0,0 +1,269 @@ +;--------------------------------------------------------------------- + kinfo: + test dword [status],2 + jnz still + or dword [status],2 + + call get_memory_for_tread_stack + mov [thread_stack_2],eax + mcall 51,1,thread2 ;, thread_stack_2 + jmp still +;--------------------------------------------------------------------- +thread2: ; start of info thread + mcall 9, procinfo_threads, -1 + mov eax,[ebx+30] + mov [PID2],eax + mcall 40, 0x7 + call load_directory.copy_dir_path +.red: + call .draw_window + +.still: + + mov eax,10 ; wait here for event + mcall + + cmp eax,1 ; redraw request ? + je .red + cmp eax,2 ; key in buffer ? + je .close + cmp eax,3 ; button in buffer ? + je .button + + jmp .still + +.button: ; button + mov eax,17 ; get id + mcall + + cmp ah,1 ; button id=1 ? + jne .still ;.noclose +.close: +; btr dword [status],1 +; bts dword [status],2 + xor dword [status],2 + xor eax,eax + mov [PID2],eax + mcall 68,13,[thread_stack_2] + mov eax,-1 ; close this program + mcall +;.noclose: +; jmp .still + + + + +; ********************************************* +; ******* WINDOW DEFINITIONS AND DRAW ******** +; ********************************************* + + +.draw_window: + + + mov eax,12 ; function 12:tell os about windowdraw + mov ebx,1 ; 1, start of draw + mcall + + ; DRAW WINDOW + xor eax,eax ; function 0 : define and draw window + mov ebx,100*65536+330 ; [x start] *65536 + [x size] + mov ecx,100*65536+120 ;290 ; [y start] *65536 + [y size] + mov edx,0x03eeeeee ; color of work area RRGGBB,8->color gl + mcall + + ; WINDOW LABEL + mcall 71,1, labelt2 + +; mov ecx,0x80000000 ; font 1 & color ( 0xF0RRGGBB ) +; mov ebx,120*65536+30 +; mov edx,file_name ;string +; mov esi,1 ;43 + mcall 4,<120,30>,0x80000000,file_name + mov edx,fitext + mov esi,14 + mov ebx,10*65536+30 + mov ecx,0x10000000 +@@: + mcall + add ebx,10 + add edx,esi + cmp ebx,10*65536+80 + jbe @r + mov eax,47 + mov edx,120*65536+40 + mov esi,ecx + mov ecx, [img_size] + mov ebx,0x800a0000 + mcall + add edx,10 + mov ecx,[img_width_2] + mcall + add edx,10 + mov ecx,[img_high_2] + mcall + add edx,10 + mov ecx,[img_resolution_2] + mcall + add edx,10 + mov ecx,[Total_Repeat_N] + mcall + +; add edx,10 +; mov ecx,[communication_area] +; mov ecx,[ecx+4096] +; mcall + +; add edx,10 +; mov ecx,[communication_area] +; mov ecx,[ecx+4096+4] +; mcall + +; add edx,10+10 +; mov ecx,[zoom_auto_factor] +; mcall + +; add edx,10+10 +; mov ecx,[scroll_bar_data_vertical.max_area] ;[img_resolution] +; mcall +; add edx,10 +; mov ecx,[scroll_bar_data_vertical.cur_area] ;[return_code] +; mcall +; add edx,10 +; mov ecx,[scroll_bar_data_vertical.position] +; mcall +; add edx,10 +; xor ecx,ecx +; mov cx,[scroll_bar_data_vertical.size_y] +; mcall + +; add edx,10+10 +; mcall 47,0x80000,[OpenDialog_Init] + +; add edx,10+10 +; mcall 47,0x80000,[OpenDialog_Start] + +; add edx,10+10 +; mcall 47,0x80000,[OpenDialog_data.com_area] + +; add edx,10+10 +; mcall 47,0x80000,I_END + +; add edx,10+10 +; mov ecx,[scroll_bar_data_horizontal.max_area] ;[img_resolution] +; mcall +; add edx,10 +; mov ecx,[scroll_bar_data_horizontal.cur_area] ;[return_code] +; mcall +; add edx,10 +; mov ecx,[scroll_bar_data_horizontal.position] +; mcall +; add edx,10 +; xor ecx,ecx +; mov cx,[scroll_bar_data_horizontal.size_x] +; mcall + +; add edx,10 +; mov ecx,[raw_pointer] ;[deflate_unpack] +; mcall + +; add edx,10+10 +; mov ebp,test1 ;raw_pointer_2 +; mov ecx,[ebp] +; mcall + +; add edx,10+10 +; mov ebp,size_before_open_dir ;lib_init ;test1 ;raw_pointer_2 +; mov ecx,[ebp] +; mcall +; add edx,10 +; add ebp,4 +; mov ecx,[ebp] +; mcall +; add edx,10 +; add ebp,4 +; mov ecx,[ebp] +; mcall +; add edx,10 +; add ebp,4 +; mov ecx,[ebp] +; mcall +; add edx,10 +; add ebp,4 +; mov ecx,[ebp] +; mcall +; add edx,10 +; add ebp,4 +; mov ecx,[ebp] +; mcall +; add edx,10 +; add ebp,4 +; mov ecx,[ebp] +; mcall +; add edx,10 +; add ebp,4 +; mov ecx,[ebp] +; mcall +; add edx,10 +; add ebp,4 +; mov ecx,[ebp] +; mcall +; add edx,10 +; add ebp,4 +; mov ecx,[ebp] +; mcall + +; add edx,10 +; add ebp,4 +; mov ecx,[version_lib_ini] +;; mov ecx,[ecx] +; mcall + +; add edx,10 +; movzx ecx,word [image_draw_size.x] +; mcall +; add edx,10 +; movzx ecx,word [image_draw_size.y] +; mcall +; add edx,10+10 +; movzx ecx,word [wa_width] +; mcall +; add edx,10 +; movzx ecx,word [wa_high] +; mcall +; add edx,10 +; movzx ecx,word [wa_width_1] +; mcall +; add edx,10 +; movzx ecx,word [wa_width_2] +; mcall +; add edx,10 +; movzx ecx,word [wa_high_1] +; mcall +; add edx,10 +; movzx ecx,word [wa_high_2] +; mcall + +; add edx,10+10 +; mov ecx,[window_width] +; mcall +; add edx,10 +; mov ecx,[window_high] +; mcall + +; add edx,10 +; xor ecx,ecx +; mov cl,[Disposal_Method] +; mcall + +; add edx,10 +; mov ecx,[soi] +; mcall +; mcall 47,0x80000,[PID2],<200, 5>,0xffffff +; mcall 47,0x800a0000,[error_locate],<140,5>,0x10ffffff + mov eax,12 ; function 12:tell os about windowdraw + mov ebx,2 ; 2, end of draw + mcall + + ret +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/win_opti.inc b/programs/media/zsea/win_opti.inc new file mode 100644 index 0000000000..0bf601a21f --- /dev/null +++ b/programs/media/zsea/win_opti.inc @@ -0,0 +1,386 @@ +;--------------------------------------------------------------------- +k_option: + test dword [status],64 + jnz still + or dword [status],64 + + call get_memory_for_tread_stack + mov [thread_stack_7],eax + mcall 51,1,thread7 ;,thread_stack_7 + jmp still +;--------------------------------------------------------------------- +get_memory_for_tread_stack: + mcall 68,12,4096 + mov edx,eax + add edx,4096 + ret +;--------------------------------------------------------------------- +thread7: ; start of bgrd thread + mcall 9, procinfo_threads, -1 + mov eax,[ebx+30] + mov [PID7],eax + mcall 40, 0x27 + mov eax,[slide_show_delay] + mov [slide_show_delay_old],eax + mov eax,[arrows_offset] + mov [arrows_offset_old],eax + mov eax,[check1+32] + mov [show_file_name_old],eax + mov eax,[check2+32] + mov [filtering_flag_old],eax + xor eax,eax + mov [option_pointer],eax + call .set_pointers +.red: + call .draw_window + +.still: + + mov eax,10 ; wait here for event + mcall + + cmp eax,1 ; redraw request ? + je .red + cmp eax,2 ; key in buffer ? + je .key + cmp eax,3 ; button in buffer ? + je .button + cmp eax,6 ; mouse in buffer ? + je .mouse + jmp .still + +.mouse: + mov ebx,[check1+32] + and ebx,10b + push dword check1 + call [check_box_mouse] + mov eax,[check1+32] + and eax,10b + cmp ebx,eax + je @f ;.still + mov [option_pointer],2 + call .set_pointers + call .draw_all_options_values + jmp .still +@@: + mov ebx,[check2+32] + and ebx,10b + push dword check2 + call [check_box_mouse] + mov eax,[check2+32] + and eax,10b + cmp ebx,eax + je .still + mov [option_pointer],3 + call .set_pointers + call .draw_all_options_values + jmp .still +;--------------------------------------------------------------------- +.key: + mcall + cmp ah,27 + je .close + cmp ah,13 + je .kok + cmp ah,32 + je .select_space + cmp ah,56 ;plus + je .select_plus ;.plus_slide_show_delay + cmp ah,43 ;plus + je .select_plus ;.plus_slide_show_delay + cmp ah,61 ;plus + je .select_plus ;.plus_slide_show_delay + cmp ah,54 ;minus + je .select_minus ;.minus_slide_show_delay + cmp ah,45 ;minus + je .select_minus ;.minus_slide_show_delay + cmp ah,95 ;minus + je .select_minus ;.minus_slide_show_delay + cmp ah,178 ;up arrow + je .up_arrow + cmp ah,177 ;down arrow + je .down_arrow + jmp .still +;--------------------------------------------------------------------- +.button: ; button + mov eax,17 ; get id + mcall + + cmp ah,5 + je .minus_arrows_offset + + cmp ah,4 + je .plus_arrows_offset + + cmp ah,3 + je .minus_slide_show_delay + + cmp ah,2 + je .plus_slide_show_delay + + cmp ah,1 ; button id=1 ? + jne .noclose +.close: + mov eax,[slide_show_delay_old] + mov [slide_show_delay],eax + mov eax,[arrows_offset_old] + mov [arrows_offset],eax + mov eax,[show_file_name_old] + mov [check1+32],eax + mov eax,[filtering_flag_old] + mov [check2+32],eax + jmp .close_all +.close_1: + mov eax,[check2+32] + test eax,10b + jz @f + mov [filtering_flag],1 + jmp .redraw_flag +@@: + mov [filtering_flag],0 +.redraw_flag: + mov [redraw_flag],byte 1 +.close_all: + xor dword [status],64 + xor eax,eax + mov [PID7],eax + + mcall 68,13,[thread_stack_7] + + mov eax,-1 ; close this program + mcall +.noclose: + +.kok: + + jmp .close_1 +;--------------------------------------------------------------------- +.select_plus: + jmp [plus_pointer] +;--------------------------------------------------------------------- +.select_minus: + jmp [minus_pointer] +;--------------------------------------------------------------------- +.select_space: + jmp [space_pointer] +;--------------------------------------------------------------------- +.plus_slide_show_delay: + cmp [option_pointer],0 + je @f + mov [option_pointer],0 + call .draw_all_options_values +@@: + cmp [slide_show_delay],99990 + je .still + add [slide_show_delay],10 + call .draw_slide_show_delay + jmp .still +;--------------------------------------------------------------------- +.minus_slide_show_delay: + cmp [option_pointer],0 + je @f + mov [option_pointer],0 + call .draw_all_options_values +@@: + cmp [slide_show_delay],0 + je .still + sub [slide_show_delay],10 + call .draw_slide_show_delay + jmp .still +;--------------------------------------------------------------------- +.plus_arrows_offset: + cmp [option_pointer],1 + je @f + mov [option_pointer],1 + call .draw_all_options_values +@@: + cmp [arrows_offset],100 + je .still + inc [arrows_offset] + call .draw_arrows_offset + call calculate_arrows_offset + jmp .still +;--------------------------------------------------------------------- +.minus_arrows_offset: + cmp [option_pointer],1 + je @f + mov [option_pointer],1 + call .draw_all_options_values +@@: + cmp [arrows_offset],1 + je .still + dec [arrows_offset] + call .draw_arrows_offset + call calculate_arrows_offset + jmp .still +;--------------------------------------------------------------------- +.space_check1: + test [check1+32],dword 10b + jnz @f + or [check1+32],dword 10b + jmp .space_check1_1 +@@: + xor [check1+32],dword 10b +.space_check1_1: + call .draw_all_options_values + jmp .still +;--------------------------------------------------------------------- +.space_check2: + test [check2+32],dword 10b + jnz @f + or [check2+32],dword 10b + jmp .space_check2_1 +@@: + xor [check2+32],dword 10b +.space_check2_1: + call .draw_all_options_values + jmp .still +;--------------------------------------------------------------------- +.down_arrow: + cmp [option_pointer],3 + je .still + inc [option_pointer] +.draw_all_points: + call .set_pointers + call .draw_all_options_values + jmp .still +;--------------------------------------------------------------------- +.up_arrow: + cmp [option_pointer],0 + je .still + dec [option_pointer] + jmp .draw_all_points +;--------------------------------------------------------------------- +.set_pointers: + cmp [option_pointer],0 + jne @f + mov [plus_pointer],thread7.plus_slide_show_delay + mov [minus_pointer],thread7.minus_slide_show_delay + mov [space_pointer],thread7.still + ret +@@: + cmp [option_pointer],1 + jne @f + mov [plus_pointer],thread7.plus_arrows_offset + mov [minus_pointer],thread7.minus_arrows_offset + mov [space_pointer],thread7.still + ret +@@: + cmp [option_pointer],2 + jne @f + mov [plus_pointer],thread7.still + mov [minus_pointer],thread7.still + mov [space_pointer],thread7.space_check1 + ret +@@: + mov [plus_pointer],thread7.still + mov [minus_pointer],thread7.still + mov [space_pointer],thread7.space_check2 + ret +;--------------------------------------------------------------------- +.draw_all_options_values: + call .draw_slide_show_delay + call .draw_arrows_offset + call .draw_check1 + call .draw_check2 + ret +;--------------------------------------------------------------------- +; ********************************************* +; ******* WINDOW DEFINITIONS AND DRAW ******** +; ********************************************* + + +.draw_window: + mcall 12,1 + ; DRAW WINDOW + xor eax,eax ; function 0 : define and draw window + mov ebx,100*65536+300 ; [x start] *65536 + [x size] + mov ecx,100*65536+120 ; [y start] *65536 + [y size] + mov edx,0x03909090 ; color of work area RRGGBB,8->color gl + mcall + + mcall 8,<15,10>,<50,11>,2,0xdddddd + inc edx + mcall ,<77,10> +;--------------------------------- + inc edx + mcall ,<15,10>,<90,11> + inc edx + mcall ,<77,10> +;--------------------------------- + inc edx + mcall ,<250,40>,<50,20> +;--------------------------------- + +; mcall 13,<50,45>,<25,12>,0xffffff +; mov ecx,[ch_flag_en] +; mcall 47,0x800a0000,,<72,27>,0x10000000; 0x40000000,0xffffff + ; WINDOW LABEL + mcall 71,1, optiontext + +; mov eax,4 ; function 4 : write text to window +; mov ebx,46*65536+28 ; [x start] *65536 + [y start] +; mov ecx,0xffffff +; mov edx, sorttext +; mov esi, sorttext.size +; mcall +; mov ebx,135*65536+57 +; mov edx, ok_btn +; mov esi, ok_btn.size ;2 + mcall 4,<10,35>,0x80ffffff,slide_show_delay_title + mcall ,<17,53>,0x90000000,slide_show_delay_text + mcall ,<10,75>,0x80ffffff,arrows_offset_title + mcall ,<17,93>,0x90000000,slide_show_delay_text + mcall ,<265,57>, ,ok_btn + + call .draw_all_options_values + +; mcall 47,0x80000,[PID5],<200, 5>,0xffffff + mcall 12,2 + + ret +;--------------------------------------------------------------------- +;.draw_opt_boxes: +; draw_option_boxes option_boxes_sort,option_boxes_sort_end +; ret +;--------------------------------------------------------------------- +.draw_slide_show_delay: + mov edx,0xffffff + cmp [option_pointer],0 + jne @f + mov edx,0xffff80 +@@: + mcall 13,<29,45>,<50,12>, + mcall 47,0x800a0000,[slide_show_delay],<32,52>,0x10000000; 0x40000000,0xffffff + ret +;--------------------------------------------------------------------- +.draw_arrows_offset: + mov edx,0xffffff + cmp [option_pointer],1 + jne @f + mov edx,0xffff80 +@@: + mcall 13,<29,45>,<90,12>, + mcall 47,0x800a0000,[arrows_offset],<32,92>,0x10000000; 0x40000000,0xffffff + ret +;--------------------------------------------------------------------- +.draw_check1: + mov [check1+12],dword 0xffffff + cmp [option_pointer],2 + jne @f + mov [check1+12],dword 0xffff80 +@@: + push dword check1 + call [check_box_draw] + ret +;--------------------------------------------------------------------- +.draw_check2: + mov [check2+12],dword 0xffffff + cmp [option_pointer],3 + jne @f + mov [check2+12],dword 0xffff80 +@@: + push dword check2 + call [check_box_draw] + ret +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/win_sort.inc b/programs/media/zsea/win_sort.inc new file mode 100644 index 0000000000..54ff5896b1 --- /dev/null +++ b/programs/media/zsea/win_sort.inc @@ -0,0 +1,206 @@ +;--------------------------------------------------------------------- +k_sort_directory: + test dword [status],16 + jnz still + or dword [status],16 + + call get_memory_for_tread_stack + mov [thread_stack_5],eax + mcall 51, 1, thread5 ;, thread_stack_5 + jmp still +;--------------------------------------------------------------------- +thread5: ; start of bgrd thread + mcall 9, procinfo_threads, -1 + mov eax,[ebx+30] + mov [PID5],eax + mcall 40, 0x27 + mov eax,[sort_type] + cmp [sort_type],dword 0 + jne @f + mov [option_group2],sort0 + jmp .thread5 +@@: + cmp [sort_type],dword 2 + jne @f + mov [option_group2],sort2 + jmp .thread5 +@@: + cmp [sort_type],dword 4 + jne @f + mov [option_group2],sort4 + jmp .thread5 +@@: +; cmp [sort_type],dword 6 +; jne @f + mov [option_group2],sort6 +; jmp .thread5 +;@@: +.thread5: + mov [sort_type_old],eax + mov eax,[option_group2] + mov [option_group2_old],eax + +.red: + call .draw_window + +.still: + + mov eax,10 ; wait here for event + mcall + + cmp eax,1 ; redraw request ? + je .red + cmp eax,2 ; key in buffer ? + je .key + cmp eax,3 ; button in buffer ? + je .button + cmp eax,6 ; mouse in buffer ? + je .mouse + jmp .still + +.mouse: + push dword option_boxes_sort + call [option_box_mouse] + + cmp [option_group2],sort0 + jne @f + mov [sort_type],dword 0 + jmp .still +@@: + cmp [option_group2],sort2 + jne @f + mov [sort_type],dword 2 + jmp .still +@@: + cmp [option_group2],sort4 + jne @f + mov [sort_type],dword 4 + jmp .still +@@: + cmp [option_group2],sort6 + jne @f + mov [sort_type],dword 6 + jmp .still + +.key: + mcall + cmp ah,27 + je .close + cmp ah,13 + je .kok + cmp ah,177 ;down + je .fdn + cmp ah,178 ;up + jne .still + cmp [sort_type],0 + je .still + + sub [sort_type],2 + jmp .flagcont + +.fdn: + cmp [sort_type],6 + je .still + add [sort_type],2 + +.flagcont: + cmp [sort_type],dword 0 + jne @f + mov [option_group2],sort0 + call .draw_opt_boxes + jmp .still +@@: + cmp [sort_type],dword 2 + jne @f + mov [option_group2],sort2 + call .draw_opt_boxes + jmp .still +@@: + cmp [sort_type],dword 4 + jne @f + mov [option_group2],sort4 + call .draw_opt_boxes + jmp .still +@@: + cmp [sort_type],dword 6 + jne .still ;@f + mov [option_group2],sort6 + call .draw_opt_boxes + jmp .still + +.button: ; button + mov eax,17 ; get id + mcall + + cmp ah,1 ; button id=1 ? + jne .noclose +.close: + mov eax,[sort_type_old] + mov [sort_type],eax + mov eax,[option_group2_old] + mov [option_group2],eax +.close_1: + xor dword [status],16 + xor eax,eax + mov [PID5],eax + + mcall 68,13,[thread_stack_5] + mov eax,-1 ; close this program + mcall +.noclose: +.kok: + mov eax,[load_directory_pointer] + cmp [eax+4],dword 0 + je .close_1 + call load_directory.copy_dir_path + call load_directory.sort + mov [sort_directory_flag],byte 1 + jmp .close_1 + +; ********************************************* +; ******* WINDOW DEFINITIONS AND DRAW ******** +; ********************************************* + + +.draw_window: + mcall 12,1 + + ; DRAW WINDOW + xor eax,eax ; function 0 : define and draw window + mov ebx,100*65536+300 ; [x start] *65536 + [x size] + mov ecx,100*65536+110 ; [y start] *65536 + [y size] + mov edx,0x03909090 ; color of work area RRGGBB,8->color gl + mcall + + mov eax,8 + mov ebx,120*65536+40 + mov ecx,50*65536+20 + mov edx,4 + mov esi,0xdddddd + mcall + + ; WINDOW LABEL + mcall 71,1, labelt5 + + mov eax,4 ; function 4 : write text to window + mov ebx,46*65536+28 ; [x start] *65536 + [y start] + mov ecx,0xffffff + mov edx, sorttext + mov esi, sorttext.size + mcall + mov ebx,135*65536+57 + mov edx, ok_btn + mov esi, ok_btn.size ;2 + mov ecx,0 + mcall + + call .draw_opt_boxes +; mcall 47,0x80000,[PID5],<200, 5>,0xffffff + mcall 12,2 + + ret +;--------------------------------------------------------------------- +.draw_opt_boxes: + push dword option_boxes_sort + call [option_box_draw] + ret \ No newline at end of file diff --git a/programs/media/zsea/zSea.asm b/programs/media/zsea/zSea.asm new file mode 100644 index 0000000000..deb96b1fe5 --- /dev/null +++ b/programs/media/zsea/zSea.asm @@ -0,0 +1,448 @@ +;***************************************************************************** +; zSea - advanced image viewer for KolibriOS +; Copyright (c) 2008-2011, Marat Zakiyanov aka Mario79, aka Mario +; All rights reserved. +; +; Redistribution and use in source and binary forms, with or without +; modification, are permitted provided that the following conditions are met: +; * Redistributions of source code must retain the above copyright +; notice, this list of conditions and the following disclaimer. +; * Redistributions in binary form must reproduce the above copyright +; notice, this list of conditions and the following disclaimer in the +; documentation and/or other materials provided with the distribution. +; * Neither the name of the nor the +; names of its contributors may be used to endorse or promote products +; derived from this software without specific prior written permission. +; +; THIS SOFTWARE IS PROVIDED BY Marat Zakiyanov ''AS IS'' AND ANY +; EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +; WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +; DISCLAIMED. IN NO EVENT SHALL BE LIABLE FOR ANY +; DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +; (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +; ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +; (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +; SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +;***************************************************************************** +; v.1.0 r3 12.06.2011 +;****************************************************************************** + use32 + org 0x0 + db 'MENUET01' ; 8 byte id + dd 0x01 ; header version + dd START ; start of code + dd IM_END ; size of image + dd I_END ; memory for app + dd stacktop ; esp + dd temp_area ; I_Param + dd path ; APPLICATION PACH + +include 'lang.inc' +;include 'macros.inc' +;include 'editbox_ex.mac' +;include 'proc32.inc' + +include '../../macros.inc' +include '../../develop/libraries/box_lib/trunk/box_lib.mac' +include '../../proc32.inc' + +;include 'load_lib.mac' +include '../../develop/libraries/box_lib/load_lib.mac' + @use_library ;use load lib macros +;****************************************************************************** + +START: ; start of execution + mcall 68, 11 + mcall 66, 1,1 + mcall 40, 0x27 + + mcall 9, procinfo, -1 + mov eax,[ebx+30] + mov [PID],eax + xor ecx,ecx +@@: + inc ecx + mcall 9, procinfo + mov eax,[PID] + cmp eax,[ebx+30] + jne @r + mov [active_process],ecx + + mcall 68,12,1024 + mov [menu_data_1.procinfo],eax + mov [menu_data_2.procinfo],eax + mov [menu_data_3.procinfo],eax + mov [menu_data_4.procinfo],eax + mov [menu_data_5.procinfo],eax + mov [menu_data_6.procinfo],eax + + mov [load_directory_pointer],dir_header + + + call load_plugins + + + call load_buttons + +; call init_data_OpenDialog + +;init_OpenDialog OpenDialog_data + push dword OpenDialog_data + call [OpenDialog_Init] + + call get_filter_data + +;----------------------------------------------------- +; check for parameters + cmp dword [temp_area],'BOOT' + jne .no_boot +.background: + call load_image + cmp [error_fs],0 + jnz .exit + call convert + + call background + +.exit: + call Set_ini +.exit_1: + mov ebx,18 + mov edx,PID1 + mov esi,7 +.kill_successors: + mov ecx,[edx] + add edx,4 + test ecx,ecx + jz @f + mcall 18 +@@: + dec esi + jnz .kill_successors + + mcall -1 +;----------------------------------------------------- + .no_boot: + xor eax,eax + cmp byte [temp_area],al + jnz @f + mov [file_name],eax + jmp .no_param +@@: + + + mov edi,string ; clear string + mov ecx,256/4 ; length of a string + xor eax,eax ; symbol <0> + rep stosd + + + mov edi,temp_area ; look for <0> in temp_area + + cmp [edi],byte "\" + jne .continue + cmp [edi+1],byte "T" + jne @f + mov [bgrmode],dword 1 + jmp .continue_1 +@@: + cmp [edi+1],byte "S" + jne START.exit + mov [bgrmode],dword 2 +.continue_1: + add edi,4 +.continue: + mov esi,edi + mov ecx,257 ; strlen + repne scasb + lea ecx, [edi-temp_area] + + mov edi,string + rep movsb ; copy string from temp_area to "string" (filename) + cmp [temp_area],byte "\" + je START.background + call load_directory + test eax,eax + jnz @f + call load_image + test eax,eax + jnz @f + call convert + jmp .no_param +@@: + mov [load_directory_pointer],dir_header + mov [error_fs],eax + call convert.error +;----------------------------------------------------- + .no_param: +; or ecx,-1 ; get information about me +; call getappinfo + +; mov edx,[process_info+30] ; edx +; mov ecx,eax + +; @@: +; call getappinfo +; cmp edx,[process_info+30] +; je @f ; PID PID , +; dec ecx ; +; jne @b ; , +; @@: + +; ecx +; mov [process],ecx +;--------------------------------------------------------------------- + cmp [wnd_width],635 + jae @f + mov [wnd_width],635 +@@: + cmp [wnd_height],150 + jae @f + mov [wnd_height],150 +@@: +; call draw_window +red: +;draw_still: +; pusha + call get_window_param + test [window_status],10b + jnz red_1 ;still + test [window_status],100b + jnz red_1 + test [window_status],1b + jnz red_1 + mov esi,-1 + mov eax,procinfo + mov eax,[eax+66] + cmp eax,150 +; cmp [window_high],150 + jae @f + mov esi,150 + mcall 67,-1,ebx,ebx +@@: + mov edx,-1 + mov eax,procinfo + mov eax,[eax+62] + cmp eax,635 +; cmp [window_width],635 + jae @f ;red_1 + mov edx,635 + mcall 67,-1,ebx, ,ebx +@@: +; mcall 67,-1,ebx +; popa +; xor esi,esi +red_1: +; xor eax,eax +; mov [scroll_bar_data_vertical.position],eax +; mov [scroll_bar_data_horizontal.position],eax + + call draw_window + + cmp [redraw_wallpaper_flag],0 + je still + mov [redraw_wallpaper_flag],0 + call clear_thread +; mcall 15,3 +; jmp red_1 +still: + cmp [RAW1_flag],1 + je animation_handler + mcall 10 +.1: + cmp [open_file_flag],1 + je kopen_1 + cmp [sort_directory_flag],byte 1 + je red_sort_directory + cmp [redraw_flag],byte 1 + je redraw_window + cmp eax,1 ; ? + je red ; - red + cmp eax,2 ; ? + je key ; - key + cmp eax,3 ; ? + je button ; - button + cmp eax,6 + je mouse +; cmp [redraw_wallpaper_flag],1 +; jne still +; mov [redraw_wallpaper_flag],0 +; mcall 15,3 + jmp still ; - + +red_sort_directory: + mov [sort_directory_flag],byte 0 + jmp red_1 + +redraw_window: + mov [redraw_flag],byte 0 + jmp red_1 +;--------------------------------------------------------------------- +; red: +; test dword [status], 4 +; jz draw_still +; mov al,18 +; mov ebx,3 +; mov ecx,[process] +; mcall 18,3,[active_process] +; and byte [status], not 4 +; jmp still +;--------------------------------------------------------------------- +button: ; button + mov eax,17 ; get id + mcall + cmp ah,1 ; button id=1 ? + je START.exit +; jne .noclose +; +; mov eax,-1 ; close this program +; mcall +.noclose: + cmp ah,2 + je slide_show.3 ;still + jmp slide_show +;--------------------------------------------------------------------- +kopen_1: + + mov [open_file_flag],0 + call load_directory + test eax,eax + jz kopen +.err: + mov [load_directory_pointer],dir_header + mov [error_fs],eax + call convert.error + jmp still ;red_1 + +kopen: + cmp [string],byte 0 + je still + + mov ecx,-1 + call getappinfo + + call load_image + + test eax,eax + jnz kopen_1.err + call convert + +.1: + call get_window_param + test [window_status],1b + jz red ;draw_still + mov [no_draw_window],1 + +; push edx +; mov edx,size_after_convert_2 +; call write_memory_size +; pop edx + + call draw_other + + mov [no_draw_window],0 +; jmp draw_still + jmp still +;--------------------------------------------------------------------- +getappinfo: + mov eax,9 + mov ebx,process_info + mcall + ret +;--------------------------------------------------------------------- +; +background: + cmp [soi],0 + je .end + mov ecx,[img_width] ; + test ecx,ecx + jz .end + mov edx,[img_high] ; + test edx,edx + jz .end + mcall 15,1 ; set size + + mov esi,ecx + imul esi,edx + lea esi,[esi*3] +; mov ebx,5 + mov ecx,[soi] + + xor edx,edx + + cmp [img_resolution],24 + je @f + mov eax,image_file +; call [plugin_convert_background] + call [convert_Conv_24b] + mov ecx,[raw_pointer_2] + mcall 15,5 ;15,5 set data + mov ecx,[raw_pointer_2] + mcall 68,13 + jmp .set_mode +@@: + + mcall 15,5 ; 15,5 set data +.set_mode: +; dec ebx ;tile/stretch + mov ecx,[bgrmode] + mcall 15,4 ; 15,4 set mode + + dec ebx ; 15,3 redraw background + mcall + +.end: + ret +;--------------------------------------------------------------------- +get_window_param: + mcall 9, procinfo, -1 + mov eax,[ebx+34] + mov [window_start_x],eax + mov eax,[ebx+38] + mov [window_start_y],eax + mov eax,[ebx+66] ;46] + inc eax + mov [window_high],eax + mov eax,[ebx+62] ;42] + inc eax + mov [window_width],eax + mov eax,[ebx+70] + mov [window_status],eax +; mcall 48,4 +; mov [skin_high],eax + ret +;--------------------------------------------------------------------- +;write_memory_size: +; pusha +; mcall 9, procinfo, -1 +; mov eax,[ebx+26] +; mov [edx],eax +; popa +; ret +;--------------------------------------------------------------------- +include 'draw_win.inc' +include 'full_win.inc' +include 'mouse.inc' +include 'key.inc' +include 'menu_key.inc' +include 'clr_bcgr.inc' +include 'w_error.inc' +include 'load.inc' +include 'animat.inc' +include 'draw_img.inc' +include 'convert.inc' +include 'zoom.inc' +include 'w_about.inc' +include 'win_file.inc' +include 'win_info.inc' +include 'win_bcgr.inc' +include 'win_sort.inc' +include 'win_opti.inc' +include 'libini.inc' +include 'dll.inc' +include 'data.inc' +;--------------------------------------------------------------------- +IM_END: +include 'dat_area.inc' +I_END: diff --git a/programs/media/zsea/zSea.ini b/programs/media/zsea/zSea.ini new file mode 100644 index 0000000000..8301415507 --- /dev/null +++ b/programs/media/zsea/zSea.ini @@ -0,0 +1,35 @@ +[Associations] +ImageEditor=/sys/media/animage +TextViewer=/sys/tinypad + +[Path] +Plugins=/plugins/ +SysLibrary=/sys/lib/ +ButtonPictures=/buttons/ + +[Files] +PassiveButtonsPic=1.png +AktiveButtonsPic=2.png +ClickButtonsPic=3.png +DisableAButtonsPic=4.png +HelpText=zSea_keys.txt + +[Plugins] +BoxLib=box_lib.obj +Sort=sort.obj +Convert=convert.obj +Rotate=rotate.obj +Scaling=scaling.obj +Plugin1=cnv_bmp.obj +Plugin2=cnv_png.obj +Plugin3=cnv_jpeg.obj +Plugin4=cnv_gif.obj + +[Var] +SortMode=2 +ArrowsOffset=10 +SlideShowDelay=300 + +ShowFileName=1 +FullScreen=1 +Zoom=100 \ No newline at end of file diff --git a/programs/media/zsea/zoom.inc b/programs/media/zsea/zoom.inc new file mode 100644 index 0000000000..b2a16da5d1 --- /dev/null +++ b/programs/media/zsea/zoom.inc @@ -0,0 +1,725 @@ +;--------------------------------------------------------------------- +invert_left_to_right: + mov ebx,3 + jmp rotate_counter_clockwise.1 +;--------------------------------------------------------------------- +invert_up_to_down: + mov ebx,4 + jmp rotate_counter_clockwise.1 +;--------------------------------------------------------------------- +rotate_clockwise: + mov ebx,1 + jmp rotate_counter_clockwise.1 +;--------------------------------------------------------------------- +rotate_counter_clockwise: + mov ebx,2 +.1: + mov eax,[soi] + test eax,eax + jz still + + mov eax,[RAW1_pointer] + test eax,eax + jz @f + cmp [Total_Repeat_N],1 + ja still +@@: + + push ebx + call proc_position_correct + mov eax,[vertical_position_coorect] + mov ebx,[horizontal_position_coorect] + mov [horizontal_position_coorect],eax + mov [vertical_position_coorect],ebx + pop ebx + mov eax,image_file +; call [plugin_rotate] + call [rotate_Start] + mov ebx,[raw_pointer] + mov eax,[ebx+4] + mov [img_width],eax + mov eax,[ebx+8] + mov [img_high],eax + call convert.img_resolution_ok + jmp kopen.1 +;--------------------------------------------------------------------- +calculate_arrows_offset: + mov eax,[arrows_offset] + imul eax,[scaling_mode] + mov ebx,100 + xor edx,edx + div ebx + mov [scroll_bar_data_vertical.ar_offset],eax + mov [scroll_bar_data_horizontal.ar_offset],eax + ret +;--------------------------------------------------------------------- +no_scaling: + mov eax,scaling_mode + cmp [eax],dword 100 + je still +.1: + mov [eax],dword 100 + mov [zoom_factors],dword zoom_factors.100 + mov eax,[eax] + jmp zoom_plus.2 + +; call calculate_arrows_offset +; call draw_zoom_factors +; jmp red +;--------------------------------------------------------------------- +scaling: + mov eax,[soi] + test eax,eax + jz still + mov eax,scaling_mode + xor ebx,ebx + cmp [eax],ebx ;dword 0 + je still + mov [eax],ebx ;dword 0 + mov [zoom_factors],dword zoom_factors.1 + call .1 + call draw_zoom_factors + jmp still +;--------------------------- +.compens_x: + call .get_x_y + xor ecx,ecx + mov cx,[wa_high_1] + imul eax,ecx + xor edx,edx + div ebx + ret +;--------------------------- +.compens_y: + call .get_x_y + xchg eax,ebx + xor ecx,ecx + mov cx,[wa_width_1] + imul eax,ecx + xor edx,edx + div ebx + ret +;--------------------------- +.get_x_y: + mov ebx,[raw_pointer] + mov eax,[ebx+4] + mov ebx,[ebx+8] + ret +;--------------------------- +.fill_for_L_R: + cmp [no_fill],1 + je @f +; xor eax,eax +; mov [no_fill],al +; ret +;@@: + pusha + mov ebx,[image_start_coordinates] + mov ecx,ebx + shl ecx,16 + mov bx,ax + mov cx,[wa_high_1] + mcall 13,,,[fill_color] ;0xffffff + mov ax,bx + ror ebx,16 + add bx,ax + add bx,[wa_width_2] + mov ax,[wa_width_1] +; add ax,5 + sub ax,bx + rol ebx,16 + mov bx,ax + mcall 13,,,[fill_color] ;0xffffff + popa +@@: + ret +;--------------------------- +.fill_for_U_D: + cmp [no_fill],1 + je @f +; xor eax,eax +; mov [no_fill],al +; ret +;@@: + pusha + mov ebx,[image_start_coordinates] + mov ecx,ebx + shl ecx,16 + mov cx,ax + mov bx,[wa_width_1] + mcall 13,,,[fill_color] ;0xffffff + mov ax,cx + ror ecx,16 + add cx,ax + add cx,[wa_high_2] + mov ax,[wa_high_1] + add ax,28 ;50 + sub ax,cx + rol ecx,16 + mov cx,ax + mcall 13,,,[fill_color] ;0xffffff + popa +@@: + ret +;--------------------------- +.1: + call .get_x_y + cmp eax,ebx + jb .y +;--------------------------- +.x: + call .compens_y + cmp ax,[wa_high_1] + jbe @f + call .compens_x + mov [wa_width_2],ax + jmp .4 +@@: + mov [wa_high_2],ax + jmp .4 +;--------------------------- +.y: + call .compens_x + cmp ax,[wa_width_1] + jbe @f + call .compens_y + mov [wa_high_2],ax + jmp .4 +@@: + mov [wa_width_2],ax +;--------------------------- +.4: + mov bx,[wa_width_2] + shl ebx,16 + mov bx,[wa_high_2] + + xor ecx,ecx +.5: + +; mov eax,ebx +; and eax,0xffff +; mov [test1],eax + +; mov eax,ebx +; shr eax,16 +; mov [test2],eax + +; mov eax,ecx +; and eax,0xffff +; mov [test3],eax + +; mov eax,ecx +; shr eax,16 +; mov [test4],eax + + mov eax,image_file + mov edx,[scaling_mode] + movzx esi,byte [filtering_flag] + mov edi,[background_color] + +; pusha +; mcall 26,9 +; mov [test1],eax +; popa + +; call [plugin_scaling] + + call [Scaling_Start] + +; pusha +; mcall 26,9 +; mov ebx,[test1] +; sub eax,ebx +; cmp [test2],0 +; je @f +; add eax,[test2] +; shr eax,1 +; cmp eax,[test3] +; jbe @f +; mov [test3],eax +;@@: +; mov [test2],eax +; popa + + mov ecx,ebx + + mov edx,[image_start_coordinates] + + mov eax,edx + shl eax,16 + mov ax,cx + mov [scroll_bar_data_vertical.y],eax + + mov eax,edx + mov ebx,ecx + shr ebx,16 + mov ax,bx + mov [scroll_bar_data_horizontal.x],eax + +; call correct_cur_area + +; movzx eax,[wa_width_1] +; mov [test1],eax +; movzx eax,[wa_width_2] +; mov [test2],eax + +; movzx eax,[wa_high_1] +; mov [test3],eax +; movzx eax,[wa_high_2] +; mov [test4],eax + + xor eax,eax + mov ax,[wa_width_1] + sub ax,[wa_width_2] + shr ax,1 + test ax,ax + jz @f + shl eax,16 + add edx,eax + shr eax,16 + call .fill_for_L_R +@@: + mov ax,[wa_high_1] + sub ax,[wa_high_2] + shr ax,1 + test ax,ax + jz @f + add edx,eax + call .fill_for_U_D +@@: + mov esi,[img_resolution] + cmp [img_resolution_2],15 + jne @f + mov esi,15 +@@: + mov eax,[raw_pointer] + mov edi,[eax+20] + add edi,eax +; mov edi,[img_palette] + xor ebp,ebp + + mov ebx,[raw_pointer_2] + + mov eax,ecx + test ax,ax + jz .no_draw ;@f + shr eax,16 + test eax,eax + jz .no_draw ;@f + + cmp [filtering_flag],0 + je @f + cmp esi,8 + jne @f + mov esi,24 +@@: + mcall 65 +.no_draw: +; mov eax,ecx +; shr eax,16 +; mov [test1],eax +; +; mov eax,ecx +; and eax,0xffff +; mov [test2],eax +; +; mov eax,edx +; shr eax,16 +; mov [test3],eax +; +; mov eax,edx +; and eax,0xffff +; mov [test4],eax + + push ebx + call draw_file_name_to_work_area + pop ebx + mov ecx,ebx ;[raw_pointer_2] + mcall 68,13 + + + xor eax,eax + mov ax,[wa_width_2] +; imul eax,100 +; = * 100 + shl eax,2 ; 4 + lea eax,[eax+eax*4] ; 5 + lea eax,[eax+eax*4] ; 5 + mov ebx,[img_width] + test ebx,ebx + jnz @f + inc ebx +@@: + xor edx,edx + div ebx + shl edx,1 + cmp ebx,edx + jb @f + inc eax +@@: + mov [zoom_auto_factor],eax + + ret +;--------------------------------------------------------------------- +calculation_next_value_plus: + mov ebx,[zoom_auto_factor] + mov ecx,zoom_factors.min + sub ecx,4 +@@: + add ecx,4 + cmp ecx,dword zoom_factors.max + jae .max + mov eax,[ecx] + cmp eax,ebx + jb @r +@@: + mov eax,zoom_factors + mov [eax],ecx +; jmp zoom_plus.1 + ret +.max: + mov ecx,dword zoom_factors.max + jmp @r +;--------------------------------------------------------------------- +calculation_next_value_minus: + mov ebx,[zoom_auto_factor] + mov ecx,zoom_factors.max + add ecx,4 +@@: + sub ecx,4 + cmp ecx,dword zoom_factors.min + jbe .min + mov eax,[ecx] + cmp eax,ebx + ja @r +@@: + mov eax,zoom_factors + mov [eax],ecx +; jmp zoom_plus.1 + ret +.min: + mov ecx,dword zoom_factors.min + jmp @r +;--------------------------------------------------------------------- +proc_position_correct: + mov [position_coorect],1 + mov eax,[scroll_bar_data_vertical.max_area] + xor ebx,ebx + mov bx,[wa_high_1] + shr ebx,1 + shl eax,8 + add ebx,[scroll_bar_data_vertical.position] + test ebx,ebx + jnz @f + inc ebx +@@: + xor edx,edx + div ebx + mov [vertical_position_coorect],eax + + mov eax,[scroll_bar_data_horizontal.max_area] + xor ebx,ebx + mov bx,[wa_width_1] + shr ebx,1 + shl eax,8 + add ebx,[scroll_bar_data_horizontal.position] + test ebx,ebx + jnz @f + inc ebx +@@: + xor edx,edx + div ebx + mov [horizontal_position_coorect],eax + ret +;--------------------------------------------------------------------- +zoom_plus: +; cmp [scaling_mode],dword 0 + mov eax,[scaling_mode] + test eax,eax +; jz no_scaling.1 +; jz calculation_next_value_plus + jnz @f + call calculation_next_value_plus + jmp .1 +@@: +; jne @f +; mov [scaling_mode],dword 100 +; mov [zoom_factors],dword zoom_factors.100 +; call draw_zoom_factors +; jmp red +;@@: + mov eax,zoom_factors + cmp [eax],dword zoom_factors.max + jae still + add [eax],dword 4 +.1: + mov eax,[eax] + mov eax,[eax] +.2: + mov [scaling_mode],eax + + mov [correct_scrollbar_100_flag],1 + call calculate_arrows_offset + + call proc_position_correct + + call drawimage + + call set_draw_scrollbar_all + call draw_scrollbars + call set_nodraw_scrollbar_all + + call draw_zoom_factors + jmp still + +zoom_all: +;****************************** + mov eax,wa_width_1 + mov eax,[eax] + push eax + mov eax,wa_high_1 + mov eax,[eax] + push eax +;****************************** + cmp [position_coorect],0 + je .correct_end + mov [position_coorect],0 + mov eax,[scroll_bar_data_vertical.max_area] +; xor ebx,ebx +; mov bx,[wa_high_1] +; shr ebx,1 +; add eax,ebx ;[scroll_bar_data_vertical.cur_area] + shl eax,8 + mov ebx,[vertical_position_coorect] + test ebx,ebx + jnz @f + inc ebx +@@: + xor edx,edx + div ebx +; shr eax,8 + xor ebx,ebx + mov bx,[wa_high_1] + shr ebx,1 + cmp eax,ebx + jae @f + xor eax,eax + jmp .position_vertical_correct +@@: + sub eax,ebx +.position_vertical_correct: + mov [scroll_bar_data_vertical.position],eax + + mov eax,[scroll_bar_data_horizontal.max_area] +; xor ebx,ebx +; mov bx,[wa_width_1] +; shr ebx,1 +; add eax,ebx ;[scroll_bar_data_horizontal.cur_area] + shl eax,8 + mov ebx,[horizontal_position_coorect] + test ebx,ebx + jnz @f + inc ebx +@@: + xor edx,edx + div ebx +; shr eax,8 + xor ebx,ebx + mov bx,[wa_width_1] + shr ebx,1 + cmp eax,ebx + jae @f + xor eax,eax + jmp .position_horizontal_correct +@@: + sub eax,ebx +.position_horizontal_correct: + mov [scroll_bar_data_horizontal.position],eax + +.correct_end: + +;**************************************************************************** +; Vertical SCROLLBAR +; At a case of resizing of the window +; Check the position of a runner has crossed a limit +;**************************************************************************** + mov eax,[scroll_bar_data_vertical.max_area] + xor ebx,ebx + mov bx,[wa_high_1] + cmp eax,ebx + ja @f + xor eax,eax + jmp .p_5 +@@: + sub eax,ebx ;[scroll_bar_data_vertical.cur_area] + cmp eax,[scroll_bar_data_vertical.position] + jae @f +.p_5: + mov [scroll_bar_data_vertical.position],eax +@@: +;**************************************************************************** +; Horizontal SCROLLBAR +; At a case of resizing of the window +; Check the position of a runner has crossed a limit +;**************************************************************************** + mov eax,[scroll_bar_data_horizontal.max_area] + xor ebx,ebx + mov bx,[wa_width_1] + cmp eax,ebx + ja @f + xor eax,eax + jmp .p_6 +@@: + sub eax,ebx ;[scroll_bar_data_horizontal.cur_area] + cmp eax,[scroll_bar_data_horizontal.position] + jae @f +.p_6: + mov [scroll_bar_data_horizontal.position],eax +@@: +;**************************************************************************** + + mov eax,[scroll_bar_data_horizontal.max_area] + mov ebx,[scroll_bar_data_vertical.max_area] + + + sub eax,[scroll_bar_data_horizontal.position] ;100 + sub ebx,[scroll_bar_data_vertical.position] ;100 + + xor ecx,ecx + mov cx,word [wa_width_1] + cmp eax,ecx + jbe @f + xor eax,eax + mov ax,[wa_width_1] +@@: + mov [wa_width_2],ax + mov ecx,eax + shl ecx,16 + xchg eax,ebx + + xor edx,edx + mov dx,word [wa_high_1] + cmp eax,edx + jbe @f + xor eax,eax + mov ax,[wa_high_1] +@@: + mov [wa_high_2],ax + mov cx,ax + + call correct_cur_area + + mov ebx,ecx + + push eax + mov eax,[scroll_bar_data_vertical.max_area] + cmp eax,[scroll_bar_data_vertical.cur_area] + jbe .horizontal ;@f + mov ax,[wa_width_1] + sub ax,[scroll_bar_data_vertical.size_x] + mov [wa_width_1],ax + cmp ax,[wa_width_2] + jae .horizontal + mov [wa_width_2],ax +.horizontal: + mov eax,[scroll_bar_data_horizontal.max_area] + cmp eax,[scroll_bar_data_horizontal.cur_area] + jbe .finish ;@f + mov ax,[wa_high_1] + sub ax,[scroll_bar_data_horizontal.size_y] + mov [wa_high_1],ax + cmp ax,[wa_high_2] + jae .finish + mov [wa_high_2],ax +.finish: ;@@: + pop eax + + mov cx,[wa_width_2] + shl ecx,16 + mov cx,[wa_high_2] + + call correct_cur_area + + mov ebx,ecx + + mov eax,[scroll_bar_data_horizontal.position] + +; imul eax,100 +; = * 100 + shl eax,2 ; 4 + lea eax,[eax+eax*4] ; 5 + lea eax,[eax+eax*4] ; 5 + push ebx + mov ebx,[scaling_mode] + xor edx,edx + div ebx + +; shl edx,1 +; cmp edx,ebx +; jb @f +; inc eax +;@@: + + pop ebx + + mov ecx,eax + shl ecx,16 + + mov eax,[scroll_bar_data_vertical.position] + +; imul eax,100 +; = * 100 + shl eax,2 ; 4 + lea eax,[eax+eax*4] ; 5 + lea eax,[eax+eax*4] ; 5 + push ebx + mov ebx,[scaling_mode] + xor edx,edx + div ebx + +; shl edx,1 +; cmp edx,ebx +; jb @f +; inc eax +;@@: + + pop ebx + + mov cx,ax + + call scaling.5 +;****************************** + pop eax + mov ebx,wa_high_1 + mov [ebx],eax + + pop eax + mov ebx,wa_width_1 + mov [ebx],eax +;****************************** + + ret +;--------------------------------------------------------------------- +zoom_minus: +; cmp [scaling_mode],dword 0 + mov eax,[scaling_mode] + test eax,eax +; jz no_scaling.1 +; jz calculation_next_value_minus + jnz @f + call calculation_next_value_minus + jmp zoom_plus.1 +@@: +; je no_scaling.1 +; jne @f +; mov [scaling_mode],dword 100 +; mov [zoom_factors],dword zoom_factors.100 +; call draw_zoom_factors +; jmp red +;@@: + mov eax,zoom_factors + cmp [eax],dword zoom_factors.min + jbe still + sub [eax],dword 4 + jmp zoom_plus.1 +;--------------------------------------------------------------------- \ No newline at end of file diff --git a/programs/media/zsea/zoom_values.txt b/programs/media/zsea/zoom_values.txt new file mode 100644 index 0000000000..59e624658d --- /dev/null +++ b/programs/media/zsea/zoom_values.txt @@ -0,0 +1,124 @@ +ACD See +5 +7 +10 +15 +20 +30 +50 +70 +100 +150 +200 +300 +500 +700 +1000 +2000 +3000 +5000 + +Fast Stone +2 +5 +10 +15 +20 +30 +40 +50 +60 +100 +125 +150 +175 +200 +300 +500 +700 +1000 +2000 +3000 +5000 + +Photoshop +0,2 +0,3 +0,4 +0,5 +0,7 +1 +1,5 +2 +3 +4 +5 +6,25 +8,33 +12,5 +16,67 +25 +33,33 +50 +66,67 +100 +200 +300 +400 +500 +600 +700 +800 +1200 +1600 + + +zSea +1 +2 +3 + 4 +5 +7 +10 + 17 +25 + 37 +50 + 62 +75 + 87 +100 + 112 +125 +150 +175 +200 + 225 +250 + 275 +300 + 350 +400 + 450 +500 + 600 +700 + 800 + 900 +1000 + 1100 +1250 1200 + 1300 + 1400 +1500 + 1750 +2000 + 2250 +2500 + 2750 +3000 + 3500 + 4000 + 4500 +5000